| 1.2 |
6.1 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 1.1 |
8.5 |
GO:0086048 |
membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 1.0 |
4.0 |
GO:1904049 |
negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.9 |
2.8 |
GO:0032223 |
negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.9 |
2.6 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.9 |
2.6 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.8 |
2.5 |
GO:0034164 |
negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.8 |
6.9 |
GO:0021842 |
directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.8 |
3.0 |
GO:2000722 |
regulation of cardiac vascular smooth muscle cell differentiation(GO:2000722) |
| 0.7 |
2.2 |
GO:0097187 |
dentinogenesis(GO:0097187) |
| 0.7 |
2.2 |
GO:0007037 |
vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.7 |
2.0 |
GO:1903410 |
lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.6 |
1.9 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 0.6 |
1.9 |
GO:0043012 |
regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.6 |
3.8 |
GO:0007500 |
mesodermal cell fate determination(GO:0007500) |
| 0.6 |
1.9 |
GO:0008057 |
eye pigment granule organization(GO:0008057) |
| 0.6 |
2.4 |
GO:0072299 |
visceral serous pericardium development(GO:0061032) negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.6 |
5.9 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.6 |
3.5 |
GO:0060535 |
trachea cartilage morphogenesis(GO:0060535) |
| 0.6 |
1.8 |
GO:0086047 |
membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 0.6 |
1.8 |
GO:0097476 |
spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.6 |
0.6 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.6 |
9.8 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.6 |
1.7 |
GO:0060086 |
circadian temperature homeostasis(GO:0060086) |
| 0.6 |
3.9 |
GO:0003172 |
primary heart field specification(GO:0003138) sinoatrial valve development(GO:0003172) sinoatrial valve morphogenesis(GO:0003185) |
| 0.6 |
3.3 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.5 |
2.7 |
GO:0044752 |
response to human chorionic gonadotropin(GO:0044752) |
| 0.5 |
3.3 |
GO:0070981 |
L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.5 |
1.6 |
GO:0017186 |
peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.5 |
3.8 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.5 |
3.7 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.5 |
2.6 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.5 |
1.5 |
GO:0051795 |
positive regulation of catagen(GO:0051795) |
| 0.5 |
1.0 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.5 |
1.0 |
GO:0034163 |
regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.5 |
2.5 |
GO:1902228 |
mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.5 |
3.0 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.5 |
2.9 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.5 |
1.4 |
GO:1990709 |
presynaptic active zone organization(GO:1990709) |
| 0.5 |
1.9 |
GO:0098942 |
regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) cytoskeletal matrix organization at active zone(GO:0048789) neurexin clustering involved in presynaptic membrane assembly(GO:0097115) retrograde trans-synaptic signaling by trans-synaptic protein complex(GO:0098942) |
| 0.5 |
2.9 |
GO:0061107 |
seminal vesicle development(GO:0061107) |
| 0.5 |
1.9 |
GO:1990926 |
short-term synaptic potentiation(GO:1990926) |
| 0.5 |
2.8 |
GO:1904674 |
positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.5 |
1.4 |
GO:0007506 |
gonadal mesoderm development(GO:0007506) |
| 0.5 |
1.4 |
GO:0031548 |
regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.4 |
1.3 |
GO:0032849 |
positive regulation of cellular pH reduction(GO:0032849) |
| 0.4 |
0.4 |
GO:0035886 |
vascular smooth muscle cell differentiation(GO:0035886) |
| 0.4 |
1.8 |
GO:0035502 |
metanephric part of ureteric bud development(GO:0035502) |
| 0.4 |
4.8 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.4 |
2.2 |
GO:0008050 |
female courtship behavior(GO:0008050) |
| 0.4 |
1.3 |
GO:0021812 |
neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.4 |
0.8 |
GO:0090427 |
activation of meiosis(GO:0090427) |
| 0.4 |
0.8 |
GO:0003289 |
atrial septum primum morphogenesis(GO:0003289) |
| 0.4 |
0.4 |
GO:0021794 |
thalamus development(GO:0021794) |
| 0.4 |
4.1 |
GO:0060486 |
Clara cell differentiation(GO:0060486) |
| 0.4 |
1.2 |
GO:1903570 |
regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 0.4 |
3.6 |
GO:0060267 |
positive regulation of respiratory burst(GO:0060267) |
| 0.4 |
2.4 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.4 |
1.2 |
GO:0072361 |
regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.4 |
1.6 |
GO:0061030 |
epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.4 |
0.4 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.4 |
1.2 |
GO:0043449 |
cellular alkene metabolic process(GO:0043449) |
| 0.4 |
1.6 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.4 |
2.4 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 0.4 |
5.1 |
GO:0060120 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.4 |
1.2 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.4 |
0.4 |
GO:0070344 |
fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) |
| 0.4 |
1.2 |
GO:0051389 |
inactivation of MAPKK activity(GO:0051389) |
| 0.4 |
1.9 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.4 |
0.4 |
GO:0060541 |
respiratory system development(GO:0060541) |
| 0.4 |
1.5 |
GO:0042247 |
morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.4 |
1.1 |
GO:1903216 |
regulation of protein processing involved in protein targeting to mitochondrion(GO:1903216) negative regulation of protein processing involved in protein targeting to mitochondrion(GO:1903217) |
| 0.4 |
4.0 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.4 |
1.5 |
GO:0060721 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.4 |
0.7 |
GO:0060425 |
lung morphogenesis(GO:0060425) |
| 0.4 |
5.4 |
GO:0060613 |
fat pad development(GO:0060613) |
| 0.3 |
2.8 |
GO:0038026 |
reelin-mediated signaling pathway(GO:0038026) |
| 0.3 |
1.0 |
GO:0060054 |
positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.3 |
1.7 |
GO:0099552 |
trans-synaptic signaling by lipid, modulating synaptic transmission(GO:0099552) trans-synaptic signaling by endocannabinoid, modulating synaptic transmission(GO:0099553) |
| 0.3 |
1.4 |
GO:0071409 |
cellular response to cycloheximide(GO:0071409) |
| 0.3 |
2.0 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.3 |
1.0 |
GO:2000705 |
dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.3 |
0.3 |
GO:1900222 |
negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.3 |
2.3 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.3 |
2.0 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.3 |
1.0 |
GO:2001226 |
negative regulation of chloride transport(GO:2001226) |
| 0.3 |
1.3 |
GO:0060979 |
vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.3 |
0.6 |
GO:0036343 |
psychomotor behavior(GO:0036343) |
| 0.3 |
3.1 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 0.3 |
0.9 |
GO:0052151 |
positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.3 |
1.2 |
GO:0009138 |
pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.3 |
0.9 |
GO:0060748 |
tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.3 |
0.9 |
GO:1902430 |
negative regulation of beta-amyloid formation(GO:1902430) |
| 0.3 |
1.2 |
GO:1905075 |
occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.3 |
0.3 |
GO:0007614 |
short-term memory(GO:0007614) |
| 0.3 |
0.3 |
GO:0097343 |
ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.3 |
1.2 |
GO:1903984 |
regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.3 |
0.9 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 0.3 |
1.5 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.3 |
0.6 |
GO:0090119 |
vesicle-mediated cholesterol transport(GO:0090119) |
| 0.3 |
1.2 |
GO:0090598 |
male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.3 |
2.0 |
GO:1903281 |
positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.3 |
1.7 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.3 |
1.7 |
GO:0097327 |
response to antineoplastic agent(GO:0097327) |
| 0.3 |
1.4 |
GO:0048749 |
compound eye development(GO:0048749) |
| 0.3 |
3.7 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.3 |
0.3 |
GO:0050673 |
epithelial cell proliferation(GO:0050673) |
| 0.3 |
1.7 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.3 |
9.9 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.3 |
1.7 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.3 |
0.8 |
GO:0033319 |
UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.3 |
0.8 |
GO:1905246 |
regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.3 |
1.1 |
GO:0038033 |
positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 0.3 |
1.1 |
GO:1900248 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.3 |
0.8 |
GO:0021793 |
chemorepulsion of branchiomotor axon(GO:0021793) |
| 0.3 |
0.5 |
GO:0019521 |
aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.3 |
0.5 |
GO:0060268 |
negative regulation of respiratory burst(GO:0060268) |
| 0.3 |
0.5 |
GO:2000563 |
positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.3 |
0.3 |
GO:2000137 |
negative regulation of cell proliferation involved in heart morphogenesis(GO:2000137) |
| 0.3 |
1.9 |
GO:0035879 |
plasma membrane lactate transport(GO:0035879) |
| 0.3 |
1.6 |
GO:0098904 |
regulation of AV node cell action potential(GO:0098904) |
| 0.3 |
0.8 |
GO:0045994 |
positive regulation of translational initiation by iron(GO:0045994) |
| 0.3 |
1.3 |
GO:0061082 |
myeloid leukocyte cytokine production(GO:0061082) |
| 0.3 |
4.0 |
GO:0021636 |
trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.3 |
2.4 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.3 |
1.8 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.3 |
1.0 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.3 |
0.3 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.3 |
2.1 |
GO:0042415 |
norepinephrine metabolic process(GO:0042415) |
| 0.3 |
0.3 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 0.3 |
1.5 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.3 |
0.5 |
GO:1905123 |
regulation of glucosylceramidase activity(GO:1905123) |
| 0.3 |
1.5 |
GO:0030421 |
defecation(GO:0030421) |
| 0.3 |
2.5 |
GO:0035583 |
sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.3 |
0.3 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.2 |
0.2 |
GO:2000338 |
chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) positive regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000340) |
| 0.2 |
0.7 |
GO:0002372 |
myeloid dendritic cell cytokine production(GO:0002372) |
| 0.2 |
0.2 |
GO:0048144 |
fibroblast proliferation(GO:0048144) |
| 0.2 |
0.2 |
GO:0070507 |
regulation of microtubule cytoskeleton organization(GO:0070507) |
| 0.2 |
1.0 |
GO:1904647 |
response to rotenone(GO:1904647) |
| 0.2 |
0.7 |
GO:0031622 |
positive regulation of fever generation(GO:0031622) |
| 0.2 |
1.2 |
GO:0015722 |
canalicular bile acid transport(GO:0015722) |
| 0.2 |
1.5 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.2 |
1.0 |
GO:0035791 |
platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
| 0.2 |
1.2 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.2 |
1.0 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.2 |
1.4 |
GO:0019747 |
regulation of isoprenoid metabolic process(GO:0019747) |
| 0.2 |
0.7 |
GO:0007509 |
mesoderm migration involved in gastrulation(GO:0007509) |
| 0.2 |
0.7 |
GO:0043095 |
regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.2 |
1.2 |
GO:0035986 |
senescence-associated heterochromatin focus assembly(GO:0035986) oncogene-induced cell senescence(GO:0090402) |
| 0.2 |
4.0 |
GO:0030949 |
positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.2 |
1.6 |
GO:0060481 |
lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.2 |
0.9 |
GO:1903347 |
negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 |
0.2 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.2 |
3.7 |
GO:0019371 |
cyclooxygenase pathway(GO:0019371) |
| 0.2 |
0.7 |
GO:0033341 |
regulation of collagen binding(GO:0033341) |
| 0.2 |
1.8 |
GO:0050653 |
chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.2 |
0.2 |
GO:0097491 |
sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.2 |
1.1 |
GO:0033274 |
response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.2 |
0.2 |
GO:0010636 |
positive regulation of mitochondrial fusion(GO:0010636) |
| 0.2 |
0.7 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.2 |
1.8 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.2 |
0.2 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.2 |
0.4 |
GO:1990535 |
neuron projection maintenance(GO:1990535) |
| 0.2 |
0.2 |
GO:0036482 |
neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.2 |
1.5 |
GO:0021590 |
cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
| 0.2 |
0.7 |
GO:2000412 |
positive regulation of thymocyte migration(GO:2000412) |
| 0.2 |
1.3 |
GO:0060633 |
negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.2 |
0.6 |
GO:0044313 |
protein K6-linked deubiquitination(GO:0044313) |
| 0.2 |
1.3 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.2 |
2.2 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.2 |
1.1 |
GO:0046108 |
uridine metabolic process(GO:0046108) |
| 0.2 |
0.2 |
GO:0046543 |
development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.2 |
4.2 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 |
0.6 |
GO:0021538 |
epithalamus development(GO:0021538) habenula development(GO:0021986) general adaptation syndrome(GO:0051866) |
| 0.2 |
1.1 |
GO:1905167 |
positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.2 |
0.6 |
GO:0052553 |
induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.2 |
0.8 |
GO:0002503 |
peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.2 |
1.5 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.2 |
1.0 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.2 |
0.8 |
GO:0016267 |
O-glycan processing, core 1(GO:0016267) |
| 0.2 |
0.6 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.2 |
0.6 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.2 |
0.6 |
GO:0034239 |
macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.2 |
6.5 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.2 |
0.8 |
GO:1903028 |
positive regulation of opsonization(GO:1903028) |
| 0.2 |
1.2 |
GO:0071955 |
recycling endosome to Golgi transport(GO:0071955) |
| 0.2 |
1.2 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.2 |
1.0 |
GO:0003430 |
growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.2 |
1.2 |
GO:2000661 |
positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.2 |
2.2 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.2 |
1.0 |
GO:0009233 |
menaquinone metabolic process(GO:0009233) |
| 0.2 |
0.6 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 0.2 |
0.2 |
GO:1900151 |
regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.2 |
1.0 |
GO:0003409 |
optic cup structural organization(GO:0003409) |
| 0.2 |
0.6 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.2 |
0.6 |
GO:1904717 |
excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.2 |
2.9 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.2 |
0.2 |
GO:0097091 |
synaptic vesicle clustering(GO:0097091) |
| 0.2 |
2.1 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.2 |
1.2 |
GO:0050882 |
voluntary musculoskeletal movement(GO:0050882) |
| 0.2 |
1.1 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.2 |
1.3 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.2 |
0.6 |
GO:0060061 |
Spemann organizer formation(GO:0060061) |
| 0.2 |
0.2 |
GO:2000182 |
regulation of progesterone biosynthetic process(GO:2000182) |
| 0.2 |
0.6 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.2 |
2.1 |
GO:1901725 |
regulation of histone deacetylase activity(GO:1901725) |
| 0.2 |
0.4 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.2 |
1.5 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.2 |
1.1 |
GO:0030309 |
poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.2 |
0.4 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.2 |
2.8 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.2 |
0.5 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.2 |
0.2 |
GO:0051897 |
positive regulation of protein kinase B signaling(GO:0051897) |
| 0.2 |
0.7 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.2 |
0.7 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.2 |
0.9 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 |
0.4 |
GO:1900168 |
glial cell-derived neurotrophic factor secretion(GO:0044467) regulation of glial cell-derived neurotrophic factor secretion(GO:1900166) positive regulation of glial cell-derived neurotrophic factor secretion(GO:1900168) |
| 0.2 |
2.5 |
GO:0044341 |
sodium-dependent phosphate transport(GO:0044341) |
| 0.2 |
4.1 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.2 |
0.4 |
GO:0045762 |
positive regulation of cyclase activity(GO:0031281) positive regulation of adenylate cyclase activity(GO:0045762) |
| 0.2 |
1.1 |
GO:0072752 |
cellular response to rapamycin(GO:0072752) |
| 0.2 |
0.7 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.2 |
0.9 |
GO:0006127 |
glycerophosphate shuttle(GO:0006127) |
| 0.2 |
1.9 |
GO:0000101 |
sulfur amino acid transport(GO:0000101) |
| 0.2 |
0.3 |
GO:0043335 |
protein unfolding(GO:0043335) |
| 0.2 |
1.5 |
GO:0039663 |
fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.2 |
0.2 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.2 |
0.5 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.2 |
0.5 |
GO:0021960 |
anterior commissure morphogenesis(GO:0021960) |
| 0.2 |
0.7 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.2 |
1.0 |
GO:0071603 |
endothelial cell-cell adhesion(GO:0071603) |
| 0.2 |
1.9 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.2 |
0.5 |
GO:0060586 |
multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.2 |
1.0 |
GO:0090206 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.2 |
0.7 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.2 |
0.2 |
GO:0035990 |
tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.2 |
1.0 |
GO:0097646 |
calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.2 |
0.8 |
GO:0035633 |
maintenance of blood-brain barrier(GO:0035633) |
| 0.2 |
0.3 |
GO:1900133 |
regulation of renin secretion into blood stream(GO:1900133) |
| 0.2 |
0.8 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 |
1.5 |
GO:0006498 |
N-terminal protein lipidation(GO:0006498) |
| 0.2 |
0.5 |
GO:0061534 |
gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
| 0.2 |
0.5 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.2 |
0.5 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.2 |
0.5 |
GO:0031443 |
fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.2 |
0.5 |
GO:0038169 |
somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.2 |
1.1 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 |
0.6 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.2 |
0.2 |
GO:0050852 |
T cell receptor signaling pathway(GO:0050852) |
| 0.2 |
1.9 |
GO:1902947 |
regulation of tau-protein kinase activity(GO:1902947) |
| 0.2 |
0.5 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.2 |
1.3 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 |
0.5 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.2 |
0.5 |
GO:0030505 |
inorganic diphosphate transport(GO:0030505) |
| 0.2 |
0.5 |
GO:0021626 |
hindbrain maturation(GO:0021578) pons maturation(GO:0021586) central nervous system maturation(GO:0021626) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.2 |
0.2 |
GO:0034143 |
regulation of toll-like receptor 4 signaling pathway(GO:0034143) |
| 0.2 |
0.2 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.2 |
1.2 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.2 |
0.5 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.2 |
2.0 |
GO:0060087 |
relaxation of vascular smooth muscle(GO:0060087) |
| 0.2 |
0.2 |
GO:0060585 |
regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.2 |
1.2 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.2 |
0.2 |
GO:0071451 |
response to superoxide(GO:0000303) cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
| 0.2 |
2.3 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.2 |
0.6 |
GO:1905045 |
Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
| 0.2 |
0.2 |
GO:0030814 |
regulation of cAMP metabolic process(GO:0030814) |
| 0.2 |
1.5 |
GO:0097039 |
protein linear polyubiquitination(GO:0097039) |
| 0.2 |
0.3 |
GO:2000452 |
CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:0035698) regulation of CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:2000452) |
| 0.2 |
0.3 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.1 |
0.3 |
GO:0021785 |
branchiomotor neuron axon guidance(GO:0021785) |
| 0.1 |
2.2 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.1 |
1.0 |
GO:1903788 |
mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.1 |
1.0 |
GO:0034371 |
chylomicron remodeling(GO:0034371) |
| 0.1 |
0.4 |
GO:0035625 |
epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.1 |
2.5 |
GO:0022038 |
corpus callosum development(GO:0022038) |
| 0.1 |
0.7 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.1 |
1.8 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 |
0.6 |
GO:0036071 |
N-glycan fucosylation(GO:0036071) |
| 0.1 |
1.8 |
GO:2000580 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 |
0.9 |
GO:0010816 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.1 |
2.0 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 |
1.3 |
GO:0006049 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.1 |
0.3 |
GO:0033128 |
negative regulation of histone phosphorylation(GO:0033128) |
| 0.1 |
1.0 |
GO:0033504 |
floor plate development(GO:0033504) |
| 0.1 |
0.4 |
GO:0097119 |
postsynaptic density protein 95 clustering(GO:0097119) |
| 0.1 |
0.3 |
GO:0042369 |
vitamin D catabolic process(GO:0042369) |
| 0.1 |
0.4 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 0.1 |
0.1 |
GO:0060149 |
negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by miRNA(GO:0060965) negative regulation of gene silencing by RNA(GO:0060967) |
| 0.1 |
0.1 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.1 |
0.6 |
GO:1905205 |
positive regulation of connective tissue replacement(GO:1905205) |
| 0.1 |
0.7 |
GO:2000343 |
positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.1 |
0.4 |
GO:0002541 |
activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.1 |
0.4 |
GO:0010725 |
regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.1 |
0.4 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.1 |
1.7 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 |
0.6 |
GO:1901978 |
positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.1 |
0.6 |
GO:1902361 |
mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.1 |
1.8 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 |
0.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.1 |
0.3 |
GO:2000542 |
negative regulation of gastrulation(GO:2000542) |
| 0.1 |
0.7 |
GO:0042713 |
sperm ejaculation(GO:0042713) |
| 0.1 |
0.6 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.1 |
0.1 |
GO:0070666 |
regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.1 |
1.8 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 |
0.4 |
GO:1903515 |
positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) calcium ion transport from cytosol to endoplasmic reticulum(GO:1903515) |
| 0.1 |
0.5 |
GO:0034395 |
regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.1 |
0.3 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.1 |
0.4 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.1 |
0.3 |
GO:0032415 |
regulation of sodium:proton antiporter activity(GO:0032415) positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.1 |
0.3 |
GO:0055064 |
chloride ion homeostasis(GO:0055064) |
| 0.1 |
0.5 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.1 |
0.5 |
GO:0046671 |
negative regulation of cellular pH reduction(GO:0032848) CD8-positive, alpha-beta T cell lineage commitment(GO:0043375) negative regulation of retinal cell programmed cell death(GO:0046671) |
| 0.1 |
0.7 |
GO:0050917 |
sensory perception of umami taste(GO:0050917) |
| 0.1 |
0.4 |
GO:0045715 |
negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 0.1 |
0.1 |
GO:0048389 |
intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
| 0.1 |
0.7 |
GO:0051611 |
negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 |
0.1 |
GO:0060018 |
astrocyte fate commitment(GO:0060018) |
| 0.1 |
1.1 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.1 |
0.1 |
GO:0042489 |
negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.1 |
4.2 |
GO:0045332 |
phospholipid translocation(GO:0045332) |
| 0.1 |
0.4 |
GO:0061580 |
colon epithelial cell migration(GO:0061580) |
| 0.1 |
0.1 |
GO:2000020 |
positive regulation of male gonad development(GO:2000020) |
| 0.1 |
0.3 |
GO:0035385 |
Roundabout signaling pathway(GO:0035385) |
| 0.1 |
0.1 |
GO:0090191 |
negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.1 |
0.3 |
GO:1903949 |
positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.1 |
0.1 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.1 |
3.3 |
GO:0030011 |
maintenance of cell polarity(GO:0030011) |
| 0.1 |
2.9 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.1 |
0.1 |
GO:0010726 |
positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.1 |
3.6 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.4 |
GO:0098972 |
dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
| 0.1 |
0.6 |
GO:0042416 |
dopamine biosynthetic process(GO:0042416) |
| 0.1 |
0.7 |
GO:0010756 |
positive regulation of plasminogen activation(GO:0010756) |
| 0.1 |
0.6 |
GO:0035105 |
sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.1 |
0.9 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.1 |
0.4 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.1 |
0.2 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 |
0.1 |
GO:0016198 |
axon choice point recognition(GO:0016198) |
| 0.1 |
0.4 |
GO:0001994 |
norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.1 |
2.4 |
GO:0051450 |
myoblast proliferation(GO:0051450) |
| 0.1 |
1.0 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.1 |
0.6 |
GO:0000432 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 |
0.8 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.1 |
0.7 |
GO:0021800 |
cerebral cortex tangential migration(GO:0021800) |
| 0.1 |
0.7 |
GO:0072178 |
nephric duct morphogenesis(GO:0072178) |
| 0.1 |
0.4 |
GO:1903400 |
L-arginine transmembrane transport(GO:1903400) |
| 0.1 |
0.4 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 |
0.4 |
GO:0043006 |
activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 0.1 |
0.5 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.1 |
0.5 |
GO:0010755 |
regulation of plasminogen activation(GO:0010755) |
| 0.1 |
0.5 |
GO:0046271 |
phenylpropanoid catabolic process(GO:0046271) |
| 0.1 |
0.1 |
GO:0014032 |
neural crest cell development(GO:0014032) |
| 0.1 |
0.1 |
GO:1903625 |
negative regulation of DNA catabolic process(GO:1903625) |
| 0.1 |
0.2 |
GO:0007198 |
adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.1 |
0.6 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.1 |
0.9 |
GO:0090394 |
negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.1 |
0.6 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.1 |
0.4 |
GO:0014834 |
skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.1 |
1.3 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
1.3 |
GO:0043152 |
induction of bacterial agglutination(GO:0043152) |
| 0.1 |
0.4 |
GO:0051066 |
dihydrobiopterin metabolic process(GO:0051066) |
| 0.1 |
0.1 |
GO:0032423 |
regulation of mismatch repair(GO:0032423) |
| 0.1 |
0.3 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.1 |
0.7 |
GO:0098707 |
ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 |
0.5 |
GO:0046051 |
UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
| 0.1 |
1.2 |
GO:0043589 |
skin morphogenesis(GO:0043589) |
| 0.1 |
1.7 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 |
0.3 |
GO:1902559 |
3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.1 |
0.3 |
GO:1904899 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.1 |
0.3 |
GO:0046041 |
ITP metabolic process(GO:0046041) |
| 0.1 |
0.6 |
GO:0042412 |
taurine biosynthetic process(GO:0042412) |
| 0.1 |
0.5 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.1 |
1.1 |
GO:0070445 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 |
1.7 |
GO:1904714 |
regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 |
2.0 |
GO:0034380 |
high-density lipoprotein particle assembly(GO:0034380) |
| 0.1 |
1.7 |
GO:0016102 |
retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.1 |
0.4 |
GO:1900245 |
positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 |
1.2 |
GO:0061303 |
cornea development in camera-type eye(GO:0061303) |
| 0.1 |
1.2 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 |
7.9 |
GO:0014047 |
glutamate secretion(GO:0014047) |
| 0.1 |
0.4 |
GO:0048743 |
positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.1 |
3.9 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 0.1 |
0.3 |
GO:0072584 |
caveolin-mediated endocytosis(GO:0072584) |
| 0.1 |
1.6 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.1 |
0.6 |
GO:0030573 |
bile acid catabolic process(GO:0030573) |
| 0.1 |
0.2 |
GO:1904978 |
regulation of endosome organization(GO:1904978) |
| 0.1 |
0.1 |
GO:0071879 |
positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 |
0.2 |
GO:0070426 |
positive regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070426) positive regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070434) |
| 0.1 |
0.2 |
GO:0002625 |
regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.1 |
2.3 |
GO:0030157 |
pancreatic juice secretion(GO:0030157) |
| 0.1 |
0.4 |
GO:0010459 |
negative regulation of heart rate(GO:0010459) |
| 0.1 |
1.1 |
GO:2001256 |
regulation of store-operated calcium entry(GO:2001256) |
| 0.1 |
0.1 |
GO:0006694 |
steroid biosynthetic process(GO:0006694) |
| 0.1 |
3.4 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 |
0.1 |
GO:0042940 |
D-amino acid transport(GO:0042940) |
| 0.1 |
0.1 |
GO:0051057 |
positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.1 |
0.4 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 |
1.4 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) pyramidal neuron development(GO:0021860) |
| 0.1 |
0.4 |
GO:0046338 |
phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 |
0.6 |
GO:1903527 |
positive regulation of membrane tubulation(GO:1903527) |
| 0.1 |
0.5 |
GO:0015891 |
iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.1 |
0.1 |
GO:0014028 |
notochord formation(GO:0014028) |
| 0.1 |
0.5 |
GO:2000609 |
regulation of thyroid hormone generation(GO:2000609) |
| 0.1 |
0.8 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.1 |
0.4 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.1 |
0.3 |
GO:0006286 |
base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
| 0.1 |
0.9 |
GO:0001714 |
endodermal cell fate specification(GO:0001714) |
| 0.1 |
0.3 |
GO:0097360 |
chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 |
0.3 |
GO:1904247 |
positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.1 |
0.2 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 |
0.3 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 0.1 |
0.3 |
GO:0043542 |
endothelial cell migration(GO:0043542) |
| 0.1 |
0.3 |
GO:0090222 |
centrosome-templated microtubule nucleation(GO:0090222) |
| 0.1 |
0.6 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.1 |
1.1 |
GO:0071374 |
cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.1 |
1.2 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
1.3 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.1 |
0.5 |
GO:0060154 |
response to cycloheximide(GO:0046898) cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 |
0.3 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 |
0.1 |
GO:0035802 |
adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
| 0.1 |
1.3 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.1 |
0.4 |
GO:2001023 |
regulation of response to drug(GO:2001023) |
| 0.1 |
0.4 |
GO:0035425 |
autocrine signaling(GO:0035425) |
| 0.1 |
0.1 |
GO:1903358 |
regulation of Golgi organization(GO:1903358) |
| 0.1 |
0.1 |
GO:0035470 |
positive regulation of vascular wound healing(GO:0035470) glomerular endothelium development(GO:0072011) |
| 0.1 |
0.2 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 |
3.1 |
GO:0008535 |
respiratory chain complex IV assembly(GO:0008535) |
| 0.1 |
0.2 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.1 |
0.3 |
GO:0060490 |
orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.1 |
0.3 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 |
0.4 |
GO:0006740 |
NADPH regeneration(GO:0006740) |
| 0.1 |
1.6 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 |
0.3 |
GO:0021526 |
medial motor column neuron differentiation(GO:0021526) |
| 0.1 |
0.7 |
GO:1900194 |
negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.1 |
0.5 |
GO:0098532 |
histone H3-K27 trimethylation(GO:0098532) |
| 0.1 |
0.6 |
GO:0050925 |
regulation of negative chemotaxis(GO:0050923) negative regulation of negative chemotaxis(GO:0050925) |
| 0.1 |
0.4 |
GO:0051918 |
negative regulation of fibrinolysis(GO:0051918) |
| 0.1 |
0.2 |
GO:0008037 |
cell recognition(GO:0008037) |
| 0.1 |
1.3 |
GO:0043402 |
glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 |
1.2 |
GO:0006527 |
arginine catabolic process(GO:0006527) |
| 0.1 |
0.6 |
GO:1904742 |
regulation of telomeric DNA binding(GO:1904742) |
| 0.1 |
0.4 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 |
1.5 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.1 |
0.1 |
GO:0035038 |
female pronucleus assembly(GO:0035038) |
| 0.1 |
0.8 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 |
0.3 |
GO:0034146 |
toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.1 |
0.4 |
GO:0030320 |
cellular anion homeostasis(GO:0030002) cellular monovalent inorganic anion homeostasis(GO:0030320) |
| 0.1 |
0.4 |
GO:0006102 |
isocitrate metabolic process(GO:0006102) |
| 0.1 |
0.5 |
GO:0002032 |
desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.1 |
0.9 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.1 |
0.2 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
0.8 |
GO:0051005 |
negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.1 |
0.4 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 |
0.3 |
GO:0035754 |
B cell chemotaxis(GO:0035754) |
| 0.1 |
0.3 |
GO:0060039 |
pericardium development(GO:0060039) |
| 0.1 |
0.1 |
GO:1903903 |
regulation of establishment of T cell polarity(GO:1903903) |
| 0.1 |
0.3 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.1 |
0.3 |
GO:0071030 |
nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.1 |
0.8 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.1 |
0.3 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 |
0.8 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.1 |
0.5 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 |
1.6 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.1 |
0.3 |
GO:2000588 |
positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.1 |
1.3 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.1 |
0.2 |
GO:0002424 |
T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.1 |
0.2 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 0.1 |
0.7 |
GO:0051547 |
regulation of keratinocyte migration(GO:0051547) |
| 0.1 |
0.3 |
GO:0045081 |
negative regulation of interleukin-10 biosynthetic process(GO:0045081) |
| 0.1 |
1.1 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.1 |
1.4 |
GO:0006855 |
drug transmembrane transport(GO:0006855) |
| 0.1 |
0.9 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 |
0.3 |
GO:0034402 |
recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.1 |
0.3 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.1 |
0.2 |
GO:0031959 |
mineralocorticoid receptor signaling pathway(GO:0031959) |
| 0.1 |
0.2 |
GO:0061343 |
cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.1 |
0.9 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.1 |
0.3 |
GO:1902513 |
regulation of organelle transport along microtubule(GO:1902513) |
| 0.1 |
0.1 |
GO:0071635 |
negative regulation of transforming growth factor beta production(GO:0071635) |
| 0.1 |
0.6 |
GO:0007342 |
fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 |
1.1 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 |
0.3 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) otic placode formation(GO:0043049) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 0.1 |
1.4 |
GO:0034446 |
substrate adhesion-dependent cell spreading(GO:0034446) |
| 0.1 |
0.6 |
GO:0045229 |
cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.1 |
0.1 |
GO:0060287 |
epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.1 |
0.3 |
GO:0035750 |
protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.1 |
0.2 |
GO:0055123 |
digestive system development(GO:0055123) |
| 0.1 |
0.4 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
0.6 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.1 |
0.4 |
GO:0060161 |
positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.1 |
0.6 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.1 |
0.1 |
GO:0072319 |
vesicle uncoating(GO:0072319) |
| 0.1 |
0.1 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 |
0.3 |
GO:0033037 |
polysaccharide localization(GO:0033037) |
| 0.1 |
1.8 |
GO:0051770 |
positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 |
0.2 |
GO:0015819 |
lysine transport(GO:0015819) L-lysine transport(GO:1902022) L-lysine transmembrane transport(GO:1903401) |
| 0.1 |
1.0 |
GO:0015893 |
drug transport(GO:0015893) |
| 0.1 |
0.1 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 |
1.0 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 |
0.1 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 |
3.0 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.1 |
0.6 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.1 |
0.1 |
GO:0006844 |
acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.1 |
0.5 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.1 |
0.3 |
GO:0021571 |
rhombomere 5 development(GO:0021571) |
| 0.1 |
0.6 |
GO:0035865 |
cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.3 |
GO:1990258 |
box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.1 |
0.3 |
GO:1903593 |
regulation of histamine secretion by mast cell(GO:1903593) |
| 0.1 |
0.5 |
GO:0090129 |
positive regulation of synapse maturation(GO:0090129) |
| 0.1 |
0.3 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.1 |
1.0 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.1 |
0.5 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.1 |
0.4 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.1 |
0.3 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.1 |
0.3 |
GO:0045648 |
positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.1 |
1.2 |
GO:0015012 |
heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.1 |
0.3 |
GO:0035897 |
proteolysis in other organism(GO:0035897) |
| 0.1 |
0.6 |
GO:0045348 |
positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 0.1 |
0.3 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 |
0.1 |
GO:0099640 |
dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) axo-dendritic protein transport(GO:0099640) |
| 0.1 |
0.2 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.1 |
0.4 |
GO:0002415 |
immune response in mucosal-associated lymphoid tissue(GO:0002386) immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.1 |
0.2 |
GO:1904404 |
transcription factor catabolic process(GO:0036369) cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
| 0.1 |
0.2 |
GO:0034343 |
type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.1 |
0.2 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.1 |
0.3 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 |
0.6 |
GO:0050428 |
purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 |
0.2 |
GO:0006598 |
polyamine catabolic process(GO:0006598) spermine catabolic process(GO:0046208) |
| 0.1 |
0.3 |
GO:0042264 |
peptidyl-aspartic acid modification(GO:0018197) peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.1 |
0.2 |
GO:0000472 |
endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.1 |
0.7 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.1 |
1.0 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.1 |
0.5 |
GO:0019530 |
taurine metabolic process(GO:0019530) |
| 0.1 |
0.2 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 |
1.3 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.1 |
1.6 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.1 |
0.1 |
GO:2000773 |
negative regulation of cellular senescence(GO:2000773) |
| 0.1 |
0.2 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.1 |
1.7 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.1 |
0.1 |
GO:0048546 |
digestive tract morphogenesis(GO:0048546) |
| 0.1 |
0.1 |
GO:0060544 |
regulation of necroptotic process(GO:0060544) |
| 0.1 |
0.3 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 |
0.1 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 |
0.2 |
GO:0048213 |
Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.1 |
0.5 |
GO:0045586 |
regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.1 |
1.9 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.1 |
0.8 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.1 |
0.5 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) |
| 0.1 |
0.3 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.1 |
0.3 |
GO:0032252 |
secretory granule localization(GO:0032252) |
| 0.1 |
0.7 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.1 |
0.2 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.1 |
2.1 |
GO:0043090 |
amino acid import(GO:0043090) |
| 0.1 |
0.5 |
GO:0070164 |
negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 |
0.6 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 |
0.1 |
GO:0002902 |
regulation of B cell apoptotic process(GO:0002902) |
| 0.1 |
0.3 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.1 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 |
0.3 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 |
0.2 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.1 |
0.9 |
GO:0043116 |
negative regulation of vascular permeability(GO:0043116) |
| 0.1 |
0.3 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
0.1 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.1 |
1.0 |
GO:0043647 |
inositol phosphate metabolic process(GO:0043647) |
| 0.1 |
0.2 |
GO:2000834 |
androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.1 |
1.2 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 |
0.6 |
GO:0060715 |
syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.1 |
0.4 |
GO:0042373 |
vitamin K metabolic process(GO:0042373) |
| 0.1 |
0.6 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) negative regulation of protein glycosylation(GO:0060051) |
| 0.1 |
0.1 |
GO:0032696 |
negative regulation of interleukin-13 production(GO:0032696) |
| 0.1 |
0.3 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.1 |
0.2 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 |
0.4 |
GO:0031179 |
peptide amidation(GO:0001519) protein amidation(GO:0018032) peptide modification(GO:0031179) |
| 0.1 |
0.4 |
GO:0086036 |
regulation of cardiac muscle cell membrane potential(GO:0086036) |
| 0.1 |
0.6 |
GO:1903756 |
regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.1 |
0.9 |
GO:0018279 |
peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.1 |
0.4 |
GO:0051253 |
negative regulation of RNA metabolic process(GO:0051253) |
| 0.1 |
1.7 |
GO:1903830 |
magnesium ion transmembrane transport(GO:1903830) |
| 0.1 |
0.7 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.1 |
0.2 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.1 |
0.2 |
GO:0045210 |
FasL biosynthetic process(GO:0045210) |
| 0.1 |
2.0 |
GO:0007158 |
neuron cell-cell adhesion(GO:0007158) |
| 0.1 |
0.3 |
GO:0035377 |
transepithelial water transport(GO:0035377) |
| 0.1 |
0.1 |
GO:0046619 |
optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.1 |
0.1 |
GO:0032915 |
positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.1 |
0.5 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 |
0.8 |
GO:0035729 |
cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.1 |
0.6 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.1 |
0.1 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 0.1 |
0.3 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.1 |
0.1 |
GO:0044333 |
Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.1 |
0.7 |
GO:0015684 |
ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
| 0.1 |
0.1 |
GO:0033603 |
positive regulation of dopamine secretion(GO:0033603) |
| 0.1 |
0.4 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 |
1.8 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.1 |
0.5 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 |
0.6 |
GO:0060600 |
dichotomous subdivision of an epithelial terminal unit(GO:0060600) |
| 0.1 |
0.8 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.1 |
0.5 |
GO:0071461 |
cellular response to redox state(GO:0071461) |
| 0.1 |
0.3 |
GO:0045989 |
positive regulation of striated muscle contraction(GO:0045989) |
| 0.1 |
0.5 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.1 |
0.3 |
GO:0010760 |
negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.1 |
0.3 |
GO:0071651 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.1 |
0.4 |
GO:0032487 |
regulation of Rap protein signal transduction(GO:0032487) |
| 0.1 |
1.0 |
GO:0090141 |
positive regulation of mitochondrial fission(GO:0090141) |
| 0.1 |
1.1 |
GO:0045187 |
regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.1 |
0.2 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 |
0.5 |
GO:0032757 |
positive regulation of interleukin-8 production(GO:0032757) |
| 0.1 |
0.2 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.1 |
0.4 |
GO:0006027 |
glycosaminoglycan catabolic process(GO:0006027) |
| 0.1 |
0.8 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.5 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.1 |
0.4 |
GO:0042335 |
cuticle development(GO:0042335) |
| 0.1 |
1.6 |
GO:0035589 |
G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.1 |
0.1 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.1 |
0.1 |
GO:0035610 |
protein side chain deglutamylation(GO:0035610) |
| 0.1 |
0.3 |
GO:0036483 |
neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.1 |
0.1 |
GO:0035026 |
leading edge cell differentiation(GO:0035026) |
| 0.1 |
0.8 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 |
0.8 |
GO:0007184 |
SMAD protein import into nucleus(GO:0007184) |
| 0.1 |
0.1 |
GO:1902219 |
regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 |
0.4 |
GO:1902896 |
terminal web assembly(GO:1902896) |
| 0.1 |
0.8 |
GO:1904322 |
response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.1 |
0.1 |
GO:0071895 |
odontoblast differentiation(GO:0071895) |
| 0.1 |
0.9 |
GO:0002479 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) |
| 0.1 |
0.1 |
GO:0044828 |
negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 |
0.4 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
0.2 |
GO:0060372 |
regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.1 |
0.1 |
GO:0035434 |
copper ion transmembrane transport(GO:0035434) |
| 0.1 |
0.4 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 |
0.4 |
GO:1903027 |
regulation of opsonization(GO:1903027) |
| 0.1 |
0.8 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.1 |
0.2 |
GO:0045919 |
positive regulation of cytolysis(GO:0045919) |
| 0.1 |
0.3 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.1 |
0.6 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.1 |
0.9 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.1 |
0.4 |
GO:0048295 |
positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.1 |
0.2 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.1 |
0.1 |
GO:0019858 |
cytosine metabolic process(GO:0019858) |
| 0.1 |
0.7 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 |
0.7 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 |
8.7 |
GO:0098661 |
inorganic anion transmembrane transport(GO:0098661) |
| 0.1 |
0.2 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.1 |
2.0 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.1 |
0.4 |
GO:0022401 |
desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.1 |
0.6 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.1 |
0.5 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.1 |
1.9 |
GO:0042304 |
regulation of fatty acid biosynthetic process(GO:0042304) |
| 0.1 |
0.8 |
GO:1900103 |
positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 |
0.3 |
GO:0033277 |
abortive mitotic cell cycle(GO:0033277) |
| 0.1 |
0.2 |
GO:0042659 |
regulation of cell fate specification(GO:0042659) |
| 0.1 |
0.3 |
GO:0032720 |
negative regulation of tumor necrosis factor production(GO:0032720) |
| 0.1 |
0.1 |
GO:0097029 |
mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 |
0.3 |
GO:0060134 |
prepulse inhibition(GO:0060134) |
| 0.1 |
0.3 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 |
0.7 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.1 |
0.3 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 |
0.3 |
GO:0051195 |
negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.1 |
0.1 |
GO:0061156 |
pulmonary artery morphogenesis(GO:0061156) |
| 0.1 |
0.1 |
GO:0051299 |
centrosome separation(GO:0051299) |
| 0.1 |
1.0 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.1 |
0.1 |
GO:0045103 |
intermediate filament-based process(GO:0045103) |
| 0.1 |
1.1 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.1 |
1.1 |
GO:0010603 |
regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.1 |
0.5 |
GO:0051969 |
regulation of transmission of nerve impulse(GO:0051969) |
| 0.1 |
0.1 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.1 |
0.2 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.1 |
0.2 |
GO:0072284 |
metanephric S-shaped body morphogenesis(GO:0072284) |
| 0.1 |
0.7 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.1 |
0.5 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.1 |
0.3 |
GO:0010286 |
heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 |
0.4 |
GO:0006311 |
meiotic gene conversion(GO:0006311) |
| 0.1 |
0.1 |
GO:1901096 |
regulation of autophagosome maturation(GO:1901096) |
| 0.1 |
1.2 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 |
0.7 |
GO:0090385 |
phagosome-lysosome fusion(GO:0090385) |
| 0.1 |
0.2 |
GO:0006433 |
prolyl-tRNA aminoacylation(GO:0006433) |
| 0.1 |
0.3 |
GO:0042357 |
thiamine diphosphate metabolic process(GO:0042357) |
| 0.1 |
0.4 |
GO:1990034 |
calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.1 |
0.1 |
GO:0099541 |
trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
| 0.1 |
0.3 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.2 |
GO:0006427 |
histidyl-tRNA aminoacylation(GO:0006427) |
| 0.1 |
0.2 |
GO:1903818 |
positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
0.1 |
GO:0097106 |
postsynaptic density organization(GO:0097106) |
| 0.1 |
0.2 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 |
0.5 |
GO:0070197 |
meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 |
0.4 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.1 |
0.2 |
GO:0072583 |
clathrin-mediated endocytosis(GO:0072583) |
| 0.1 |
0.2 |
GO:1990314 |
cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.1 |
0.6 |
GO:0010993 |
regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 |
0.3 |
GO:0090156 |
cellular sphingolipid homeostasis(GO:0090156) |
| 0.1 |
0.3 |
GO:0090131 |
mesenchyme migration(GO:0090131) |
| 0.1 |
0.3 |
GO:1902412 |
regulation of mitotic cytokinesis(GO:1902412) |
| 0.1 |
0.1 |
GO:0090149 |
mitochondrial membrane fission(GO:0090149) |
| 0.1 |
0.7 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 |
0.1 |
GO:1900164 |
determination of left/right asymmetry in lateral mesoderm(GO:0003140) nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.1 |
0.2 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.1 |
0.3 |
GO:0070544 |
histone H3-K36 demethylation(GO:0070544) |
| 0.1 |
0.2 |
GO:0035624 |
receptor transactivation(GO:0035624) |
| 0.1 |
0.8 |
GO:0048538 |
thymus development(GO:0048538) |
| 0.1 |
0.3 |
GO:0097021 |
lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.1 |
0.3 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.1 |
0.5 |
GO:0045995 |
regulation of embryonic development(GO:0045995) |
| 0.1 |
0.1 |
GO:0035864 |
response to potassium ion(GO:0035864) |
| 0.0 |
0.5 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.0 |
0.9 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.0 |
0.1 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.0 |
0.2 |
GO:0098876 |
vesicle-mediated transport to the plasma membrane(GO:0098876) |
| 0.0 |
0.7 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.0 |
0.1 |
GO:0014040 |
positive regulation of Schwann cell differentiation(GO:0014040) |
| 0.0 |
0.2 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.0 |
0.5 |
GO:0035826 |
rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.0 |
0.2 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.0 |
0.5 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 |
0.2 |
GO:0061213 |
positive regulation of mesonephros development(GO:0061213) |
| 0.0 |
0.3 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.0 |
0.1 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.0 |
0.1 |
GO:0038145 |
macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.0 |
0.3 |
GO:0006540 |
glutamate decarboxylation to succinate(GO:0006540) |
| 0.0 |
0.1 |
GO:0034499 |
late endosome to Golgi transport(GO:0034499) |
| 0.0 |
0.5 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.0 |
4.4 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.0 |
0.2 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.0 |
0.1 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 |
0.1 |
GO:0043311 |
positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 0.0 |
2.4 |
GO:0097503 |
sialylation(GO:0097503) |
| 0.0 |
0.1 |
GO:2000312 |
regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 |
0.1 |
GO:0034553 |
respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.0 |
0.7 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 |
0.0 |
GO:1903721 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.0 |
0.6 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.0 |
0.1 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.0 |
0.3 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.0 |
0.3 |
GO:0086046 |
membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 |
0.8 |
GO:0008045 |
motor neuron axon guidance(GO:0008045) |
| 0.0 |
0.2 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.0 |
0.1 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.0 |
0.0 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 |
1.0 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
0.8 |
GO:0002385 |
mucosal immune response(GO:0002385) |
| 0.0 |
0.2 |
GO:0035809 |
regulation of urine volume(GO:0035809) |
| 0.0 |
0.1 |
GO:0019417 |
sulfur oxidation(GO:0019417) |
| 0.0 |
0.0 |
GO:1902617 |
response to fluoride(GO:1902617) |
| 0.0 |
0.3 |
GO:0047497 |
establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.0 |
0.4 |
GO:0061003 |
positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 |
0.4 |
GO:1900116 |
extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
| 0.0 |
0.0 |
GO:0031133 |
cellular magnesium ion homeostasis(GO:0010961) regulation of axon diameter(GO:0031133) |
| 0.0 |
0.2 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 0.0 |
0.8 |
GO:0019388 |
galactose catabolic process(GO:0019388) |
| 0.0 |
0.3 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.0 |
0.6 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.0 |
0.1 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 0.0 |
0.5 |
GO:0070294 |
renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.0 |
0.2 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 |
0.0 |
GO:1904338 |
regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.0 |
0.1 |
GO:1905146 |
lysosomal protein catabolic process(GO:1905146) |
| 0.0 |
0.2 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 |
0.1 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 |
0.4 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 |
0.2 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 |
0.2 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.0 |
0.1 |
GO:1903774 |
positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 |
0.1 |
GO:0032764 |
negative regulation of mast cell cytokine production(GO:0032764) |
| 0.0 |
0.3 |
GO:0010628 |
positive regulation of gene expression(GO:0010628) |
| 0.0 |
1.0 |
GO:0036149 |
phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 |
0.0 |
GO:0086018 |
SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) |
| 0.0 |
0.5 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.0 |
0.2 |
GO:0006848 |
pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 |
0.7 |
GO:0070070 |
proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 |
0.7 |
GO:0003374 |
dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 |
0.3 |
GO:0016079 |
synaptic vesicle exocytosis(GO:0016079) |
| 0.0 |
0.1 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) |
| 0.0 |
0.5 |
GO:0034058 |
endosomal vesicle fusion(GO:0034058) |
| 0.0 |
0.4 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.0 |
0.1 |
GO:1904385 |
cellular response to angiotensin(GO:1904385) |
| 0.0 |
0.2 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 |
0.1 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.0 |
0.4 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 0.0 |
0.2 |
GO:2000697 |
negative regulation of nephron tubule epithelial cell differentiation(GO:0072183) negative regulation of epithelial cell differentiation involved in kidney development(GO:2000697) |
| 0.0 |
0.3 |
GO:0006359 |
regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.0 |
0.3 |
GO:0048194 |
Golgi vesicle budding(GO:0048194) |
| 0.0 |
0.4 |
GO:0006021 |
inositol biosynthetic process(GO:0006021) |
| 0.0 |
0.3 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.0 |
0.1 |
GO:0048250 |
mitochondrial iron ion transport(GO:0048250) |
| 0.0 |
0.8 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.0 |
0.1 |
GO:0080120 |
CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.0 |
0.3 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.0 |
0.3 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.0 |
0.3 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 |
0.7 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.0 |
0.1 |
GO:0046013 |
T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 |
0.4 |
GO:0001963 |
synaptic transmission, dopaminergic(GO:0001963) |
| 0.0 |
0.5 |
GO:0071493 |
cellular response to UV-B(GO:0071493) |
| 0.0 |
0.1 |
GO:0044413 |
evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 0.0 |
0.2 |
GO:0002931 |
response to ischemia(GO:0002931) |
| 0.0 |
0.6 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.0 |
0.0 |
GO:0030889 |
negative regulation of B cell proliferation(GO:0030889) |
| 0.0 |
0.3 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.0 |
0.3 |
GO:0021954 |
central nervous system neuron development(GO:0021954) |
| 0.0 |
0.0 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.0 |
1.1 |
GO:0060292 |
long term synaptic depression(GO:0060292) |
| 0.0 |
0.1 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.0 |
0.1 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.0 |
0.2 |
GO:0018101 |
protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 |
0.1 |
GO:1902895 |
positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.0 |
0.2 |
GO:0014911 |
positive regulation of smooth muscle cell migration(GO:0014911) |
| 0.0 |
0.2 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 |
1.2 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 |
0.1 |
GO:0046629 |
gamma-delta T cell activation(GO:0046629) |
| 0.0 |
0.0 |
GO:2000721 |
positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.0 |
0.3 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 |
0.8 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.0 |
0.2 |
GO:1901162 |
primary amino compound biosynthetic process(GO:1901162) |
| 0.0 |
0.8 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.0 |
0.4 |
GO:0032354 |
response to follicle-stimulating hormone(GO:0032354) |
| 0.0 |
0.2 |
GO:1903566 |
positive regulation of protein localization to cilium(GO:1903566) |
| 0.0 |
0.0 |
GO:1903626 |
positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.0 |
0.6 |
GO:0045048 |
protein insertion into ER membrane(GO:0045048) |
| 0.0 |
0.0 |
GO:0001579 |
medium-chain fatty acid transport(GO:0001579) |
| 0.0 |
0.2 |
GO:1902045 |
negative regulation of Fas signaling pathway(GO:1902045) |
| 0.0 |
0.2 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.0 |
0.3 |
GO:0090292 |
nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 |
0.4 |
GO:0046398 |
UDP-glucuronate metabolic process(GO:0046398) |
| 0.0 |
0.1 |
GO:0019085 |
early viral transcription(GO:0019085) |
| 0.0 |
0.1 |
GO:0006043 |
glucosamine catabolic process(GO:0006043) |
| 0.0 |
0.1 |
GO:0060315 |
negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.0 |
0.0 |
GO:0022605 |
oogenesis stage(GO:0022605) |
| 0.0 |
0.5 |
GO:0019373 |
epoxygenase P450 pathway(GO:0019373) |
| 0.0 |
0.3 |
GO:0098706 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.0 |
0.3 |
GO:0030100 |
regulation of endocytosis(GO:0030100) |
| 0.0 |
0.3 |
GO:0043622 |
cortical microtubule organization(GO:0043622) |
| 0.0 |
1.0 |
GO:1903861 |
positive regulation of dendrite extension(GO:1903861) |
| 0.0 |
0.4 |
GO:2000786 |
positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 |
0.3 |
GO:0097267 |
omega-hydroxylase P450 pathway(GO:0097267) |
| 0.0 |
0.3 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 |
0.1 |
GO:2000174 |
regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.0 |
0.2 |
GO:1903615 |
regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
| 0.0 |
0.1 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
0.1 |
GO:1902283 |
negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.0 |
0.2 |
GO:1901550 |
regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.0 |
0.3 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 |
0.1 |
GO:0031054 |
pre-miRNA processing(GO:0031054) |
| 0.0 |
0.6 |
GO:0070584 |
mitochondrion morphogenesis(GO:0070584) |
| 0.0 |
0.1 |
GO:0034755 |
iron ion transmembrane transport(GO:0034755) |
| 0.0 |
2.8 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.1 |
GO:2000364 |
cardiac muscle tissue regeneration(GO:0061026) regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.0 |
0.1 |
GO:0071677 |
positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 |
0.0 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 |
0.1 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.0 |
0.2 |
GO:0010803 |
regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 |
0.2 |
GO:0019427 |
acetate metabolic process(GO:0006083) acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.0 |
0.1 |
GO:0044878 |
mitotic cytokinesis checkpoint(GO:0044878) |
| 0.0 |
0.2 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.0 |
0.2 |
GO:0033387 |
putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 |
1.0 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 |
0.3 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 |
0.2 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 |
0.1 |
GO:0060281 |
regulation of oocyte development(GO:0060281) |
| 0.0 |
0.3 |
GO:0071888 |
macrophage apoptotic process(GO:0071888) |
| 0.0 |
0.1 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.0 |
0.1 |
GO:0032224 |
positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 |
0.0 |
GO:0051654 |
establishment of mitochondrion localization(GO:0051654) |
| 0.0 |
0.4 |
GO:1990440 |
positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.0 |
0.2 |
GO:0001964 |
startle response(GO:0001964) |
| 0.0 |
0.1 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.0 |
0.2 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 |
0.1 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.0 |
1.3 |
GO:0008333 |
endosome to lysosome transport(GO:0008333) |
| 0.0 |
0.1 |
GO:0080154 |
regulation of fertilization(GO:0080154) |
| 0.0 |
1.0 |
GO:0071549 |
cellular response to dexamethasone stimulus(GO:0071549) |
| 0.0 |
0.0 |
GO:0005986 |
sucrose biosynthetic process(GO:0005986) |
| 0.0 |
0.9 |
GO:0046579 |
positive regulation of Ras protein signal transduction(GO:0046579) |
| 0.0 |
0.0 |
GO:0048302 |
isotype switching to IgG isotypes(GO:0048291) regulation of isotype switching to IgG isotypes(GO:0048302) |
| 0.0 |
0.4 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.0 |
0.1 |
GO:0002329 |
pre-B cell differentiation(GO:0002329) |
| 0.0 |
0.3 |
GO:0051597 |
response to methylmercury(GO:0051597) |
| 0.0 |
0.7 |
GO:1903204 |
negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.0 |
0.2 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.0 |
0.1 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.0 |
0.1 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 |
0.3 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 |
0.1 |
GO:1901020 |
negative regulation of calcium ion transmembrane transporter activity(GO:1901020) |
| 0.0 |
1.5 |
GO:0006376 |
mRNA splice site selection(GO:0006376) |
| 0.0 |
0.0 |
GO:0010586 |
miRNA metabolic process(GO:0010586) |
| 0.0 |
0.2 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 |
0.2 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.0 |
0.5 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.0 |
0.5 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 |
0.2 |
GO:1902075 |
cellular response to salt(GO:1902075) |
| 0.0 |
0.6 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 |
0.2 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 |
0.1 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) |
| 0.0 |
0.7 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.0 |
0.2 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.0 |
0.5 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 |
0.1 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.0 |
0.0 |
GO:0043496 |
regulation of protein homodimerization activity(GO:0043496) |
| 0.0 |
0.1 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.0 |
0.1 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.0 |
0.2 |
GO:0039535 |
regulation of RIG-I signaling pathway(GO:0039535) |
| 0.0 |
0.1 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 |
0.2 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) strand invasion(GO:0042148) |
| 0.0 |
1.5 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.0 |
0.1 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 |
0.3 |
GO:0008088 |
axo-dendritic transport(GO:0008088) |
| 0.0 |
0.3 |
GO:0009313 |
oligosaccharide catabolic process(GO:0009313) |
| 0.0 |
0.3 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 0.0 |
0.4 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.0 |
0.1 |
GO:1900126 |
negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 |
0.2 |
GO:0008218 |
bioluminescence(GO:0008218) |
| 0.0 |
0.3 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.0 |
0.4 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 |
0.1 |
GO:0044805 |
late nucleophagy(GO:0044805) |
| 0.0 |
0.1 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.0 |
0.1 |
GO:0032007 |
negative regulation of TOR signaling(GO:0032007) |
| 0.0 |
0.4 |
GO:0070535 |
histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.0 |
0.7 |
GO:0039702 |
viral budding via host ESCRT complex(GO:0039702) |
| 0.0 |
0.5 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.0 |
0.1 |
GO:0032364 |
oxygen homeostasis(GO:0032364) |
| 0.0 |
0.1 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.0 |
0.1 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 |
0.3 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.0 |
0.1 |
GO:0042045 |
epithelial fluid transport(GO:0042045) |
| 0.0 |
0.1 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 |
0.0 |
GO:0090296 |
base-excision repair, DNA ligation(GO:0006288) regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.0 |
0.1 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 |
0.5 |
GO:0007216 |
G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 |
0.5 |
GO:0007035 |
vacuolar acidification(GO:0007035) |
| 0.0 |
0.1 |
GO:0033028 |
myeloid cell apoptotic process(GO:0033028) |
| 0.0 |
0.5 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.0 |
0.1 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 0.0 |
0.1 |
GO:0035845 |
photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 |
0.3 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.0 |
0.3 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.0 |
0.1 |
GO:1902074 |
response to salt(GO:1902074) |
| 0.0 |
0.1 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.0 |
0.4 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.0 |
0.0 |
GO:1903760 |
regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) |
| 0.0 |
0.1 |
GO:0071468 |
cellular response to acidic pH(GO:0071468) |
| 0.0 |
0.0 |
GO:0051769 |
nitric-oxide synthase biosynthetic process(GO:0051767) regulation of nitric-oxide synthase biosynthetic process(GO:0051769) |
| 0.0 |
0.2 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.0 |
0.1 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 |
1.7 |
GO:0051384 |
response to glucocorticoid(GO:0051384) |
| 0.0 |
0.1 |
GO:0061511 |
centriole elongation(GO:0061511) |
| 0.0 |
0.4 |
GO:0071380 |
cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 |
0.3 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.0 |
0.2 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.0 |
0.0 |
GO:0060398 |
regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 |
0.2 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.1 |
GO:0021942 |
radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.0 |
0.2 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 |
0.7 |
GO:2000369 |
regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 |
0.4 |
GO:0071786 |
endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 |
0.3 |
GO:0036152 |
phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 |
0.2 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 |
0.2 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.0 |
0.1 |
GO:0042759 |
long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 |
0.2 |
GO:0036111 |
very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.0 |
0.1 |
GO:0071442 |
regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 |
0.1 |
GO:0060316 |
positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 |
0.1 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 |
0.1 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 |
0.2 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.0 |
0.2 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.0 |
0.0 |
GO:0001661 |
conditioned taste aversion(GO:0001661) |
| 0.0 |
0.1 |
GO:0099590 |
neurotransmitter receptor internalization(GO:0099590) |
| 0.0 |
0.1 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.0 |
0.2 |
GO:2000516 |
positive regulation of CD4-positive, alpha-beta T cell activation(GO:2000516) |
| 0.0 |
0.3 |
GO:0035279 |
mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 |
0.4 |
GO:0001541 |
ovarian follicle development(GO:0001541) |
| 0.0 |
0.3 |
GO:0017121 |
phospholipid scrambling(GO:0017121) |
| 0.0 |
0.2 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.0 |
0.4 |
GO:0007194 |
negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 |
0.0 |
GO:0042816 |
vitamin B6 metabolic process(GO:0042816) |
| 0.0 |
0.1 |
GO:2000659 |
regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.0 |
0.1 |
GO:0071963 |
establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 |
0.0 |
GO:0044533 |
induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.0 |
0.1 |
GO:0035457 |
cellular response to interferon-alpha(GO:0035457) |
| 0.0 |
0.2 |
GO:0002483 |
antigen processing and presentation of endogenous peptide antigen(GO:0002483) |
| 0.0 |
0.0 |
GO:0001820 |
serotonin secretion(GO:0001820) |
| 0.0 |
0.2 |
GO:1905097 |
regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
| 0.0 |
0.0 |
GO:0030856 |
regulation of epithelial cell differentiation(GO:0030856) |
| 0.0 |
0.0 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.0 |
0.1 |
GO:1903301 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.0 |
0.1 |
GO:0045109 |
intermediate filament organization(GO:0045109) |
| 0.0 |
0.1 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.0 |
0.1 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 0.0 |
0.5 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.0 |
0.1 |
GO:0051036 |
regulation of endosome size(GO:0051036) |
| 0.0 |
0.8 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.0 |
0.1 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 |
0.0 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 |
0.0 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.0 |
0.1 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.0 |
0.1 |
GO:0071420 |
cellular response to histamine(GO:0071420) |
| 0.0 |
0.1 |
GO:0051414 |
response to cortisol(GO:0051414) |
| 0.0 |
0.1 |
GO:0090218 |
positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) positive regulation of lipid kinase activity(GO:0090218) |
| 0.0 |
0.1 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.0 |
0.1 |
GO:0006478 |
peptidyl-tyrosine sulfation(GO:0006478) |
| 0.0 |
0.1 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.0 |
0.1 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 |
1.1 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.0 |
0.3 |
GO:0021772 |
olfactory bulb development(GO:0021772) |
| 0.0 |
0.0 |
GO:1903031 |
regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.0 |
0.2 |
GO:0060312 |
regulation of blood vessel remodeling(GO:0060312) |
| 0.0 |
0.0 |
GO:1902109 |
negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.0 |
0.1 |
GO:0033385 |
geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.0 |
0.1 |
GO:0042822 |
pyridoxal phosphate metabolic process(GO:0042822) |
| 0.0 |
0.1 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 |
0.0 |
GO:0018065 |
protein lipoylation(GO:0009249) protein-cofactor linkage(GO:0018065) |
| 0.0 |
0.1 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.0 |
0.5 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.0 |
1.2 |
GO:0050690 |
regulation of defense response to virus by virus(GO:0050690) |
| 0.0 |
0.1 |
GO:0014037 |
Schwann cell differentiation(GO:0014037) |
| 0.0 |
0.3 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.0 |
0.1 |
GO:0002803 |
positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.0 |
0.3 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 |
0.1 |
GO:0071545 |
inositol phosphate catabolic process(GO:0071545) |
| 0.0 |
0.1 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.0 |
1.2 |
GO:0051965 |
positive regulation of synapse assembly(GO:0051965) |
| 0.0 |
0.1 |
GO:0006612 |
protein targeting to membrane(GO:0006612) |
| 0.0 |
0.1 |
GO:0048203 |
vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.0 |
0.0 |
GO:0002669 |
positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.0 |
0.1 |
GO:1901621 |
negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.0 |
0.0 |
GO:1901837 |
negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.0 |
0.2 |
GO:0090481 |
pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.0 |
0.0 |
GO:0099558 |
maintenance of synapse structure(GO:0099558) |
| 0.0 |
0.1 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.0 |
0.1 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.0 |
0.2 |
GO:2000074 |
regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 |
0.3 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 |
0.3 |
GO:0048009 |
insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.0 |
0.1 |
GO:0010025 |
wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 |
0.4 |
GO:2001222 |
regulation of neuron migration(GO:2001222) |
| 0.0 |
0.0 |
GO:0060838 |
lymphatic endothelial cell fate commitment(GO:0060838) |
| 0.0 |
0.4 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.0 |
0.0 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.0 |
0.1 |
GO:0035574 |
histone H4-K20 demethylation(GO:0035574) |
| 0.0 |
0.5 |
GO:0007141 |
male meiosis I(GO:0007141) |
| 0.0 |
0.0 |
GO:1904017 |
response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 |
0.1 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.0 |
2.0 |
GO:0009301 |
snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 |
0.1 |
GO:0072525 |
pyridine-containing compound biosynthetic process(GO:0072525) |
| 0.0 |
0.2 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.0 |
0.0 |
GO:0031145 |
anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 |
0.1 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.0 |
0.0 |
GO:0031952 |
regulation of protein autophosphorylation(GO:0031952) |
| 0.0 |
0.0 |
GO:2000779 |
regulation of double-strand break repair(GO:2000779) |
| 0.0 |
0.3 |
GO:0008347 |
glial cell migration(GO:0008347) |
| 0.0 |
0.1 |
GO:0060152 |
peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.0 |
0.1 |
GO:0001783 |
B cell apoptotic process(GO:0001783) |
| 0.0 |
0.1 |
GO:0009395 |
phospholipid catabolic process(GO:0009395) |
| 0.0 |
0.1 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 |
0.1 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.0 |
0.4 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.0 |
0.2 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.0 |
0.2 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.0 |
0.1 |
GO:0051898 |
negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 |
0.4 |
GO:0009994 |
oocyte differentiation(GO:0009994) |
| 0.0 |
0.1 |
GO:0060526 |
prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.0 |
0.1 |
GO:0017004 |
cytochrome complex assembly(GO:0017004) |
| 0.0 |
0.1 |
GO:0010693 |
negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 |
0.1 |
GO:0003366 |
cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.0 |
0.0 |
GO:0007350 |
blastoderm segmentation(GO:0007350) |
| 0.0 |
0.0 |
GO:2000561 |
CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.0 |
0.1 |
GO:0007288 |
sperm axoneme assembly(GO:0007288) |
| 0.0 |
0.1 |
GO:0009048 |
dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 |
0.1 |
GO:0014029 |
neural crest formation(GO:0014029) |
| 0.0 |
0.3 |
GO:0015813 |
L-glutamate transport(GO:0015813) |
| 0.0 |
0.1 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 0.0 |
0.1 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.0 |
0.1 |
GO:0019242 |
methylglyoxal biosynthetic process(GO:0019242) |
| 0.0 |
0.0 |
GO:0031291 |
Ran protein signal transduction(GO:0031291) |
| 0.0 |
0.0 |
GO:0042698 |
ovulation cycle(GO:0042698) |
| 0.0 |
0.1 |
GO:0035803 |
egg coat formation(GO:0035803) |
| 0.0 |
0.1 |
GO:0034128 |
regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.0 |
0.1 |
GO:0016242 |
negative regulation of macroautophagy(GO:0016242) |
| 0.0 |
0.2 |
GO:0042340 |
keratan sulfate catabolic process(GO:0042340) |
| 0.0 |
0.2 |
GO:0030033 |
microvillus assembly(GO:0030033) |
| 0.0 |
0.3 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.0 |
0.0 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 0.0 |
0.1 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 |
0.0 |
GO:0033127 |
regulation of histone phosphorylation(GO:0033127) positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 |
0.1 |
GO:0002291 |
T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 |
0.0 |
GO:1905051 |
regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.0 |
0.1 |
GO:0002155 |
regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 |
0.0 |
GO:0046852 |
positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.0 |
0.0 |
GO:0035195 |
gene silencing by miRNA(GO:0035195) |
| 0.0 |
0.4 |
GO:0032878 |
regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.0 |
0.0 |
GO:0002767 |
immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.0 |
0.2 |
GO:0035360 |
positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.0 |
0.0 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.0 |
0.0 |
GO:0006670 |
sphingosine metabolic process(GO:0006670) |
| 0.0 |
0.1 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.0 |
0.1 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 |
0.1 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 0.0 |
0.1 |
GO:0006668 |
sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.0 |
0.0 |
GO:0048741 |
myotube cell development(GO:0014904) skeletal muscle fiber development(GO:0048741) |
| 0.0 |
0.2 |
GO:0006552 |
leucine catabolic process(GO:0006552) |
| 0.0 |
0.0 |
GO:0045113 |
integrin biosynthetic process(GO:0045112) regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 |
0.3 |
GO:0033540 |
fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.0 |
0.1 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.0 |
0.3 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 0.0 |
0.2 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.0 |
0.1 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.0 |
0.0 |
GO:0045876 |
positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 |
0.2 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 |
0.0 |
GO:0032290 |
peripheral nervous system myelin formation(GO:0032290) |
| 0.0 |
0.0 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.0 |
0.1 |
GO:0016188 |
synaptic vesicle maturation(GO:0016188) |
| 0.0 |
0.1 |
GO:0006308 |
DNA catabolic process(GO:0006308) |
| 0.0 |
0.1 |
GO:0051340 |
regulation of ligase activity(GO:0051340) |
| 0.0 |
0.0 |
GO:0001696 |
gastric acid secretion(GO:0001696) |
| 0.0 |
0.1 |
GO:0050930 |
induction of positive chemotaxis(GO:0050930) |
| 0.0 |
0.2 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
0.1 |
GO:0038195 |
urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.0 |
0.1 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.0 |
0.2 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 |
0.1 |
GO:0019285 |
glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.0 |
0.1 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.0 |
0.0 |
GO:0046709 |
IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.0 |
0.0 |
GO:1901503 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.0 |
0.1 |
GO:1900078 |
positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.0 |
0.4 |
GO:0051865 |
protein autoubiquitination(GO:0051865) |
| 0.0 |
0.1 |
GO:0035458 |
cellular response to interferon-beta(GO:0035458) |
| 0.0 |
0.0 |
GO:0097296 |
activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.0 |
0.0 |
GO:0060167 |
regulation of adenosine receptor signaling pathway(GO:0060167) |
| 0.0 |
0.0 |
GO:0071431 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 |
0.2 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.0 |
0.1 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.0 |
0.5 |
GO:0061178 |
regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
| 0.0 |
0.0 |
GO:0007228 |
positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 |
0.1 |
GO:2001014 |
regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 |
0.2 |
GO:0034332 |
adherens junction organization(GO:0034332) |
| 0.0 |
0.1 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.0 |
0.6 |
GO:0000186 |
activation of MAPKK activity(GO:0000186) |
| 0.0 |
0.0 |
GO:0009080 |
alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.0 |
0.1 |
GO:0045161 |
neuronal ion channel clustering(GO:0045161) |
| 0.0 |
0.0 |
GO:1904562 |
phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 |
0.1 |
GO:0010896 |
regulation of triglyceride catabolic process(GO:0010896) |
| 0.0 |
0.1 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.0 |
0.0 |
GO:0038109 |
response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.0 |
0.0 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 |
0.0 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.0 |
0.0 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 |
4.6 |
GO:0000209 |
protein polyubiquitination(GO:0000209) |
| 0.0 |
0.0 |
GO:0000019 |
regulation of mitotic recombination(GO:0000019) |
| 0.0 |
0.1 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 |
0.1 |
GO:0032869 |
cellular response to insulin stimulus(GO:0032869) |
| 0.0 |
0.1 |
GO:0070373 |
negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
| 0.0 |
0.6 |
GO:0016101 |
diterpenoid metabolic process(GO:0016101) |
| 0.0 |
0.0 |
GO:0072656 |
maintenance of protein location in mitochondrion(GO:0072656) |
| 0.0 |
0.4 |
GO:0015914 |
phospholipid transport(GO:0015914) |
| 0.0 |
0.1 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.0 |
0.2 |
GO:0032728 |
positive regulation of interferon-beta production(GO:0032728) |
| 0.0 |
0.0 |
GO:1902630 |
regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 |
0.0 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.0 |
0.0 |
GO:0016094 |
polyprenol biosynthetic process(GO:0016094) |
| 0.0 |
0.1 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 |
1.2 |
GO:0070268 |
cornification(GO:0070268) |
| 0.0 |
0.0 |
GO:0006821 |
chloride transport(GO:0006821) |
| 0.0 |
1.2 |
GO:0002478 |
antigen processing and presentation of exogenous peptide antigen(GO:0002478) |
| 0.0 |
0.4 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.0 |
0.0 |
GO:1904220 |
regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.0 |
0.1 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.0 |
0.2 |
GO:0050779 |
RNA destabilization(GO:0050779) |
| 0.0 |
0.1 |
GO:0009312 |
oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 |
0.1 |
GO:0006853 |
carnitine shuttle(GO:0006853) |
| 0.0 |
0.1 |
GO:2000171 |
negative regulation of dendrite development(GO:2000171) |
| 0.0 |
0.0 |
GO:0050665 |
hydrogen peroxide biosynthetic process(GO:0050665) |
| 0.0 |
0.1 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.0 |
0.1 |
GO:0044501 |
modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.0 |
0.2 |
GO:0035307 |
positive regulation of dephosphorylation(GO:0035306) positive regulation of protein dephosphorylation(GO:0035307) |
| 0.0 |
0.0 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.0 |
0.2 |
GO:0046329 |
negative regulation of JNK cascade(GO:0046329) |
| 0.0 |
0.0 |
GO:0031349 |
positive regulation of defense response(GO:0031349) |
| 0.0 |
0.0 |
GO:0043112 |
receptor metabolic process(GO:0043112) |
| 0.0 |
0.1 |
GO:0097502 |
mannosylation(GO:0097502) |
| 0.0 |
0.1 |
GO:0071934 |
thiamine transmembrane transport(GO:0071934) |
| 0.0 |
0.1 |
GO:0070257 |
positive regulation of mucus secretion(GO:0070257) |
