[ { "id": 601, "npaid": "NPA000601", "original_name": "Brefelamide", "mol_formula": "C22H20N2O5", "mol_weight": 392.411, "exact_mass": 392.1372, "inchikey": "XOHMSOOURABJGK-UHFFFAOYSA-N", "smiles": "C1=CC(=C(C(=C1)OC2=CC=C(C=C2)O)N)C(=O)CCNC(=O)C3=CC=C(C=C3)O", "cluster_id": 475, "node_id": 418, "synonyms": [ "Brefelamide" ], "inchi": "InChI=1S/C22H20N2O5/c23-21-18(2-1-3-20(21)29-17-10-8-16(26)9-11-17)19(27)12-13-24-22(28)14-4-6-15(25)7-5-14/h1-11,25-26H,12-13,23H2,(H,24,28)", "m_plus_h": 393.1445, "m_plus_na": 415.1264, "origin_reference": { "doi": "10.1021/jo051352x", "pmid": 16238318, "authors": "Kikuchi, Haruhisa; Saito, Yoshinori; Sekiya, Jun'ichi; Okano, Yumiko; Saito, Masaki; Nakahata, Norimichi; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Isolation and synthesis of a new aromatic compound, brefelamide, from dictyostelium cellular slime molds and its inhibitory effect on the proliferation of astrocytoma cells", "journal": "Journal of Organic Chemistry", "year": 2005, "volume": "70", "issue": "22", "pages": "8854-8858" }, "origin_organism": { "id": 503, "type": "Fungus", "genus": "Dictyostelium", "species": "cellular", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [ "10.1021/jo051352x" ], "reassignments": [], "external_ids": [] }, { "id": 865, "npaid": "NPA000865", "original_name": "Dictyopyrone B", "mol_formula": "C21H34O3", "mol_weight": 334.5, "exact_mass": 334.2508, "inchikey": "TVGUMWJNRTVELQ-WRFKIARRSA-N", "smiles": "C/C=C/CCCCCCCCCCC(=O)C1=C(C[C@@H](OC1=O)C)C", "cluster_id": 646, "node_id": 558, "synonyms": [ "Dictyopyrone B" ], "inchi": "InChI=1S/C21H34O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-19(22)20-17(2)16-18(3)24-21(20)23/h4-5,18H,6-16H2,1-3H3/b5-4+/t18-/m0/s1", "m_plus_h": 335.2581, "m_plus_na": 357.24, "origin_reference": { "doi": "10.1021/jo991338i", "pmid": 10814044, "authors": "Takaya, Yoshiaki; Kikuchi, Haruhisa; Terui, Yuichi; Komiya, Jun; Furukawa, Ken-Ichi; Seya, Kazuhiko; Motomura, Shigeru; Ito, Akira; Oshima, Yoshiteru", "title": "Novel acyl \u03b1-pyronoids, dictyopyrone A, B, and C, from Dictyostelium cellular slime molds", "journal": "Journal of Organic Chemistry", "year": 2000, "volume": "65", "issue": "4", "pages": "985-989" }, "origin_organism": { "id": 692, "type": "Fungus", "genus": "Dictyostelium", "species": "longosporum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 870, "npaid": "NPA000870", "original_name": "Dihydrodictyopyrone A", "mol_formula": "C19H32O3", "mol_weight": 308.462, "exact_mass": 308.2351, "inchikey": "IWYMSCITVORDAJ-QOSFWDOTSA-N", "smiles": "C/C=C/CCCCCCCCC(=O)[C@@H]1[C@H](C[C@@H](OC1=O)C)C", "cluster_id": 650, "node_id": 562, "synonyms": [ "Dihydrodictyopyrone A" ], "inchi": "InChI=1S/C19H32O3/c1-4-5-6-7-8-9-10-11-12-13-17(20)18-15(2)14-16(3)22-19(18)21/h4-5,15-16,18H,6-14H2,1-3H3/b5-4+/t15-,16-,18-/m0/s1", "m_plus_h": 309.2424, "m_plus_na": 331.2243, "origin_reference": { "doi": "10.1016/j.tetlet.2007.06.040", "pmid": null, "authors": "Kikuchi, Haruhisa; Nakamura, Koji; Kubohara, Yuzuru; Gokan, Naomi; Hosaka, Kohei; Maeda, Yasuo; Oshima, Yoshiteru", "title": "Dihydrodictyopyrones A and C: new members of dictyopyrone family isolated from Dictyostelium cellular slime molds", "journal": "Tetrahedron Letters", "year": 2007, "volume": "48", "issue": "33", "pages": "5905-5909" }, "origin_organism": { "id": 503, "type": "Fungus", "genus": "Dictyostelium", "species": "cellular", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 1916, "npaid": "NPA001916", "original_name": "Furanodictine A", "mol_formula": "C13H21NO6", "mol_weight": 287.312, "exact_mass": 287.1369, "inchikey": "XACKKSAZFKSCJT-FLBHPLMVSA-N", "smiles": "CC(C)CC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC([C@@H]2NC(=O)C)O", "cluster_id": 1270, "node_id": 1059, "synonyms": [ "Furanodictine A" ], "inchi": "InChI=1S/C13H21NO6/c1-6(2)4-9(16)19-8-5-18-12-10(14-7(3)15)13(17)20-11(8)12/h6,8,10-13,17H,4-5H2,1-3H3,(H,14,15)/t8-,10-,11-,12-,13?/m1/s1", "m_plus_h": 288.1442, "m_plus_na": 310.1261, "origin_reference": { "doi": "10.1021/jo015657x", "pmid": 11597217, "authors": "Kikuchi; Saito; Komiya; Takaya; Honma; Nakahata; Ito; Oshima", "title": "Furanodictine A and B: Amino sugar analogues produced by cellular slime mold Dictyostelium discoideum showing neuronal differentiation activity", "journal": "Journal of Organic Chemistry", "year": 2001, "volume": "66", "issue": "21", "pages": "6982-6987" }, "origin_organism": { "id": 1346, "type": "Fungus", "genus": "Dictyostelium", "species": "discoideum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 2208, "npaid": "NPA002208", "original_name": "Dictyoterphenyl A", "mol_formula": "C20H17NO4", "mol_weight": 335.359, "exact_mass": 335.1158, "inchikey": "VYJICDOYZDQLGP-UHFFFAOYSA-N", "smiles": "COC1=C(C=C(C=C1)C(=O)N)C2=CC(=C(C=C2)O)C3=CC=C(C=C3)O", "cluster_id": 1412, "node_id": 1171, "synonyms": [ "Dictyoterphenyl A" ], "inchi": "InChI=1S/C20H17NO4/c1-25-19-9-5-14(20(21)24)11-17(19)13-4-8-18(23)16(10-13)12-2-6-15(22)7-3-12/h2-11,22-23H,1H3,(H2,21,24)", "m_plus_h": 336.1231, "m_plus_na": 358.105, "origin_reference": { "doi": "10.1016/j.tet.2012.08.041", "pmid": null, "authors": "Kikuchi, Haruhisa; Matsuo, Yusuke; Katou, Yasuhiro; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Isolation, synthesis, and biological activity of biphenyl and m-terphenyl-type compounds from Dictyostelium cellular slime molds", "journal": "Tetrahedron", "year": 2012, "volume": "68", "issue": "43", "pages": "8884-8889" }, "origin_organism": { "id": 503, "type": "Fungus", "genus": "Dictyostelium", "species": "cellular", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 4074, "npaid": "NPA004074", "original_name": "DIF-1", "mol_formula": "C13H16Cl2O4", "mol_weight": 307.173, "exact_mass": 306.0426, "inchikey": "VUDQSRFCCHQIIU-UHFFFAOYSA-N", "smiles": "CCCCCC(=O)C1=C(C(=C(C(=C1O)Cl)OC)Cl)O", "cluster_id": 2302, "node_id": 1807, "synonyms": [ "DIF-1" ], "inchi": "InChI=1S/C13H16Cl2O4/c1-3-4-5-6-7(16)8-11(17)9(14)13(19-2)10(15)12(8)18/h17-18H,3-6H2,1-2H3", "m_plus_h": 307.0499, "m_plus_na": 329.0318, "origin_reference": { "doi": "10.1038/328811a0", "pmid": 3627228, "authors": "Morris, H R; Taylor, G W; Masento, M S; Jermyn, K A; Kay, R R", "title": "Chemical structure of the morphogen differentiation inducing factor from Dictyostelium discoideum", "journal": "Nature", "year": 1987, "volume": "328", "issue": "6133", "pages": "811-814" }, "origin_organism": { "id": 1346, "type": "Fungus", "genus": "Dictyostelium", "species": "discoideum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 5886, "npaid": "NPA005886", "original_name": "Dihydrodictyopyrone C", "mol_formula": "C19H34O3", "mol_weight": 310.478, "exact_mass": 310.2508, "inchikey": "DIPXKPDEFBRLPH-BQFCYCMXSA-N", "smiles": "CCCCCCCCCCCC(=O)[C@@H]1[C@H](C[C@@H](OC1=O)C)C", "cluster_id": 650, "node_id": 562, "synonyms": [ "Dihydrodictyopyrone C" ], "inchi": "InChI=1S/C19H34O3/c1-4-5-6-7-8-9-10-11-12-13-17(20)18-15(2)14-16(3)22-19(18)21/h15-16,18H,4-14H2,1-3H3/t15-,16-,18-/m0/s1", "m_plus_h": 311.2581, "m_plus_na": 333.24, "origin_reference": { "doi": "10.1016/j.tetlet.2007.06.040", "pmid": null, "authors": "Kikuchi, Haruhisa; Nakamura, Koji; Kubohara, Yuzuru; Gokan, Naomi; Hosaka, Kohei; Maeda, Yasuo; Oshima, Yoshiteru", "title": "Dihydrodictyopyrones A and C: new members of dictyopyrone family isolated from Dictyostelium cellular slime molds", "journal": "Tetrahedron Letters", "year": 2007, "volume": "48", "issue": "33", "pages": "5905-5909" }, "origin_organism": { "id": 503, "type": "Fungus", "genus": "Dictyostelium", "species": "cellular", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 6916, "npaid": "NPA006916", "original_name": "Hexadeca-5,9-dienoic acid", "mol_formula": "C16H28O2", "mol_weight": 252.398, "exact_mass": 252.2089, "inchikey": "FHLHSNNZRDBQGE-MQEUWQHPSA-N", "smiles": "CCCCCC/C=C\\CC/C=C\\CCCC(=O)O", "cluster_id": 161, "node_id": 152, "synonyms": [ "Hexadeca-5,9-dienoic acid" ], "inchi": "InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8,11-12H,2-6,9-10,13-15H2,1H3,(H,17,18)/b8-7-,12-11-", "m_plus_h": 253.2162, "m_plus_na": 275.1981, "origin_reference": { "doi": "10.1016/0006-291x(62)90086-4", "pmid": null, "authors": "Davidoff, Frank; Korn, Edward", "title": "Lipids of dictyostelium discoideum: Phospholipid composition and the presence of two new fatty acids: cis,cis-5,11-octadecadienoic and cis,cis-5,9-hexadecadienoic acids ", "journal": "Biochemical and Biophysical Research Communications", "year": 1962, "volume": "9", "issue": "1-2", "pages": "54-58" }, "origin_organism": { "id": 1346, "type": "Fungus", "genus": "Dictyostelium", "species": "discoideum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 9614, "npaid": "NPA009614", "original_name": "Dictyoglucosamine A", "mol_formula": "C29H53NO8", "mol_weight": 543.742, "exact_mass": 543.3771, "inchikey": "JMBNBSZNQHQINZ-VVTJRAGWSA-N", "smiles": "CCCCCCCCCCCCCCCCCC(=O)O[C@@H]1[C@H]([C@H](O[C@@H]([C@H]1O)COC(=O)CC)O)NC(=O)C", "cluster_id": 4248, "node_id": 1424, "synonyms": [ "Dictyoglucosamine A" ], "inchi": "InChI=1S/C29H53NO8/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(33)38-28-26(30-22(3)31)29(35)37-23(27(28)34)21-36-24(32)5-2/h23,26-29,34-35H,4-21H2,1-3H3,(H,30,31)/t23-,26-,27-,28-,29+/m1/s1", "m_plus_h": 544.3844, "m_plus_na": 566.3663, "origin_reference": { "doi": "10.1016/s0040-4039(02)00038-2", "pmid": null, "authors": "Kikuchi, Haruhisa; Komiya, Jun; Saito, Yoshinori; Sekiya, Jun-Ichi; Honma, Shigeyoshi; Nakahata, Norimichi; Oshima, Yoshiteru", "title": "The isolation and synthesis of two novel N-acetyl glucosamine derivatives from Dictyostelium cellular slime molds which exhibit neurite outgrowth activity", "journal": "Tetrahedron Letters", "year": 2002, "volume": "43", "issue": "8", "pages": "1477-1480" }, "origin_organism": { "id": 3900, "type": "Fungus", "genus": "Dictyostelium", "species": "purpureum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 9738, "npaid": "NPA009738", "original_name": "Dictyopyrone C", "mol_formula": "C19H32O3", "mol_weight": 308.462, "exact_mass": 308.2351, "inchikey": "IBSUGPKFCLTAFW-INIZCTEOSA-N", "smiles": "CCCCCCCCCCCC(=O)C1=C(C[C@@H](OC1=O)C)C", "cluster_id": 646, "node_id": 558, "synonyms": [ "Dictyopyrone C" ], "inchi": "InChI=1S/C19H32O3/c1-4-5-6-7-8-9-10-11-12-13-17(20)18-15(2)14-16(3)22-19(18)21/h16H,4-14H2,1-3H3/t16-/m0/s1", "m_plus_h": 309.2424, "m_plus_na": 331.2243, "origin_reference": { "doi": "10.1021/jo991338i", "pmid": 10814044, "authors": "Takaya, Yoshiaki; Kikuchi, Haruhisa; Terui, Yuichi; Komiya, Jun; Furukawa, Ken-Ichi; Seya, Kazuhiko; Motomura, Shigeru; Ito, Akira; Oshima, Yoshiteru", "title": "Novel acyl \u03b1-pyronoids, dictyopyrone A, B, and C, from Dictyostelium cellular slime molds", "journal": "Journal of Organic Chemistry", "year": 2000, "volume": "65", "issue": "4", "pages": "985-989" }, "origin_organism": { "id": 692, "type": "Fungus", "genus": "Dictyostelium", "species": "longosporum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 9943, "npaid": "NPA009943", "original_name": "AB0022A", "mol_formula": "C20H19Cl3O6", "mol_weight": 461.725, "exact_mass": 460.0247, "inchikey": "HANVBLRSGDIVGE-UHFFFAOYSA-N", "smiles": "CCCCCC(=O)C1=C(C2=C(C(=C1OC)Cl)OC3=C2C(=C(C(=C3Cl)OC)Cl)O)O", "cluster_id": 2302, "node_id": 1807, "synonyms": [ "AB0022A" ], "inchi": "InChI=1S/C20H19Cl3O6/c1-4-5-6-7-8(24)9-15(25)10-11-16(26)12(21)20(28-3)14(23)19(11)29-18(10)13(22)17(9)27-2/h25-26H,4-7H2,1-3H3", "m_plus_h": 461.032, "m_plus_na": 483.0139, "origin_reference": { "doi": "10.7164/antibiotics.53.959", "pmid": 11099230, "authors": "SAWADA, TAKAYUKI; AONO, MASAHIRO; ASAKAWA, SEIICHI; ITO, AKIRA; AWANO, KATSUYA", "title": "Structure Determination and Total Synthesis of a Novel Antibacterial Substance, AB0022A, Produced by a Cellular Slime Mold", "journal": "Journal of Antibiotics", "year": 2000, "volume": "53", "issue": "9", "pages": "959-966" }, "origin_organism": { "id": 3900, "type": "Fungus", "genus": "Dictyostelium", "species": "purpureum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [ "10.7164/antibiotics.53.959" ], "reassignments": [], "external_ids": [] }, { "id": 10005, "npaid": "NPA010005", "original_name": "Dictyoglucosamine B", "mol_formula": "C31H57NO8", "mol_weight": 571.796, "exact_mass": 571.4084, "inchikey": "MQDKWTJFIHWFGF-FCLMYRLYSA-N", "smiles": "CCCCCCCCCCCCCCCCCC(=O)O[C@@H]1[C@H]([C@H](O[C@@H]([C@H]1O)COC(=O)CC(C)C)O)NC(=O)C", "cluster_id": 4248, "node_id": 1424, "synonyms": [ "Dictyoglucosamine B" ], "inchi": "InChI=1S/C31H57NO8/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(34)40-30-28(32-24(4)33)31(37)39-25(29(30)36)22-38-27(35)21-23(2)3/h23,25,28-31,36-37H,5-22H2,1-4H3,(H,32,33)/t25-,28-,29-,30-,31+/m1/s1", "m_plus_h": 572.4157, "m_plus_na": 594.3976, "origin_reference": { "doi": "10.1016/s0040-4039(02)00038-2", "pmid": null, "authors": "Kikuchi, Haruhisa; Komiya, Jun; Saito, Yoshinori; Sekiya, Jun-Ichi; Honma, Shigeyoshi; Nakahata, Norimichi; Oshima, Yoshiteru", "title": "The isolation and synthesis of two novel N-acetyl glucosamine derivatives from Dictyostelium cellular slime molds which exhibit neurite outgrowth activity", "journal": "Tetrahedron Letters", "year": 2002, "volume": "43", "issue": "8", "pages": "1477-1480" }, "origin_organism": { "id": 3900, "type": "Fungus", "genus": "Dictyostelium", "species": "purpureum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 10709, "npaid": "NPA010709", "original_name": "Dictyopyrone A", "mol_formula": "C19H30O3", "mol_weight": 306.446, "exact_mass": 306.2195, "inchikey": "LDTOSUNDGREUIH-APHBUQMISA-N", "smiles": "C/C=C/CCCCCCCCC(=O)C1=C(C[C@@H](OC1=O)C)C", "cluster_id": 646, "node_id": 558, "synonyms": [ "Dictyopyrone A" ], "inchi": "InChI=1S/C19H30O3/c1-4-5-6-7-8-9-10-11-12-13-17(20)18-15(2)14-16(3)22-19(18)21/h4-5,16H,6-14H2,1-3H3/b5-4+/t16-/m0/s1", "m_plus_h": 307.2268, "m_plus_na": 329.2087, "origin_reference": { "doi": "10.1021/jo991338i", "pmid": 10814044, "authors": "Takaya, Yoshiaki; Kikuchi, Haruhisa; Terui, Yuichi; Komiya, Jun; Furukawa, Ken-Ichi; Seya, Kazuhiko; Motomura, Shigeru; Ito, Akira; Oshima, Yoshiteru", "title": "Novel acyl \u03b1-pyronoids, dictyopyrone A, B, and C, from Dictyostelium cellular slime molds", "journal": "Journal of Organic Chemistry", "year": 2000, "volume": "65", "issue": "4", "pages": "985-989" }, "origin_organism": { "id": 692, "type": "Fungus", "genus": "Dictyostelium", "species": "longosporum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 11109, "npaid": "NPA011109", "original_name": "Dictyobiphenyl B", "mol_formula": "C13H10O4", "mol_weight": 230.219, "exact_mass": 230.0579, "inchikey": "NZIAZFCXJCQGBL-UHFFFAOYSA-N", "smiles": "C1=CC(=CC=C1C2=C(C=CC(=C2)C(=O)O)O)O", "cluster_id": 4657, "node_id": 43, "synonyms": [ "Dictyobiphenyl B" ], "inchi": "InChI=1S/C13H10O4/c14-10-4-1-8(2-5-10)11-7-9(13(16)17)3-6-12(11)15/h1-7,14-15H,(H,16,17)", "m_plus_h": 231.0652, "m_plus_na": 253.0471, "origin_reference": { "doi": "10.1016/j.tet.2012.08.041", "pmid": null, "authors": "Kikuchi, Haruhisa; Matsuo, Yusuke; Katou, Yasuhiro; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Isolation, synthesis, and biological activity of biphenyl and m-terphenyl-type compounds from Dictyostelium cellular slime molds", "journal": "Tetrahedron", "year": 2012, "volume": "68", "issue": "43", "pages": "8884-8889" }, "origin_organism": { "id": 503, "type": "Fungus", "genus": "Dictyostelium", "species": "cellular", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 11346, "npaid": "NPA011346", "original_name": "Dictyomedin A", "mol_formula": "C21H16O7", "mol_weight": 380.352, "exact_mass": 380.0896, "inchikey": "DJFAUDCMYUMUNB-UHFFFAOYSA-N", "smiles": "COC1=C(C=CC(=C1)C2=C3C(=CC(=C2)C(=O)O)C4=CC(=C(C=C4O3)O)OC)O", "cluster_id": 4718, "node_id": 10, "synonyms": [ "Dictyomedin A" ], "inchi": "InChI=1S/C21H16O7/c1-26-18-7-10(3-4-15(18)22)12-5-11(21(24)25)6-14-13-8-19(27-2)16(23)9-17(13)28-20(12)14/h3-9,22-23H,1-2H3,(H,24,25)", "m_plus_h": 381.0969, "m_plus_na": 403.0788, "origin_reference": { "doi": "10.1016/s0040-4039(00)01879-7", "pmid": null, "authors": "Takaya, Yoshiaki; Kikuchi, Haruhisa; Terui, Yuichi; Komiya, Jun; Maeda, Yasuo; Ito, Akira; Oshima, Yoshiteru", "title": "Novel aromatic substances, dictyomedin A and B, from Dictyostelium cellular slime molds and their inhibitory effects on Dictyostelium development", "journal": "Tetrahedron Letters", "year": 2001, "volume": "42", "issue": "1", "pages": "61-63" }, "origin_organism": { "id": 4275, "type": "Fungus", "genus": "Dictyostelium", "species": "medium", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 11644, "npaid": "NPA011644", "original_name": "Furanodictine B", "mol_formula": "C13H21NO6", "mol_weight": 287.312, "exact_mass": 287.1369, "inchikey": "XACKKSAZFKSCJT-FZKCVIRVSA-N", "smiles": "CC(C)CC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC([C@H]2NC(=O)C)O", "cluster_id": 1270, "node_id": 1059, "synonyms": [ "Furanodictine B" ], "inchi": "InChI=1S/C13H21NO6/c1-6(2)4-9(16)19-8-5-18-12-10(14-7(3)15)13(17)20-11(8)12/h6,8,10-13,17H,4-5H2,1-3H3,(H,14,15)/t8-,10+,11-,12-,13?/m1/s1", "m_plus_h": 288.1442, "m_plus_na": 310.1261, "origin_reference": { "doi": "10.1021/jo015657x", "pmid": 11597217, "authors": "Kikuchi; Saito; Komiya; Takaya; Honma; Nakahata; Ito; Oshima", "title": "Furanodictine A and B: Amino sugar analogues produced by cellular slime mold Dictyostelium discoideum showing neuronal differentiation activity", "journal": "Journal of Organic Chemistry", "year": 2001, "volume": "66", "issue": "21", "pages": "6982-6987" }, "origin_organism": { "id": 1346, "type": "Fungus", "genus": "Dictyostelium", "species": "discoideum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 12414, "npaid": "NPA012414", "original_name": "Dictyoterphenyl B", "mol_formula": "C19H14O5", "mol_weight": 322.316, "exact_mass": 322.0841, "inchikey": "VCXQEVGIMJXZKY-UHFFFAOYSA-N", "smiles": "C1=CC(=CC=C1C2=C(C=CC(=C2)C3=C(C=CC(=C3)C(=O)O)O)O)O", "cluster_id": 4657, "node_id": 43, "synonyms": [ "Dictyoterphenyl B" ], "inchi": "InChI=1S/C19H14O5/c20-14-5-1-11(2-6-14)15-9-12(3-7-17(15)21)16-10-13(19(23)24)4-8-18(16)22/h1-10,20-22H,(H,23,24)", "m_plus_h": 323.0914, "m_plus_na": 345.0733, "origin_reference": { "doi": "10.1016/j.tet.2012.08.041", "pmid": null, "authors": "Kikuchi, Haruhisa; Matsuo, Yusuke; Katou, Yasuhiro; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Isolation, synthesis, and biological activity of biphenyl and m-terphenyl-type compounds from Dictyostelium cellular slime molds", "journal": "Tetrahedron", "year": 2012, "volume": "68", "issue": "43", "pages": "8884-8889" }, "origin_organism": { "id": 503, "type": "Fungus", "genus": "Dictyostelium", "species": "cellular", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 12513, "npaid": "NPA012513", "original_name": "Discadenine", "mol_formula": "C14H20N6O2", "mol_weight": 304.354, "exact_mass": 304.1648, "inchikey": "VSABNZFZVFUZGA-UHFFFAOYSA-N", "smiles": "CC(=CCN=C1C2=C(N=CN2)N(C=N1)CCC(C(=O)O)N)C", "cluster_id": 5036, "node_id": 3567, "synonyms": [ "Discadenine" ], "inchi": "InChI=1S/C14H20N6O2/c1-9(2)3-5-16-12-11-13(18-7-17-11)20(8-19-12)6-4-10(15)14(21)22/h3,7-8,10H,4-6,15H2,1-2H3,(H,17,18)(H,21,22)", "m_plus_h": 305.1721, "m_plus_na": 327.154, "origin_reference": { "doi": "10.1016/s0040-4039(00)93115-0", "pmid": null, "authors": "Abe, Hiroshi; Uchiyama, Masaaki; Tanaka, Yoshimasa; Sait\u00f4, Hazime", "title": "Structure of discadenine, a spore germination inhibitor from the cellular slime mold, Dictyostelium discoideum", "journal": "Tetrahedron Letters", "year": 1976, "volume": "17", "issue": "42", "pages": "3807-3810" }, "origin_organism": { "id": 1346, "type": "Fungus", "genus": "Dictyostelium", "species": "discoideum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 17976, "npaid": "NPA017976", "original_name": "Dictyomedin B", "mol_formula": "C20H14O6", "mol_weight": 350.326, "exact_mass": 350.079, "inchikey": "IIWIZLFAVSKXQB-UHFFFAOYSA-N", "smiles": "COC1=C(C=C2C(=C1)C3=CC(=CC(=C3O2)C4=CC=C(C=C4)O)C(=O)O)O", "cluster_id": 4718, "node_id": 10, "synonyms": [ "Dictyomedin B" ], "inchi": "InChI=1S/C20H14O6/c1-25-18-8-14-15-7-11(20(23)24)6-13(10-2-4-12(21)5-3-10)19(15)26-17(14)9-16(18)22/h2-9,21-22H,1H3,(H,23,24)", "m_plus_h": 351.0863, "m_plus_na": 373.0682, "origin_reference": { "doi": "10.1016/s0040-4039(00)01879-7", "pmid": null, "authors": "Takaya, Yoshiaki; Kikuchi, Haruhisa; Terui, Yuichi; Komiya, Jun; Maeda, Yasuo; Ito, Akira; Oshima, Yoshiteru", "title": "Novel aromatic substances, dictyomedin A and B, from Dictyostelium cellular slime molds and their inhibitory effects on Dictyostelium development", "journal": "Tetrahedron Letters", "year": 2001, "volume": "42", "issue": "1", "pages": "61-63" }, "origin_organism": { "id": 4275, "type": "Fungus", "genus": "Dictyostelium", "species": "medium", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19364, "npaid": "NPA019364", "original_name": "Dictyobiphenyl A", "mol_formula": "C14H13NO3", "mol_weight": 243.262, "exact_mass": 243.0895, "inchikey": "KPMUKQOHVNKINL-UHFFFAOYSA-N", "smiles": "COC1=C(C=C(C=C1)C(=O)N)C2=CC=C(C=C2)O", "cluster_id": 1412, "node_id": 1171, "synonyms": [ "Dictyobiphenyl A" ], "inchi": "InChI=1S/C14H13NO3/c1-18-13-7-4-10(14(15)17)8-12(13)9-2-5-11(16)6-3-9/h2-8,16H,1H3,(H2,15,17)", "m_plus_h": 244.0968, "m_plus_na": 266.0787, "origin_reference": { "doi": "10.1016/j.tet.2012.08.041", "pmid": null, "authors": "Kikuchi, Haruhisa; Matsuo, Yusuke; Katou, Yasuhiro; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Isolation, synthesis, and biological activity of biphenyl and m-terphenyl-type compounds from Dictyostelium cellular slime molds", "journal": "Tetrahedron", "year": 2012, "volume": "68", "issue": "43", "pages": "8884-8889" }, "origin_organism": { "id": 503, "type": "Fungus", "genus": "Dictyostelium", "species": "cellular", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 22850, "npaid": "NPA022850", "original_name": "Dictyobispyrone B", "mol_formula": "C22H32O4", "mol_weight": 360.494, "exact_mass": 360.2301, "inchikey": "GDPLHYVNEPCEPF-IDOMTICXSA-N", "smiles": "C/C=C/CCCCCCCCCCC1=C2C(=CC(=O)O1)C[C@@H](OC2=O)C", "cluster_id": 7490, "node_id": 5052, "synonyms": [ "Dictyobispyrone B" ], "inchi": "InChI=1S/C22H32O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-19-21-18(16-20(23)26-19)15-17(2)25-22(21)24/h3-4,16-17H,5-15H2,1-2H3/b4-3+/t17-/m0/s1", "m_plus_h": 361.2374, "m_plus_na": 383.2193, "origin_reference": { "doi": "10.1016/j.tet.2016.12.040", "pmid": null, "authors": "Nguyen, Van Hai; Kikuchi, Haruhisa; Sasaki, Hiraku; Iizumi, Kyoichi; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Production of novel bispyrone metabolites in the cellular slime mold Dictyostelium giganteum induced by zinc(II) ion", "journal": "Tetrahedron", "year": 2017, "volume": "73", "issue": "5", "pages": "583-588" }, "origin_organism": { "id": 7581, "type": "Fungus", "genus": "Dictyostelium", "species": "giganteum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 22851, "npaid": "NPA022851", "original_name": "Dictyobispyrone E", "mol_formula": "C21H32O4", "mol_weight": 348.483, "exact_mass": 348.2301, "inchikey": "BHPMKXIPBPKCMZ-INIZCTEOSA-N", "smiles": "CCCCCCCCCCCCC1=C2C(=CC(=O)O1)C[C@@H](OC2=O)C", "cluster_id": 7490, "node_id": 5052, "synonyms": [ "Dictyobispyrone E" ], "inchi": "InChI=1S/C21H32O4/c1-3-4-5-6-7-8-9-10-11-12-13-18-20-17(15-19(22)25-18)14-16(2)24-21(20)23/h15-16H,3-14H2,1-2H3/t16-/m0/s1", "m_plus_h": 349.2374, "m_plus_na": 371.2193, "origin_reference": { "doi": "10.1016/j.tet.2016.12.040", "pmid": null, "authors": "Nguyen, Van Hai; Kikuchi, Haruhisa; Sasaki, Hiraku; Iizumi, Kyoichi; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Production of novel bispyrone metabolites in the cellular slime mold Dictyostelium giganteum induced by zinc(II) ion", "journal": "Tetrahedron", "year": 2017, "volume": "73", "issue": "5", "pages": "583-588" }, "origin_organism": { "id": 7581, "type": "Fungus", "genus": "Dictyostelium", "species": "giganteum", "taxon": { "id": 1770, "name": "Dictyostelium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12072", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 4823, "npaid": "NPA004823", "original_name": "Physarorubinic acid", "mol_formula": "C18H19NO6", "mol_weight": 345.351, "exact_mass": 345.1212, "inchikey": "OKSWYDBASPIKBT-XRUNLMSZSA-N", "smiles": "CN1[C@H](C(=O)/C(=C(/C=C/C=C/C=C/C=C/C=C/C(=O)O)\\O)/C1=O)CO", "cluster_id": 2602, "node_id": 2006, "synonyms": [ "Physarorubinic acid" ], "inchi": "InChI=1S/C18H19NO6/c1-19-13(12-20)17(24)16(18(19)25)14(21)10-8-6-4-2-3-5-7-9-11-15(22)23/h2-11,13,20-21H,12H2,1H3,(H,22,23)/b3-2+,6-4+,7-5+,10-8+,11-9+,16-14+/t13-/m0/s1", "m_plus_h": 346.1285, "m_plus_na": 368.1104, "origin_reference": { "doi": "10.1002/jlac.199719970904", "pmid": null, "authors": "Nowak, Alexander; Steffan, Bert", "title": "Physarorubinic acid, a polyenoyltetramic acid type plasmodial pigment from the slime mold Physarum polycephalum (myxomycetes)", "journal": "Liebigs Annalen der Chemie", "year": 1997, "volume": "1997", "issue": "9", "pages": "1817-1821" }, "origin_organism": { "id": 2628, "type": "Fungus", "genus": "Physarum", "species": "polycephalum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 8264, "npaid": "NPA008264", "original_name": "Polycephalin C", "mol_formula": "C32H36N2O8", "mol_weight": 576.646, "exact_mass": 576.2472, "inchikey": "NMRXEMWZLVUIOR-NOLJHJQRSA-N", "smiles": "CN1[C@H](C(=O)/C(=C(/C=C/C=C/C=C/[C@H]2CCC=C[C@@H]2/C=C/C=C/C=C/C(=C\\3/C(=O)[C@@H](N(C3=O)C)CO)/O)\\O)/C1=O)CO", "cluster_id": 3812, "node_id": 2817, "synonyms": [ "Polycephalin C" ], "inchi": "InChI=1S/C32H36N2O8/c1-33-23(19-35)29(39)27(31(33)41)25(37)17-9-5-3-7-13-21-15-11-12-16-22(21)14-8-4-6-10-18-26(38)28-30(40)24(20-36)34(2)32(28)42/h3-11,13-15,17-18,21-24,35-38H,12,16,19-20H2,1-2H3/b5-3+,6-4+,13-7+,14-8+,17-9+,18-10+,27-25+,28-26+/t21-,22-,23-,24-/m0/s1", "m_plus_h": 577.2545, "m_plus_na": 599.2364, "origin_reference": { "doi": "10.1002/(sici)1521-3757(19981116)110:22<3341::aid-ange3341>3.3.co;2-j", "pmid": 29711329, "authors": "Nowak, Alexander; Steffan, Bert", "title": "Polycephalin B und C: ungew\u00f6hnliche Tetrams\u00e4uren aus Plasmodien des Schleimpilzes Physarum polycephalum (Myxomycetes) ( Polycephalin B and C: unusual tetramic acids from plasmodium of the slime fungus Physarum polycephalum (Myxomycetes))", "journal": "Angewandte Chemie", "year": 1998, "volume": "110", "issue": "22", "pages": "3341-3343" }, "origin_organism": { "id": 2628, "type": "Fungus", "genus": "Physarum", "species": "polycephalum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [ "10.1002/1521-3773(20020802)41:15<2786::AID-ANIE2786>3.0.CO;2-Z" ], "reassignments": [], "external_ids": [] }, { "id": 8931, "npaid": "NPA008931", "original_name": "Physarigin A", "mol_formula": "C25H28N2O5", "mol_weight": 436.508, "exact_mass": 436.1998, "inchikey": "QXCDSLJZTKLCGM-QXQSFSDISA-N", "smiles": "CC(=O)NC1=C(C=CC=C1OC)/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)NCCC(=O)O", "cluster_id": 4022, "node_id": 2958, "synonyms": [ "Physarigin A" ], "inchi": "InChI=1S/C25H28N2O5/c1-20(28)27-25-21(15-13-16-22(25)32-2)14-11-9-7-5-3-4-6-8-10-12-17-23(29)26-19-18-24(30)31/h3-17H,18-19H2,1-2H3,(H,26,29)(H,27,28)(H,30,31)/b5-3+,6-4+,9-7+,10-8+,14-11+,17-12+", "m_plus_h": 437.2071, "m_plus_na": 459.189, "origin_reference": { "doi": "10.1016/s0040-4039(03)01041-4", "pmid": null, "authors": "Misono, Yuka; Ito, Akira; Matsumoto, Jun; Sakamoto, Shigeru; Yamaguchi, Kentaro; Ishibashi, Masami", "title": "Physarigins A-C, three new yellow pigments from a cultured myxomycete Physarum rigidum", "journal": "Tetrahedron Letters", "year": 2003, "volume": "44", "issue": "24", "pages": "4479-4481" }, "origin_organism": { "id": 3750, "type": "Fungus", "genus": "Physarum", "species": "rigidum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 10333, "npaid": "NPA010333", "original_name": "Physarigin B", "mol_formula": "C26H30N2O5", "mol_weight": 450.535, "exact_mass": 450.2155, "inchikey": "DDPBZJFKHOQWLE-YIDPWANWSA-N", "smiles": "CC(CNC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/C1=C(C(=CC=C1)OC)NC(=O)C)C(=O)O", "cluster_id": 4022, "node_id": 2958, "synonyms": [ "Physarigin B" ], "inchi": "InChI=1S/C26H30N2O5/c1-20(26(31)32)19-27-24(30)18-13-11-9-7-5-4-6-8-10-12-15-22-16-14-17-23(33-3)25(22)28-21(2)29/h4-18,20H,19H2,1-3H3,(H,27,30)(H,28,29)(H,31,32)/b6-4+,7-5+,10-8+,11-9+,15-12+,18-13+", "m_plus_h": 451.2228, "m_plus_na": 473.2047, "origin_reference": { "doi": "10.1016/s0040-4039(03)01041-4", "pmid": null, "authors": "Misono, Yuka; Ito, Akira; Matsumoto, Jun; Sakamoto, Shigeru; Yamaguchi, Kentaro; Ishibashi, Masami", "title": "Physarigins A-C, three new yellow pigments from a cultured myxomycete Physarum rigidum", "journal": "Tetrahedron Letters", "year": 2003, "volume": "44", "issue": "24", "pages": "4479-4481" }, "origin_organism": { "id": 3750, "type": "Fungus", "genus": "Physarum", "species": "rigidum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 10694, "npaid": "NPA010694", "original_name": "Physarochrome A", "mol_formula": "C24H27N3O6", "mol_weight": 453.495, "exact_mass": 453.19, "inchikey": "RGGPZGKUAMUKLV-QCBGMGOKSA-N", "smiles": "CC(=O)NC1=C(C=CC=C1O)/C=C/C=C/C=C/C=C/C=C/C(=O)NC(CCC(=O)N)C(=O)O", "cluster_id": 4545, "node_id": 3279, "synonyms": [ "Physarochrome A" ], "inchi": "InChI=1S/C24H27N3O6/c1-17(28)26-23-18(12-10-13-20(23)29)11-8-6-4-2-3-5-7-9-14-22(31)27-19(24(32)33)15-16-21(25)30/h2-14,19,29H,15-16H2,1H3,(H2,25,30)(H,26,28)(H,27,31)(H,32,33)/b3-2+,6-4+,7-5+,11-8+,14-9+", "m_plus_h": 454.1973, "m_plus_na": 476.1792, "origin_reference": { "doi": "10.1016/s0040-4039(00)96350-0", "pmid": null, "authors": "Steffan, Bert; Praemassing, Monika; Steglich, Wolfgang", "title": "Physarochrome A, a plasmodial pigment from the slime mould Physarum polycephalum (myxomycetes)", "journal": "Tetrahedron Letters", "year": 1987, "volume": "28", "issue": "32", "pages": "3667-3670" }, "origin_organism": { "id": 2628, "type": "Fungus", "genus": "Physarum", "species": "polycephalum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 11571, "npaid": "NPA011571", "original_name": "Melleumin A", "mol_formula": "C25H29N3O8", "mol_weight": 499.52, "exact_mass": 499.1955, "inchikey": "BTCSAJYXUASTSJ-VMWCRYPFSA-N", "smiles": "C[C@@H]1[C@@H](C(=O)NCC(=O)NC([C@H](CC(=O)O1)O)CC2=CC=C(C=C2)O)NC(=O)C3=CC=C(C=C3)OC", "cluster_id": 4790, "node_id": 3421, "synonyms": [ "Melleumin A" ], "inchi": "InChI=1S/C25H29N3O8/c1-14-23(28-24(33)16-5-9-18(35-2)10-6-16)25(34)26-13-21(31)27-19(20(30)12-22(32)36-14)11-15-3-7-17(29)8-4-15/h3-10,14,19-20,23,29-30H,11-13H2,1-2H3,(H,26,34)(H,27,31)(H,28,33)/t14-,19?,20+,23+/m1/s1", "m_plus_h": 500.2028, "m_plus_na": 522.1847, "origin_reference": { "doi": "10.1016/j.tetlet.2004.11.053", "pmid": null, "authors": "Nakatani, Satomi; Kamata, Kazuaki; Sato, Masaaki; Onuki, Hiroyuki; Hirota, Hiroshi; Matsumoto, Jun; Ishibashi, Masami", "title": "Melleumin A, a novel peptide lactone isolated from the cultured myxomycete Physarum melleum", "journal": "Tetrahedron Letters", "year": 2005, "volume": "46", "issue": "2", "pages": "267-271" }, "origin_organism": { "id": 4320, "type": "Fungus", "genus": "Physarum", "species": "melleum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [ "10.1039/c0ob00352b", "10.1002/asia.200800355" ], "reassignments": [], "external_ids": [] }, { "id": 14481, "npaid": "NPA014481", "original_name": "Melleumin B", "mol_formula": "C26H33N3O9", "mol_weight": 531.562, "exact_mass": 531.2217, "inchikey": "ZMONQYLFROSDFP-HJIRHMBKSA-N", "smiles": "C[C@H]([C@@H](C(=O)NCC(=O)NC(CC1=CC=C(C=C1)O)[C@H](CC(=O)OC)O)NC(=O)C2=CC=C(C=C2)OC)O", "cluster_id": 5545, "node_id": 3421, "synonyms": [ "Melleumin B" ], "inchi": "InChI=1S/C26H33N3O9/c1-15(30)24(29-25(35)17-6-10-19(37-2)11-7-17)26(36)27-14-22(33)28-20(21(32)13-23(34)38-3)12-16-4-8-18(31)9-5-16/h4-11,15,20-21,24,30-32H,12-14H2,1-3H3,(H,27,36)(H,28,33)(H,29,35)/t15-,20?,21+,24+/m1/s1", "m_plus_h": 532.229, "m_plus_na": 554.2109, "origin_reference": { "doi": "10.1016/j.tetlet.2004.11.053", "pmid": null, "authors": "Nakatani, Satomi; Kamata, Kazuaki; Sato, Masaaki; Onuki, Hiroyuki; Hirota, Hiroshi; Matsumoto, Jun; Ishibashi, Masami", "title": "Melleumin A, a novel peptide lactone isolated from the cultured myxomycete Physarum melleum", "journal": "Tetrahedron Letters", "year": 2005, "volume": "46", "issue": "2", "pages": "267-271" }, "origin_organism": { "id": 4320, "type": "Fungus", "genus": "Physarum", "species": "melleum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 16573, "npaid": "NPA016573", "original_name": "Physarigin C", "mol_formula": "C25H30N2O6", "mol_weight": 454.523, "exact_mass": 454.2104, "inchikey": "VRFSFPAMHJPKSX-LTQWNSRPSA-N", "smiles": "CC(=O)NC1=C(C=CC=C1OC)/C=C/C=C/C=C/C=C/C=C/C(CC(=O)NCCC(=O)O)O", "cluster_id": 4022, "node_id": 2958, "synonyms": [ "Physarigin C" ], "inchi": "InChI=1S/C25H30N2O6/c1-19(28)27-25-20(13-11-15-22(25)33-2)12-9-7-5-3-4-6-8-10-14-21(29)18-23(30)26-17-16-24(31)32/h3-15,21,29H,16-18H2,1-2H3,(H,26,30)(H,27,28)(H,31,32)/b4-3+,7-5+,8-6+,12-9+,14-10+", "m_plus_h": 455.2177, "m_plus_na": 477.1996, "origin_reference": { "doi": "10.1016/s0040-4039(03)01041-4", "pmid": null, "authors": "Misono, Yuka; Ito, Akira; Matsumoto, Jun; Sakamoto, Shigeru; Yamaguchi, Kentaro; Ishibashi, Masami", "title": "Physarigins A-C, three new yellow pigments from a cultured myxomycete Physarum rigidum", "journal": "Tetrahedron Letters", "year": 2003, "volume": "44", "issue": "24", "pages": "4479-4481" }, "origin_organism": { "id": 3750, "type": "Fungus", "genus": "Physarum", "species": "rigidum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 16797, "npaid": "NPA016797", "original_name": "Chrysophysarin A", "mol_formula": "C21H30N3O2+", "mol_weight": 356.49, "exact_mass": 356.2333, "inchikey": "IJGNGQQFTLOVNN-XIUYYCRVSA-O", "smiles": "CC(C)C[C@@H](C(=O)C)NC(=O)/C=C/C=C/C=C/C=C/C1=C[N+](=CN1C)C", "cluster_id": 6124, "node_id": 4227, "synonyms": [ "Chrysophysarin A" ], "inchi": "InChI=1S/C21H29N3O2/c1-17(2)14-20(18(3)25)22-21(26)13-11-9-7-6-8-10-12-19-15-23(4)16-24(19)5/h6-13,15-17,20H,14H2,1-5H3/p+1/b8-6+,9-7+,12-10+,13-11+/t20-/m0/s1", "m_plus_h": 357.2406, "m_plus_na": 379.2225, "origin_reference": { "doi": "10.1016/s0040-4020(99)01020-0", "pmid": null, "authors": "Eisenbarth, Sophie; Steffan, Bert", "title": "Structure and Biosynthesis of Chrysophysarin A, a Plasmodial Pigment from the Slime Mould Physarum polycephalum (Myxomycetes)", "journal": "Tetrahedron", "year": 2000, "volume": "56", "issue": "3", "pages": "363-365" }, "origin_organism": { "id": 2628, "type": "Fungus", "genus": "Physarum", "species": "polycephalum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 20504, "npaid": "NPA020504", "original_name": "Polycephalin B", "mol_formula": "C32H36N2O7", "mol_weight": 560.647, "exact_mass": 560.2523, "inchikey": "VWRLMMCGDWPJPY-AVIQIKCZSA-N", "smiles": "CN1[C@H](C(=O)/C(=C(/C=C/C=C/C=C/[C@@H]2C=CCC[C@H]2/C=C/C=C/C=C/C(=C/3\\C(=C)N[C@H](C3=O)CO)/O)\\O)/C1=O)CO", "cluster_id": 3812, "node_id": 2817, "synonyms": [ "Polycephalin B" ], "inchi": "InChI=1S/C32H36N2O7/c1-21-28(30(39)24(19-35)33-21)26(37)17-9-5-3-7-13-22-15-11-12-16-23(22)14-8-4-6-10-18-27(38)29-31(40)25(20-36)34(2)32(29)41/h3-10,12-14,16-18,22-25,33,35-38H,1,11,15,19-20H2,2H3/b5-3+,6-4+,13-7+,14-8+,17-9+,18-10+,28-26-,29-27+/t22-,23-,24+,25+/m1/s1", "m_plus_h": 561.2596, "m_plus_na": 583.2415, "origin_reference": { "doi": "10.1002/(sici)1521-3757(19981116)110:22<3341::aid-ange3341>3.3.co;2-j", "pmid": 29711329, "authors": "Nowak, Alexander; Steffan, Bert", "title": "Polycephalin B und C: ungew\u00f6hnliche Tetrams\u00e4uren aus Plasmodien des Schleimpilzes Physarum polycephalum (Myxomycetes) ( Polycephalin B and C: unusual tetramic acids from plasmodium of the slime fungus Physarum polycephalum (Myxomycetes))", "journal": "Angewandte Chemie", "year": 1998, "volume": "110", "issue": "22", "pages": "3341-3343" }, "origin_organism": { "id": 2628, "type": "Fungus", "genus": "Physarum", "species": "polycephalum", "taxon": { "id": 1755, "name": "Physarum", "rank": "genus", "taxon_db": "mycobank", "external_id": "12178", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 2777, "npaid": "NPA002777", "original_name": "Makaluvamine A", "mol_formula": "C11H11N3O", "mol_weight": 201.229, "exact_mass": 201.0902, "inchikey": "RUIRYCQUTHWLMZ-UHFFFAOYSA-N", "smiles": "CN1C=C2CCN=C3C2=C1C(=O)C(=C3)N", "cluster_id": 1704, "node_id": 1380, "synonyms": [ "Makaluvamine A" ], "inchi": "InChI=1S/C11H11N3O/c1-14-5-6-2-3-13-8-4-7(12)11(15)10(14)9(6)8/h4-5H,2-3,12H2,1H3", "m_plus_h": 202.0975, "m_plus_na": 224.0794, "origin_reference": { "doi": "10.1021/np000382m", "pmid": 11170681, "authors": "Ishibashi, Masami; Iwasaki, Tomoko; Imai, Satomi; Sakamoto, Shigeru; Yamaguchi, Kentaro; Ito, Akira", "title": "Laboratory culture of the myxomycetes: Formation of fruiting bodies of Didymium bahiense and its plasmodial production of makaluvamine A", "journal": "Journal of Natural Products", "year": 2001, "volume": "64", "issue": "1", "pages": "108-110" }, "origin_organism": { "id": 1785, "type": "Fungus", "genus": "Didymium", "species": "bahiense", "taxon": { "id": 1752, "name": "Didymium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12074", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1751, "name": "Didymiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81899" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [ { "external_db_name": "gnps", "external_db_code": "CCMSLIB00004679177%3%Makaluvamine&A" } ] }, { "id": 13525, "npaid": "NPA013525", "original_name": "Makaluvamine I", "mol_formula": "C10H9N3O", "mol_weight": 187.202, "exact_mass": 187.0746, "inchikey": "UTRVSXOLOJTIAD-UHFFFAOYSA-N", "smiles": "C1CN=C2C=C(C(=C3C2=C1C=N3)O)N", "cluster_id": 5310, "node_id": 3720, "synonyms": [ "Makaluvamine I" ], "inchi": "InChI=1S/C10H9N3O/c11-6-3-7-8-5(1-2-12-7)4-13-9(8)10(6)14/h3-4,14H,1-2,11H2", "m_plus_h": 188.0819, "m_plus_na": 210.0638, "origin_reference": { "doi": "10.1016/j.bse.2004.06.015", "pmid": null, "authors": "Nakatani, Satomi; Kiyota, Makiko; Matsumoto, Jun; Ishibashi, Masami", "title": "Pyrroloiminoquinone pigments from Didymium iridis", "journal": "Biochemical Systematics and Ecology", "year": 2005, "volume": "33", "issue": "3", "pages": "323-325" }, "origin_organism": { "id": 4659, "type": "Fungus", "genus": "Didymium", "species": "iridis", "taxon": { "id": 1752, "name": "Didymium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12074", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1751, "name": "Didymiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81899" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [ { "external_db_name": "gnps", "external_db_code": "CCMSLIB00004679175%3%Makaluvamine&I" } ] }, { "id": 18600, "npaid": "NPA018600", "original_name": "Damirone C", "mol_formula": "C10H8N2O2", "mol_weight": 188.186, "exact_mass": 188.0586, "inchikey": "LQWJMBUZIZJYQC-UHFFFAOYSA-N", "smiles": "C1CN=C2C=C(C(=C3C2=C1C=N3)O)O", "cluster_id": 5310, "node_id": 3720, "synonyms": [ "Damirone C" ], "inchi": "InChI=1S/C10H8N2O2/c13-7-3-6-8-5(1-2-11-6)4-12-9(8)10(7)14/h3-4,13-14H,1-2H2", "m_plus_h": 189.0659, "m_plus_na": 211.0478, "origin_reference": { "doi": "10.1016/j.bse.2004.06.015", "pmid": null, "authors": "Nakatani, Satomi; Kiyota, Makiko; Matsumoto, Jun; Ishibashi, Masami", "title": "Pyrroloiminoquinone pigments from Didymium iridis", "journal": "Biochemical Systematics and Ecology", "year": 2005, "volume": "33", "issue": "3", "pages": "323-325" }, "origin_organism": { "id": 4659, "type": "Fungus", "genus": "Didymium", "species": "iridis", "taxon": { "id": 1752, "name": "Didymium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12074", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1751, "name": "Didymiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81899" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 1137, "npaid": "NPA001137", "original_name": "Ppc-1", "mol_formula": "C21H25NO4", "mol_weight": 355.434, "exact_mass": 355.1784, "inchikey": "PBLQSFOIWOTFNY-UHFFFAOYSA-N", "smiles": "CC(=CCOC1=CC=CC2=C1N=C(C=C2OC)C(=O)OCC=C(C)C)C", "cluster_id": 822, "node_id": 691, "synonyms": [ "Ppc-1" ], "inchi": "InChI=1S/C21H25NO4/c1-14(2)9-11-25-18-8-6-7-16-19(24-5)13-17(22-20(16)18)21(23)26-12-10-15(3)4/h6-10,13H,11-12H2,1-5H3", "m_plus_h": 356.1857, "m_plus_na": 378.1676, "origin_reference": { "doi": "10.1016/j.tet.2010.06.029", "pmid": null, "authors": "Kikuchi, Haruhisa; Ishiko, Shinya; Nakamura, Koji; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Novel prenylated and geranylated aromatic compounds isolated from Polysphondylium cellular slime molds", "journal": "Tetrahedron", "year": 2010, "volume": "66", "issue": "32", "pages": "6000-6007" }, "origin_organism": { "id": 882, "type": "Fungus", "genus": "Polysphondylium", "species": "tenuissimum", "taxon": { "id": 1771, "name": "Polysphondylium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12193", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 4747, "npaid": "NPA004747", "original_name": "Pt-5", "mol_formula": "C20H27ClO4", "mol_weight": 366.885, "exact_mass": 366.1598, "inchikey": "LWKCUPJDLQXLRJ-GXDHUFHOSA-N", "smiles": "CCCC(=O)C1=C(C(=C(C=C1OC/C=C(\\C)/CCC=C(C)C)O)Cl)O", "cluster_id": 2572, "node_id": 1987, "synonyms": [ "Pt-5" ], "inchi": "InChI=1S/C20H27ClO4/c1-5-7-15(22)18-17(12-16(23)19(21)20(18)24)25-11-10-14(4)9-6-8-13(2)3/h8,10,12,23-24H,5-7,9,11H2,1-4H3/b14-10+", "m_plus_h": 367.1671, "m_plus_na": 389.149, "origin_reference": { "doi": "10.1016/j.tet.2010.06.029", "pmid": null, "authors": "Kikuchi, Haruhisa; Ishiko, Shinya; Nakamura, Koji; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Novel prenylated and geranylated aromatic compounds isolated from Polysphondylium cellular slime molds", "journal": "Tetrahedron", "year": 2010, "volume": "66", "issue": "32", "pages": "6000-6007" }, "origin_organism": { "id": 882, "type": "Fungus", "genus": "Polysphondylium", "species": "tenuissimum", "taxon": { "id": 1771, "name": "Polysphondylium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12193", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 6081, "npaid": "NPA006081", "original_name": "All-cis-5,9,l2-Heptadecatrienoic acid", "mol_formula": "C17H28O2", "mol_weight": 264.409, "exact_mass": 264.2089, "inchikey": "BBKXRISLVPKIPJ-NLDSCFMSSA-N", "smiles": "CCCC/C=C\\C/C=C\\CC/C=C\\CCCC(=O)O", "cluster_id": 161, "node_id": 152, "synonyms": [ "All-cis-5,9,l2-Heptadecatrienoic acid" ], "inchi": "InChI=1S/C17H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h5-6,8-9,12-13H,2-4,7,10-11,14-16H2,1H3,(H,18,19)/b6-5-,9-8-,13-12-", "m_plus_h": 265.2162, "m_plus_na": 287.1981, "origin_reference": { "doi": "10.1007/bf02522934", "pmid": null, "authors": "Saito, Tamao; Ochiai, Hiroshi", "title": "Identification of a novel all-cis-5,9,12-Heptadecatrienoic acid in the cellular slime moldPolysphondylium pallidum", "journal": "Lipids", "year": 1996, "volume": "31", "issue": "4", "pages": "445-447" }, "origin_organism": { "id": 3042, "type": "Fungus", "genus": "Polysphondylium", "species": "pallidum", "taxon": { "id": 1771, "name": "Polysphondylium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12193", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 6977, "npaid": "NPA006977", "original_name": "Pf-1", "mol_formula": "C18H15Cl3O6", "mol_weight": 433.671, "exact_mass": 431.9934, "inchikey": "IAMHJDFJSZVQPT-UHFFFAOYSA-N", "smiles": "CCCC(=O)C1=C(C2=C(C(=C1OC)Cl)OC3=C2C(=C(C(=C3Cl)OC)Cl)O)O", "cluster_id": 2302, "node_id": 1807, "synonyms": [ "Pf-1" ], "inchi": "InChI=1S/C18H15Cl3O6/c1-4-5-6(22)7-13(23)8-9-14(24)10(19)18(26-3)12(21)17(9)27-16(8)11(20)15(7)25-2/h23-24H,4-5H2,1-3H3", "m_plus_h": 433.0007, "m_plus_na": 454.9826, "origin_reference": { "doi": "10.1016/j.bmc.2013.05.022", "pmid": 23746784, "authors": "Kikuchi, Haruhisa; Kubohara, Yuzuru; Nguyen, Van Hai; Katou, Yasuhiro; Oshima, Yoshiteru", "title": "Novel chlorinated dibenzofurans isolated from the cellular slime mold, Polysphondylium filamentosum, and their biological activities", "journal": "Bioorganic and Medicinal Chemistry", "year": 2013, "volume": "21", "issue": "15", "pages": "4628-4633" }, "origin_organism": { "id": 3293, "type": "Fungus", "genus": "Polysphondylium", "species": "filamentosum", "taxon": { "id": 1771, "name": "Polysphondylium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12193", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 7601, "npaid": "NPA007601", "original_name": "Pt-4", "mol_formula": "C16H22O4", "mol_weight": 278.348, "exact_mass": 278.1518, "inchikey": "HZJFLPSTXGCDLK-UHFFFAOYSA-N", "smiles": "CCCC(=O)C1=C(C=C(C=C1OC)OCC=C(C)C)O", "cluster_id": 3606, "node_id": 2684, "synonyms": [ "Pt-4" ], "inchi": "InChI=1S/C16H22O4/c1-5-6-13(17)16-14(18)9-12(10-15(16)19-4)20-8-7-11(2)3/h7,9-10,18H,5-6,8H2,1-4H3", "m_plus_h": 279.1591, "m_plus_na": 301.141, "origin_reference": { "doi": "10.1016/j.tet.2010.06.029", "pmid": null, "authors": "Kikuchi, Haruhisa; Ishiko, Shinya; Nakamura, Koji; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Novel prenylated and geranylated aromatic compounds isolated from Polysphondylium cellular slime molds", "journal": "Tetrahedron", "year": 2010, "volume": "66", "issue": "32", "pages": "6000-6007" }, "origin_organism": { "id": 882, "type": "Fungus", "genus": "Polysphondylium", "species": "tenuissimum", "taxon": { "id": 1771, "name": "Polysphondylium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12193", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 13126, "npaid": "NPA013126", "original_name": "Pt-2", "mol_formula": "C16H22N4O3", "mol_weight": 318.377, "exact_mass": 318.1692, "inchikey": "BTFUWYCAQYPMPS-DHZHZOJOSA-N", "smiles": "CC(=CCC/C(=C/CN1C2=C(C(=O)NC(=O)N2C)NC1=O)/C)C", "cluster_id": 5206, "node_id": 3663, "synonyms": [ "Pt-2" ], "inchi": "InChI=1S/C16H22N4O3/c1-10(2)6-5-7-11(3)8-9-20-14-12(17-16(20)23)13(21)18-15(22)19(14)4/h6,8H,5,7,9H2,1-4H3,(H,17,23)(H,18,21,22)/b11-8+", "m_plus_h": 319.1765, "m_plus_na": 341.1584, "origin_reference": { "doi": "10.1016/j.tet.2010.06.029", "pmid": null, "authors": "Kikuchi, Haruhisa; Ishiko, Shinya; Nakamura, Koji; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Novel prenylated and geranylated aromatic compounds isolated from Polysphondylium cellular slime molds", "journal": "Tetrahedron", "year": 2010, "volume": "66", "issue": "32", "pages": "6000-6007" }, "origin_organism": { "id": 882, "type": "Fungus", "genus": "Polysphondylium", "species": "tenuissimum", "taxon": { "id": 1771, "name": "Polysphondylium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12193", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 17870, "npaid": "NPA017870", "original_name": "Pt-3", "mol_formula": "C15H15NO2", "mol_weight": 241.29, "exact_mass": 241.1103, "inchikey": "ZIFDBDYESJDTSE-UHFFFAOYSA-N", "smiles": "CC(=CCC1=CC=CC2=C1N=C(C=C2)C(=O)O)C", "cluster_id": 6379, "node_id": 1184, "synonyms": [ "Pt-3" ], "inchi": "InChI=1S/C15H15NO2/c1-10(2)6-7-11-4-3-5-12-8-9-13(15(17)18)16-14(11)12/h3-6,8-9H,7H2,1-2H3,(H,17,18)", "m_plus_h": 242.1176, "m_plus_na": 264.0995, "origin_reference": { "doi": "10.1016/j.tet.2010.06.029", "pmid": null, "authors": "Kikuchi, Haruhisa; Ishiko, Shinya; Nakamura, Koji; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Novel prenylated and geranylated aromatic compounds isolated from Polysphondylium cellular slime molds", "journal": "Tetrahedron", "year": 2010, "volume": "66", "issue": "32", "pages": "6000-6007" }, "origin_organism": { "id": 5334, "type": "Fungus", "genus": "Polysphondylium", "species": "pseudo-candidum", "taxon": { "id": 1771, "name": "Polysphondylium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12193", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 18108, "npaid": "NPA018108", "original_name": "Pf-2", "mol_formula": "C19H17Cl3O6", "mol_weight": 447.698, "exact_mass": 446.0091, "inchikey": "AOJFYMTVKJGXCA-UHFFFAOYSA-N", "smiles": "CCCC(=O)C1=C(C2=C(C(=C1OC)Cl)OC3=C2C(=C(C(=C3Cl)OC)Cl)O)OC", "cluster_id": 2302, "node_id": 1807, "synonyms": [ "Pf-2" ], "inchi": "InChI=1S/C19H17Cl3O6/c1-5-6-7(23)8-15(25-2)10-9-14(24)11(20)19(27-4)13(22)17(9)28-18(10)12(21)16(8)26-3/h24H,5-6H2,1-4H3", "m_plus_h": 447.0164, "m_plus_na": 468.9983, "origin_reference": { "doi": "10.1016/j.bmc.2013.05.022", "pmid": 23746784, "authors": "Kikuchi, Haruhisa; Kubohara, Yuzuru; Nguyen, Van Hai; Katou, Yasuhiro; Oshima, Yoshiteru", "title": "Novel chlorinated dibenzofurans isolated from the cellular slime mold, Polysphondylium filamentosum, and their biological activities", "journal": "Bioorganic and Medicinal Chemistry", "year": 2013, "volume": "21", "issue": "15", "pages": "4628-4633" }, "origin_organism": { "id": 3293, "type": "Fungus", "genus": "Polysphondylium", "species": "filamentosum", "taxon": { "id": 1771, "name": "Polysphondylium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12193", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19066, "npaid": "NPA019066", "original_name": "Pt-1", "mol_formula": "C17H24N4O3", "mol_weight": 332.404, "exact_mass": 332.1848, "inchikey": "RABARORWOHVBMF-FMIVXFBMSA-N", "smiles": "CC(=CCC/C(=C/CN1C2=C(C(=O)NC(=O)N2C)N(C1=O)C)/C)C", "cluster_id": 5206, "node_id": 3663, "synonyms": [ "Pt-1" ], "inchi": "InChI=1S/C17H24N4O3/c1-11(2)7-6-8-12(3)9-10-21-15-13(19(4)17(21)24)14(22)18-16(23)20(15)5/h7,9H,6,8,10H2,1-5H3,(H,18,22,23)/b12-9+", "m_plus_h": 333.1921, "m_plus_na": 355.174, "origin_reference": { "doi": "10.1016/j.tet.2010.06.029", "pmid": null, "authors": "Kikuchi, Haruhisa; Ishiko, Shinya; Nakamura, Koji; Kubohara, Yuzuru; Oshima, Yoshiteru", "title": "Novel prenylated and geranylated aromatic compounds isolated from Polysphondylium cellular slime molds", "journal": "Tetrahedron", "year": 2010, "volume": "66", "issue": "32", "pages": "6000-6007" }, "origin_organism": { "id": 882, "type": "Fungus", "genus": "Polysphondylium", "species": "tenuissimum", "taxon": { "id": 1771, "name": "Polysphondylium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12193", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1766, "name": "Dictyosteliomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90102" }, { "id": 1767, "name": "Dictyosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90718" }, { "id": 1768, "name": "Dictyosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90595" }, { "id": 1769, "name": "Dictyosteliaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81898" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 1944, "npaid": "NPA001944", "original_name": "Enteridinine A", "mol_formula": "C34H60O13", "mol_weight": 676.841, "exact_mass": 676.4034, "inchikey": "XLQDENIGXYGWCK-FKPCIKMYSA-N", "smiles": "CC[C@@H]([C@H](C)[C@@H]1[C@@H]([C@@H]([C@@H]([C@@]2(O1)[C@@H]([C@H]([C@H]([C@H](O2)[C@H](C)C(=O)O[C@H]3C[C@H]([C@@H]([C@H](O3)C)O[C@H]4C[C@]([C@@H]([C@H](O4)C)O)(C)O)O)C)O)C)C)O)C)O", "cluster_id": 1285, "node_id": 1070, "synonyms": [ "Enteridinine A" ], "inchi": "InChI=1S/C34H60O13/c1-11-22(35)14(2)28-15(3)26(37)18(6)34(46-28)19(7)27(38)16(4)29(47-34)17(5)32(40)45-24-12-23(36)30(20(8)42-24)44-25-13-33(10,41)31(39)21(9)43-25/h14-31,35-39,41H,11-13H2,1-10H3/t14-,15+,16+,17-,18-,19+,20+,21+,22-,23+,24-,25-,26-,27-,28+,29-,30+,31+,33-,34-/m0/s1", "m_plus_h": 677.4107, "m_plus_na": 699.3926, "origin_reference": { "doi": "10.1016/j.phytochem.2003.09.020", "pmid": 14759541, "authors": "Rezanka, Tomas; Dvorakova, Radmila; Hanus, Lumir O.; Dembitsky, Valery M.", "title": "Enteridinines A and B from slime mold Enteridium lycoperdon", "journal": "Phytochemistry", "year": 2004, "volume": "65", "issue": "4", "pages": "455-462" }, "origin_organism": { "id": 1362, "type": "Fungus", "genus": "Enteridium", "species": "lycoperdon", "taxon": { "id": 1758, "name": "Enteridium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12084", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 4720, "npaid": "NPA004720", "original_name": "Enteridinine B", "mol_formula": "C40H70O15", "mol_weight": 790.985, "exact_mass": 790.4715, "inchikey": "CBKADAVICKKBON-VNWPRZSASA-N", "smiles": "CC[C@@H]([C@H](C)[C@@H]1[C@@H]([C@@H]([C@@H]([C@@]2(O1)[C@@H]([C@H]([C@H]([C@H](O2)[C@H](C)C(=O)O[C@@H]3C[C@H]([C@H]([C@@H](O3)C)O[C@@H]4CC[C@H]([C@@H](O4)C)O[C@@H]5C[C@]([C@H]([C@@H](O5)C)O)(C)O)O)C)O)C)C)O)C)O", "cluster_id": 1285, "node_id": 1070, "synonyms": [ "Enteridinine B" ], "inchi": "InChI=1S/C40H70O15/c1-12-26(41)17(2)34-18(3)32(43)21(6)40(54-34)22(7)33(44)19(4)35(55-40)20(5)38(46)53-30-15-27(42)36(24(9)49-30)52-29-14-13-28(23(8)48-29)51-31-16-39(11,47)37(45)25(10)50-31/h17-37,41-45,47H,12-16H2,1-11H3/t17-,18+,19+,20-,21-,22+,23-,24-,25-,26-,27+,28+,29+,30+,31+,32-,33-,34+,35-,36-,37-,39-,40-/m0/s1", "m_plus_h": 791.4788, "m_plus_na": 813.4607, "origin_reference": { "doi": "10.1016/j.phytochem.2003.09.020", "pmid": 14759541, "authors": "Rezanka, Tomas; Dvorakova, Radmila; Hanus, Lumir O.; Dembitsky, Valery M.", "title": "Enteridinines A and B from slime mold Enteridium lycoperdon", "journal": "Phytochemistry", "year": 2004, "volume": "65", "issue": "4", "pages": "455-462" }, "origin_organism": { "id": 1362, "type": "Fungus", "genus": "Enteridium", "species": "lycoperdon", "taxon": { "id": 1758, "name": "Enteridium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12084", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 13159, "npaid": "NPA013159", "original_name": "Lycoperdinoside B", "mol_formula": "C45H70O11", "mol_weight": 787.044, "exact_mass": 786.4918, "inchikey": "CUIIPEFEUZOWRS-VAECVIILSA-N", "smiles": "C[C@@H]1CCC(=O)O[C@@H]1[C@H](C)[C@H](C/C=C(\\C)/C=C(\\C)/C[C@H](C)/C=C\\C2[C@H](C=CC(=O)O2)C)O[C@@H]3CC[C@H]([C@@H](O3)C)O[C@@H]4CC[C@H]([C@@H](O4)C)O[C@@H]5CC[C@H]([C@@H](O5)C)O", "cluster_id": 5218, "node_id": 3667, "synonyms": [ "Lycoperdinoside B" ], "inchi": "InChI=1S/C45H70O11/c1-26(10-15-36-29(4)12-19-40(47)52-36)24-28(3)25-27(2)11-16-37(31(6)45-30(5)13-20-41(48)56-45)53-43-22-17-39(33(8)50-43)55-44-23-18-38(34(9)51-44)54-42-21-14-35(46)32(7)49-42/h10-12,15,19,25-26,29-39,42-46H,13-14,16-18,20-24H2,1-9H3/b15-10-,27-11+,28-25+/t26-,29+,30-,31-,32+,33+,34+,35-,36?,37+,38-,39-,42-,43-,44-,45+/m1/s1", "m_plus_h": 787.4991, "m_plus_na": 809.481, "origin_reference": { "doi": "10.1002/ejoc.200300575", "pmid": null, "authors": "\u0158ezanka, Tom\u00e1\u0161; Dvo\u0159\u00e1kov\u00e1, Radmila; Hanu\u0161, Lum\u00edr O.; Dembitsky, Valery M.", "title": "Lycoperdinoside A and B, New Glycosides from the Slime Mold Enteridium lycoperdon", "journal": "European Journal of Organic Chemistry", "year": 2004, "volume": "2004", "issue": "5", "pages": "995-1001" }, "origin_organism": { "id": 1362, "type": "Fungus", "genus": "Enteridium", "species": "lycoperdon", "taxon": { "id": 1758, "name": "Enteridium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12084", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 15956, "npaid": "NPA015956", "original_name": "Lycoperdinoside A", "mol_formula": "C39H60O9", "mol_weight": 672.9, "exact_mass": 672.4237, "inchikey": "QWHGIEDBQGPECB-REYVIGJVSA-N", "smiles": "C[C@@H]1CCC(=O)O[C@@H]1[C@H](C)[C@H](C/C=C(\\C)/C=C(\\C)/C[C@H](C)/C=C\\C2[C@H](C=CC(=O)O2)C)O[C@H]3CC[C@H]([C@@H](O3)C)O[C@@H]4CC[C@H]([C@@H](O4)C)O", "cluster_id": 5218, "node_id": 3667, "synonyms": [ "Lycoperdinoside A" ], "inchi": "InChI=1S/C39H60O9/c1-23(9-14-32-26(4)11-17-35(41)45-32)21-25(3)22-24(2)10-15-33(28(6)39-27(5)12-18-36(42)48-39)46-38-20-16-34(30(8)44-38)47-37-19-13-31(40)29(7)43-37/h9-11,14,17,22-23,26-34,37-40H,12-13,15-16,18-21H2,1-8H3/b14-9-,24-10+,25-22+/t23-,26+,27-,28-,29+,30+,31-,32?,33+,34-,37-,38+,39+/m1/s1", "m_plus_h": 673.431, "m_plus_na": 695.4129, "origin_reference": { "doi": "10.1002/ejoc.200300575", "pmid": null, "authors": "\u0158ezanka, Tom\u00e1\u0161; Dvo\u0159\u00e1kov\u00e1, Radmila; Hanu\u0161, Lum\u00edr O.; Dembitsky, Valery M.", "title": "Lycoperdinoside A and B, New Glycosides from the Slime Mold Enteridium lycoperdon", "journal": "European Journal of Organic Chemistry", "year": 2004, "volume": "2004", "issue": "5", "pages": "995-1001" }, "origin_organism": { "id": 1362, "type": "Fungus", "genus": "Enteridium", "species": "lycoperdon", "taxon": { "id": 1758, "name": "Enteridium", "rank": "genus", "taxon_db": "mycobank", "external_id": "12084", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 7648, "npaid": "NPA007648", "original_name": "Ceratiopyron B", "mol_formula": "C21H32O3", "mol_weight": 332.484, "exact_mass": 332.2351, "inchikey": "AYFKHCDPLUIRAR-BSWSSELBSA-N", "smiles": "CCC/C=C/C=C/CCCCCCCCC1=CC(=CC(=O)O1)OC", "cluster_id": 3620, "node_id": 2694, "synonyms": [ "Ceratiopyron B" ], "inchi": "InChI=1S/C21H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-17-20(23-2)18-21(22)24-19/h5-8,17-18H,3-4,9-16H2,1-2H3/b6-5+,8-7+", "m_plus_h": 333.2424, "m_plus_na": 355.2243, "origin_reference": { "doi": "10.1002/jlac.199519950112", "pmid": null, "authors": "Velten, Robert; Josten, Ingrid; Steglich, Wolfgang", "title": "Unges\u00e4ttigte 6-Alkylpyrone aus dem SchleimpilzCeratiomyxa fruticulosa (Myxomycetes) Unsaturated 6\u2010Alkylpyrones from the Slime Mould Ceratiomyxa fruticulosa (Myxomycetes)", "journal": "Liebigs Annalen der Chemie", "year": 1995, "volume": "1995", "issue": "1", "pages": "81-85" }, "origin_organism": { "id": 3474, "type": "Fungus", "genus": "Ceratiomyxa", "species": "fruticulosa", "taxon": { "id": 1765, "name": "Ceratiomyxa", "rank": "genus", "taxon_db": "mycobank", "external_id": "12029", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1762, "name": "Protosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90323" }, { "id": 1763, "name": "Protosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90442" }, { "id": 1764, "name": "Ceratiomyxaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81550" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 8206, "npaid": "NPA008206", "original_name": "Ceratiopyron C", "mol_formula": "C23H32O3", "mol_weight": 356.506, "exact_mass": 356.2351, "inchikey": "PZAYALWUASATCU-KFEOSCLUSA-N", "smiles": "CCC/C=C/C=C/CCCC/C=C/C=C/CCC1=CC(=CC(=O)O1)OC", "cluster_id": 3620, "node_id": 2694, "synonyms": [ "Ceratiopyron C" ], "inchi": "InChI=1S/C23H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-22(25-2)20-23(24)26-21/h5-8,13-16,19-20H,3-4,9-12,17-18H2,1-2H3/b6-5+,8-7+,14-13+,16-15+", "m_plus_h": 357.2424, "m_plus_na": 379.2243, "origin_reference": { "doi": "10.1002/jlac.199519950112", "pmid": null, "authors": "Velten, Robert; Josten, Ingrid; Steglich, Wolfgang", "title": "Unges\u00e4ttigte 6-Alkylpyrone aus dem SchleimpilzCeratiomyxa fruticulosa (Myxomycetes) Unsaturated 6\u2010Alkylpyrones from the Slime Mould Ceratiomyxa fruticulosa (Myxomycetes)", "journal": "Liebigs Annalen der Chemie", "year": 1995, "volume": "1995", "issue": "1", "pages": "81-85" }, "origin_organism": { "id": 3474, "type": "Fungus", "genus": "Ceratiomyxa", "species": "fruticulosa", "taxon": { "id": 1765, "name": "Ceratiomyxa", "rank": "genus", "taxon_db": "mycobank", "external_id": "12029", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1762, "name": "Protosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90323" }, { "id": 1763, "name": "Protosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90442" }, { "id": 1764, "name": "Ceratiomyxaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81550" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 13321, "npaid": "NPA013321", "original_name": "Arcyrioxocin A", "mol_formula": "C20H11N3O3", "mol_weight": 341.326, "exact_mass": 341.08, "inchikey": "ZRFZDXJUCWCPME-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C3=C4C(=C(NC4=O)O)C5=CNC6=C5C(=CC=C6)OC3=N2", "cluster_id": 5256, "node_id": 10, "synonyms": [ "Arcyrioxocin A" ], "inchi": "InChI=1S/C20H11N3O3/c24-18-15-10-8-21-12-6-3-7-13(14(10)12)26-20-16(17(15)19(25)23-18)9-4-1-2-5-11(9)22-20/h1-8,21,24H,(H,23,25)", "m_plus_h": 342.0873, "m_plus_na": 364.0692, "origin_reference": { "doi": "10.1351/pac198961030281", "pmid": null, "authors": "Wolfgang Steglich", "title": "Slime moulds (Myxomycetes) as a source of new biologically active metabolites", "journal": "Pure and Applied Chemistry", "year": 1989, "volume": "61", "issue": "3", "pages": "281-288" }, "origin_organism": { "id": 4620, "type": "Fungus", "genus": "Ceratiomyxa", "species": "sp.", "taxon": { "id": 1765, "name": "Ceratiomyxa", "rank": "genus", "taxon_db": "mycobank", "external_id": "12029", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1762, "name": "Protosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90323" }, { "id": 1763, "name": "Protosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90442" }, { "id": 1764, "name": "Ceratiomyxaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81550" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 14313, "npaid": "NPA014313", "original_name": "Ceratioflavin A", "mol_formula": "C23H26O3", "mol_weight": 350.458, "exact_mass": 350.1882, "inchikey": "OKPDDZOFQVFXCZ-IFKNUABHSA-N", "smiles": "C/C=C/CC/C=C/C=C/C=C/C=C/C=C/C=C/C1=CC(=CC(=O)O1)OC", "cluster_id": 5503, "node_id": 3843, "synonyms": [ "Ceratioflavin A" ], "inchi": "InChI=1S/C23H26O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-22(25-2)20-23(24)26-21/h3-4,7-20H,5-6H2,1-2H3/b4-3+,8-7+,10-9+,12-11+,14-13+,16-15+,18-17+", "m_plus_h": 351.1955, "m_plus_na": 373.1774, "origin_reference": { "doi": "10.1002/jlac.199519950112", "pmid": null, "authors": "Velten, Robert; Josten, Ingrid; Steglich, Wolfgang", "title": "Unges\u00e4ttigte 6-Alkylpyrone aus dem SchleimpilzCeratiomyxa fruticulosa (Myxomycetes) Unsaturated 6\u2010Alkylpyrones from the Slime Mould Ceratiomyxa fruticulosa (Myxomycetes)", "journal": "Liebigs Annalen der Chemie", "year": 1995, "volume": "1995", "issue": "1", "pages": "81-85" }, "origin_organism": { "id": 3474, "type": "Fungus", "genus": "Ceratiomyxa", "species": "fruticulosa", "taxon": { "id": 1765, "name": "Ceratiomyxa", "rank": "genus", "taxon_db": "mycobank", "external_id": "12029", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1762, "name": "Protosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90323" }, { "id": 1763, "name": "Protosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90442" }, { "id": 1764, "name": "Ceratiomyxaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81550" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 17158, "npaid": "NPA017158", "original_name": "Ceratiopyron D", "mol_formula": "C23H32O3", "mol_weight": 356.506, "exact_mass": 356.2351, "inchikey": "VJXCRRDKVZGHIV-UVHOCLKUSA-N", "smiles": "CCC/C=C/C=C/CC/C=C/C=C/CCCCC1=CC(=CC(=O)O1)OC", "cluster_id": 3620, "node_id": 2694, "synonyms": [ "Ceratiopyron D" ], "inchi": "InChI=1S/C23H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-22(25-2)20-23(24)26-21/h5-8,11-14,19-20H,3-4,9-10,15-18H2,1-2H3/b6-5+,8-7+,12-11+,14-13+", "m_plus_h": 357.2424, "m_plus_na": 379.2243, "origin_reference": { "doi": "10.1002/jlac.199519950112", "pmid": null, "authors": "Velten, Robert; Josten, Ingrid; Steglich, Wolfgang", "title": "Unges\u00e4ttigte 6-Alkylpyrone aus dem SchleimpilzCeratiomyxa fruticulosa (Myxomycetes) Unsaturated 6\u2010Alkylpyrones from the Slime Mould Ceratiomyxa fruticulosa (Myxomycetes)", "journal": "Liebigs Annalen der Chemie", "year": 1995, "volume": "1995", "issue": "1", "pages": "81-85" }, "origin_organism": { "id": 3474, "type": "Fungus", "genus": "Ceratiomyxa", "species": "fruticulosa", "taxon": { "id": 1765, "name": "Ceratiomyxa", "rank": "genus", "taxon_db": "mycobank", "external_id": "12029", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1762, "name": "Protosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90323" }, { "id": 1763, "name": "Protosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90442" }, { "id": 1764, "name": "Ceratiomyxaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81550" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19974, "npaid": "NPA019974", "original_name": "Ceratiopyron A", "mol_formula": "C21H30O3", "mol_weight": 330.468, "exact_mass": 330.2195, "inchikey": "DNFXGOXBILBXTD-MHIMLCKZSA-N", "smiles": "C/C=C/CCCCCCCC/C=C/C=C/C1=CC(=CC(=O)O1)OC", "cluster_id": 5503, "node_id": 3843, "synonyms": [ "Ceratiopyron A" ], "inchi": "InChI=1S/C21H30O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-17-20(23-2)18-21(22)24-19/h3-4,13-18H,5-12H2,1-2H3/b4-3+,14-13+,16-15+", "m_plus_h": 331.2268, "m_plus_na": 353.2087, "origin_reference": { "doi": "10.1002/jlac.199519950112", "pmid": null, "authors": "Velten, Robert; Josten, Ingrid; Steglich, Wolfgang", "title": "Unges\u00e4ttigte 6-Alkylpyrone aus dem SchleimpilzCeratiomyxa fruticulosa (Myxomycetes) Unsaturated 6\u2010Alkylpyrones from the Slime Mould Ceratiomyxa fruticulosa (Myxomycetes)", "journal": "Liebigs Annalen der Chemie", "year": 1995, "volume": "1995", "issue": "1", "pages": "81-85" }, "origin_organism": { "id": 3474, "type": "Fungus", "genus": "Ceratiomyxa", "species": "fruticulosa", "taxon": { "id": 1765, "name": "Ceratiomyxa", "rank": "genus", "taxon_db": "mycobank", "external_id": "12029", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1762, "name": "Protosteliomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90323" }, { "id": 1763, "name": "Protosteliales", "rank": "order", "taxon_db": "mycobank", "external_id": "90442" }, { "id": 1764, "name": "Ceratiomyxaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81550" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 3509, "npaid": "NPA003509", "original_name": "Tubiferal B", "mol_formula": "C30H44O6", "mol_weight": 500.676, "exact_mass": 500.3138, "inchikey": "IFDXLURAAJTNJZ-UHBAVIIOSA-N", "smiles": "CC(=CCC[C@H]([C@H]1[C@H](C[C@@]2([C@@]1(CC=C3[C@H]2CC[C@@H]4C(=C3)C[C@H]([C@@H](C4(C)C)O)O)C)C=O)O)C(=O)O)C", "cluster_id": 2056, "node_id": 1628, "synonyms": [ "Tubiferal B" ], "inchi": "InChI=1S/C30H44O6/c1-17(2)7-6-8-20(27(35)36)25-24(33)15-30(16-31)22-10-9-21-19(13-18(22)11-12-29(25,30)5)14-23(32)26(34)28(21,3)4/h7,11,13,16,20-26,32-34H,6,8-10,12,14-15H2,1-5H3,(H,35,36)/t20-,21-,22-,23-,24+,25+,26+,29-,30-/m1/s1", "m_plus_h": 501.3211, "m_plus_na": 523.303, "origin_reference": { "doi": "10.1016/j.tet.2004.08.071", "pmid": null, "authors": "Kamata, Kazuaki; Onuki, Hiroyuki; Hirota, Hiroshi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Sato, Masaaki; Ishibashi, Masami", "title": "Tubiferal A, a backbone-rearranged triterpenoid lactone isolated from the myxomycete Tubifera dimorphotheca, possessing reversal of drug resistance activity", "journal": "Tetrahedron", "year": 2004, "volume": "60", "issue": "44", "pages": "9835-9839" }, "origin_organism": { "id": 2137, "type": "Fungus", "genus": "Tubifera", "species": "dimorphotheca", "taxon": { "id": 1760, "name": "Tubifera", "rank": "genus", "taxon_db": "mycobank", "external_id": "12251", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 17864, "npaid": "NPA017864", "original_name": "Tubiferal A", "mol_formula": "C30H42O5", "mol_weight": 482.661, "exact_mass": 482.3032, "inchikey": "SKMJFLCULWXBDN-UHBAVIIOSA-N", "smiles": "CC(=CCC[C@@H]1[C@H]2[C@H](C[C@@]3([C@@]2(CC=C4[C@H]3CC[C@@H]5C(=C4)C[C@H]([C@@H](C5(C)C)O)O)C)C=O)OC1=O)C", "cluster_id": 6378, "node_id": 1628, "synonyms": [ "Tubiferal A" ], "inchi": "InChI=1S/C30H42O5/c1-17(2)7-6-8-20-25-24(35-27(20)34)15-30(16-31)22-10-9-21-19(13-18(22)11-12-29(25,30)5)14-23(32)26(33)28(21,3)4/h7,11,13,16,20-26,32-33H,6,8-10,12,14-15H2,1-5H3/t20-,21-,22-,23-,24+,25+,26+,29-,30-/m1/s1", "m_plus_h": 483.3105, "m_plus_na": 505.2924, "origin_reference": { "doi": "10.1016/j.tet.2004.08.071", "pmid": null, "authors": "Kamata, Kazuaki; Onuki, Hiroyuki; Hirota, Hiroshi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Sato, Masaaki; Ishibashi, Masami", "title": "Tubiferal A, a backbone-rearranged triterpenoid lactone isolated from the myxomycete Tubifera dimorphotheca, possessing reversal of drug resistance activity", "journal": "Tetrahedron", "year": 2004, "volume": "60", "issue": "44", "pages": "9835-9839" }, "origin_organism": { "id": 2137, "type": "Fungus", "genus": "Tubifera", "species": "dimorphotheca", "taxon": { "id": 1760, "name": "Tubifera", "rank": "genus", "taxon_db": "mycobank", "external_id": "12251", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 552, "npaid": "NPA000552", "original_name": "7-Methoxylindbladione", "mol_formula": "C17H16O7", "mol_weight": 332.308, "exact_mass": 332.0896, "inchikey": "FVZOCXPLUSPLSC-AATRIKPKSA-N", "smiles": "CCCC(=O)/C=C/C1=C(C2=C(C=C(C(=O)C2=O)OC)C(=C1O)O)O", "cluster_id": 442, "node_id": 10, "synonyms": [ "7-Methoxylindbladione" ], "inchi": "InChI=1S/C17H16O7/c1-3-4-8(18)5-6-9-13(19)12-10(15(21)14(9)20)7-11(24-2)16(22)17(12)23/h5-7,19-21H,3-4H2,1-2H3/b6-5+", "m_plus_h": 333.0969, "m_plus_na": 355.0788, "origin_reference": { "doi": "10.1248/cpb.50.1126", "pmid": 12192152, "authors": "Ishikawa, Yae; Ishibashi, Masami; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki", "title": "Lindbladione and Related Naphthoquinone Pigments from a Myxomycete Lindbladia tubulina", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2002, "volume": "50", "issue": "8", "pages": "1126-1127" }, "origin_organism": { "id": 464, "type": "Fungus", "genus": "Lindbladia", "species": "tubulina", "taxon": { "id": 1749, "name": "Lindbladia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12135", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1747, "name": "Cribrariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81555" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 2786, "npaid": "NPA002786", "original_name": "6,7-dimethoxydihydrolindbladione", "mol_formula": "C18H20O7", "mol_weight": 348.351, "exact_mass": 348.1209, "inchikey": "VBCLWCRRZXKXIS-UHFFFAOYSA-N", "smiles": "CCCC(=O)CCC1=C(C2=C(C(=C(C=C2C(=O)C1=O)OC)OC)O)O", "cluster_id": 1709, "node_id": 10, "synonyms": [ "6,7-dimethoxydihydrolindbladione" ], "inchi": "InChI=1S/C18H20O7/c1-4-5-9(19)6-7-10-14(20)13-11(16(22)15(10)21)8-12(24-2)18(25-3)17(13)23/h8,20,23H,4-7H2,1-3H3", "m_plus_h": 349.1282, "m_plus_na": 371.1101, "origin_reference": { "doi": "10.1021/np030089x", "pmid": 12880324, "authors": "Misono, Yuka; Ishikawa, Yae; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Dihydrolindbladiones, three new naphthoquinone pigments from a myxomycete Lindbladia tubulina", "journal": "Journal of Natural Products", "year": 2003, "volume": "66", "issue": "7", "pages": "999-1001" }, "origin_organism": { "id": 464, "type": "Fungus", "genus": "Lindbladia", "species": "tubulina", "taxon": { "id": 1749, "name": "Lindbladia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12135", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1747, "name": "Cribrariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81555" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 3960, "npaid": "NPA003960", "original_name": "6,7-Dimethoxylindbladione", "mol_formula": "C18H18O7", "mol_weight": 346.335, "exact_mass": 346.1053, "inchikey": "PIMHFJPKESFSSO-VOTSOKGWSA-N", "smiles": "CCCC(=O)/C=C/C1=C(C2=C(C(=C(C=C2C(=O)C1=O)OC)OC)O)O", "cluster_id": 1709, "node_id": 10, "synonyms": [ "6,7-Dimethoxylindbladione" ], "inchi": "InChI=1S/C18H18O7/c1-4-5-9(19)6-7-10-14(20)13-11(16(22)15(10)21)8-12(24-2)18(25-3)17(13)23/h6-8,20,23H,4-5H2,1-3H3/b7-6+", "m_plus_h": 347.1126, "m_plus_na": 369.0945, "origin_reference": { "doi": "10.1248/cpb.50.1126", "pmid": 12192152, "authors": "Ishikawa, Yae; Ishibashi, Masami; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki", "title": "Lindbladione and Related Naphthoquinone Pigments from a Myxomycete Lindbladia tubulina", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2002, "volume": "50", "issue": "8", "pages": "1126-1127" }, "origin_organism": { "id": 464, "type": "Fungus", "genus": "Lindbladia", "species": "tubulina", "taxon": { "id": 1749, "name": "Lindbladia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12135", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1747, "name": "Cribrariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81555" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 4396, "npaid": "NPA004396", "original_name": "Dihydrolindbladione", "mol_formula": "C16H16O7", "mol_weight": 320.297, "exact_mass": 320.0896, "inchikey": "VVPAGGCRNFFVAP-UHFFFAOYSA-N", "smiles": "CCCC(=O)CCC1=C(C2=C(C=C(C(=O)C2=O)O)C(=C1O)O)O", "cluster_id": 2439, "node_id": 10, "synonyms": [ "Dihydrolindbladione" ], "inchi": "InChI=1S/C16H16O7/c1-2-3-7(17)4-5-8-12(19)11-9(14(21)13(8)20)6-10(18)15(22)16(11)23/h6,18-21H,2-5H2,1H3", "m_plus_h": 321.0969, "m_plus_na": 343.0788, "origin_reference": { "doi": "10.1021/np030089x", "pmid": 12880324, "authors": "Misono, Yuka; Ishikawa, Yae; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Dihydrolindbladiones, three new naphthoquinone pigments from a myxomycete Lindbladia tubulina", "journal": "Journal of Natural Products", "year": 2003, "volume": "66", "issue": "7", "pages": "999-1001" }, "origin_organism": { "id": 464, "type": "Fungus", "genus": "Lindbladia", "species": "tubulina", "taxon": { "id": 1749, "name": "Lindbladia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12135", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1747, "name": "Cribrariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81555" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 17368, "npaid": "NPA017368", "original_name": "6-methoxydihydrolindbladione", "mol_formula": "C17H18O7", "mol_weight": 334.324, "exact_mass": 334.1053, "inchikey": "OJXRMXFUEDTZTD-UHFFFAOYSA-N", "smiles": "CCCC(=O)CCC1=C(C2=C(C(=C(C=C2C(=O)C1=O)O)OC)O)O", "cluster_id": 1709, "node_id": 10, "synonyms": [ "6-methoxydihydrolindbladione" ], "inchi": "InChI=1S/C17H18O7/c1-3-4-8(18)5-6-9-13(20)12-10(15(22)14(9)21)7-11(19)17(24-2)16(12)23/h7,19-20,23H,3-6H2,1-2H3", "m_plus_h": 335.1126, "m_plus_na": 357.0945, "origin_reference": { "doi": "10.1021/np030089x", "pmid": 12880324, "authors": "Misono, Yuka; Ishikawa, Yae; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Dihydrolindbladiones, three new naphthoquinone pigments from a myxomycete Lindbladia tubulina", "journal": "Journal of Natural Products", "year": 2003, "volume": "66", "issue": "7", "pages": "999-1001" }, "origin_organism": { "id": 464, "type": "Fungus", "genus": "Lindbladia", "species": "tubulina", "taxon": { "id": 1749, "name": "Lindbladia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12135", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1747, "name": "Cribrariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81555" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 9755, "npaid": "NPA009755", "original_name": "6-hydroxy-9'-methoxystaurosporinone", "mol_formula": "C21H15N3O3", "mol_weight": 357.369, "exact_mass": 357.1113, "inchikey": "ATBXPCOFDWGOCJ-UHFFFAOYSA-N", "smiles": "COC1C2=C3C4=CC=CC=C4NC3=C5C(=C2C(=O)N1)C6=C(N5)C=C(C=C6)O", "cluster_id": 2448, "node_id": 10, "synonyms": [ "6-hydroxy-9'-methoxystaurosporinone" ], "inchi": "InChI=1S/C21H15N3O3/c1-27-21-17-15-10-4-2-3-5-12(10)22-19(15)18-14(16(17)20(26)24-21)11-7-6-9(25)8-13(11)23-18/h2-8,21-23,25H,1H3,(H,24,26)", "m_plus_h": 358.1186, "m_plus_na": 380.1005, "origin_reference": { "doi": "10.1021/np1002687", "pmid": 20839811, "authors": "Shintani, Akinori; Toume, Kazufumi; Rifai, Yusnita; Arai, Midori A.; Ishibashi, Masami", "title": "A bisindole alkaloid with hedgehog signal inhibitory activity from the myxomycete perichaena chrysosperma", "journal": "Journal of Natural Products", "year": 2010, "volume": "73", "issue": "10", "pages": "1711-1713" }, "origin_organism": { "id": 3939, "type": "Fungus", "genus": "Perichaena", "species": "chrysosperma", "taxon": { "id": 1745, "name": "Perichaena", "rank": "genus", "taxon_db": "mycobank", "external_id": "12173", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 17415, "npaid": "NPA017415", "original_name": "6,9'-dihydroxystaurosporinone", "mol_formula": "C20H13N3O3", "mol_weight": 343.342, "exact_mass": 343.0957, "inchikey": "SFJSCRJUSYHDLA-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C3=C4C(NC(=O)C4=C5C6=C(C=C(C=C6)O)NC5=C3N2)O", "cluster_id": 2448, "node_id": 10, "synonyms": [ "6,9'-dihydroxystaurosporinone" ], "inchi": "InChI=1S/C20H13N3O3/c24-8-5-6-10-12(7-8)22-18-14(10)16-15(19(25)23-20(16)26)13-9-3-1-2-4-11(9)21-17(13)18/h1-7,19,21-22,24-25H,(H,23,26)", "m_plus_h": 344.103, "m_plus_na": 366.0849, "origin_reference": { "doi": "10.1021/np1002687", "pmid": 20839811, "authors": "Shintani, Akinori; Toume, Kazufumi; Rifai, Yusnita; Arai, Midori A.; Ishibashi, Masami", "title": "A bisindole alkaloid with hedgehog signal inhibitory activity from the myxomycete perichaena chrysosperma", "journal": "Journal of Natural Products", "year": 2010, "volume": "73", "issue": "10", "pages": "1711-1713" }, "origin_organism": { "id": 3939, "type": "Fungus", "genus": "Perichaena", "species": "chrysosperma", "taxon": { "id": 1745, "name": "Perichaena", "rank": "genus", "taxon_db": "mycobank", "external_id": "12173", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 566, "npaid": "NPA000566", "original_name": "Cribrarione A", "mol_formula": "C13H10O7", "mol_weight": 278.216, "exact_mass": 278.0427, "inchikey": "LOWZCAXXHXKLLG-UHFFFAOYSA-N", "smiles": "COC1=C(C2=C(C(=C1)O)C(=O)C3=C(C2=O)OCC3O)O", "cluster_id": 450, "node_id": 10, "synonyms": [ "Cribrarione A" ], "inchi": "InChI=1S/C13H10O7/c1-19-6-2-4(14)7-9(10(6)16)12(18)13-8(11(7)17)5(15)3-20-13/h2,5,14-16H,3H2,1H3", "m_plus_h": 279.05, "m_plus_na": 301.0319, "origin_reference": { "doi": "10.1016/s0040-4020(03)00514-3", "pmid": null, "authors": "Naoe, Ayano; Ishibashi, Masami; Yamamoto, Yukinori", "title": "Cribrarione A, a new antimicrobial naphthoquinone pigment from a myxomycete Cribraria purpurea", "journal": "Tetrahedron", "year": 2003, "volume": "59", "issue": "19", "pages": "3433-3435" }, "origin_organism": { "id": 476, "type": "Fungus", "genus": "Cribraria", "species": "purpurea", "taxon": { "id": 1748, "name": "Cribraria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12058", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1747, "name": "Cribrariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81555" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 11519, "npaid": "NPA011519", "original_name": "Cribrarione B", "mol_formula": "C12H10O6", "mol_weight": 250.206, "exact_mass": 250.0477, "inchikey": "GMPMHBSGNWRGNG-UHFFFAOYSA-N", "smiles": "CC(C1=CC(=C2C(=C1O)C(=CC(=O)C2=O)O)O)O", "cluster_id": 4777, "node_id": 10, "synonyms": [ "Cribrarione B" ], "inchi": "InChI=1S/C12H10O6/c1-4(13)5-2-6(14)10-9(11(5)17)7(15)3-8(16)12(10)18/h2-4,13-15,17H,1H3", "m_plus_h": 251.055, "m_plus_na": 273.0369, "origin_reference": { "doi": "10.1021/np030308e", "pmid": 14695806, "authors": "Iwata, Dai; Ishibashi, Masami; Yamamoto, Yukinori", "title": "Cribrarione B, a New Naphthoquinone Pigment from the Myxomycete Cribrariacancellata", "journal": "Journal of Natural Products", "year": 2003, "volume": "66", "issue": "12", "pages": "1611-1612" }, "origin_organism": { "id": 4312, "type": "Fungus", "genus": "Cribraria", "species": "cancellata", "taxon": { "id": 1748, "name": "Cribraria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12058", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1747, "name": "Cribrariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81555" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 12842, "npaid": "NPA012842", "original_name": "Cribrarione C", "mol_formula": "C10H6O6", "mol_weight": 222.152, "exact_mass": 222.0164, "inchikey": "NOSOVUIKQSBANI-UHFFFAOYSA-N", "smiles": "C1=C2C(=C(C(=C1O)O)O)C(=CC(=O)C2=O)O", "cluster_id": 5126, "node_id": 10, "synonyms": [ "Cribrarione C" ], "inchi": "InChI=1S/C10H6O6/c11-4-2-6(13)8(14)3-1-5(12)9(15)10(16)7(3)4/h1-2,11-12,15-16H", "m_plus_h": 223.0237, "m_plus_na": 245.0056, "origin_reference": { "doi": "10.1248/cpb.57.894", "pmid": 19652423, "authors": "Shintani, Akinori; Yamazaki, Hiroyuki; Yamamoto, Yukinori; Ahmed, Firoj; Ishibashi, Masami", "title": "Cribrarione C, a naphthoquinone pigment from the myxomycete Cribraria meylanii", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2009, "volume": "57", "issue": "8", "pages": "894-895" }, "origin_organism": { "id": 4538, "type": "Fungus", "genus": "Cribraria", "species": "meylanii", "taxon": { "id": 1748, "name": "Cribraria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12058", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1747, "name": "Cribrariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81555" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 40, "npaid": "NPA000040", "original_name": "Arcyroxepin A", "mol_formula": "C20H11N3O3", "mol_weight": 341.326, "exact_mass": 341.08, "inchikey": "UUCOIMUVMFGMET-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C3=C(N2)OC4=C(C5=CC=CC=C5N4)C6=C3C(=O)NC6=O", "cluster_id": 39, "node_id": 10, "synonyms": [ "Arcyroxepin A" ], "inchi": "InChI=1S/C20H11N3O3/c24-17-15-13-9-5-1-3-7-11(9)21-19(13)26-20-14(16(15)18(25)23-17)10-6-2-4-8-12(10)22-20/h1-8,21-22H,(H,23,24,25)", "m_plus_h": 342.0873, "m_plus_na": 364.0692, "origin_reference": { "doi": "10.1351/pac198153061233", "pmid": null, "authors": "Steglich, W.", "title": "Biologically active compounds from higher fungi", "journal": "Pure and Applied Chemistry", "year": 1981, "volume": "53", "issue": "6", "pages": "1233-1240" }, "origin_organism": { "id": 40, "type": "Fungus", "genus": "Trichia", "species": "floriformis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 3122, "npaid": "NPA003122", "original_name": "Kehokorin A", "mol_formula": "C27H28O10", "mol_weight": 512.511, "exact_mass": 512.1682, "inchikey": "BVXZZBSRUHMSQH-YGVWRSSSSA-N", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(C3=C(C=C2)OC4=C(C(=C(C=C34)O)C5=CC=C(C=C5)OC)OC)OC)O)O)O", "cluster_id": 1875, "node_id": 1501, "synonyms": [ "Kehokorin A" ], "inchi": "InChI=1S/C27H28O10/c1-12-21(29)22(30)23(31)27(35-12)37-18-10-9-17-20(25(18)33-3)15-11-16(28)19(26(34-4)24(15)36-17)13-5-7-14(32-2)8-6-13/h5-12,21-23,27-31H,1-4H3/t12-,21-,22+,23+,27-/m0/s1", "m_plus_h": 513.1755, "m_plus_na": 535.1574, "origin_reference": { "doi": "10.1016/j.tetlet.2006.01.012", "pmid": null, "authors": "Kaniwa, Kouken; Ohtsuki, Takashi; Yamamoto, Yukinori; Ishibashi, Masami", "title": "Kehokorins A-C, novel cytotoxic dibenzofurans isolated from the myxomycete Trichia favoginea var. persimilis", "journal": "Tetrahedron Letters", "year": 2006, "volume": "47", "issue": "10", "pages": "1505-1508" }, "origin_organism": { "id": 1953, "type": "Fungus", "genus": "Trichia", "species": "favoginea var. persimilis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 4041, "npaid": "NPA004041", "original_name": "Arcyriarubin B", "mol_formula": "C20H13N3O3", "mol_weight": 343.342, "exact_mass": 343.0957, "inchikey": "FPFDAPLHFVEXKC-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C(=CN2)C3=C(C(=O)NC3=O)C4=CNC5=C4C=CC(=C5)O", "cluster_id": 1010, "node_id": 10, "synonyms": [ "Arcyriarubin B" ], "inchi": "InChI=1S/C20H13N3O3/c24-10-5-6-12-14(9-22-16(12)7-10)18-17(19(25)23-20(18)26)13-8-21-15-4-2-1-3-11(13)15/h1-9,21-22,24H,(H,23,25,26)", "m_plus_h": 344.103, "m_plus_na": 366.0849, "origin_reference": { "doi": "10.1351/pac198153061233", "pmid": null, "authors": "Steglich, W.", "title": "Biologically active compounds from higher fungi", "journal": "Pure and Applied Chemistry", "year": 1981, "volume": "53", "issue": "6", "pages": "1233-1240" }, "origin_organism": { "id": 40, "type": "Fungus", "genus": "Trichia", "species": "floriformis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 4316, "npaid": "NPA004316", "original_name": "Kehokorin B", "mol_formula": "C21H18O6", "mol_weight": 366.369, "exact_mass": 366.1103, "inchikey": "BXHDIDRYYPPYIM-UHFFFAOYSA-N", "smiles": "COC1=CC=C(C=C1)C2=C(C=C3C4=C(C=CC(=C4OC)O)OC3=C2OC)O", "cluster_id": 1875, "node_id": 1501, "synonyms": [ "Kehokorin B" ], "inchi": "InChI=1S/C21H18O6/c1-24-12-6-4-11(5-7-12)17-15(23)10-13-18-16(27-19(13)21(17)26-3)9-8-14(22)20(18)25-2/h4-10,22-23H,1-3H3", "m_plus_h": 367.1176, "m_plus_na": 389.0995, "origin_reference": { "doi": "10.1016/j.tetlet.2006.01.012", "pmid": null, "authors": "Kaniwa, Kouken; Ohtsuki, Takashi; Yamamoto, Yukinori; Ishibashi, Masami", "title": "Kehokorins A-C, novel cytotoxic dibenzofurans isolated from the myxomycete Trichia favoginea var. persimilis", "journal": "Tetrahedron Letters", "year": 2006, "volume": "47", "issue": "10", "pages": "1505-1508" }, "origin_organism": { "id": 1953, "type": "Fungus", "genus": "Trichia", "species": "favoginea var. persimilis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 10015, "npaid": "NPA010015", "original_name": "Isovelleral", "mol_formula": "C15H20O2", "mol_weight": 232.323, "exact_mass": 232.1463, "inchikey": "PJAAESPGJOSQGZ-DZGBDDFRSA-N", "smiles": "C[C@]12C[C@]1(C(=C[C@H]3[C@@H]2CC(C3)(C)C)C=O)C=O", "cluster_id": 4368, "node_id": 2700, "synonyms": [ "Isovelleral" ], "inchi": "InChI=1S/C15H20O2/c1-13(2)5-10-4-11(7-16)15(9-17)8-14(15,3)12(10)6-13/h4,7,9-10,12H,5-6,8H2,1-3H3/t10-,12+,14-,15-/m1/s1", "m_plus_h": 233.1536, "m_plus_na": 255.1355, "origin_reference": { "doi": "10.1016/s0040-4039(01)84520-2", "pmid": null, "authors": "Magnusson, G.; Thoren, S.; Wickberg, B.", "title": "Fungal extractives I. structure of a sesquiterpene dialdehyde from Lactarius by computer simulation of the nmr spectrum", "journal": "Tetrahedron Letters", "year": 1972, "volume": "13", "issue": "12", "pages": "1105-1108" }, "origin_organism": { "id": 40, "type": "Fungus", "genus": "Trichia", "species": "floriformis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [ "10.1021/jo0015568" ], "reassignments": [], "external_ids": [] }, { "id": 11166, "npaid": "NPA011166", "original_name": "Trichiol", "mol_formula": "C29H46O4", "mol_weight": 458.683, "exact_mass": 458.3396, "inchikey": "XHYBMPNUAQFCPC-AGKUGKFISA-N", "smiles": "CCC(C[C@@H]1[C@H]2[C@H]3CC[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@@]5(CC[C@@H](C6)O)C)[C@H](O1)OC2=O)C(C)C", "cluster_id": 4675, "node_id": 3352, "synonyms": [ "Trichiol" ], "inchi": "InChI=1S/C29H46O4/c1-5-17(16(2)3)14-24-25-23-9-8-22-20-7-6-18-15-19(30)10-12-28(18,4)21(20)11-13-29(22,23)27(32-24)33-26(25)31/h16-25,27,30H,5-15H2,1-4H3/t17?,18-,19-,20+,21-,22-,23+,24+,25+,27+,28-,29+/m0/s1", "m_plus_h": 459.3469, "m_plus_na": 481.3288, "origin_reference": { "doi": "10.1016/j.tetlet.2006.04.108", "pmid": null, "authors": "Kaniwa, Kouken; Ohtsuki, Takashi; Sonoda, Tomomi; Yamamoto, Yukinori; Hayashi, Masahiko; Kamiyama, Kanki; Ishibashi, Masami", "title": "Trichiol and 3-epitrichiol acetate, novel cytotoxic sterols with an unprecedented 2,6-dioxabicyclo[2.2.2]octan-3-one ring system from the myxomycete Trichia favoginea var. persimilis", "journal": "Tetrahedron Letters", "year": 2006, "volume": "47", "issue": "26", "pages": "4351-4354" }, "origin_organism": { "id": 1953, "type": "Fungus", "genus": "Trichia", "species": "favoginea var. persimilis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 12924, "npaid": "NPA012924", "original_name": "3-epitrichiol acetate", "mol_formula": "C31H48O5", "mol_weight": 500.72, "exact_mass": 500.3502, "inchikey": "BXTFLLHVJAONOL-KXCYLCNDSA-N", "smiles": "CCC(C[C@@H]1[C@H]2[C@H]3CC[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@@]5(CC[C@H](C6)OC(=O)C)C)[C@H](O1)OC2=O)C(C)C", "cluster_id": 4675, "node_id": 3352, "synonyms": [ "3-epitrichiol acetate" ], "inchi": "InChI=1S/C31H48O5/c1-6-19(17(2)3)15-26-27-25-10-9-24-22-8-7-20-16-21(34-18(4)32)11-13-30(20,5)23(22)12-14-31(24,25)29(35-26)36-28(27)33/h17,19-27,29H,6-16H2,1-5H3/t19?,20-,21+,22+,23-,24-,25+,26+,27+,29+,30-,31+/m0/s1", "m_plus_h": 501.3575, "m_plus_na": 523.3394, "origin_reference": { "doi": "10.1016/j.tetlet.2006.04.108", "pmid": null, "authors": "Kaniwa, Kouken; Ohtsuki, Takashi; Sonoda, Tomomi; Yamamoto, Yukinori; Hayashi, Masahiko; Kamiyama, Kanki; Ishibashi, Masami", "title": "Trichiol and 3-epitrichiol acetate, novel cytotoxic sterols with an unprecedented 2,6-dioxabicyclo[2.2.2]octan-3-one ring system from the myxomycete Trichia favoginea var. persimilis", "journal": "Tetrahedron Letters", "year": 2006, "volume": "47", "issue": "26", "pages": "4351-4354" }, "origin_organism": { "id": 1953, "type": "Fungus", "genus": "Trichia", "species": "favoginea var. persimilis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 13589, "npaid": "NPA013589", "original_name": "Tridentoquinone", "mol_formula": "C26H34O4", "mol_weight": 410.554, "exact_mass": 410.2457, "inchikey": "HNZJHYHUUDPPHQ-RYRMPNIESA-N", "smiles": "C/C/1=C/CC/C(=C\\CC2=C(C(=O)C3=C(C2=O)OC([C@@H]3CC/C(=C\\CC1)/C)(C)C)O)/C", "cluster_id": 5329, "node_id": 3734, "synonyms": [ "Tridentoquinone" ], "inchi": "InChI=1S/C26H34O4/c1-16-8-6-10-17(2)12-14-19-22(27)24(29)21-20(15-13-18(3)11-7-9-16)26(4,5)30-25(21)23(19)28/h8,11-12,20,27H,6-7,9-10,13-15H2,1-5H3/b16-8-,17-12-,18-11-/t20-/m1/s1", "m_plus_h": 411.253, "m_plus_na": 433.2349, "origin_reference": { "doi": "10.1351/pac198153061233", "pmid": null, "authors": "Steglich, W.", "title": "Biologically active compounds from higher fungi", "journal": "Pure and Applied Chemistry", "year": 1981, "volume": "53", "issue": "6", "pages": "1233-1240" }, "origin_organism": { "id": 40, "type": "Fungus", "genus": "Trichia", "species": "floriformis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 14708, "npaid": "NPA014708", "original_name": "Alliacolide", "mol_formula": "C15H22O4", "mol_weight": 266.337, "exact_mass": 266.1518, "inchikey": "LLRILYDNXOIONB-PMKYJIPRSA-N", "smiles": "C[C@@H]1CC[C@@]2([C@@H](C(=O)O[C@]23[C@]14[C@H](O4)C(C3)(C)C)C)O", "cluster_id": 5599, "node_id": 3904, "synonyms": [ "Alliacolide" ], "inchi": "InChI=1S/C15H22O4/c1-8-5-6-13(17)9(2)10(16)18-14(13)7-12(3,4)11-15(8,14)19-11/h8-9,11,17H,5-7H2,1-4H3/t8-,9-,11-,13+,14+,15-/m1/s1", "m_plus_h": 267.1591, "m_plus_na": 289.141, "origin_reference": { "doi": "10.1351/pac198153061233", "pmid": null, "authors": "Steglich, W.", "title": "Biologically active compounds from higher fungi", "journal": "Pure and Applied Chemistry", "year": 1981, "volume": "53", "issue": "6", "pages": "1233-1240" }, "origin_organism": { "id": 40, "type": "Fungus", "genus": "Trichia", "species": "floriformis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 16285, "npaid": "NPA016285", "original_name": "Trichione", "mol_formula": "C17H14O8", "mol_weight": 346.291, "exact_mass": 346.0689, "inchikey": "FWFSNBVRUVMUSO-DAFODLJHSA-N", "smiles": "C1=CC2=C(C(=C1)O)C(=C(C(=O)C2=O)/C=C/CCOC(=O)CC(=O)O)O", "cluster_id": 5990, "node_id": 4140, "synonyms": [ "Trichione" ], "inchi": "InChI=1S/C17H14O8/c18-11-6-3-5-9-14(11)15(22)10(17(24)16(9)23)4-1-2-7-25-13(21)8-12(19)20/h1,3-6,18,22H,2,7-8H2,(H,19,20)/b4-1+", "m_plus_h": 347.0762, "m_plus_na": 369.0581, "origin_reference": { "doi": "10.1351/pac198153061233", "pmid": null, "authors": "Steglich, W.", "title": "Biologically active compounds from higher fungi", "journal": "Pure and Applied Chemistry", "year": 1981, "volume": "53", "issue": "6", "pages": "1233-1240" }, "origin_organism": { "id": 40, "type": "Fungus", "genus": "Trichia", "species": "floriformis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 16592, "npaid": "NPA016592", "original_name": "Striatin A", "mol_formula": "C27H36O7", "mol_weight": 472.578, "exact_mass": 472.2461, "inchikey": "RSLKKOGGERUDQS-YCPCRVJHSA-N", "smiles": "CC(C)C1=C2[C@H]3CC=C([C@@H]4[C@@H]([C@@]3(CC[C@]2(CC1)C)C)O[C@H]5[C@@]4(C(=O)[C@@H](CO5)OC(=O)C)O)C=O", "cluster_id": 2401, "node_id": 1875, "synonyms": [ "Striatin A" ], "inchi": "InChI=1S/C27H36O7/c1-14(2)17-8-9-25(4)10-11-26(5)18(21(17)25)7-6-16(12-28)20-23(26)34-24-27(20,31)22(30)19(13-32-24)33-15(3)29/h6,12,14,18-20,23-24,31H,7-11,13H2,1-5H3/t18-,19-,20-,23+,24+,25-,26-,27-/m1/s1", "m_plus_h": 473.2534, "m_plus_na": 495.2353, "origin_reference": { "doi": "10.1039/c39780000665", "pmid": null, "authors": "Hecht, H.J.; Hofle, G.; Steglich, W.; Anke, T.; Oberwinkler, F.", "title": "Striatin A, B, and C: novel diterpenoid antibiotics from Cyathus striatus; X-ray crystal structure of striatin A", "journal": "Journal of the Chemical Society, Chemical Communications", "year": 1978, "volume": null, "issue": "15", "pages": "665-666" }, "origin_organism": { "id": 40, "type": "Fungus", "genus": "Trichia", "species": "floriformis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19060, "npaid": "NPA019060", "original_name": "Homotrichione", "mol_formula": "C19H18O8", "mol_weight": 374.345, "exact_mass": 374.1002, "inchikey": "CWZRKOWMWFFYSO-ZZXKWVIFSA-N", "smiles": "C1=CC2=C(C(=C1)O)C(=C(C(=O)C2=O)/C=C/CCCCOC(=O)CC(=O)O)O", "cluster_id": 5990, "node_id": 4140, "synonyms": [ "Homotrichione" ], "inchi": "InChI=1S/C19H18O8/c20-13-8-5-7-11-16(13)17(24)12(19(26)18(11)25)6-3-1-2-4-9-27-15(23)10-14(21)22/h3,5-8,20,24H,1-2,4,9-10H2,(H,21,22)/b6-3+", "m_plus_h": 375.1075, "m_plus_na": 397.0894, "origin_reference": { "doi": "10.1351/pac198153061233", "pmid": null, "authors": "Steglich, W.", "title": "Biologically active compounds from higher fungi", "journal": "Pure and Applied Chemistry", "year": 1981, "volume": "53", "issue": "6", "pages": "1233-1240" }, "origin_organism": { "id": 40, "type": "Fungus", "genus": "Trichia", "species": "floriformis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19884, "npaid": "NPA019884", "original_name": "Kehokorin C", "mol_formula": "C20H16O5", "mol_weight": 336.343, "exact_mass": 336.0998, "inchikey": "LCMGLFUBCRALOH-UHFFFAOYSA-N", "smiles": "COC1=CC=C(C=C1)C2=C(C=C3C4=C(C=CC(=C4)O)OC3=C2OC)O", "cluster_id": 1875, "node_id": 1501, "synonyms": [ "Kehokorin C" ], "inchi": "InChI=1S/C20H16O5/c1-23-13-6-3-11(4-7-13)18-16(22)10-15-14-9-12(21)5-8-17(14)25-19(15)20(18)24-2/h3-10,21-22H,1-2H3", "m_plus_h": 337.1071, "m_plus_na": 359.089, "origin_reference": { "doi": "10.1016/j.tetlet.2006.01.012", "pmid": null, "authors": "Kaniwa, Kouken; Ohtsuki, Takashi; Yamamoto, Yukinori; Ishibashi, Masami", "title": "Kehokorins A-C, novel cytotoxic dibenzofurans isolated from the myxomycete Trichia favoginea var. persimilis", "journal": "Tetrahedron Letters", "year": 2006, "volume": "47", "issue": "10", "pages": "1505-1508" }, "origin_organism": { "id": 1953, "type": "Fungus", "genus": "Trichia", "species": "favoginea var. persimilis", "taxon": { "id": 1746, "name": "Trichia", "rank": "genus", "taxon_db": "mycobank", "external_id": "12246", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1744, "name": "Trichiaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81590" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 15, "npaid": "NPA000015", "original_name": "Lycogarubin A", "mol_formula": "C24H19N3O6", "mol_weight": 445.431, "exact_mass": 445.1274, "inchikey": "GTHIVVRMSDWBAX-UHFFFAOYSA-N", "smiles": "COC(=O)C1=C(C(=C(N1)C(=O)OC)C2=CNC3=C2C=C(C=C3)O)C4=CNC5=C4C=C(C=C5)O", "cluster_id": 15, "node_id": 15, "synonyms": [ "Lycogarubin A" ], "inchi": "InChI=1S/C24H19N3O6/c1-32-23(30)21-19(15-9-25-17-5-3-11(28)7-13(15)17)20(22(27-21)24(31)33-2)16-10-26-18-6-4-12(29)8-14(16)18/h3-10,25-29H,1-2H3", "m_plus_h": 446.1347, "m_plus_na": 468.1166, "origin_reference": { "doi": "10.1016/s0040-4039(00)77170-x", "pmid": null, "authors": "Hasmimoto; Yasuda; Akazawa; Takaoka; Tori; Asakawa", "title": "Three novel dimethyl pyrroledicarboxylate, lycogarubins A-C, from the myxomycetes Lycogala epidendrum", "journal": "Tetrahedron Letters", "year": 1994, "volume": "35", "issue": "16", "pages": "2559-2560" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 1089, "npaid": "NPA001089", "original_name": "Lycogaride D", "mol_formula": "C57H68O9", "mol_weight": 897.162, "exact_mass": 896.4863, "inchikey": "DXOVAENMTDGRER-DWIHHQIHSA-N", "smiles": "CC/C=C\\C=C/CCC[C@@H]1O[C@H]1C#CC#CCCC(=O)OCC(OC(=O)CCC#CC#C[C@@H]2O[C@H]2CCC/C=C\\C=C/CC)COC(=O)CCC#CC#C[C@@H]3O[C@H]3CCC/C=C\\C=C/CC", "cluster_id": 792, "node_id": 673, "synonyms": [ "Lycogaride D" ], "inchi": "InChI=1S/C57H68O9/c1-4-7-10-13-16-19-28-37-49-52(64-49)40-31-22-25-34-43-55(58)61-46-48(63-57(60)45-36-27-24-33-42-54-51(66-54)39-30-21-18-15-12-9-6-3)47-62-56(59)44-35-26-23-32-41-53-50(65-53)38-29-20-17-14-11-8-5-2/h7-18,48-54H,4-6,19-21,28-30,34-39,43-47H2,1-3H3/b10-7-,11-8-,12-9-,16-13-,17-14-,18-15-/t49-,50-,51-,52-,53-,54-/m0/s1", "m_plus_h": 897.4936, "m_plus_na": 919.4755, "origin_reference": { "doi": "10.1016/0031-9422(95)00664-8", "pmid": null, "authors": "Buchanan, Malcolm S.; Hashimoto, Toshihiro; Asakawa, Yoshinori", "title": "Acylglycerols from the slime mould, Lycogala epidendrum", "journal": "Phytochemistry", "year": 1996, "volume": "41", "issue": "3", "pages": "791-794" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 5773, "npaid": "NPA005773", "original_name": "Not named", "mol_formula": "C23H17N3O4", "mol_weight": 399.406, "exact_mass": 399.1219, "inchikey": "CUKHLCPFGKVMHR-UHFFFAOYSA-N", "smiles": "COC(=O)C1=C(C(=C(N1)C(=O)O)C2=CNC3=CC=CC=C32)C4=CNC5=CC=CC=C54", "cluster_id": 15, "node_id": 15, "synonyms": [ "Not named" ], "inchi": "InChI=1S/C23H17N3O4/c1-30-23(29)21-19(15-11-25-17-9-5-3-7-13(15)17)18(20(26-21)22(27)28)14-10-24-16-8-4-2-6-12(14)16/h2-11,24-26H,1H3,(H,27,28)", "m_plus_h": 400.1292, "m_plus_na": 422.1111, "origin_reference": { "doi": "10.1248/cpb.53.594", "pmid": 15863941, "authors": "Kamata, Kazuaki; Kiyota, Makiko; Naoe, Ayano; Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Yamori, Takao; Ishibashi, Masami", "title": "New bisindole alkaloids isolated from myxomycetes arcyria cinerea and lycogala epidendrum", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2005, "volume": "53", "issue": "5", "pages": "594-597" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 5921, "npaid": "NPA005921", "original_name": "(Z)-methyl-2-hydroxy-3-(1H-indol-3-yl)acrylate", "mol_formula": "C12H11NO3", "mol_weight": 217.224, "exact_mass": 217.0739, "inchikey": "LOCJAKWRQPUYTL-WDZFZDKYSA-N", "smiles": "COC(=O)/C(=C/C1=CNC2=CC=CC=C21)/O", "cluster_id": 3026, "node_id": 2294, "synonyms": [ "(Z)-methyl-2-hydroxy-3-(1H-indol-3-yl)acrylate" ], "inchi": "InChI=1S/C12H11NO3/c1-16-12(15)11(14)6-8-7-13-10-5-3-2-4-9(8)10/h2-7,13-14H,1H3/b11-6-", "m_plus_h": 218.0812, "m_plus_na": 240.0631, "origin_reference": { "doi": "10.1016/0040-4039(94)88320-3", "pmid": null, "authors": "Frode, Rita; Hinze, Claudia; Josten, Ingrid; Schmidt, Bettina; Steffan, Bert; Steglich, Wolfgang", "title": "Isolation and synthesis of 3,4-bis(indol-3-yl)pyrrole-2,5-dicarboxylic acid derivatives from the slime mould Lycogala epidendrum", "journal": "Tetrahedron Letters", "year": 1994, "volume": "35", "issue": "11", "pages": "1689-1690" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 7222, "npaid": "NPA007222", "original_name": "Lycogalinoside A", "mol_formula": "C38H60O11", "mol_weight": 692.887, "exact_mass": 692.4136, "inchikey": "NNIKSBGUOULFOA-LUFVKTRQSA-N", "smiles": "CCC[C@H](C)[C@H]([C@H](C)C(=O)[C@H](C)/C=C(\\C)/C=C/C[C@H](C)/C=C/[C@H]1CC=CC(=O)O1)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](O2)C)O[C@H]3C[C@@H]([C@@H]([C@@H](O3)C)O)O)O)O", "cluster_id": 3461, "node_id": 2588, "synonyms": [ "Lycogalinoside A" ], "inchi": "InChI=1S/C38H60O11/c1-9-12-23(4)36(49-38-35(44)34(43)37(27(8)46-38)48-31-20-29(39)33(42)26(7)45-31)25(6)32(41)24(5)19-22(3)14-10-13-21(2)17-18-28-15-11-16-30(40)47-28/h10-11,14,16-19,21,23-29,31,33-39,42-44H,9,12-13,15,20H2,1-8H3/b14-10+,18-17+,22-19+/t21-,23-,24+,25+,26-,27+,28+,29-,31-,33+,34-,35+,36+,37-,38-/m0/s1", "m_plus_h": 693.4209, "m_plus_na": 715.4028, "origin_reference": { "doi": "10.1016/s0031-9422(03)00214-0", "pmid": null, "authors": "Rezanka, Tomas; Dvorakova, Radmila", "title": "Polypropionate lactones of deoxysugars glycosides from slime mold Lycogala epidendrum", "journal": "Phytochemistry", "year": 2003, "volume": "63", "issue": "8", "pages": "945-952" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 10416, "npaid": "NPA010416", "original_name": "Not named", "mol_formula": "C23H17N3O5", "mol_weight": 415.405, "exact_mass": 415.1168, "inchikey": "CWTDTJMIXBLAHI-UHFFFAOYSA-N", "smiles": "COC(=O)C1=C(C(=C(N1)C(=O)O)C2=CNC3=C2C=C(C=C3)O)C4=CNC5=CC=CC=C54", "cluster_id": 15, "node_id": 15, "synonyms": [ "Not named" ], "inchi": "InChI=1S/C23H17N3O5/c1-31-23(30)21-19(14-9-24-16-5-3-2-4-12(14)16)18(20(26-21)22(28)29)15-10-25-17-7-6-11(27)8-13(15)17/h2-10,24-27H,1H3,(H,28,29)", "m_plus_h": 416.1241, "m_plus_na": 438.106, "origin_reference": { "doi": "10.1248/cpb.53.594", "pmid": 15863941, "authors": "Kamata, Kazuaki; Kiyota, Makiko; Naoe, Ayano; Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Yamori, Takao; Ishibashi, Masami", "title": "New bisindole alkaloids isolated from myxomycetes arcyria cinerea and lycogala epidendrum", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2005, "volume": "53", "issue": "5", "pages": "594-597" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 12411, "npaid": "NPA012411", "original_name": "Lycogarubin B", "mol_formula": "C24H19N3O5", "mol_weight": 429.432, "exact_mass": 429.1325, "inchikey": "SZBJDRXMLSSPCV-UHFFFAOYSA-N", "smiles": "COC(=O)C1=C(C(=C(N1)C(=O)OC)C2=CNC3=CC=CC=C32)C4=CNC5=C4C=C(C=C5)O", "cluster_id": 15, "node_id": 15, "synonyms": [ "Lycogarubin B" ], "inchi": "InChI=1S/C24H19N3O5/c1-31-23(29)21-19(15-10-25-17-6-4-3-5-13(15)17)20(22(27-21)24(30)32-2)16-11-26-18-8-7-12(28)9-14(16)18/h3-11,25-28H,1-2H3", "m_plus_h": 430.1398, "m_plus_na": 452.1217, "origin_reference": { "doi": "10.1016/s0040-4039(00)77170-x", "pmid": null, "authors": "Hasmimoto; Yasuda; Akazawa; Takaoka; Tori; Asakawa", "title": "Three novel dimethyl pyrroledicarboxylate, lycogarubins A-C, from the myxomycetes Lycogala epidendrum", "journal": "Tetrahedron Letters", "year": 1994, "volume": "35", "issue": "16", "pages": "2559-2560" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 12451, "npaid": "NPA012451", "original_name": "Lycogaride F", "mol_formula": "C39H48O7", "mol_weight": 628.806, "exact_mass": 628.34, "inchikey": "WANRVFGAADTRAB-FRPTVKRASA-N", "smiles": "CC/C=C\\C=C/CCC[C@H]1[C@@H](O1)C#CC#CCCC(=O)OCC(CO)OC(=O)CCC#CC#C[C@H]2[C@@H](O2)CCC/C=C\\C=C/CC", "cluster_id": 792, "node_id": 673, "synonyms": [ "Lycogaride F" ], "inchi": "InChI=1S/C39H48O7/c1-3-5-7-9-11-13-19-25-34-36(45-34)27-21-15-17-23-29-38(41)43-32-33(31-40)44-39(42)30-24-18-16-22-28-37-35(46-37)26-20-14-12-10-8-6-4-2/h5-12,33-37,40H,3-4,13-14,19-20,23-26,29-32H2,1-2H3/b7-5-,8-6-,11-9-,12-10-/t33?,34-,35-,36-,37-/m0/s1", "m_plus_h": 629.3473, "m_plus_na": 651.3292, "origin_reference": { "doi": "10.1016/0031-9422(95)00664-8", "pmid": null, "authors": "Buchanan, Malcolm S.; Hashimoto, Toshihiro; Asakawa, Yoshinori", "title": "Acylglycerols from the slime mould, Lycogala epidendrum", "journal": "Phytochemistry", "year": 1996, "volume": "41", "issue": "3", "pages": "791-794" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 16171, "npaid": "NPA016171", "original_name": "6-hydroxystaurosporinone", "mol_formula": "C20H13N3O2", "mol_weight": 327.343, "exact_mass": 327.1008, "inchikey": "GMSWOSYARKHCHX-UHFFFAOYSA-N", "smiles": "C1C2=C3C4=CC=CC=C4NC3=C5C(=C2C(=O)N1)C6=C(N5)C=C(C=C6)O", "cluster_id": 2448, "node_id": 10, "synonyms": [ "6-hydroxystaurosporinone" ], "inchi": "InChI=1S/C20H13N3O2/c24-9-5-6-11-14(7-9)23-19-16(11)17-12(8-21-20(17)25)15-10-3-1-2-4-13(10)22-18(15)19/h1-7,22-24H,8H2,(H,21,25)", "m_plus_h": 328.1081, "m_plus_na": 350.09, "origin_reference": { "doi": "10.1016/j.bmcl.2005.03.103", "pmid": 15911254, "authors": "Hosoya, Takahiro; Yamamoto, Yukinori; Uehara, Yoshimasa; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "New cytotoxic bisindole alkaloids with protein tyrosine kinase inhibitory activity from a myxomycete Lycogala epidendrum", "journal": "Bioorganic and Medicinal Chemistry Letters", "year": 2005, "volume": "15", "issue": "11", "pages": "2776-2780" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 16409, "npaid": "NPA016409", "original_name": "Lycogarubin C", "mol_formula": "C24H19N3O4", "mol_weight": 413.433, "exact_mass": 413.1376, "inchikey": "DKTWEIRHZXHFQB-UHFFFAOYSA-N", "smiles": "COC(=O)C1=C(C(=C(N1)C(=O)OC)C2=CNC3=CC=CC=C32)C4=CNC5=CC=CC=C54", "cluster_id": 15, "node_id": 15, "synonyms": [ "Lycogarubin C" ], "inchi": "InChI=1S/C24H19N3O4/c1-30-23(28)21-19(15-11-25-17-9-5-3-7-13(15)17)20(22(27-21)24(29)31-2)16-12-26-18-10-6-4-8-14(16)18/h3-12,25-27H,1-2H3", "m_plus_h": 414.1449, "m_plus_na": 436.1268, "origin_reference": { "doi": "10.1016/s0040-4039(00)77170-x", "pmid": null, "authors": "Hasmimoto; Yasuda; Akazawa; Takaoka; Tori; Asakawa", "title": "Three novel dimethyl pyrroledicarboxylate, lycogarubins A-C, from the myxomycetes Lycogala epidendrum", "journal": "Tetrahedron Letters", "year": 1994, "volume": "35", "issue": "16", "pages": "2559-2560" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [ "10.1021/ol100146b" ], "reassignments": [], "external_ids": [] }, { "id": 17473, "npaid": "NPA017473", "original_name": "Lycogaride G", "mol_formula": "C39H48O7", "mol_weight": 628.806, "exact_mass": 628.34, "inchikey": "WVKNISGQYHZRGL-GYNAOWENSA-N", "smiles": "CC/C=C\\C=C/CCC[C@@H]1O[C@H]1C#CC#CCCC(=O)OCC(O)COC(=O)CCC#CC#C[C@@H]2O[C@H]2CCC/C=C\\C=C/CC", "cluster_id": 792, "node_id": 673, "synonyms": [ "Lycogaride G" ], "inchi": "InChI=1S/C39H48O7/c1-3-5-7-9-11-13-19-25-34-36(45-34)27-21-15-17-23-29-38(41)43-31-33(40)32-44-39(42)30-24-18-16-22-28-37-35(46-37)26-20-14-12-10-8-6-4-2/h5-12,33-37,40H,3-4,13-14,19-20,23-26,29-32H2,1-2H3/b7-5-,8-6-,11-9-,12-10-/t34-,35-,36-,37-/m0/s1", "m_plus_h": 629.3473, "m_plus_na": 651.3292, "origin_reference": { "doi": "10.1016/0031-9422(95)00664-8", "pmid": null, "authors": "Buchanan, Malcolm S.; Hashimoto, Toshihiro; Asakawa, Yoshinori", "title": "Acylglycerols from the slime mould, Lycogala epidendrum", "journal": "Phytochemistry", "year": 1996, "volume": "41", "issue": "3", "pages": "791-794" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 17535, "npaid": "NPA017535", "original_name": "Lycogalinoside B", "mol_formula": "C38H60O11", "mol_weight": 692.887, "exact_mass": 692.4136, "inchikey": "NNIKSBGUOULFOA-IUKQMUBCSA-N", "smiles": "CCC[C@@H](C)[C@H]([C@H](C)C(=O)[C@H](C)/C=C(\\C)/C=C/C[C@H](C)/C=C/[C@H]1CC=CC(=O)O1)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)C)O[C@H]3C[C@H]([C@@H]([C@H](O3)C)O)O)O)O", "cluster_id": 3461, "node_id": 2588, "synonyms": [ "Lycogalinoside B" ], "inchi": "InChI=1S/C38H60O11/c1-9-12-23(4)36(49-38-35(44)34(43)37(27(8)46-38)48-31-20-29(39)33(42)26(7)45-31)25(6)32(41)24(5)19-22(3)14-10-13-21(2)17-18-28-15-11-16-30(40)47-28/h10-11,14,16-19,21,23-29,31,33-39,42-44H,9,12-13,15,20H2,1-8H3/b14-10+,18-17+,22-19+/t21-,23+,24+,25+,26+,27+,28+,29+,31-,33+,34+,35+,36+,37-,38-/m0/s1", "m_plus_h": 693.4209, "m_plus_na": 715.4028, "origin_reference": { "doi": "10.1016/s0031-9422(03)00214-0", "pmid": null, "authors": "Rezanka, Tomas; Dvorakova, Radmila", "title": "Polypropionate lactones of deoxysugars glycosides from slime mold Lycogala epidendrum", "journal": "Phytochemistry", "year": 2003, "volume": "63", "issue": "8", "pages": "945-952" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19590, "npaid": "NPA019590", "original_name": "Not named", "mol_formula": "C23H17N3O5", "mol_weight": 415.405, "exact_mass": 415.1168, "inchikey": "JENKNOSPMIZSJR-UHFFFAOYSA-N", "smiles": "COC(=O)C1=C(C(=C(N1)C(=O)O)C2=CNC3=CC=CC=C32)C4=CNC5=C4C=C(C=C5)O", "cluster_id": 15, "node_id": 15, "synonyms": [ "Not named" ], "inchi": "InChI=1S/C23H17N3O5/c1-31-23(30)21-19(15-10-25-17-7-6-11(27)8-13(15)17)18(20(26-21)22(28)29)14-9-24-16-5-3-2-4-12(14)16/h2-10,24-27H,1H3,(H,28,29)", "m_plus_h": 416.1241, "m_plus_na": 438.106, "origin_reference": { "doi": "10.1248/cpb.53.594", "pmid": 15863941, "authors": "Kamata, Kazuaki; Kiyota, Makiko; Naoe, Ayano; Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Yamori, Takao; Ishibashi, Masami", "title": "New bisindole alkaloids isolated from myxomycetes arcyria cinerea and lycogala epidendrum", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2005, "volume": "53", "issue": "5", "pages": "594-597" }, "origin_organism": { "id": 15, "type": "Fungus", "genus": "Lycogala", "species": "epidendrum", "taxon": { "id": 1759, "name": "Lycogala", "rank": "genus", "taxon_db": "mycobank", "external_id": "12137", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1756, "name": "Liceales", "rank": "order", "taxon_db": "mycobank", "external_id": "90435" }, { "id": 1757, "name": "Reticulariaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81582" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 3361, "npaid": "NPA003361", "original_name": "Not named", "mol_formula": "C16H16N2O4", "mol_weight": 300.314, "exact_mass": 300.111, "inchikey": "ILVPUOFERZHGNR-MQJVFOOVSA-N", "smiles": "C1C[C@H]2/C(=C/C(=O)CC(=O)O)/NC3=CC=CC=C3C(=O)N2C1", "cluster_id": 27, "node_id": 27, "synonyms": [ "Not named" ], "inchi": "InChI=1S/C16H16N2O4/c19-10(9-15(20)21)8-13-14-6-3-7-18(14)16(22)11-4-1-2-5-12(11)17-13/h1-2,4-5,8,14,17H,3,6-7,9H2,(H,20,21)/b13-8-/t14-/m0/s1", "m_plus_h": 301.1183, "m_plus_na": 323.1002, "origin_reference": { "doi": "10.1248/cpb.52.368", "pmid": 14993765, "authors": "Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Cycloanthranilylproline-derived constituents from a myxomycete Fuligo candida", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2004, "volume": "52", "issue": "3", "pages": "368-370" }, "origin_organism": { "id": 2066, "type": "Fungus", "genus": "Fuligo", "species": "candida", "taxon": { "id": 1754, "name": "Fuligo", "rank": "genus", "taxon_db": "mycobank", "external_id": "12091", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 3673, "npaid": "NPA003673", "original_name": "Fuligopyrone", "mol_formula": "C18H17NO5", "mol_weight": 327.336, "exact_mass": 327.1107, "inchikey": "WDDXZETYSGHOSC-ZPUQHVIOSA-N", "smiles": "C1=CC(=CC=C1/C=C/C=C/C(=O)NCCC2=CC(=CC(=O)O2)O)O", "cluster_id": 2129, "node_id": 1680, "synonyms": [ "Fuligopyrone" ], "inchi": "InChI=1S/C18H17NO5/c20-14-7-5-13(6-8-14)3-1-2-4-17(22)19-10-9-16-11-15(21)12-18(23)24-16/h1-8,11-12,20-21H,9-10H2,(H,19,22)/b3-1+,4-2+", "m_plus_h": 328.118, "m_plus_na": 350.0999, "origin_reference": { "doi": "10.1351/pac198961030281", "pmid": null, "authors": "Wolfgang Steglich", "title": "Slime moulds (Myxomycetes) as a source of new biologically active metabolites", "journal": "Pure and Applied Chemistry", "year": 1989, "volume": "61", "issue": "3", "pages": "281-288" }, "origin_organism": { "id": 2206, "type": "Fungus", "genus": "Fuligo", "species": "sp.", "taxon": { "id": 1754, "name": "Fuligo", "rank": "genus", "taxon_db": "mycobank", "external_id": "12091", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 7863, "npaid": "NPA007863", "original_name": "Not named", "mol_formula": "C24H21N3O2", "mol_weight": 383.451, "exact_mass": 383.1634, "inchikey": "NYQWWRQVZXCLIH-NLLZLTKUSA-N", "smiles": "C1C[C@H]2/C(=C/C(=O)/C=C/C3=CNC4=CC=CC=C43)/NC5=CC=CC=C5C(=O)N2C1", "cluster_id": 27, "node_id": 27, "synonyms": [ "Not named" ], "inchi": "InChI=1S/C24H21N3O2/c28-17(12-11-16-15-25-20-8-3-1-6-18(16)20)14-22-23-10-5-13-27(23)24(29)19-7-2-4-9-21(19)26-22/h1-4,6-9,11-12,14-15,23,25-26H,5,10,13H2/b12-11+,22-14-/t23-/m0/s1", "m_plus_h": 384.1707, "m_plus_na": 406.1526, "origin_reference": { "doi": "10.1248/cpb.52.368", "pmid": 14993765, "authors": "Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Cycloanthranilylproline-derived constituents from a myxomycete Fuligo candida", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2004, "volume": "52", "issue": "3", "pages": "368-370" }, "origin_organism": { "id": 2066, "type": "Fungus", "genus": "Fuligo", "species": "candida", "taxon": { "id": 1754, "name": "Fuligo", "rank": "genus", "taxon_db": "mycobank", "external_id": "12091", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 8214, "npaid": "NPA008214", "original_name": "Foligorubine A", "mol_formula": "C19H21NO5", "mol_weight": 343.379, "exact_mass": 343.142, "inchikey": "HVZNYPUTCXUQSO-BERGDQOTSA-N", "smiles": "C/C=C/C=C/C=C/C=C/C=C/C(=C1C(=O)[C@H](NC1=O)CCC(=O)O)O", "cluster_id": 3802, "node_id": 2811, "synonyms": [ "Foligorubine A" ], "inchi": "InChI=1S/C19H21NO5/c1-2-3-4-5-6-7-8-9-10-11-15(21)17-18(24)14(20-19(17)25)12-13-16(22)23/h2-11,14,21H,12-13H2,1H3,(H,20,25)(H,22,23)/b3-2+,5-4+,7-6+,9-8+,11-10+,17-15?/t14-/m1/s1", "m_plus_h": 344.1493, "m_plus_na": 366.1312, "origin_reference": { "doi": "10.1002/anie.198705861", "pmid": null, "authors": "Casser, Ingrid; Steffan, Bert; Steglich, Wolfgang", "title": "The chemistry of the plasmodial pigments of the slime mold Fuligo septica (Myxomycetes)", "journal": "Angewandte Chemie International Edition", "year": 1987, "volume": "26", "issue": "6", "pages": "586-587" }, "origin_organism": { "id": 2206, "type": "Fungus", "genus": "Fuligo", "species": "sp.", "taxon": { "id": 1754, "name": "Fuligo", "rank": "genus", "taxon_db": "mycobank", "external_id": "12091", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 11205, "npaid": "NPA011205", "original_name": "Not named", "mol_formula": "C15H16N2O2", "mol_weight": 256.305, "exact_mass": 256.1212, "inchikey": "QIABJYAEDCYFEV-XXYUJHKVSA-N", "smiles": "CC(=O)/C=C\\1/[C@@H]2CCCN2C(=O)C3=CC=CC=C3N1", "cluster_id": 27, "node_id": 27, "synonyms": [ "Not named" ], "inchi": "InChI=1S/C15H16N2O2/c1-10(18)9-13-14-7-4-8-17(14)15(19)11-5-2-3-6-12(11)16-13/h2-3,5-6,9,14,16H,4,7-8H2,1H3/b13-9-/t14-/m0/s1", "m_plus_h": 257.1285, "m_plus_na": 279.1104, "origin_reference": { "doi": "10.1248/cpb.52.368", "pmid": 14993765, "authors": "Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Cycloanthranilylproline-derived constituents from a myxomycete Fuligo candida", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2004, "volume": "52", "issue": "3", "pages": "368-370" }, "origin_organism": { "id": 2066, "type": "Fungus", "genus": "Fuligo", "species": "candida", "taxon": { "id": 1754, "name": "Fuligo", "rank": "genus", "taxon_db": "mycobank", "external_id": "12091", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 13024, "npaid": "NPA013024", "original_name": "Fulicineroside", "mol_formula": "C50H72O15", "mol_weight": 913.111, "exact_mass": 912.4871, "inchikey": "TZYNOEQOBDAWPQ-QOQJHRHESA-N", "smiles": "CC[C@@H](C)[C@H]([C@H]1[C@@H](O1)C[C@H](C)/C=C/C=C(\\C)/C2=CC3=C(C(=C2)O)C4=C(O3)C=CC(=C4O)CC[C@@H](C)COC5C(C(C(C(O5)C)OC6CCC(C(O6)C)OC7CC(C(C(O7)C)O)O)O)O)O", "cluster_id": 5180, "node_id": 3649, "synonyms": [ "Fulicineroside" ], "inchi": "InChI=1S/C50H72O15/c1-9-26(4)43(53)49-38(64-49)19-24(2)11-10-12-27(5)32-20-33(51)41-37(21-32)62-36-16-15-31(45(55)42(36)41)14-13-25(3)23-58-50-47(57)46(56)48(30(8)61-50)65-39-18-17-35(28(6)59-39)63-40-22-34(52)44(54)29(7)60-40/h10-12,15-16,20-21,24-26,28-30,34-35,38-40,43-44,46-57H,9,13-14,17-19,22-23H2,1-8H3/b11-10+,27-12+/t24-,25-,26-,28?,29?,30?,34?,35?,38+,39?,40?,43-,44?,46?,47?,48?,49-,50?/m1/s1", "m_plus_h": 913.4944, "m_plus_na": 935.4763, "origin_reference": { "doi": "10.1002/ejoc.200400870", "pmid": null, "authors": "\u0158ezanka, Tom\u00e1\u0161; Hanu\u0161, Lum\u00edr O.; Kujan, Petr; Dembitsky, Valery M.", "title": "Fulicineroside, an Unusual Glycosidic Dibenzofuran Metabolite from the Slime Mold Fuligo cinerea (Schwein.) Morgan", "journal": "European Journal of Organic Chemistry", "year": 2005, "volume": "2005", "issue": "13", "pages": "2708-2714" }, "origin_organism": { "id": 4569, "type": "Fungus", "genus": "Fuligo", "species": "cinerea", "taxon": { "id": 1754, "name": "Fuligo", "rank": "genus", "taxon_db": "mycobank", "external_id": "12091", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [ "10.1002/chem.201204545" ], "reassignments": [], "external_ids": [] }, { "id": 13240, "npaid": "NPA013240", "original_name": "Cycloanthranilylproline", "mol_formula": "C12H12N2O2", "mol_weight": 216.24, "exact_mass": 216.0899, "inchikey": "MXBNEEHQIDLPLQ-UHFFFAOYSA-N", "smiles": "C1CC2C(=O)NC3=CC=CC=C3C(=O)N2C1", "cluster_id": 27, "node_id": 27, "synonyms": [ "Cycloanthranilylproline" ], "inchi": "InChI=1S/C12H12N2O2/c15-11-10-6-3-7-14(10)12(16)8-4-1-2-5-9(8)13-11/h1-2,4-5,10H,3,6-7H2,(H,13,15)", "m_plus_h": 217.0972, "m_plus_na": 239.0791, "origin_reference": { "doi": "10.1248/cpb.52.368", "pmid": 14993765, "authors": "Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Cycloanthranilylproline-derived constituents from a myxomycete Fuligo candida", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2004, "volume": "52", "issue": "3", "pages": "368-370" }, "origin_organism": { "id": 2066, "type": "Fungus", "genus": "Fuligo", "species": "candida", "taxon": { "id": 1754, "name": "Fuligo", "rank": "genus", "taxon_db": "mycobank", "external_id": "12091", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [ { "external_db_name": "gnps", "external_db_code": "CCMSLIB00000078794%3%\"NCGC00160211-01!2,3-Dihydro-1H-pyrrolo[2,1-c][1,4]benzodiazepine-5,11(10H,11aH)-dione\"" } ] }, { "id": 17342, "npaid": "NPA017342", "original_name": "N\u03b1-(4-aminobenzoyl)tryptophan", "mol_formula": "C18H17N3O3", "mol_weight": 323.352, "exact_mass": 323.127, "inchikey": "KQHBFHIQPPASRA-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)C3=CC=C(C=C3)N", "cluster_id": 259, "node_id": 235, "synonyms": [ "N\u03b1-(4-aminobenzoyl)tryptophan" ], "inchi": "InChI=1S/C18H17N3O3/c19-13-7-5-11(6-8-13)17(22)21-16(18(23)24)9-12-10-20-15-4-2-1-3-14(12)15/h1-8,10,16,20H,9,19H2,(H,21,22)(H,23,24)", "m_plus_h": 324.1343, "m_plus_na": 346.1162, "origin_reference": { "doi": "10.1248/cpb.52.368", "pmid": 14993765, "authors": "Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Cycloanthranilylproline-derived constituents from a myxomycete Fuligo candida", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2004, "volume": "52", "issue": "3", "pages": "368-370" }, "origin_organism": { "id": 2066, "type": "Fungus", "genus": "Fuligo", "species": "candida", "taxon": { "id": 1754, "name": "Fuligo", "rank": "genus", "taxon_db": "mycobank", "external_id": "12091", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 18116, "npaid": "NPA018116", "original_name": "Fuligoic acid", "mol_formula": "C15H15ClO5", "mol_weight": 310.733, "exact_mass": 310.0608, "inchikey": "MNZFRTMXWSABEV-FXCHFOLMSA-N", "smiles": "COC1=CC(=O)O[C@@H](C1)/C=C/C=C/C=C/C=C(/C(=O)O)\\Cl", "cluster_id": 6423, "node_id": 4392, "synonyms": [ "Fuligoic acid" ], "inchi": "InChI=1S/C15H15ClO5/c1-20-12-9-11(21-14(17)10-12)7-5-3-2-4-6-8-13(16)15(18)19/h2-8,10-11H,9H2,1H3,(H,18,19)/b3-2+,6-4+,7-5+,13-8-/t11-/m1/s1", "m_plus_h": 311.0681, "m_plus_na": 333.05, "origin_reference": { "doi": "10.1016/j.tetlet.2009.01.122", "pmid": null, "authors": "Shintani, Akinori; Ohtsuki, Takashi; Yamamoto, Yukinori; Hakamatsuka, Takashi; Kawahara, Nobuo; Goda, Yukihiro; Ishibashi, Masami", "title": "Fuligoic acid, a new yellow pigment with a chlorinated polyene-pyrone acid structure isolated from the myxomycete Fuligo septica f. flava", "journal": "Tetrahedron Letters", "year": 2009, "volume": "50", "issue": "26", "pages": "3189-3190" }, "origin_organism": { "id": 5364, "type": "Fungus", "genus": "Fuligo", "species": "septica f. flava", "taxon": { "id": 1754, "name": "Fuligo", "rank": "genus", "taxon_db": "mycobank", "external_id": "12091", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1750, "name": "Physarales", "rank": "order", "taxon_db": "mycobank", "external_id": "90440" }, { "id": 1753, "name": "Physaraceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81574" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 1450, "npaid": "NPA001450", "original_name": "Arcyriarubin B 6-O-sulfate", "mol_formula": "C20H13N3O6S", "mol_weight": 423.406, "exact_mass": 423.0525, "inchikey": "NGBRFUYDUQHTFT-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C(=CN2)C3=C(C(=O)NC3=O)C4=CNC5=C4C=CC(=C5)OS(=O)(=O)O", "cluster_id": 1010, "node_id": 10, "synonyms": [ "Arcyriarubin B 6-O-sulfate" ], "inchi": "InChI=1S/C20H13N3O6S/c24-19-17(13-8-21-15-4-2-1-3-11(13)15)18(20(25)23-19)14-9-22-16-7-10(5-6-12(14)16)29-30(26,27)28/h1-9,21-22H,(H,23,24,25)(H,26,27,28)", "m_plus_h": 424.0598, "m_plus_na": 446.0417, "origin_reference": { "doi": "10.1021/np060269h", "pmid": 16933891, "authors": "Kamata, Kazuaki; Suetsugu, Tomoko; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Bisindole alkaloids from myxomycetes Arcyria denudata and Arcyria obvelata", "journal": "Journal of Natural Products", "year": 2006, "volume": "69", "issue": "8", "pages": "1252-1254" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 2985, "npaid": "NPA002985", "original_name": "Dihydroarcyriarubin C", "mol_formula": "C20H15N3O4", "mol_weight": 361.357, "exact_mass": 361.1063, "inchikey": "MDOQJLLAKJRIGD-UHFFFAOYSA-N", "smiles": "C1=CC2=C(C=C1O)NC=C2C3C(C(=O)NC3=O)C4=CNC5=C4C=CC(=C5)O", "cluster_id": 1807, "node_id": 1452, "synonyms": [ "Dihydroarcyriarubin C" ], "inchi": "InChI=1S/C20H15N3O4/c24-9-1-3-11-13(7-21-15(11)5-9)17-18(20(27)23-19(17)26)14-8-22-16-6-10(25)2-4-12(14)16/h1-8,17-18,21-22,24-25H,(H,23,26,27)", "m_plus_h": 362.1136, "m_plus_na": 384.0955, "origin_reference": { "doi": "10.1016/s0960-894x(03)00592-4", "pmid": 14611848, "authors": "Nakatani, Satomi; Naoe, Ayano; Yamamoto, Yukinori; Yamauchi, Tomohiro; Yamaguchi, Naoto; Ishibashi, Masami", "title": "Isolation of bisindole alkaloids that inhibit the cell cycle from Myxomycetes Arcyria ferruginea and Tubifera casparyi", "journal": "Bioorganic and Medicinal Chemistry Letters", "year": 2003, "volume": "13", "issue": "17", "pages": "2879-2881" }, "origin_organism": { "id": 1893, "type": "Fungus", "genus": "Arcyria", "species": "ferruginea", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 4418, "npaid": "NPA004418", "original_name": "Arcyriaflavin C", "mol_formula": "C20H11N3O4", "mol_weight": 357.325, "exact_mass": 357.075, "inchikey": "COUUDSNRXUXNDW-UHFFFAOYSA-N", "smiles": "C1=CC2=C(C=C1O)NC3=C4C(=C5C(=C23)C(=O)NC5=O)C6=C(N4)C=C(C=C6)O", "cluster_id": 2448, "node_id": 10, "synonyms": [ "Arcyriaflavin C" ], "inchi": "InChI=1S/C20H11N3O4/c24-7-1-3-9-11(5-7)21-17-13(9)15-16(20(27)23-19(15)26)14-10-4-2-8(25)6-12(10)22-18(14)17/h1-6,21-22,24-25H,(H,23,26,27)", "m_plus_h": 358.0823, "m_plus_na": 380.0642, "origin_reference": { "doi": "10.1002/ange.19800920607", "pmid": null, "authors": "Steglich, Wolfgang; Steffan, Bert; Kopanski, Lothar; Eckhardt, Gert", "title": "Indolfarbstoffe aus Fruchtk\u00f6rpern des SchleimpilzesArcyria denudata (Indole dyes from fruiting bodies of the slime mold Arcyria denudata)", "journal": "Angewandte Chemie", "year": 1980, "volume": "92", "issue": "6", "pages": "463-464" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 9249, "npaid": "NPA009249", "original_name": "Arcyriarubin A", "mol_formula": "C20H13N3O2", "mol_weight": 327.343, "exact_mass": 327.1008, "inchikey": "DQYBRTASHMYDJG-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C(=CN2)C3=C(C(=O)NC3=O)C4=CNC5=CC=CC=C54", "cluster_id": 1010, "node_id": 10, "synonyms": [ "Arcyriarubin A" ], "inchi": "InChI=1S/C20H13N3O2/c24-19-17(13-9-21-15-7-3-1-5-11(13)15)18(20(25)23-19)14-10-22-16-8-4-2-6-12(14)16/h1-10,21-22H,(H,23,24,25)", "m_plus_h": 328.1081, "m_plus_na": 350.09, "origin_reference": { "doi": "10.1002/ange.19800920607", "pmid": null, "authors": "Steglich, Wolfgang; Steffan, Bert; Kopanski, Lothar; Eckhardt, Gert", "title": "Indolfarbstoffe aus Fruchtk\u00f6rpern des SchleimpilzesArcyria denudata (Indole dyes from fruiting bodies of the slime mold Arcyria denudata)", "journal": "Angewandte Chemie", "year": 1980, "volume": "92", "issue": "6", "pages": "463-464" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 10292, "npaid": "NPA010292", "original_name": "Arcyroxocin B", "mol_formula": "C20H13N3O4", "mol_weight": 359.341, "exact_mass": 359.0906, "inchikey": "VLBHCPDDRYCSDJ-UHFFFAOYSA-N", "smiles": "C1=CC2=C3C(=C1)OC4=C(C5C(C3=CN2)C(=O)NC5=O)C6=C(N4)C=C(C=C6)O", "cluster_id": 4441, "node_id": 10, "synonyms": [ "Arcyroxocin B" ], "inchi": "InChI=1S/C20H13N3O4/c24-8-4-5-9-12(6-8)22-20-16(9)17-15(18(25)23-19(17)26)10-7-21-11-2-1-3-13(27-20)14(10)11/h1-7,15,17,21-22,24H,(H,23,25,26)", "m_plus_h": 360.0979, "m_plus_na": 382.0798, "origin_reference": { "doi": "10.1021/np060269h", "pmid": 16933891, "authors": "Kamata, Kazuaki; Suetsugu, Tomoko; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Bisindole alkaloids from myxomycetes Arcyria denudata and Arcyria obvelata", "journal": "Journal of Natural Products", "year": 2006, "volume": "69", "issue": "8", "pages": "1252-1254" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 11373, "npaid": "NPA011373", "original_name": "Cinereapyrrole A", "mol_formula": "C22H17N3O4", "mol_weight": 387.395, "exact_mass": 387.1219, "inchikey": "BNSOXMYZQBRSHQ-UHFFFAOYSA-N", "smiles": "COC(=O)C1=C(C(=CN1)C2=CNC3=C2C=C(C=C3)O)C4=CNC5=C4C=C(C=C5)O", "cluster_id": 15, "node_id": 15, "synonyms": [ "Cinereapyrrole A" ], "inchi": "InChI=1S/C22H17N3O4/c1-29-22(28)21-20(16-9-24-19-5-3-12(27)7-14(16)19)17(10-25-21)15-8-23-18-4-2-11(26)6-13(15)18/h2-10,23-27H,1H3", "m_plus_h": 388.1292, "m_plus_na": 410.1111, "origin_reference": { "doi": "10.1248/cpb.53.594", "pmid": 15863941, "authors": "Kamata, Kazuaki; Kiyota, Makiko; Naoe, Ayano; Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Yamori, Takao; Ishibashi, Masami", "title": "New bisindole alkaloids isolated from myxomycetes arcyria cinerea and lycogala epidendrum", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2005, "volume": "53", "issue": "5", "pages": "594-597" }, "origin_organism": { "id": 4281, "type": "Fungus", "genus": "Arcyria", "species": "cinerea", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 14109, "npaid": "NPA014109", "original_name": "Arcyrioxocin B", "mol_formula": "C20H11N3O4", "mol_weight": 357.325, "exact_mass": 357.075, "inchikey": "GFRYOSZUQBGLNQ-UHFFFAOYSA-N", "smiles": "C1=CC2=C3C(=C1)OC4=NC5=C(C4=C6C(=C(NC6=O)O)C3=CN2)C=CC(=C5)O", "cluster_id": 5256, "node_id": 10, "synonyms": [ "Arcyrioxocin B" ], "inchi": "InChI=1S/C20H11N3O4/c24-8-4-5-9-12(6-8)22-20-16(9)17-15(18(25)23-19(17)26)10-7-21-11-2-1-3-13(27-20)14(10)11/h1-7,21,24-25H,(H,23,26)", "m_plus_h": 358.0823, "m_plus_na": 380.0642, "origin_reference": { "doi": "10.1351/pac198961030281", "pmid": null, "authors": "Wolfgang Steglich", "title": "Slime moulds (Myxomycetes) as a source of new biologically active metabolites", "journal": "Pure and Applied Chemistry", "year": 1989, "volume": "61", "issue": "3", "pages": "281-288" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 14253, "npaid": "NPA014253", "original_name": "Cinereapyrrole B", "mol_formula": "C22H17N3O3", "mol_weight": 371.396, "exact_mass": 371.127, "inchikey": "UTLACMOGKIDNLW-UHFFFAOYSA-N", "smiles": "COC(=O)C1=C(C(=CN1)C2=CNC3=CC=CC=C32)C4=CNC5=C4C=C(C=C5)O", "cluster_id": 15, "node_id": 15, "synonyms": [ "Cinereapyrrole B" ], "inchi": "InChI=1S/C22H17N3O3/c1-28-22(27)21-20(16-10-24-19-7-6-12(26)8-14(16)19)17(11-25-21)15-9-23-18-5-3-2-4-13(15)18/h2-11,23-26H,1H3", "m_plus_h": 372.1343, "m_plus_na": 394.1162, "origin_reference": { "doi": "10.1248/cpb.53.594", "pmid": 15863941, "authors": "Kamata, Kazuaki; Kiyota, Makiko; Naoe, Ayano; Nakatani, Satomi; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Yamori, Takao; Ishibashi, Masami", "title": "New bisindole alkaloids isolated from myxomycetes arcyria cinerea and lycogala epidendrum", "journal": "Chemical and Pharmaceutical Bulletin", "year": 2005, "volume": "53", "issue": "5", "pages": "594-597" }, "origin_organism": { "id": 4281, "type": "Fungus", "genus": "Arcyria", "species": "cinerea", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 15641, "npaid": "NPA015641", "original_name": "14-O-\u03b1-D-mannopyranosyl-(2E,4E,7R,8E,10E,12E,14S)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid", "mol_formula": "C28H42O9", "mol_weight": 522.635, "exact_mass": 522.2829, "inchikey": "HTGFZKQPJXUSTN-QFVPHOAWSA-N", "smiles": "CC(=CC[C@@H](/C(=C/C=C/C(=C/[C@](C)(C/C=C/C=C/C(=O)O)O)/C)/C)O[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C", "cluster_id": 5829, "node_id": 4042, "synonyms": [ "14-O-\u03b1-D-mannopyranosyl-(2E,4E,7R,8E,10E,12E,14S)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid" ], "inchi": "InChI=1S/C28H42O9/c1-18(2)13-14-21(36-27-26(34)25(33)24(32)22(17-29)37-27)20(4)11-9-10-19(3)16-28(5,35)15-8-6-7-12-23(30)31/h6-13,16,21-22,24-27,29,32-35H,14-15,17H2,1-5H3,(H,30,31)/b8-6+,10-9+,12-7+,19-16+,20-11+/t21-,22+,24+,25-,26-,27-,28-/m0/s1", "m_plus_h": 523.2902, "m_plus_na": 545.2721, "origin_reference": { "doi": "10.1016/s0031-9422(02)00159-0", "pmid": null, "authors": "Rezanka, Tomas", "title": "Glycosides of polyenoic branched fatty acids from myxomycetes", "journal": "Phytochemistry", "year": 2002, "volume": "60", "issue": "6", "pages": "639-646" }, "origin_organism": { "id": 4281, "type": "Fungus", "genus": "Arcyria", "species": "cinerea", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 15678, "npaid": "NPA015678", "original_name": "14-O-\u03b1-L-rhamnopyranosyl-(2E,4E,7R,8E,10E,12E,14R)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid", "mol_formula": "C28H42O8", "mol_weight": 506.636, "exact_mass": 506.288, "inchikey": "LUVNAVZCRYWYPQ-NVPBYRBVSA-N", "smiles": "C[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)O[C@H](CC=C(C)C)/C(=C/C=C/C(=C/[C@](C)(C/C=C/C=C/C(=O)O)O)/C)/C)O)O)O", "cluster_id": 5829, "node_id": 4042, "synonyms": [ "14-O-\u03b1-L-rhamnopyranosyl-(2E,4E,7R,8E,10E,12E,14R)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid" ], "inchi": "InChI=1S/C28H42O8/c1-18(2)14-15-22(36-27-26(33)25(32)24(31)21(5)35-27)20(4)12-10-11-19(3)17-28(6,34)16-9-7-8-13-23(29)30/h7-14,17,21-22,24-27,31-34H,15-16H2,1-6H3,(H,29,30)/b9-7+,11-10+,13-8+,19-17+,20-12+/t21-,22-,24-,25+,26+,27-,28+/m1/s1", "m_plus_h": 507.2953, "m_plus_na": 529.2772, "origin_reference": { "doi": "10.1016/s0031-9422(02)00159-0", "pmid": null, "authors": "Rezanka, Tomas", "title": "Glycosides of polyenoic branched fatty acids from myxomycetes", "journal": "Phytochemistry", "year": 2002, "volume": "60", "issue": "6", "pages": "639-646" }, "origin_organism": { "id": 4281, "type": "Fungus", "genus": "Arcyria", "species": "cinerea", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 16493, "npaid": "NPA016493", "original_name": "Dihydroarcyrioxocin A", "mol_formula": "C20H13N3O3", "mol_weight": 343.342, "exact_mass": 343.0957, "inchikey": "HQYGCSHOJQPWQA-RDJZCZTQSA-N", "smiles": "C1=CC=C2C(=C1)C3=C(N2)OC4=CC=CC5=C4C(=CN5)[C@H]6[C@@H]3C(=O)NC6=O", "cluster_id": 4441, "node_id": 10, "synonyms": [ "Dihydroarcyrioxocin A" ], "inchi": "InChI=1S/C20H13N3O3/c24-18-15-10-8-21-12-6-3-7-13(14(10)12)26-20-16(17(15)19(25)23-18)9-4-1-2-5-11(9)22-20/h1-8,15,17,21-22H,(H,23,24,25)/t15-,17-/m0/s1", "m_plus_h": 344.103, "m_plus_na": 366.0849, "origin_reference": { "doi": "10.1351/pac198961030281", "pmid": null, "authors": "Wolfgang Steglich", "title": "Slime moulds (Myxomycetes) as a source of new biologically active metabolites", "journal": "Pure and Applied Chemistry", "year": 1989, "volume": "61", "issue": "3", "pages": "281-288" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 16991, "npaid": "NPA016991", "original_name": "Arcyriarubin C", "mol_formula": "C20H13N3O4", "mol_weight": 359.341, "exact_mass": 359.0906, "inchikey": "UDSNXTIQGIGPLE-UHFFFAOYSA-N", "smiles": "C1=CC2=C(C=C1O)NC=C2C3=C(C(=O)NC3=O)C4=CNC5=C4C=CC(=C5)O", "cluster_id": 1010, "node_id": 10, "synonyms": [ "Arcyriarubin C" ], "inchi": "InChI=1S/C20H13N3O4/c24-9-1-3-11-13(7-21-15(11)5-9)17-18(20(27)23-19(17)26)14-8-22-16-6-10(25)2-4-12(14)16/h1-8,21-22,24-25H,(H,23,26,27)", "m_plus_h": 360.0979, "m_plus_na": 382.0798, "origin_reference": { "doi": "10.1002/anie.198004591", "pmid": null, "authors": "Steglich, Wolfgang; Steffan, Bert; Kopanski, Lothar; Eckhardt, Gerd", "title": "Indole pigments from the fruiting bodies of the slime mold Arcyria denudata", "journal": "Angewandte Chemie International Edition", "year": 1980, "volume": "19", "issue": "6", "pages": "459-460" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 17081, "npaid": "NPA017081", "original_name": "14-O-\u03b2-D-glucopyranosyl-(2E,4E,7S,8E,10E,12E,14R)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid", "mol_formula": "C28H42O9", "mol_weight": 522.635, "exact_mass": 522.2829, "inchikey": "HTGFZKQPJXUSTN-DABOWUONSA-N", "smiles": "CC(=CC[C@H](/C(=C/C=C/C(=C/[C@@](C)(C/C=C/C=C/C(=O)O)O)/C)/C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C", "cluster_id": 5829, "node_id": 4042, "synonyms": [ "14-O-\u03b2-D-glucopyranosyl-(2E,4E,7S,8E,10E,12E,14R)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid" ], "inchi": "InChI=1S/C28H42O9/c1-18(2)13-14-21(36-27-26(34)25(33)24(32)22(17-29)37-27)20(4)11-9-10-19(3)16-28(5,35)15-8-6-7-12-23(30)31/h6-13,16,21-22,24-27,29,32-35H,14-15,17H2,1-5H3,(H,30,31)/b8-6+,10-9+,12-7+,19-16+,20-11+/t21-,22-,24-,25+,26-,27-,28-/m1/s1", "m_plus_h": 523.2902, "m_plus_na": 545.2721, "origin_reference": { "doi": "10.1016/s0031-9422(02)00159-0", "pmid": null, "authors": "Rezanka, Tomas", "title": "Glycosides of polyenoic branched fatty acids from myxomycetes", "journal": "Phytochemistry", "year": 2002, "volume": "60", "issue": "6", "pages": "639-646" }, "origin_organism": { "id": 4281, "type": "Fungus", "genus": "Arcyria", "species": "cinerea", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19096, "npaid": "NPA019096", "original_name": "(2E,4E,7S,8E,10E,12E,14S)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid", "mol_formula": "C22H32O4", "mol_weight": 360.494, "exact_mass": 360.2301, "inchikey": "AJIPQLGQGAHQQV-RMIYBBOLSA-N", "smiles": "CC(=CC[C@@H](/C(=C/C=C/C(=C/[C@@](C)(C/C=C/C=C/C(=O)O)O)/C)/C)O)C", "cluster_id": 5829, "node_id": 4042, "synonyms": [ "(2E,4E,7S,8E,10E,12E,14S)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid" ], "inchi": "InChI=1S/C22H32O4/c1-17(2)13-14-20(23)19(4)11-9-10-18(3)16-22(5,26)15-8-6-7-12-21(24)25/h6-13,16,20,23,26H,14-15H2,1-5H3,(H,24,25)/b8-6+,10-9+,12-7+,18-16+,19-11+/t20-,22+/m0/s1", "m_plus_h": 361.2374, "m_plus_na": 383.2193, "origin_reference": { "doi": "10.1016/s0031-9422(02)00159-0", "pmid": null, "authors": "Rezanka, Tomas", "title": "Glycosides of polyenoic branched fatty acids from myxomycetes", "journal": "Phytochemistry", "year": 2002, "volume": "60", "issue": "6", "pages": "639-646" }, "origin_organism": { "id": 4281, "type": "Fungus", "genus": "Arcyria", "species": "cinerea", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19116, "npaid": "NPA019116", "original_name": "Dihydroarcyriacyanin A", "mol_formula": "C20H13N3O2", "mol_weight": 327.343, "exact_mass": 327.1008, "inchikey": "FEHIKJHVVDDNCJ-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C3=C(N2)C4=C5C(=CC=C4)NC=C5C6C3C(=O)NC6=O", "cluster_id": 4441, "node_id": 10, "synonyms": [ "Dihydroarcyriacyanin A" ], "inchi": "InChI=1S/C20H13N3O2/c24-19-16-11-8-21-13-7-3-5-10(14(11)13)18-15(17(16)20(25)23-19)9-4-1-2-6-12(9)22-18/h1-8,16-17,21-22H,(H,23,24,25)", "m_plus_h": 328.1081, "m_plus_na": 350.09, "origin_reference": { "doi": "10.1021/np060269h", "pmid": 16933891, "authors": "Kamata, Kazuaki; Suetsugu, Tomoko; Yamamoto, Yukinori; Hayashi, Masahiko; Komiyama, Kanki; Ishibashi, Masami", "title": "Bisindole alkaloids from myxomycetes Arcyria denudata and Arcyria obvelata", "journal": "Journal of Natural Products", "year": 2006, "volume": "69", "issue": "8", "pages": "1252-1254" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19144, "npaid": "NPA019144", "original_name": "Arcyriaflavin B", "mol_formula": "C20H11N3O3", "mol_weight": 341.326, "exact_mass": 341.08, "inchikey": "GNCMMKJNEMBGHM-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C3=C4C(=C5C6=C(C=C(C=C6)O)NC5=C3N2)C(=O)NC4=O", "cluster_id": 2448, "node_id": 10, "synonyms": [ "Arcyriaflavin B" ], "inchi": "InChI=1S/C20H11N3O3/c24-8-5-6-10-12(7-8)22-18-14(10)16-15(19(25)23-20(16)26)13-9-3-1-2-4-11(9)21-17(13)18/h1-7,21-22,24H,(H,23,25,26)", "m_plus_h": 342.0873, "m_plus_na": 364.0692, "origin_reference": { "doi": "10.1002/ange.19800920607", "pmid": null, "authors": "Steglich, Wolfgang; Steffan, Bert; Kopanski, Lothar; Eckhardt, Gert", "title": "Indolfarbstoffe aus Fruchtk\u00f6rpern des SchleimpilzesArcyria denudata (Indole dyes from fruiting bodies of the slime mold Arcyria denudata)", "journal": "Angewandte Chemie", "year": 1980, "volume": "92", "issue": "6", "pages": "463-464" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19347, "npaid": "NPA019347", "original_name": "Arcyriaflavin A", "mol_formula": "C20H11N3O2", "mol_weight": 325.327, "exact_mass": 325.0851, "inchikey": "KAJXOWFGKYKMMZ-UHFFFAOYSA-N", "smiles": "C1=CC=C2C(=C1)C3=C4C(=C5C6=CC=CC=C6NC5=C3N2)C(=O)NC4=O", "cluster_id": 2448, "node_id": 10, "synonyms": [ "Arcyriaflavin A" ], "inchi": "InChI=1S/C20H11N3O2/c24-19-15-13-9-5-1-3-7-11(9)21-17(13)18-14(16(15)20(25)23-19)10-6-2-4-8-12(10)22-18/h1-8,21-22H,(H,23,24,25)", "m_plus_h": 326.0924, "m_plus_na": 348.0743, "origin_reference": { "doi": "10.1002/ange.19800920607", "pmid": null, "authors": "Steglich, Wolfgang; Steffan, Bert; Kopanski, Lothar; Eckhardt, Gert", "title": "Indolfarbstoffe aus Fruchtk\u00f6rpern des SchleimpilzesArcyria denudata (Indole dyes from fruiting bodies of the slime mold Arcyria denudata)", "journal": "Angewandte Chemie", "year": 1980, "volume": "92", "issue": "6", "pages": "463-464" }, "origin_organism": { "id": 1070, "type": "Fungus", "genus": "Arcyria", "species": "denudata", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] }, { "id": 19585, "npaid": "NPA019585", "original_name": "14-O-\u03b1-D-glucopyranosyl-(2E,4E,7S,8E,10E,12E,14S)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid", "mol_formula": "C28H42O9", "mol_weight": 522.635, "exact_mass": 522.2829, "inchikey": "HTGFZKQPJXUSTN-MOAXIQLASA-N", "smiles": "CC(=CC[C@@H](/C(=C/C=C/C(=C/[C@@](C)(C/C=C/C=C/C(=O)O)O)/C)/C)O[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C", "cluster_id": 5829, "node_id": 4042, "synonyms": [ "14-O-\u03b1-D-glucopyranosyl-(2E,4E,7S,8E,10E,12E,14S)-7,9,13,17-tetramethyl-7,14-dihydroxy-2,4,8,10,12,16-octadecahexaenoic acid" ], "inchi": "InChI=1S/C28H42O9/c1-18(2)13-14-21(36-27-26(34)25(33)24(32)22(17-29)37-27)20(4)11-9-10-19(3)16-28(5,35)15-8-6-7-12-23(30)31/h6-13,16,21-22,24-27,29,32-35H,14-15,17H2,1-5H3,(H,30,31)/b8-6+,10-9+,12-7+,19-16+,20-11+/t21-,22+,24+,25-,26+,27-,28+/m0/s1", "m_plus_h": 523.2902, "m_plus_na": 545.2721, "origin_reference": { "doi": "10.1016/s0031-9422(02)00159-0", "pmid": null, "authors": "Rezanka, Tomas", "title": "Glycosides of polyenoic branched fatty acids from myxomycetes", "journal": "Phytochemistry", "year": 2002, "volume": "60", "issue": "6", "pages": "639-646" }, "origin_organism": { "id": 4281, "type": "Fungus", "genus": "Arcyria", "species": "cinerea", "taxon": { "id": 1743, "name": "Arcyria", "rank": "genus", "taxon_db": "mycobank", "external_id": "12016", "ancestors": [ { "id": 599, "name": "Eukarya", "rank": "domain", "taxon_db": "mycobank", "external_id": null }, { "id": 1738, "name": "Protozoa", "rank": "kingdom", "taxon_db": "mycobank", "external_id": "99001" }, { "id": 1739, "name": "Myxomycota", "rank": "phylum", "taxon_db": "mycobank", "external_id": "90262" }, { "id": 1740, "name": "Myxomycetes", "rank": "class", "taxon_db": "mycobank", "external_id": "90788" }, { "id": 1741, "name": "Trichiales", "rank": "order", "taxon_db": "mycobank", "external_id": "90452" }, { "id": 1742, "name": "Arcyriaceae", "rank": "family", "taxon_db": "mycobank", "external_id": "81895" } ] } }, "syntheses": [], "reassignments": [], "external_ids": [] } ]