| 0.4 |
1.2 |
GO:0060929 |
Purkinje myocyte differentiation(GO:0003168) septum secundum development(GO:0003285) cardiac pacemaker cell fate commitment(GO:0060927) atrioventricular node cell fate commitment(GO:0060929) |
| 0.2 |
0.9 |
GO:0061349 |
chemoattraction of serotonergic neuron axon(GO:0036517) planar cell polarity pathway involved in outflow tract morphogenesis(GO:0061347) planar cell polarity pathway involved in ventricular septum morphogenesis(GO:0061348) planar cell polarity pathway involved in cardiac right atrium morphogenesis(GO:0061349) planar cell polarity pathway involved in cardiac muscle tissue morphogenesis(GO:0061350) planar cell polarity pathway involved in pericardium morphogenesis(GO:0061354) chemoattraction of axon(GO:0061642) negative regulation of cell proliferation in midbrain(GO:1904934) planar cell polarity pathway involved in midbrain dopaminergic neuron differentiation(GO:1904955) |
| 0.1 |
0.8 |
GO:0090258 |
negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 |
0.4 |
GO:0043181 |
vacuolar sequestering(GO:0043181) |
| 0.1 |
0.5 |
GO:1904808 |
regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 |
0.7 |
GO:0045200 |
establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 |
0.3 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.1 |
0.5 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.1 |
0.2 |
GO:0050758 |
thymidylate synthase biosynthetic process(GO:0050757) regulation of thymidylate synthase biosynthetic process(GO:0050758) negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.1 |
0.1 |
GO:0050885 |
neuromuscular process controlling balance(GO:0050885) |
| 0.1 |
0.4 |
GO:0086021 |
SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.1 |
0.9 |
GO:1905247 |
positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.1 |
0.1 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.1 |
0.5 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 |
0.4 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.1 |
0.2 |
GO:2000657 |
regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
| 0.1 |
0.2 |
GO:0017198 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 |
0.3 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 |
0.3 |
GO:0010512 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.0 |
0.1 |
GO:0019230 |
pathogenesis(GO:0009405) proprioception(GO:0019230) negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.0 |
0.1 |
GO:0001544 |
initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.0 |
0.1 |
GO:0072579 |
molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.0 |
0.5 |
GO:1900113 |
negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 |
0.1 |
GO:0071790 |
spindle pole body duplication(GO:0030474) spindle pole body organization(GO:0051300) spindle pole body localization(GO:0070631) establishment of spindle pole body localization(GO:0070632) spindle pole body localization to nuclear envelope(GO:0071789) establishment of spindle pole body localization to nuclear envelope(GO:0071790) |
| 0.0 |
0.7 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.0 |
0.2 |
GO:0019303 |
D-ribose catabolic process(GO:0019303) |
| 0.0 |
0.0 |
GO:1904562 |
phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 |
0.1 |
GO:0051311 |
meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
| 0.0 |
0.3 |
GO:0061502 |
early endosome to recycling endosome transport(GO:0061502) |
| 0.0 |
0.3 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 |
0.2 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 0.0 |
0.1 |
GO:0072720 |
cellular response to mycotoxin(GO:0036146) response to dithiothreitol(GO:0072720) |
| 0.0 |
0.1 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.0 |
0.2 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 |
0.2 |
GO:0043988 |
histone H3-S28 phosphorylation(GO:0043988) |
| 0.0 |
0.4 |
GO:0014010 |
Schwann cell proliferation(GO:0014010) |
| 0.0 |
0.1 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.0 |
0.1 |
GO:1990697 |
protein depalmitoleylation(GO:1990697) |
| 0.0 |
0.1 |
GO:0003219 |
cardiac right ventricle formation(GO:0003219) |
| 0.0 |
0.1 |
GO:0045645 |
regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.0 |
0.2 |
GO:0007070 |
negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.0 |
0.1 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 |
0.1 |
GO:0003186 |
tricuspid valve morphogenesis(GO:0003186) |
| 0.0 |
0.1 |
GO:0042351 |
'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.0 |
0.1 |
GO:0032072 |
plasmacytoid dendritic cell activation(GO:0002270) regulation of restriction endodeoxyribonuclease activity(GO:0032072) negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.0 |
0.3 |
GO:0045656 |
negative regulation of monocyte differentiation(GO:0045656) |
| 0.0 |
0.1 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.0 |
3.3 |
GO:0042147 |
retrograde transport, endosome to Golgi(GO:0042147) |
| 0.0 |
0.1 |
GO:0060178 |
regulation of exocyst assembly(GO:0001928) regulation of exocyst localization(GO:0060178) |
| 0.0 |
0.1 |
GO:1990927 |
vesicle-mediated cholesterol transport(GO:0090119) short-term synaptic potentiation(GO:1990926) calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.0 |
0.2 |
GO:0071630 |
nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.0 |
0.5 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 |
0.0 |
GO:0021558 |
trochlear nerve development(GO:0021558) |
| 0.0 |
0.2 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.0 |
0.3 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 |
0.3 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.0 |
0.2 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 |
0.1 |
GO:0007388 |
anterior compartment pattern formation(GO:0007387) posterior compartment specification(GO:0007388) |
| 0.0 |
0.2 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.0 |
0.1 |
GO:0060382 |
regulation of DNA strand elongation(GO:0060382) |
| 0.0 |
0.1 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.0 |
0.2 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.0 |
0.1 |
GO:0060988 |
lipid tube assembly(GO:0060988) |
| 0.0 |
0.1 |
GO:1901207 |
regulation of heart looping(GO:1901207) |
| 0.0 |
0.1 |
GO:0006679 |
glucosylceramide biosynthetic process(GO:0006679) |
| 0.0 |
0.2 |
GO:0070120 |
ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.0 |
0.1 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.0 |
0.1 |
GO:0035799 |
ureter maturation(GO:0035799) |
| 0.0 |
0.1 |
GO:0044240 |
multicellular organism lipid catabolic process(GO:0044240) |
| 0.0 |
0.1 |
GO:0055005 |
ventricular cardiac myofibril assembly(GO:0055005) |
| 0.0 |
0.1 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.0 |
0.1 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.0 |
0.2 |
GO:0097338 |
response to clozapine(GO:0097338) |
| 0.0 |
0.1 |
GO:2001184 |
positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.0 |
0.1 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.0 |
0.2 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.0 |
0.2 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 |
0.1 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.0 |
0.1 |
GO:0072086 |
specification of loop of Henle identity(GO:0072086) |
| 0.0 |
0.1 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.0 |
0.2 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.0 |
0.5 |
GO:0090331 |
negative regulation of platelet aggregation(GO:0090331) |
| 0.0 |
0.1 |
GO:2000782 |
regulation of unidimensional cell growth(GO:0051510) negative regulation of unidimensional cell growth(GO:0051511) establishment of cell polarity regulating cell shape(GO:0071964) regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000769) positive regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000771) regulation of establishment of cell polarity regulating cell shape(GO:2000782) positive regulation of establishment of cell polarity regulating cell shape(GO:2000784) positive regulation of barbed-end actin filament capping(GO:2000814) |
| 0.0 |
0.6 |
GO:0090083 |
regulation of inclusion body assembly(GO:0090083) |
| 0.0 |
0.1 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.0 |
0.0 |
GO:1904617 |
negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.0 |
0.1 |
GO:0046035 |
CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.0 |
0.1 |
GO:1901491 |
negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 |
0.1 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 |
0.1 |
GO:1902659 |
regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.0 |
0.1 |
GO:0007185 |
transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 |
0.1 |
GO:0071344 |
diphosphate metabolic process(GO:0071344) |
| 0.0 |
0.1 |
GO:0090336 |
positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.0 |
0.1 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.2 |
GO:0071816 |
tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 |
0.1 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 |
0.1 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.0 |
0.1 |
GO:1904526 |
regulation of microtubule binding(GO:1904526) |
| 0.0 |
0.0 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.0 |
0.1 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 0.0 |
0.0 |
GO:2001021 |
negative regulation of response to DNA damage stimulus(GO:2001021) |
| 0.0 |
0.4 |
GO:0021680 |
cerebellar Purkinje cell layer development(GO:0021680) |
| 0.0 |
0.1 |
GO:1905244 |
regulation of modification of synaptic structure(GO:1905244) |
| 0.0 |
0.2 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.0 |
0.2 |
GO:0098828 |
positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 |
0.0 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.0 |
0.3 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 |
0.1 |
GO:2000664 |
positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.0 |
0.1 |
GO:2001295 |
malonyl-CoA biosynthetic process(GO:2001295) |
| 0.0 |
0.3 |
GO:0070262 |
peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 |
0.0 |
GO:0044209 |
AMP salvage(GO:0044209) |
| 0.0 |
0.0 |
GO:0002476 |
antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
| 0.0 |
0.1 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 |
0.1 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 |
0.0 |
GO:0021684 |
cell differentiation in hindbrain(GO:0021533) cerebellar granular layer morphogenesis(GO:0021683) cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) regulation of axon diameter(GO:0031133) positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.0 |
0.0 |
GO:2001037 |
tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.0 |
0.0 |
GO:0030070 |
insulin processing(GO:0030070) |
| 0.0 |
0.1 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 |
0.0 |
GO:0099640 |
axo-dendritic protein transport(GO:0099640) |
| 0.0 |
0.0 |
GO:0040040 |
thermosensory behavior(GO:0040040) |
| 0.0 |
0.0 |
GO:0072387 |
flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.0 |
0.0 |
GO:1902869 |
regulation of amacrine cell differentiation(GO:1902869) |
| 0.0 |
0.1 |
GO:0035524 |
proline transmembrane transport(GO:0035524) |
| 0.0 |
0.1 |
GO:1901563 |
cellular response to camptothecin(GO:0072757) response to camptothecin(GO:1901563) |
| 0.0 |
0.1 |
GO:0036155 |
acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.0 |
0.1 |
GO:0001778 |
plasma membrane repair(GO:0001778) |
| 0.0 |
0.0 |
GO:0016103 |
diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.0 |
0.2 |
GO:0000722 |
telomere maintenance via recombination(GO:0000722) |
| 0.0 |
0.1 |
GO:0033600 |
negative regulation of mammary gland epithelial cell proliferation(GO:0033600) negative regulation of negative chemotaxis(GO:0050925) |
| 0.0 |
0.0 |
GO:0045875 |
negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 |
0.2 |
GO:0003356 |
regulation of cilium beat frequency(GO:0003356) |
| 0.0 |
0.1 |
GO:0002098 |
tRNA wobble uridine modification(GO:0002098) |
