| 1.5 |
11.6 |
GO:0086048 |
membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 1.4 |
4.1 |
GO:0017186 |
peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 1.3 |
3.8 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 1.2 |
3.7 |
GO:0010621 |
negative regulation of transcription by transcription factor localization(GO:0010621) |
| 1.2 |
7.2 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 1.2 |
6.0 |
GO:1905072 |
apoptotic process involved in endocardial cushion morphogenesis(GO:0003277) intermediate mesoderm morphogenesis(GO:0048390) intermediate mesoderm formation(GO:0048391) intermediate mesodermal cell differentiation(GO:0048392) regulation of cardiac muscle fiber development(GO:0055018) positive regulation of cardiac muscle fiber development(GO:0055020) bud dilation involved in lung branching(GO:0060503) BMP signaling pathway involved in ureter morphogenesis(GO:0061149) renal system segmentation(GO:0061150) BMP signaling pathway involved in renal system segmentation(GO:0061151) pulmonary artery endothelial tube morphogenesis(GO:0061155) regulation of transcription from RNA polymerase II promoter involved in mesonephros development(GO:0061216) BMP signaling pathway involved in nephric duct formation(GO:0071893) negative regulation of branch elongation involved in ureteric bud branching(GO:0072096) negative regulation of branch elongation involved in ureteric bud branching by BMP signaling pathway(GO:0072097) anterior/posterior pattern specification involved in ureteric bud development(GO:0072099) specification of ureteric bud anterior/posterior symmetry(GO:0072100) specification of ureteric bud anterior/posterior symmetry by BMP signaling pathway(GO:0072101) ureter epithelial cell differentiation(GO:0072192) negative regulation of mesenchymal cell proliferation involved in ureter development(GO:0072200) positive regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901964) cardiac jelly development(GO:1905072) regulation of metanephric S-shaped body morphogenesis(GO:2000004) negative regulation of metanephric S-shaped body morphogenesis(GO:2000005) regulation of metanephric comma-shaped body morphogenesis(GO:2000006) negative regulation of metanephric comma-shaped body morphogenesis(GO:2000007) |
| 1.1 |
3.4 |
GO:0099558 |
maintenance of synapse structure(GO:0099558) |
| 1.1 |
4.5 |
GO:1904049 |
negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 1.1 |
5.4 |
GO:0003430 |
growth plate cartilage chondrocyte growth(GO:0003430) |
| 1.1 |
3.2 |
GO:1903570 |
regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 1.1 |
3.2 |
GO:0034164 |
negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 1.1 |
7.4 |
GO:0071603 |
endothelial cell-cell adhesion(GO:0071603) |
| 1.0 |
3.8 |
GO:0097156 |
fasciculation of motor neuron axon(GO:0097156) |
| 1.0 |
2.9 |
GO:0007037 |
vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.9 |
2.8 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 0.9 |
5.6 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.9 |
0.9 |
GO:0007500 |
mesodermal cell fate determination(GO:0007500) |
| 0.9 |
4.4 |
GO:0033274 |
response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.9 |
2.6 |
GO:0043449 |
cellular alkene metabolic process(GO:0043449) |
| 0.9 |
0.9 |
GO:0060038 |
cardiac muscle cell proliferation(GO:0060038) |
| 0.8 |
4.1 |
GO:1902228 |
mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.8 |
2.4 |
GO:0032223 |
negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.7 |
2.2 |
GO:0060061 |
Spemann organizer formation(GO:0060061) |
| 0.7 |
3.7 |
GO:0002528 |
regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.7 |
6.7 |
GO:0021842 |
directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.7 |
3.0 |
GO:0060721 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.7 |
1.5 |
GO:0003274 |
endocardial cushion fusion(GO:0003274) |
| 0.7 |
0.7 |
GO:0021794 |
thalamus development(GO:0021794) |
| 0.7 |
6.5 |
GO:1902748 |
mammillary body development(GO:0021767) mammillary axonal complex development(GO:0061373) positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.7 |
3.6 |
GO:1905167 |
positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.7 |
6.3 |
GO:0038026 |
reelin-mediated signaling pathway(GO:0038026) |
| 0.7 |
3.5 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.7 |
2.8 |
GO:0038033 |
positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 0.7 |
0.7 |
GO:0042214 |
terpene metabolic process(GO:0042214) |
| 0.7 |
0.7 |
GO:0051547 |
regulation of keratinocyte migration(GO:0051547) |
| 0.7 |
5.9 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.6 |
3.2 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.6 |
1.9 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 0.6 |
3.8 |
GO:0033277 |
abortive mitotic cell cycle(GO:0033277) |
| 0.6 |
2.5 |
GO:0061092 |
regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.6 |
5.6 |
GO:0010459 |
negative regulation of heart rate(GO:0010459) |
| 0.6 |
3.1 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.6 |
1.9 |
GO:0008057 |
eye pigment granule organization(GO:0008057) |
| 0.6 |
4.3 |
GO:0003172 |
primary heart field specification(GO:0003138) sinoatrial valve development(GO:0003172) sinoatrial valve morphogenesis(GO:0003185) |
| 0.6 |
1.8 |
GO:0034239 |
macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.6 |
3.6 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 0.6 |
3.0 |
GO:0048749 |
compound eye development(GO:0048749) |
| 0.6 |
3.6 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.6 |
3.6 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.6 |
0.6 |
GO:0036482 |
neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.6 |
3.5 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.6 |
0.6 |
GO:0048266 |
behavioral response to pain(GO:0048266) |
| 0.6 |
1.7 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.6 |
2.9 |
GO:0044752 |
response to human chorionic gonadotropin(GO:0044752) |
| 0.6 |
3.9 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.6 |
2.2 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.6 |
2.2 |
GO:0042247 |
morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.5 |
2.2 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.5 |
2.7 |
GO:0008050 |
female courtship behavior(GO:0008050) |
| 0.5 |
5.3 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.5 |
3.7 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.5 |
0.5 |
GO:2000074 |
regulation of type B pancreatic cell development(GO:2000074) |
| 0.5 |
2.1 |
GO:0016267 |
O-glycan processing, core 1(GO:0016267) |
| 0.5 |
1.6 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.5 |
1.5 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.5 |
2.0 |
GO:1900248 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.5 |
3.6 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.5 |
0.5 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.5 |
3.0 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.5 |
2.4 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.5 |
3.9 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.5 |
1.9 |
GO:0072299 |
visceral serous pericardium development(GO:0061032) negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.5 |
0.5 |
GO:0097252 |
oligodendrocyte apoptotic process(GO:0097252) |
| 0.5 |
3.3 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.5 |
0.5 |
GO:1902746 |
regulation of lens fiber cell differentiation(GO:1902746) |
| 0.5 |
1.4 |
GO:0002586 |
regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
| 0.5 |
0.9 |
GO:0034163 |
regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.5 |
7.1 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.4 |
1.3 |
GO:0002731 |
negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.4 |
2.2 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.4 |
1.3 |
GO:0052151 |
positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.4 |
4.0 |
GO:1904352 |
positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.4 |
2.2 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.4 |
8.8 |
GO:0006527 |
arginine catabolic process(GO:0006527) |
| 0.4 |
1.3 |
GO:0033319 |
UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.4 |
0.4 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.4 |
0.4 |
GO:1903691 |
positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.4 |
2.2 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.4 |
1.3 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.4 |
1.3 |
GO:0043012 |
regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.4 |
2.5 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.4 |
2.9 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.4 |
1.6 |
GO:1905075 |
occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.4 |
1.2 |
GO:0007509 |
mesoderm migration involved in gastrulation(GO:0007509) |
| 0.4 |
1.6 |
GO:1902361 |
mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.4 |
0.4 |
GO:0046543 |
development of secondary female sexual characteristics(GO:0046543) |
| 0.4 |
1.2 |
GO:0060086 |
circadian temperature homeostasis(GO:0060086) |
| 0.4 |
1.2 |
GO:0032849 |
positive regulation of cellular pH reduction(GO:0032849) |
| 0.4 |
1.2 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.4 |
1.2 |
GO:0060054 |
positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.4 |
1.2 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.4 |
1.5 |
GO:1990926 |
short-term synaptic potentiation(GO:1990926) |
| 0.4 |
5.4 |
GO:0036486 |
trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
| 0.4 |
3.8 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 0.4 |
5.7 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.4 |
0.4 |
GO:0009880 |
embryonic pattern specification(GO:0009880) |
| 0.4 |
1.9 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.4 |
1.5 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.4 |
2.2 |
GO:0009233 |
menaquinone metabolic process(GO:0009233) |
| 0.4 |
2.2 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.4 |
0.7 |
GO:0002424 |
T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.4 |
2.6 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.4 |
1.8 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.4 |
2.5 |
GO:0043129 |
surfactant homeostasis(GO:0043129) |
| 0.4 |
1.8 |
GO:0097327 |
response to antineoplastic agent(GO:0097327) |
| 0.4 |
0.4 |
GO:2000137 |
negative regulation of cell proliferation involved in heart morphogenesis(GO:2000137) |
| 0.4 |
0.4 |
GO:0097491 |
sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.4 |
2.5 |
GO:1903281 |
positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.4 |
0.4 |
GO:0048880 |
sensory system development(GO:0048880) |
| 0.3 |
2.4 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) |
| 0.3 |
0.3 |
GO:2000224 |
regulation of testosterone biosynthetic process(GO:2000224) |
| 0.3 |
1.4 |
GO:0002904 |
positive regulation of B cell apoptotic process(GO:0002904) |
| 0.3 |
1.7 |
GO:0015891 |
iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.3 |
0.7 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.3 |
0.7 |
GO:1900673 |
olefin metabolic process(GO:1900673) |
| 0.3 |
0.3 |
GO:2001076 |
thorax and anterior abdomen determination(GO:0007356) regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.3 |
1.3 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.3 |
3.3 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.3 |
1.6 |
GO:0003409 |
optic cup structural organization(GO:0003409) |
| 0.3 |
1.0 |
GO:0033341 |
regulation of collagen binding(GO:0033341) |
| 0.3 |
2.2 |
GO:0035879 |
plasma membrane lactate transport(GO:0035879) |
| 0.3 |
0.3 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.3 |
1.9 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.3 |
0.6 |
GO:0042311 |
vasodilation(GO:0042311) |
| 0.3 |
1.5 |
GO:0035986 |
senescence-associated heterochromatin focus assembly(GO:0035986) oncogene-induced cell senescence(GO:0090402) |
| 0.3 |
0.9 |
GO:2001226 |
negative regulation of chloride transport(GO:2001226) |
| 0.3 |
0.3 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.3 |
0.6 |
GO:0097091 |
synaptic vesicle clustering(GO:0097091) |
| 0.3 |
0.3 |
GO:0060585 |
vein smooth muscle contraction(GO:0014826) regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.3 |
1.5 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 |
0.6 |
GO:0034122 |
negative regulation of toll-like receptor signaling pathway(GO:0034122) |
| 0.3 |
1.8 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.3 |
3.6 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.3 |
1.8 |
GO:0060535 |
trachea cartilage morphogenesis(GO:0060535) |
| 0.3 |
0.9 |
GO:2000563 |
positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.3 |
0.3 |
GO:0045210 |
FasL biosynthetic process(GO:0045210) |
| 0.3 |
1.5 |
GO:0060154 |
cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.3 |
0.3 |
GO:0002514 |
B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 0.3 |
1.8 |
GO:0030421 |
defecation(GO:0030421) |
| 0.3 |
1.5 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.3 |
1.8 |
GO:0060267 |
positive regulation of respiratory burst(GO:0060267) |
| 0.3 |
5.0 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.3 |
0.9 |
GO:1900133 |
regulation of renin secretion into blood stream(GO:1900133) |
| 0.3 |
1.2 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.3 |
5.5 |
GO:0022038 |
corpus callosum development(GO:0022038) |
| 0.3 |
0.3 |
GO:1900222 |
negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.3 |
1.7 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.3 |
0.3 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.3 |
1.4 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.3 |
1.1 |
GO:1905205 |
positive regulation of connective tissue replacement(GO:1905205) |
| 0.3 |
4.2 |
GO:0060613 |
fat pad development(GO:0060613) |
| 0.3 |
2.0 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.3 |
0.6 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.3 |
1.1 |
GO:0061030 |
epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.3 |
1.7 |
GO:0070981 |
L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.3 |
0.6 |
GO:2000987 |
positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.3 |
0.8 |
GO:0046627 |
negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.3 |
1.1 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.3 |
0.8 |
GO:0043311 |
positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 0.3 |
0.8 |
GO:1904247 |
positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.3 |
9.2 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.3 |
4.0 |
GO:0016102 |
retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.3 |
3.0 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.3 |
2.9 |
GO:0072178 |
nephric duct morphogenesis(GO:0072178) |
| 0.3 |
0.8 |
GO:0072361 |
regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.3 |
1.9 |
GO:0045629 |
negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.3 |
0.8 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.3 |
1.3 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.3 |
1.6 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.3 |
2.3 |
GO:0006498 |
N-terminal protein lipidation(GO:0006498) |
| 0.3 |
0.3 |
GO:0050653 |
chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.3 |
0.3 |
GO:0042489 |
negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.3 |
1.8 |
GO:1903788 |
mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.3 |
1.0 |
GO:0036071 |
N-glycan fucosylation(GO:0036071) |
| 0.3 |
1.8 |
GO:0010171 |
body morphogenesis(GO:0010171) |
| 0.3 |
0.5 |
GO:0043091 |
L-arginine import(GO:0043091) arginine import(GO:0090467) |
| 0.3 |
0.5 |
GO:2000412 |
positive regulation of thymocyte migration(GO:2000412) |
| 0.3 |
1.5 |
GO:0019747 |
regulation of isoprenoid metabolic process(GO:0019747) |
| 0.3 |
0.8 |
GO:0032915 |
positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.2 |
2.0 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.2 |
1.5 |
GO:0097646 |
calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.2 |
0.5 |
GO:0070839 |
divalent metal ion export(GO:0070839) |
| 0.2 |
2.2 |
GO:0002606 |
positive regulation of antigen processing and presentation(GO:0002579) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.2 |
3.7 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.2 |
1.7 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.2 |
2.7 |
GO:1901725 |
regulation of histone deacetylase activity(GO:1901725) |
| 0.2 |
1.0 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.2 |
3.2 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 |
1.0 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.2 |
0.7 |
GO:1903216 |
regulation of protein processing involved in protein targeting to mitochondrion(GO:1903216) negative regulation of protein processing involved in protein targeting to mitochondrion(GO:1903217) |
| 0.2 |
0.5 |
GO:1990927 |
calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.2 |
1.0 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.2 |
1.2 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.2 |
0.7 |
GO:0021586 |
pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.2 |
2.4 |
GO:0035583 |
sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.2 |
1.2 |
GO:0002032 |
desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.2 |
1.7 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 |
1.4 |
GO:0098904 |
regulation of AV node cell action potential(GO:0098904) |
| 0.2 |
1.2 |
GO:0042412 |
taurine biosynthetic process(GO:0042412) |
| 0.2 |
0.2 |
GO:0035408 |
histone H3-T6 phosphorylation(GO:0035408) |
| 0.2 |
0.2 |
GO:0002581 |
negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
| 0.2 |
0.9 |
GO:1903028 |
positive regulation of opsonization(GO:1903028) |
| 0.2 |
1.6 |
GO:0060356 |
leucine import(GO:0060356) |
| 0.2 |
0.9 |
GO:0051005 |
negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.2 |
0.9 |
GO:0006740 |
NADPH regeneration(GO:0006740) |
| 0.2 |
0.7 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.2 |
1.9 |
GO:0090206 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.2 |
0.7 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.2 |
1.6 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.2 |
0.2 |
GO:0014839 |
myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.2 |
0.5 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.2 |
1.1 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.2 |
0.9 |
GO:0045875 |
negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.2 |
0.7 |
GO:0036333 |
hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.2 |
0.2 |
GO:0014022 |
neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.2 |
1.3 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 0.2 |
0.2 |
GO:1903903 |
regulation of establishment of T cell polarity(GO:1903903) |
| 0.2 |
0.4 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.2 |
0.4 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.2 |
0.9 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.2 |
0.2 |
GO:0003284 |
septum primum development(GO:0003284) |
| 0.2 |
0.4 |
GO:1901685 |
glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
| 0.2 |
0.7 |
GO:0042659 |
regulation of cell fate specification(GO:0042659) |
| 0.2 |
0.7 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.2 |
0.7 |
GO:0006288 |
base-excision repair, DNA ligation(GO:0006288) |
| 0.2 |
0.2 |
GO:0046108 |
uridine metabolic process(GO:0046108) |
| 0.2 |
0.2 |
GO:0030575 |
nuclear body organization(GO:0030575) |
| 0.2 |
1.1 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.2 |
0.9 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.2 |
0.2 |
GO:0006844 |
acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.2 |
1.3 |
GO:0098707 |
ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.2 |
0.9 |
GO:0021812 |
neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.2 |
1.9 |
GO:0043402 |
glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.2 |
0.2 |
GO:0000305 |
response to superoxide(GO:0000303) response to oxygen radical(GO:0000305) |
| 0.2 |
2.3 |
GO:0060510 |
Type II pneumocyte differentiation(GO:0060510) |
| 0.2 |
1.3 |
GO:0030309 |
poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.2 |
0.8 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.2 |
1.9 |
GO:1902866 |
regulation of retina development in camera-type eye(GO:1902866) |
| 0.2 |
0.6 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.2 |
1.9 |
GO:0006049 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.2 |
0.2 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.2 |
0.4 |
GO:0032964 |
collagen biosynthetic process(GO:0032964) regulation of collagen biosynthetic process(GO:0032965) |
| 0.2 |
0.8 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.2 |
2.3 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.2 |
0.8 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.2 |
0.2 |
GO:0021539 |
subthalamus development(GO:0021539) |
| 0.2 |
0.4 |
GO:0090427 |
activation of meiosis(GO:0090427) |
| 0.2 |
1.2 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 |
2.8 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.2 |
6.6 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.2 |
1.0 |
GO:0030573 |
bile acid catabolic process(GO:0030573) |
| 0.2 |
1.4 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.2 |
0.2 |
GO:0071895 |
odontoblast differentiation(GO:0071895) |
| 0.2 |
1.2 |
GO:0042501 |
serine phosphorylation of STAT protein(GO:0042501) |
| 0.2 |
1.6 |
GO:0051611 |
negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.2 |
3.5 |
GO:0046520 |
sphingoid biosynthetic process(GO:0046520) |
| 0.2 |
1.2 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.2 |
0.8 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.2 |
1.9 |
GO:0033183 |
negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.2 |
0.6 |
GO:0070446 |
cellular response to caloric restriction(GO:0061433) negative regulation of oligodendrocyte progenitor proliferation(GO:0070446) |
| 0.2 |
0.6 |
GO:0021526 |
medial motor column neuron differentiation(GO:0021526) |
| 0.2 |
0.8 |
GO:0090598 |
male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.2 |
0.8 |
GO:0071651 |
positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.2 |
0.6 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.2 |
2.1 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.2 |
0.7 |
GO:0045715 |
negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 0.2 |
3.9 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.2 |
0.7 |
GO:0009138 |
pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.2 |
0.7 |
GO:0046338 |
phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.2 |
3.0 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.2 |
0.4 |
GO:0060455 |
negative regulation of gastric acid secretion(GO:0060455) |
| 0.2 |
1.1 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.2 |
0.5 |
GO:0097187 |
dentinogenesis(GO:0097187) |
| 0.2 |
0.5 |
GO:0060743 |
epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.2 |
0.5 |
GO:1902559 |
3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.2 |
3.8 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.2 |
2.0 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.2 |
3.2 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.2 |
2.3 |
GO:0060120 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.2 |
0.5 |
GO:0042369 |
vitamin D catabolic process(GO:0042369) |
| 0.2 |
0.2 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.2 |
1.4 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.2 |
0.7 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.2 |
0.7 |
GO:2001171 |
positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.2 |
2.1 |
GO:2000580 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.2 |
0.7 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.2 |
0.4 |
GO:0072254 |
metanephric mesangial cell differentiation(GO:0072209) metanephric glomerular mesangial cell differentiation(GO:0072254) |
| 0.2 |
0.7 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.2 |
0.7 |
GO:0019285 |
glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.2 |
0.9 |
GO:0060214 |
endocardium morphogenesis(GO:0003160) endocardium formation(GO:0060214) |
| 0.2 |
1.7 |
GO:0071374 |
cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.2 |
0.5 |
GO:0098972 |
dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
| 0.2 |
0.7 |
GO:1902161 |
positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.2 |
0.7 |
GO:0060398 |
regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.2 |
1.6 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.2 |
0.9 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 0.2 |
0.5 |
GO:0002541 |
activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.2 |
0.2 |
GO:1990641 |
response to iron ion starvation(GO:1990641) |
| 0.2 |
0.2 |
GO:0055123 |
digestive system development(GO:0055123) |
| 0.2 |
0.7 |
GO:0046898 |
response to cycloheximide(GO:0046898) |
| 0.2 |
2.7 |
GO:0030949 |
positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.2 |
0.8 |
GO:0061535 |
glutamate secretion, neurotransmission(GO:0061535) |
| 0.2 |
2.0 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.2 |
1.2 |
GO:1900274 |
regulation of phospholipase C activity(GO:1900274) |
| 0.2 |
0.3 |
GO:1904220 |
regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.2 |
0.5 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.2 |
0.3 |
GO:0060545 |
positive regulation of necroptotic process(GO:0060545) |
| 0.2 |
0.7 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.2 |
1.5 |
GO:0039663 |
fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.2 |
0.7 |
GO:0035897 |
proteolysis in other organism(GO:0035897) |
| 0.2 |
0.2 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.2 |
0.3 |
GO:0098597 |
observational learning(GO:0098597) |
| 0.2 |
2.3 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.2 |
0.5 |
GO:0061582 |
colon epithelial cell migration(GO:0061580) intestinal epithelial cell migration(GO:0061582) |
| 0.2 |
0.2 |
GO:0002902 |
regulation of B cell apoptotic process(GO:0002902) negative regulation of B cell apoptotic process(GO:0002903) |
| 0.2 |
0.8 |
GO:0035633 |
maintenance of blood-brain barrier(GO:0035633) |
| 0.2 |
0.7 |
GO:0097021 |
lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.2 |
0.8 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 0.2 |
0.5 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.2 |
0.5 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.2 |
0.5 |
GO:0038169 |
somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.2 |
0.2 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.2 |
0.3 |
GO:0040014 |
regulation of multicellular organism growth(GO:0040014) |
| 0.2 |
0.2 |
GO:0035802 |
adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
| 0.2 |
0.3 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.2 |
0.6 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.2 |
0.5 |
GO:0033037 |
polysaccharide localization(GO:0033037) |
| 0.2 |
0.3 |
GO:0007497 |
posterior midgut development(GO:0007497) |
| 0.2 |
0.9 |
GO:0019427 |
acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.2 |
1.9 |
GO:0060600 |
dichotomous subdivision of an epithelial terminal unit(GO:0060600) |
| 0.2 |
3.0 |
GO:0030157 |
pancreatic juice secretion(GO:0030157) |
| 0.2 |
0.3 |
GO:2000182 |
regulation of progesterone biosynthetic process(GO:2000182) |
| 0.2 |
1.7 |
GO:1904378 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 |
2.3 |
GO:0070070 |
proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 |
2.8 |
GO:0030325 |
adrenal gland development(GO:0030325) |
| 0.2 |
0.2 |
GO:0060979 |
vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.2 |
0.9 |
GO:0043001 |
Golgi to plasma membrane protein transport(GO:0043001) |
| 0.2 |
0.3 |
GO:2000542 |
regulation of endodermal cell differentiation(GO:1903224) negative regulation of endodermal cell differentiation(GO:1903225) negative regulation of gastrulation(GO:2000542) |
| 0.2 |
0.6 |
GO:0070295 |
renal water absorption(GO:0070295) |
| 0.2 |
0.5 |
GO:1903515 |
regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) calcium ion transport from cytosol to endoplasmic reticulum(GO:1903515) |
| 0.2 |
1.7 |
GO:0044341 |
sodium-dependent phosphate transport(GO:0044341) |
| 0.2 |
0.3 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.2 |
0.6 |
GO:0018352 |
protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.2 |
0.5 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.2 |
1.2 |
GO:1990034 |
calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.2 |
2.1 |
GO:0048333 |
mesodermal cell differentiation(GO:0048333) |
| 0.2 |
1.5 |
GO:0097039 |
protein linear polyubiquitination(GO:0097039) |
| 0.2 |
0.6 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.2 |
0.5 |
GO:0002372 |
myeloid dendritic cell cytokine production(GO:0002372) |
| 0.2 |
1.5 |
GO:0015684 |
ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
| 0.2 |
0.2 |
GO:0051057 |
positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.2 |
1.2 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.1 |
2.2 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.1 |
0.6 |
GO:0016344 |
meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 |
0.9 |
GO:0042335 |
cuticle development(GO:0042335) |
| 0.1 |
3.8 |
GO:0034063 |
stress granule assembly(GO:0034063) |
| 0.1 |
0.9 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.1 |
0.4 |
GO:0035624 |
receptor transactivation(GO:0035624) |
| 0.1 |
0.6 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.1 |
0.7 |
GO:0072709 |
cellular response to sorbitol(GO:0072709) |
| 0.1 |
0.1 |
GO:1903207 |
neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.1 |
0.6 |
GO:2001287 |
negative regulation of caveolin-mediated endocytosis(GO:2001287) |
| 0.1 |
2.3 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
0.3 |
GO:0044828 |
negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 |
0.1 |
GO:0060029 |
convergent extension involved in organogenesis(GO:0060029) |
| 0.1 |
0.9 |
GO:0071955 |
recycling endosome to Golgi transport(GO:0071955) |
| 0.1 |
0.9 |
GO:0072752 |
cellular response to rapamycin(GO:0072752) |
| 0.1 |
0.3 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 0.1 |
1.0 |
GO:0050428 |
purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 |
0.3 |
GO:0061072 |
iris morphogenesis(GO:0061072) |
| 0.1 |
1.0 |
GO:0071461 |
cellular response to redox state(GO:0071461) |
| 0.1 |
0.4 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.1 |
0.7 |
GO:0043335 |
protein unfolding(GO:0043335) |
| 0.1 |
0.1 |
GO:0021626 |
hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
| 0.1 |
3.0 |
GO:0034356 |
NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.1 |
4.6 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.1 |
1.4 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.1 |
0.1 |
GO:0097084 |
vascular smooth muscle cell development(GO:0097084) |
| 0.1 |
0.3 |
GO:0010212 |
response to ionizing radiation(GO:0010212) |
| 0.1 |
0.1 |
GO:1901723 |
negative regulation of cell proliferation involved in kidney development(GO:1901723) |
| 0.1 |
0.4 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 0.1 |
0.6 |
GO:0001878 |
response to yeast(GO:0001878) |
| 0.1 |
0.3 |
GO:0032106 |
positive regulation of response to extracellular stimulus(GO:0032106) positive regulation of response to nutrient levels(GO:0032109) |
| 0.1 |
0.4 |
GO:0052553 |
induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.1 |
1.0 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.1 |
1.8 |
GO:1902074 |
response to salt(GO:1902074) |
| 0.1 |
1.0 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.1 |
1.8 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 |
0.4 |
GO:0007506 |
gonadal mesoderm development(GO:0007506) |
| 0.1 |
1.5 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.1 |
0.8 |
GO:0002051 |
osteoblast fate commitment(GO:0002051) |
| 0.1 |
0.8 |
GO:0042373 |
vitamin K metabolic process(GO:0042373) |
| 0.1 |
0.4 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.1 |
0.8 |
GO:0010816 |
neuropeptide catabolic process(GO:0010813) substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.1 |
0.4 |
GO:0008589 |
regulation of smoothened signaling pathway(GO:0008589) |
| 0.1 |
1.1 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.1 |
0.3 |
GO:0042701 |
progesterone secretion(GO:0042701) |
| 0.1 |
2.7 |
GO:0019373 |
epoxygenase P450 pathway(GO:0019373) |
| 0.1 |
0.4 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.1 |
0.5 |
GO:0019072 |
viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 |
0.8 |
GO:0006574 |
valine catabolic process(GO:0006574) |
| 0.1 |
1.6 |
GO:0070294 |
renal sodium ion absorption(GO:0070294) |
| 0.1 |
0.1 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.1 |
0.4 |
GO:0048213 |
Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.1 |
0.3 |
GO:0000429 |
carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) late viral transcription(GO:0019086) carbon catabolite regulation of transcription(GO:0045990) carbon catabolite activation of transcription(GO:0045991) regulation of transcription by glucose(GO:0046015) |
| 0.1 |
1.2 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.1 |
0.1 |
GO:0010039 |
response to iron ion(GO:0010039) |
| 0.1 |
0.5 |
GO:0072071 |
mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
| 0.1 |
0.4 |
GO:0060586 |
multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.1 |
0.8 |
GO:1902045 |
negative regulation of Fas signaling pathway(GO:1902045) |
| 0.1 |
1.9 |
GO:1904714 |
regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 |
0.9 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.1 |
0.1 |
GO:0042940 |
D-amino acid transport(GO:0042940) |
| 0.1 |
0.5 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.1 |
0.6 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.1 |
1.3 |
GO:0061303 |
cornea development in camera-type eye(GO:0061303) |
| 0.1 |
0.4 |
GO:1904717 |
excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.1 |
0.9 |
GO:0045229 |
cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.1 |
1.0 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.1 |
0.8 |
GO:0051414 |
response to cortisol(GO:0051414) |
| 0.1 |
6.3 |
GO:0061098 |
positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.1 |
0.8 |
GO:0060161 |
positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.1 |
0.5 |
GO:0070426 |
positive regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070426) positive regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070434) |
| 0.1 |
3.0 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.1 |
0.1 |
GO:0006668 |
sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.1 |
1.7 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.1 |
1.2 |
GO:0051973 |
positive regulation of telomerase activity(GO:0051973) |
| 0.1 |
0.4 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.1 |
0.4 |
GO:0003147 |
neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
| 0.1 |
0.6 |
GO:0015819 |
lysine transport(GO:0015819) L-lysine transport(GO:1902022) L-lysine transmembrane transport(GO:1903401) |
| 0.1 |
0.2 |
GO:0033024 |
mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.1 |
0.1 |
GO:0010726 |
positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.1 |
1.1 |
GO:0006021 |
inositol biosynthetic process(GO:0006021) |
| 0.1 |
1.2 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.1 |
0.5 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.1 |
0.5 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 |
0.5 |
GO:0098942 |
regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) cytoskeletal matrix organization at active zone(GO:0048789) neurexin clustering involved in presynaptic membrane assembly(GO:0097115) retrograde trans-synaptic signaling by soluble gas(GO:0098923) retrograde trans-synaptic signaling by trans-synaptic protein complex(GO:0098942) trans-synaptic signaling by soluble gas(GO:0099543) |
| 0.1 |
0.6 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.1 |
0.5 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.4 |
GO:0021538 |
epithalamus development(GO:0021538) habenula development(GO:0021986) general adaptation syndrome(GO:0051866) |
| 0.1 |
0.2 |
GO:0007198 |
adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.1 |
0.1 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 |
0.1 |
GO:0048294 |
negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.1 |
0.2 |
GO:0061470 |
T follicular helper cell differentiation(GO:0061470) |
| 0.1 |
0.6 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.1 |
1.3 |
GO:0051195 |
negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.1 |
0.5 |
GO:1903566 |
positive regulation of protein localization to cilium(GO:1903566) |
| 0.1 |
1.0 |
GO:0007265 |
Ras protein signal transduction(GO:0007265) |
| 0.1 |
0.4 |
GO:2000588 |
positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.1 |
0.4 |
GO:0045081 |
negative regulation of interleukin-10 biosynthetic process(GO:0045081) |
| 0.1 |
0.4 |
GO:0014736 |
negative regulation of muscle atrophy(GO:0014736) response to injury involved in regulation of muscle adaptation(GO:0014876) |
| 0.1 |
0.4 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.1 |
0.2 |
GO:0061364 |
apoptotic process involved in luteolysis(GO:0061364) |
| 0.1 |
0.8 |
GO:0070673 |
response to interleukin-18(GO:0070673) |
| 0.1 |
0.3 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.1 |
0.1 |
GO:0018065 |
protein lipoylation(GO:0009249) protein-cofactor linkage(GO:0018065) |
| 0.1 |
1.0 |
GO:0001714 |
endodermal cell fate specification(GO:0001714) |
| 0.1 |
1.6 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.1 |
0.3 |
GO:0021571 |
rhombomere 5 development(GO:0021571) |
| 0.1 |
0.5 |
GO:0009753 |
response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 0.1 |
0.7 |
GO:1903527 |
positive regulation of membrane tubulation(GO:1903527) |
| 0.1 |
0.6 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.1 |
0.5 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
1.0 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.1 |
0.5 |
GO:0010760 |
negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.1 |
0.2 |
GO:0046532 |
regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 |
1.1 |
GO:0021800 |
cerebral cortex tangential migration(GO:0021800) |
| 0.1 |
0.7 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.1 |
0.2 |
GO:0019521 |
aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.1 |
0.1 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 |
0.3 |
GO:0048203 |
vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.1 |
0.6 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.1 |
0.3 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.1 |
0.6 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.1 |
0.8 |
GO:1900194 |
negative regulation of oocyte maturation(GO:1900194) |
| 0.1 |
0.8 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.1 |
0.6 |
GO:0002296 |
T-helper 1 cell lineage commitment(GO:0002296) |
| 0.1 |
0.2 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.1 |
0.3 |
GO:1900245 |
positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 |
0.4 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.1 |
0.9 |
GO:0032328 |
alanine transport(GO:0032328) |
| 0.1 |
0.2 |
GO:0014829 |
vascular smooth muscle contraction(GO:0014829) |
| 0.1 |
1.2 |
GO:0035279 |
mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 |
2.8 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.5 |
GO:1904764 |
negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.1 |
0.3 |
GO:0034445 |
regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.1 |
0.6 |
GO:2000609 |
regulation of thyroid hormone generation(GO:2000609) |
| 0.1 |
0.3 |
GO:0019243 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 |
0.1 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.1 |
0.5 |
GO:0046685 |
response to arsenic-containing substance(GO:0046685) |
| 0.1 |
1.2 |
GO:1990440 |
positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 |
0.1 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.1 |
0.4 |
GO:0036483 |
neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.1 |
1.4 |
GO:0009313 |
oligosaccharide catabolic process(GO:0009313) |
| 0.1 |
0.1 |
GO:0097360 |
chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 |
0.5 |
GO:0006605 |
protein targeting(GO:0006605) |
| 0.1 |
3.1 |
GO:0045332 |
phospholipid translocation(GO:0045332) |
| 0.1 |
1.4 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.1 |
0.4 |
GO:0035865 |
cellular response to potassium ion(GO:0035865) |
| 0.1 |
2.1 |
GO:0046885 |
regulation of hormone biosynthetic process(GO:0046885) |
| 0.1 |
0.3 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 |
0.4 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.1 |
1.5 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.1 |
0.7 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
0.5 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.1 |
0.3 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 |
0.7 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.1 |
0.3 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 |
2.4 |
GO:0009437 |
carnitine metabolic process(GO:0009437) |
| 0.1 |
0.8 |
GO:0038028 |
insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 |
2.2 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 |
0.5 |
GO:1903615 |
regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
| 0.1 |
0.7 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.1 |
0.3 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.1 |
0.3 |
GO:0006433 |
prolyl-tRNA aminoacylation(GO:0006433) |
| 0.1 |
0.5 |
GO:1904995 |
negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 |
1.4 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.1 |
0.2 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.1 |
0.1 |
GO:0060268 |
negative regulation of respiratory burst(GO:0060268) |
| 0.1 |
1.1 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.1 |
1.0 |
GO:0001502 |
cartilage condensation(GO:0001502) |
| 0.1 |
0.5 |
GO:0045922 |
negative regulation of fatty acid metabolic process(GO:0045922) |
| 0.1 |
0.1 |
GO:0046619 |
optic placode formation(GO:0001743) optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.1 |
2.7 |
GO:0007158 |
neuron cell-cell adhesion(GO:0007158) |
| 0.1 |
0.1 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.1 |
0.2 |
GO:0002437 |
inflammatory response to antigenic stimulus(GO:0002437) |
| 0.1 |
0.5 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 |
0.6 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.1 |
1.4 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 |
0.4 |
GO:1904647 |
response to rotenone(GO:1904647) |
| 0.1 |
1.0 |
GO:0000101 |
sulfur amino acid transport(GO:0000101) |
| 0.1 |
0.5 |
GO:0031291 |
Ran protein signal transduction(GO:0031291) |
| 0.1 |
0.3 |
GO:0080120 |
CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.1 |
0.5 |
GO:0090156 |
cellular sphingolipid homeostasis(GO:0090156) |
| 0.1 |
0.3 |
GO:0019085 |
early viral transcription(GO:0019085) |
| 0.1 |
0.9 |
GO:0045054 |
constitutive secretory pathway(GO:0045054) |
| 0.1 |
0.7 |
GO:0042267 |
natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.1 |
0.7 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 |
0.3 |
GO:1903593 |
regulation of histamine secretion by mast cell(GO:1903593) |
| 0.1 |
0.9 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 |
0.6 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 |
0.7 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.1 |
0.4 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) negative regulation of cellular pH reduction(GO:0032848) CD8-positive, alpha-beta T cell lineage commitment(GO:0043375) regulation of retinal cell programmed cell death(GO:0046668) negative regulation of retinal cell programmed cell death(GO:0046671) |
| 0.1 |
1.7 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 |
0.4 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.1 |
0.5 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.1 |
0.7 |
GO:0032057 |
negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.1 |
0.2 |
GO:0051253 |
negative regulation of RNA metabolic process(GO:0051253) |
| 0.1 |
0.3 |
GO:1905146 |
lysosomal protein catabolic process(GO:1905146) |
| 0.1 |
1.7 |
GO:0045109 |
intermediate filament organization(GO:0045109) |
| 0.1 |
0.6 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.1 |
1.0 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.2 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.1 |
0.7 |
GO:0086042 |
cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
| 0.1 |
0.3 |
GO:0033385 |
geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.1 |
0.5 |
GO:0001757 |
somite specification(GO:0001757) |
| 0.1 |
0.4 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 |
0.2 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 0.1 |
0.4 |
GO:0051353 |
positive regulation of oxidoreductase activity(GO:0051353) |
| 0.1 |
0.4 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 |
0.1 |
GO:1904779 |
regulation of protein localization to centrosome(GO:1904779) |
| 0.1 |
0.3 |
GO:1901096 |
regulation of autophagosome maturation(GO:1901096) |
| 0.1 |
1.0 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 |
0.5 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.1 |
0.9 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 |
0.4 |
GO:0061034 |
olfactory bulb mitral cell layer development(GO:0061034) |
| 0.1 |
0.3 |
GO:0044854 |
plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
| 0.1 |
0.3 |
GO:0045792 |
negative regulation of cell size(GO:0045792) |
| 0.1 |
0.3 |
GO:0050823 |
peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.1 |
0.3 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.1 |
2.5 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 0.1 |
0.6 |
GO:1904381 |
Golgi apparatus mannose trimming(GO:1904381) |
| 0.1 |
0.3 |
GO:0035750 |
protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.1 |
0.3 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 |
0.1 |
GO:0045911 |
positive regulation of DNA recombination(GO:0045911) |
| 0.1 |
0.3 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.1 |
0.5 |
GO:2000661 |
positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.1 |
0.4 |
GO:0006687 |
glycosphingolipid metabolic process(GO:0006687) |
| 0.1 |
0.9 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
1.5 |
GO:0051450 |
myoblast proliferation(GO:0051450) |
| 0.1 |
2.2 |
GO:0007184 |
SMAD protein import into nucleus(GO:0007184) |
| 0.1 |
0.3 |
GO:0010845 |
positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.1 |
0.3 |
GO:2000097 |
regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.1 |
1.1 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.1 |
2.8 |
GO:1903393 |
positive regulation of adherens junction organization(GO:1903393) |
| 0.1 |
0.2 |
GO:0034402 |
recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.1 |
1.6 |
GO:0015012 |
heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.1 |
0.2 |
GO:1905000 |
regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.1 |
1.3 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.1 |
1.2 |
GO:0019371 |
cyclooxygenase pathway(GO:0019371) |
| 0.1 |
0.4 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.1 |
0.2 |
GO:1903721 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 |
0.5 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 |
0.2 |
GO:0061589 |
calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.1 |
0.7 |
GO:0045104 |
intermediate filament cytoskeleton organization(GO:0045104) |
| 0.1 |
0.2 |
GO:0060748 |
tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.1 |
0.4 |
GO:0048743 |
positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.1 |
0.2 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 |
0.3 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 |
0.2 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 |
0.5 |
GO:0045048 |
protein insertion into ER membrane(GO:0045048) |
| 0.1 |
0.3 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.1 |
0.2 |
GO:0048295 |
positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.1 |
0.3 |
GO:0019249 |
lactate biosynthetic process(GO:0019249) |
| 0.1 |
2.4 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.1 |
0.6 |
GO:0009048 |
dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 |
1.2 |
GO:0034058 |
endosomal vesicle fusion(GO:0034058) |
| 0.1 |
0.6 |
GO:0048563 |
post-embryonic organ morphogenesis(GO:0048563) |
| 0.1 |
0.2 |
GO:2000660 |
negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.1 |
0.8 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 |
1.0 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.1 |
1.1 |
GO:2000786 |
positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 |
0.2 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 |
0.3 |
GO:0051066 |
dihydrobiopterin metabolic process(GO:0051066) |
| 0.1 |
0.4 |
GO:0006127 |
glycerophosphate shuttle(GO:0006127) |
| 0.1 |
0.5 |
GO:0036500 |
ATF6-mediated unfolded protein response(GO:0036500) |
| 0.1 |
0.6 |
GO:0052405 |
negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.1 |
2.4 |
GO:0032011 |
ARF protein signal transduction(GO:0032011) |
| 0.1 |
0.9 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 0.1 |
0.2 |
GO:0045994 |
positive regulation of translational initiation by iron(GO:0045994) |
| 0.1 |
0.5 |
GO:1904322 |
response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.1 |
0.3 |
GO:1903301 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 |
0.4 |
GO:0017004 |
cytochrome complex assembly(GO:0017004) |
| 0.1 |
0.4 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.1 |
0.1 |
GO:0051896 |
regulation of protein kinase B signaling(GO:0051896) |
| 0.1 |
1.0 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.1 |
4.1 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.1 |
0.4 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.1 |
0.5 |
GO:0035672 |
oligopeptide transmembrane transport(GO:0035672) |
| 0.1 |
0.2 |
GO:1904562 |
phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.1 |
0.2 |
GO:0034447 |
very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.1 |
0.5 |
GO:0031179 |
peptide amidation(GO:0001519) protein amidation(GO:0018032) peptide modification(GO:0031179) |
| 0.1 |
1.7 |
GO:0016024 |
CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.1 |
0.1 |
GO:0002874 |
regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.1 |
0.1 |
GO:1990822 |
basic amino acid transmembrane transport(GO:1990822) |
| 0.1 |
0.3 |
GO:0006102 |
isocitrate metabolic process(GO:0006102) |
| 0.1 |
1.2 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.1 |
1.6 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.1 |
0.1 |
GO:0001994 |
norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.1 |
0.5 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
1.1 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 |
1.0 |
GO:1901978 |
positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.1 |
2.6 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.1 |
1.4 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.1 |
0.3 |
GO:0070842 |
aggresome assembly(GO:0070842) |
| 0.1 |
0.4 |
GO:0072512 |
ferric iron transport(GO:0015682) trivalent inorganic cation transport(GO:0072512) |
| 0.1 |
0.3 |
GO:0060152 |
peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.1 |
0.2 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 |
0.4 |
GO:0051958 |
methotrexate transport(GO:0051958) |
| 0.1 |
0.2 |
GO:0070885 |
negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.1 |
0.2 |
GO:0002803 |
positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.1 |
0.7 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.1 |
0.8 |
GO:0002084 |
protein depalmitoylation(GO:0002084) |
| 0.1 |
0.1 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.1 |
0.1 |
GO:0000422 |
mitophagy(GO:0000422) mitochondrion disassembly(GO:0061726) |
| 0.1 |
0.8 |
GO:0035826 |
rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.1 |
0.1 |
GO:0097029 |
mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 |
0.9 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.1 |
1.4 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.1 |
0.1 |
GO:1990314 |
cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.1 |
1.1 |
GO:1900103 |
positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 |
0.1 |
GO:1902617 |
response to fluoride(GO:1902617) |
| 0.1 |
1.8 |
GO:0035589 |
G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.1 |
0.7 |
GO:0010818 |
T cell chemotaxis(GO:0010818) |
| 0.1 |
0.2 |
GO:0030473 |
nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) nuclear migration along microfilament(GO:0031022) |
| 0.1 |
0.8 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 |
0.4 |
GO:0010286 |
heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 |
0.1 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.1 |
0.4 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.1 |
0.2 |
GO:0006598 |
polyamine catabolic process(GO:0006598) |
| 0.1 |
0.8 |
GO:0032354 |
response to follicle-stimulating hormone(GO:0032354) |
| 0.1 |
0.1 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.1 |
0.5 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 |
1.1 |
GO:0043578 |
nuclear matrix organization(GO:0043578) |
| 0.1 |
0.3 |
GO:0002329 |
pre-B cell differentiation(GO:0002329) |
| 0.1 |
0.1 |
GO:0014075 |
response to amine(GO:0014075) |
| 0.1 |
0.2 |
GO:1902283 |
negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.1 |
0.9 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.1 |
0.3 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
1.3 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.1 |
0.7 |
GO:0090315 |
negative regulation of protein targeting to membrane(GO:0090315) |
| 0.1 |
0.3 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 |
0.4 |
GO:0010993 |
regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 |
0.9 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.1 |
2.4 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.1 |
1.6 |
GO:0030011 |
maintenance of cell polarity(GO:0030011) |
| 0.1 |
3.7 |
GO:1903318 |
negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
| 0.1 |
0.8 |
GO:0035092 |
sperm chromatin condensation(GO:0035092) |
| 0.1 |
0.5 |
GO:0014061 |
regulation of norepinephrine secretion(GO:0014061) |
| 0.1 |
0.1 |
GO:0071280 |
cellular response to copper ion(GO:0071280) |
| 0.1 |
0.1 |
GO:0035358 |
regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) |
| 0.1 |
4.4 |
GO:0050690 |
regulation of defense response to virus by virus(GO:0050690) |
| 0.1 |
0.1 |
GO:0007439 |
ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.1 |
0.3 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 |
0.1 |
GO:0035990 |
tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.1 |
0.2 |
GO:0003050 |
regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.1 |
0.4 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 |
0.4 |
GO:0036111 |
very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.1 |
0.2 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.1 |
1.7 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.1 |
0.9 |
GO:0036508 |
protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) |
| 0.1 |
0.3 |
GO:1904978 |
regulation of endosome organization(GO:1904978) |
| 0.1 |
0.3 |
GO:0071934 |
thiamine transmembrane transport(GO:0071934) |
| 0.1 |
1.1 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 |
0.6 |
GO:0030007 |
cellular potassium ion homeostasis(GO:0030007) |
| 0.1 |
0.4 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) pyramidal neuron development(GO:0021860) |
| 0.1 |
0.2 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 0.1 |
0.2 |
GO:0048250 |
mitochondrial iron ion transport(GO:0048250) |
| 0.1 |
1.2 |
GO:0000079 |
regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) regulation of cyclin-dependent protein kinase activity(GO:1904029) |
| 0.1 |
1.8 |
GO:0050779 |
RNA destabilization(GO:0050779) |
| 0.1 |
0.1 |
GO:0030856 |
regulation of epithelial cell differentiation(GO:0030856) |
| 0.1 |
0.2 |
GO:0034499 |
late endosome to Golgi transport(GO:0034499) |
| 0.1 |
0.8 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 |
0.4 |
GO:0090190 |
positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
| 0.1 |
0.1 |
GO:0098917 |
retrograde trans-synaptic signaling(GO:0098917) |
| 0.1 |
0.1 |
GO:0007189 |
adenylate cyclase-activating G-protein coupled receptor signaling pathway(GO:0007189) |
| 0.1 |
0.5 |
GO:0015677 |
copper ion import(GO:0015677) |
| 0.1 |
0.2 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.1 |
0.3 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.1 |
0.1 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.1 |
0.4 |
GO:0050829 |
defense response to Gram-negative bacterium(GO:0050829) |
| 0.1 |
2.2 |
GO:0016236 |
macroautophagy(GO:0016236) |
| 0.1 |
1.6 |
GO:0006882 |
cellular zinc ion homeostasis(GO:0006882) |
| 0.1 |
0.1 |
GO:2000018 |
regulation of male gonad development(GO:2000018) |
| 0.1 |
0.6 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 0.1 |
0.4 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.1 |
1.1 |
GO:2000251 |
positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.1 |
0.8 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.1 |
0.3 |
GO:0050917 |
sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
| 0.1 |
1.4 |
GO:0016242 |
negative regulation of macroautophagy(GO:0016242) |
| 0.1 |
0.2 |
GO:0048769 |
sarcomerogenesis(GO:0048769) |
| 0.1 |
0.8 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.1 |
0.4 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 |
1.5 |
GO:0039702 |
viral budding via host ESCRT complex(GO:0039702) |
| 0.1 |
0.9 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.1 |
0.1 |
GO:0044533 |
induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.1 |
1.9 |
GO:0046320 |
regulation of fatty acid oxidation(GO:0046320) |
| 0.1 |
0.2 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.1 |
5.7 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.1 |
0.2 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 |
1.3 |
GO:0032878 |
regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.1 |
1.0 |
GO:0043647 |
inositol phosphate metabolic process(GO:0043647) |
| 0.1 |
0.3 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 |
0.1 |
GO:1900126 |
negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 |
1.5 |
GO:0060292 |
long term synaptic depression(GO:0060292) |
| 0.1 |
0.1 |
GO:0045103 |
intermediate filament-based process(GO:0045103) |
| 0.1 |
0.1 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.1 |
0.5 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.1 |
0.5 |
GO:0071257 |
cellular response to electrical stimulus(GO:0071257) |
| 0.1 |
0.9 |
GO:0090110 |
cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.1 |
1.3 |
GO:0071174 |
mitotic spindle checkpoint(GO:0071174) |
| 0.1 |
1.6 |
GO:0006884 |
cell volume homeostasis(GO:0006884) |
| 0.1 |
2.0 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.1 |
1.2 |
GO:0001963 |
synaptic transmission, dopaminergic(GO:0001963) |
| 0.1 |
0.3 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.1 |
0.1 |
GO:0035900 |
response to isolation stress(GO:0035900) |
| 0.1 |
0.1 |
GO:0031247 |
actin rod assembly(GO:0031247) |
| 0.1 |
0.3 |
GO:0070197 |
meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 |
0.5 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.1 |
0.9 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.1 |
0.7 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.1 |
0.1 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 |
1.6 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.1 |
0.9 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.1 |
0.2 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 |
2.1 |
GO:1904031 |
positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.1 |
0.2 |
GO:0098734 |
macromolecule depalmitoylation(GO:0098734) |
| 0.1 |
0.3 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.1 |
0.2 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.1 |
0.3 |
GO:0090241 |
negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 |
0.1 |
GO:0090149 |
mitochondrial membrane fission(GO:0090149) |
| 0.1 |
0.2 |
GO:0032455 |
nerve growth factor processing(GO:0032455) |
| 0.1 |
0.6 |
GO:0060087 |
relaxation of vascular smooth muscle(GO:0060087) |
| 0.1 |
0.4 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.1 |
0.2 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 |
0.2 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.1 |
0.1 |
GO:0045213 |
neurotransmitter receptor metabolic process(GO:0045213) |
| 0.1 |
0.1 |
GO:0035995 |
detection of muscle stretch(GO:0035995) |
| 0.1 |
1.0 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 |
0.8 |
GO:0036148 |
phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.1 |
0.2 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 0.1 |
0.2 |
GO:0008218 |
bioluminescence(GO:0008218) |
| 0.1 |
0.5 |
GO:0046661 |
male sex differentiation(GO:0046661) |
| 0.1 |
0.1 |
GO:0015680 |
intracellular copper ion transport(GO:0015680) |
| 0.1 |
0.5 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.1 |
0.2 |
GO:0021784 |
vagus nerve morphogenesis(GO:0021644) postganglionic parasympathetic fiber development(GO:0021784) chemorepulsion of branchiomotor axon(GO:0021793) regulation of negative chemotaxis(GO:0050923) |
| 0.1 |
0.8 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.1 |
0.2 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.1 |
0.8 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.1 |
0.7 |
GO:0006911 |
phagocytosis, engulfment(GO:0006911) |
| 0.1 |
0.2 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.1 |
0.6 |
GO:0042340 |
keratan sulfate catabolic process(GO:0042340) |
| 0.0 |
0.1 |
GO:0038145 |
macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.0 |
0.3 |
GO:0090141 |
positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 |
0.2 |
GO:0051608 |
histamine transport(GO:0051608) |
| 0.0 |
0.5 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 |
0.1 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 |
0.9 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.0 |
0.2 |
GO:0070445 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 |
0.3 |
GO:0031577 |
spindle checkpoint(GO:0031577) |
| 0.0 |
0.1 |
GO:0033028 |
myeloid cell apoptotic process(GO:0033028) |
| 0.0 |
0.4 |
GO:0046475 |
glycerophospholipid catabolic process(GO:0046475) |
| 0.0 |
0.6 |
GO:0098789 |
pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 |
0.2 |
GO:0090129 |
positive regulation of synapse maturation(GO:0090129) |
| 0.0 |
0.5 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 |
0.4 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.0 |
0.3 |
GO:0034128 |
negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.0 |
0.7 |
GO:0001574 |
ganglioside biosynthetic process(GO:0001574) |
| 0.0 |
1.0 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 |
0.0 |
GO:0009080 |
alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.0 |
0.1 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 |
0.4 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 |
0.1 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 |
1.5 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.1 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 |
0.2 |
GO:2000727 |
positive regulation of cardiac muscle cell differentiation(GO:2000727) |
| 0.0 |
0.3 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.0 |
0.2 |
GO:0072334 |
UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.0 |
0.6 |
GO:0033540 |
fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.0 |
0.8 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.0 |
0.4 |
GO:1903286 |
regulation of potassium ion import(GO:1903286) |
| 0.0 |
0.9 |
GO:0002385 |
mucosal immune response(GO:0002385) |
| 0.0 |
0.1 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.0 |
0.6 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.0 |
0.3 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.0 |
0.2 |
GO:0061511 |
centriole elongation(GO:0061511) |
| 0.0 |
0.1 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 |
0.2 |
GO:2000078 |
positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.0 |
0.2 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.0 |
0.5 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.0 |
0.4 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.0 |
0.1 |
GO:0009648 |
photoperiodism(GO:0009648) |
| 0.0 |
0.0 |
GO:0060462 |
lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.0 |
0.7 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 |
4.0 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.0 |
0.1 |
GO:0070309 |
lens fiber cell morphogenesis(GO:0070309) |
| 0.0 |
0.4 |
GO:0010265 |
SCF complex assembly(GO:0010265) |
| 0.0 |
0.6 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 0.0 |
0.4 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 |
0.4 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.1 |
GO:2001240 |
negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.0 |
0.6 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.0 |
0.0 |
GO:0002861 |
regulation of inflammatory response to antigenic stimulus(GO:0002861) |
| 0.0 |
0.3 |
GO:0072396 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.0 |
0.5 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.0 |
0.3 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.0 |
0.3 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.0 |
0.3 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 |
2.1 |
GO:0014047 |
glutamate secretion(GO:0014047) |
| 0.0 |
0.6 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.0 |
0.3 |
GO:0002456 |
T cell mediated immunity(GO:0002456) |
| 0.0 |
0.1 |
GO:0044818 |
mitotic G2/M transition checkpoint(GO:0044818) |
| 0.0 |
0.1 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.0 |
0.8 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.0 |
0.1 |
GO:0071677 |
positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 |
0.6 |
GO:1902430 |
negative regulation of beta-amyloid formation(GO:1902430) |
| 0.0 |
0.1 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 |
0.1 |
GO:0090649 |
response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 |
0.1 |
GO:0006929 |
substrate-dependent cell migration(GO:0006929) |
| 0.0 |
0.1 |
GO:0045824 |
negative regulation of innate immune response(GO:0045824) |
| 0.0 |
0.1 |
GO:0035459 |
cargo loading into vesicle(GO:0035459) |
| 0.0 |
0.2 |
GO:0032487 |
regulation of Rap protein signal transduction(GO:0032487) |
| 0.0 |
0.4 |
GO:0006704 |
glucocorticoid biosynthetic process(GO:0006704) |
| 0.0 |
0.2 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 |
0.1 |
GO:0099637 |
neurotransmitter receptor transport to plasma membrane(GO:0098877) postsynaptic neurotransmitter receptor cycle(GO:0099630) neurotransmitter receptor transport(GO:0099637) |
| 0.0 |
0.1 |
GO:0010862 |
positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 |
0.8 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.0 |
0.6 |
GO:0019388 |
galactose catabolic process(GO:0019388) |
| 0.0 |
0.2 |
GO:0001829 |
trophectodermal cell differentiation(GO:0001829) |
| 0.0 |
0.6 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 |
0.3 |
GO:0046498 |
S-adenosylmethionine cycle(GO:0033353) S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.0 |
0.3 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 |
0.3 |
GO:0061339 |
establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.0 |
0.2 |
GO:1905244 |
regulation of modification of synaptic structure(GO:1905244) |
| 0.0 |
0.2 |
GO:0072015 |
glomerular visceral epithelial cell development(GO:0072015) |
| 0.0 |
3.8 |
GO:0034446 |
substrate adhesion-dependent cell spreading(GO:0034446) |
| 0.0 |
0.5 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.0 |
0.1 |
GO:1905051 |
regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.0 |
4.1 |
GO:0070268 |
cornification(GO:0070268) |
| 0.0 |
0.8 |
GO:2000369 |
regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 |
0.2 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 |
0.5 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 |
0.2 |
GO:0093001 |
glycolytic process through glucose-1-phosphate(GO:0061622) glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.0 |
0.3 |
GO:0045586 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 |
0.2 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 0.0 |
0.1 |
GO:0010269 |
response to selenium ion(GO:0010269) |
| 0.0 |
0.3 |
GO:0034551 |
respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 |
0.2 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 |
0.2 |
GO:0051351 |
positive regulation of ligase activity(GO:0051351) |
| 0.0 |
0.5 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 |
0.7 |
GO:0050718 |
positive regulation of interleukin-1 beta secretion(GO:0050718) |
| 0.0 |
0.2 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.0 |
0.2 |
GO:0032494 |
response to peptidoglycan(GO:0032494) |
| 0.0 |
0.5 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 |
1.4 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.0 |
0.1 |
GO:0097237 |
cellular response to toxic substance(GO:0097237) |
| 0.0 |
0.3 |
GO:0048194 |
Golgi vesicle budding(GO:0048194) |
| 0.0 |
0.1 |
GO:0006311 |
meiotic gene conversion(GO:0006311) |
| 0.0 |
0.3 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.0 |
0.2 |
GO:2000465 |
regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.0 |
0.5 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 |
0.2 |
GO:0061734 |
parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 0.0 |
1.7 |
GO:0006370 |
7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 |
0.4 |
GO:0007614 |
short-term memory(GO:0007614) |
| 0.0 |
0.2 |
GO:0022401 |
desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.0 |
1.7 |
GO:0007029 |
endoplasmic reticulum organization(GO:0007029) |
| 0.0 |
1.6 |
GO:0007340 |
acrosome reaction(GO:0007340) |
| 0.0 |
0.2 |
GO:0006069 |
ethanol oxidation(GO:0006069) |
| 0.0 |
0.1 |
GO:0010165 |
response to X-ray(GO:0010165) |
| 0.0 |
0.5 |
GO:0070828 |
heterochromatin organization(GO:0070828) |
| 0.0 |
1.0 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.0 |
0.3 |
GO:0046632 |
alpha-beta T cell differentiation(GO:0046632) |
| 0.0 |
0.3 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 |
0.1 |
GO:0015881 |
creatine transport(GO:0015881) creatine transmembrane transport(GO:1902598) |
| 0.0 |
0.1 |
GO:0044878 |
mitotic cytokinesis checkpoint(GO:0044878) |
| 0.0 |
1.0 |
GO:1903861 |
positive regulation of dendrite extension(GO:1903861) |
| 0.0 |
0.1 |
GO:0035864 |
response to potassium ion(GO:0035864) |
| 0.0 |
0.3 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 |
0.1 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 |
0.2 |
GO:0048712 |
negative regulation of astrocyte differentiation(GO:0048712) |
| 0.0 |
0.8 |
GO:1903830 |
magnesium ion transmembrane transport(GO:1903830) |
| 0.0 |
0.1 |
GO:0044331 |
cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.0 |
0.7 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 |
0.6 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 |
0.1 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.0 |
0.1 |
GO:0042759 |
long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 |
0.1 |
GO:0061737 |
leukotriene signaling pathway(GO:0061737) |
| 0.0 |
1.5 |
GO:0001523 |
retinoid metabolic process(GO:0001523) |
| 0.0 |
0.5 |
GO:0002931 |
response to ischemia(GO:0002931) |
| 0.0 |
0.2 |
GO:0051443 |
positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.0 |
0.0 |
GO:0044144 |
regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
| 0.0 |
0.4 |
GO:0035729 |
cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.0 |
0.1 |
GO:1902513 |
regulation of organelle transport along microtubule(GO:1902513) |
| 0.0 |
0.2 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.0 |
1.1 |
GO:0035666 |
TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
| 0.0 |
0.1 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.0 |
0.2 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.0 |
0.4 |
GO:0045475 |
locomotor rhythm(GO:0045475) |
| 0.0 |
0.1 |
GO:0038084 |
vascular endothelial growth factor signaling pathway(GO:0038084) |
| 0.0 |
0.5 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.0 |
0.3 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 |
1.4 |
GO:0006958 |
complement activation, classical pathway(GO:0006958) |
| 0.0 |
0.2 |
GO:1904744 |
positive regulation of telomeric DNA binding(GO:1904744) |
| 0.0 |
0.1 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 |
1.2 |
GO:0008333 |
endosome to lysosome transport(GO:0008333) |
| 0.0 |
0.1 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 |
0.4 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 |
0.3 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.0 |
0.1 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 |
0.4 |
GO:0008612 |
peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.0 |
0.2 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.0 |
0.7 |
GO:0061462 |
protein localization to lysosome(GO:0061462) |
| 0.0 |
0.1 |
GO:0060148 |
positive regulation of posttranscriptional gene silencing(GO:0060148) |
| 0.0 |
0.1 |
GO:0050928 |
Tie signaling pathway(GO:0048014) negative regulation of positive chemotaxis(GO:0050928) |
| 0.0 |
0.1 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.0 |
0.1 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.0 |
0.1 |
GO:1904177 |
regulation of adipose tissue development(GO:1904177) |
| 0.0 |
0.1 |
GO:0039531 |
regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039531) |
| 0.0 |
0.2 |
GO:0007638 |
mechanosensory behavior(GO:0007638) |
| 0.0 |
0.4 |
GO:0033866 |
nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.0 |
0.1 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.0 |
0.2 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 |
0.1 |
GO:0019853 |
L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.0 |
0.0 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 |
0.1 |
GO:0050868 |
negative regulation of T cell activation(GO:0050868) |
| 0.0 |
0.3 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.0 |
0.4 |
GO:0048714 |
positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.0 |
0.1 |
GO:0006533 |
aspartate catabolic process(GO:0006533) |
| 0.0 |
0.5 |
GO:0070734 |
histone H3-K27 methylation(GO:0070734) |
| 0.0 |
0.0 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.0 |
0.2 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.0 |
0.1 |
GO:0006478 |
peptidyl-tyrosine sulfation(GO:0006478) |
| 0.0 |
0.2 |
GO:0097296 |
activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.0 |
0.2 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.0 |
0.2 |
GO:0010830 |
regulation of myotube differentiation(GO:0010830) |
| 0.0 |
0.1 |
GO:0071477 |
hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.0 |
0.1 |
GO:0019417 |
sulfur oxidation(GO:0019417) |
| 0.0 |
0.1 |
GO:0036378 |
calcitriol biosynthetic process from calciol(GO:0036378) |
| 0.0 |
0.3 |
GO:0036296 |
response to increased oxygen levels(GO:0036296) |
| 0.0 |
0.2 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.0 |
0.6 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 |
0.2 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 |
0.6 |
GO:0051607 |
defense response to virus(GO:0051607) |
| 0.0 |
0.1 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 |
0.1 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.0 |
0.4 |
GO:0002021 |
response to dietary excess(GO:0002021) |
| 0.0 |
0.1 |
GO:1904640 |
response to methionine(GO:1904640) |
| 0.0 |
0.1 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 |
0.1 |
GO:0097205 |
renal filtration(GO:0097205) |
| 0.0 |
0.1 |
GO:0031952 |
regulation of protein autophosphorylation(GO:0031952) |
| 0.0 |
0.6 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.0 |
0.7 |
GO:0070584 |
mitochondrion morphogenesis(GO:0070584) |
| 0.0 |
0.7 |
GO:0030204 |
chondroitin sulfate metabolic process(GO:0030204) chondroitin sulfate proteoglycan metabolic process(GO:0050654) |
| 0.0 |
0.1 |
GO:0032290 |
peripheral nervous system myelin formation(GO:0032290) |
| 0.0 |
0.3 |
GO:0009134 |
nucleoside diphosphate catabolic process(GO:0009134) |
| 0.0 |
0.1 |
GO:0071545 |
inositol phosphate catabolic process(GO:0071545) |
| 0.0 |
0.1 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.0 |
0.1 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 |
0.1 |
GO:0046629 |
gamma-delta T cell activation(GO:0046629) |
| 0.0 |
0.3 |
GO:0051155 |
positive regulation of striated muscle cell differentiation(GO:0051155) |
| 0.0 |
0.1 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.0 |
0.1 |
GO:0033685 |
negative regulation of luteinizing hormone secretion(GO:0033685) |
| 0.0 |
0.2 |
GO:0043161 |
proteasome-mediated ubiquitin-dependent protein catabolic process(GO:0043161) |
| 0.0 |
0.1 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 |
0.1 |
GO:0072720 |
cellular response to mycotoxin(GO:0036146) response to dithiothreitol(GO:0072720) |
| 0.0 |
0.3 |
GO:0014850 |
response to muscle activity(GO:0014850) |
| 0.0 |
0.1 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 |
0.7 |
GO:0016254 |
preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 |
0.3 |
GO:1902412 |
regulation of mitotic cytokinesis(GO:1902412) |
| 0.0 |
1.2 |
GO:0006497 |
protein lipidation(GO:0006497) |
| 0.0 |
0.1 |
GO:0018101 |
protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 |
0.4 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 |
0.3 |
GO:1903541 |
regulation of exosomal secretion(GO:1903541) |
| 0.0 |
0.6 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 |
0.4 |
GO:0006626 |
protein targeting to mitochondrion(GO:0006626) |
| 0.0 |
0.1 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.0 |
0.0 |
GO:1900239 |
phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.0 |
0.1 |
GO:2000121 |
regulation of removal of superoxide radicals(GO:2000121) |
| 0.0 |
0.1 |
GO:0072162 |
metanephric mesenchymal cell differentiation(GO:0072162) |
| 0.0 |
0.2 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.0 |
0.0 |
GO:1901386 |
negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 |
0.0 |
GO:0048483 |
autonomic nervous system development(GO:0048483) |
| 0.0 |
0.1 |
GO:0071774 |
response to fibroblast growth factor(GO:0071774) |
| 0.0 |
0.3 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.0 |
0.4 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 |
0.1 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.0 |
0.7 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 |
0.1 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.0 |
0.2 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.0 |
0.1 |
GO:1901018 |
positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.0 |
0.1 |
GO:0046901 |
tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.0 |
0.3 |
GO:0021954 |
central nervous system neuron development(GO:0021954) |
| 0.0 |
0.2 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.0 |
0.0 |
GO:0071421 |
manganese ion transmembrane transport(GO:0071421) |
| 0.0 |
0.0 |
GO:0038109 |
response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.0 |
0.2 |
GO:0006552 |
leucine catabolic process(GO:0006552) |
| 0.0 |
0.1 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.0 |
0.0 |
GO:1904479 |
negative regulation of intestinal absorption(GO:1904479) |
| 0.0 |
0.1 |
GO:0006848 |
pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 |
0.0 |
GO:1990167 |
protein K27-linked deubiquitination(GO:1990167) |
| 0.0 |
0.0 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 0.0 |
0.5 |
GO:0055078 |
sodium ion homeostasis(GO:0055078) |
| 0.0 |
0.3 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.0 |
0.3 |
GO:0090280 |
positive regulation of calcium ion import(GO:0090280) |
| 0.0 |
0.3 |
GO:2001222 |
regulation of neuron migration(GO:2001222) |
| 0.0 |
0.2 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.0 |
0.1 |
GO:0002353 |
kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.0 |
0.0 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 |
0.0 |
GO:0035811 |
negative regulation of urine volume(GO:0035811) |
| 0.0 |
0.1 |
GO:0071348 |
cellular response to interleukin-11(GO:0071348) |
| 0.0 |
0.2 |
GO:0061512 |
protein localization to cilium(GO:0061512) |
| 0.0 |
0.1 |
GO:1903078 |
positive regulation of protein localization to plasma membrane(GO:1903078) |
| 0.0 |
0.1 |
GO:0036229 |
glutamine transport(GO:0006868) glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.0 |
0.2 |
GO:0043313 |
regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
| 0.0 |
0.2 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 |
0.0 |
GO:0048710 |
regulation of astrocyte differentiation(GO:0048710) |
| 0.0 |
0.2 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 |
0.2 |
GO:0097119 |
postsynaptic density protein 95 clustering(GO:0097119) |
| 0.0 |
0.1 |
GO:0010693 |
negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 |
0.4 |
GO:2000273 |
positive regulation of receptor activity(GO:2000273) |
| 0.0 |
0.2 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 |
0.0 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.0 |
0.1 |
GO:0046813 |
receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 |
0.0 |
GO:0070585 |
protein localization to mitochondrion(GO:0070585) |
| 0.0 |
0.1 |
GO:2000508 |
regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 |
0.4 |
GO:0042044 |
fluid transport(GO:0042044) |
| 0.0 |
0.1 |
GO:0071963 |
establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 |
0.4 |
GO:0070987 |
error-free translesion synthesis(GO:0070987) |
| 0.0 |
0.1 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.0 |
0.0 |
GO:0006623 |
protein targeting to vacuole(GO:0006623) |
| 0.0 |
0.1 |
GO:0010133 |
proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
| 0.0 |
0.1 |
GO:0009443 |
pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.0 |
0.3 |
GO:0071380 |
cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 |
0.0 |
GO:0003197 |
endocardial cushion development(GO:0003197) |
| 0.0 |
0.2 |
GO:0070723 |
response to cholesterol(GO:0070723) |
| 0.0 |
0.1 |
GO:0036149 |
phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 |
0.4 |
GO:0001881 |
receptor recycling(GO:0001881) |
| 0.0 |
0.1 |
GO:0086046 |
membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 |
0.1 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.0 |
0.1 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) |
| 0.0 |
0.1 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.0 |
0.4 |
GO:1990830 |
response to leukemia inhibitory factor(GO:1990823) cellular response to leukemia inhibitory factor(GO:1990830) |
| 0.0 |
0.1 |
GO:1901052 |
sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.0 |
0.4 |
GO:0048009 |
insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.0 |
0.1 |
GO:0035458 |
cellular response to interferon-beta(GO:0035458) |
| 0.0 |
0.3 |
GO:0030033 |
microvillus assembly(GO:0030033) |
| 0.0 |
0.6 |
GO:0002755 |
MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 |
0.3 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.0 |
0.8 |
GO:0006081 |
cellular aldehyde metabolic process(GO:0006081) |
| 0.0 |
0.2 |
GO:0050731 |
positive regulation of peptidyl-tyrosine phosphorylation(GO:0050731) |
| 0.0 |
0.0 |
GO:1902527 |
positive regulation of protein monoubiquitination(GO:1902527) |
| 0.0 |
0.4 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 |
0.0 |
GO:0097106 |
postsynaptic density organization(GO:0097106) |
| 0.0 |
0.1 |
GO:1905045 |
Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
| 0.0 |
0.1 |
GO:0070544 |
histone lysine demethylation(GO:0070076) histone H3-K36 demethylation(GO:0070544) |
| 0.0 |
0.0 |
GO:1904397 |
negative regulation of neuromuscular junction development(GO:1904397) |
| 0.0 |
0.0 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.0 |
0.1 |
GO:0071440 |
regulation of histone H3-K14 acetylation(GO:0071440) |
| 0.0 |
1.3 |
GO:0007229 |
integrin-mediated signaling pathway(GO:0007229) |
| 0.0 |
0.3 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.0 |
0.3 |
GO:1900227 |
positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 |
1.5 |
GO:1903955 |
positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 |
0.1 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.0 |
0.1 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 |
0.3 |
GO:0051898 |
negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 |
0.1 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 |
0.4 |
GO:0000186 |
activation of MAPKK activity(GO:0000186) |
| 0.0 |
0.2 |
GO:0090026 |
positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.0 |
0.1 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 |
0.1 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 |
0.1 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 |
0.0 |
GO:0060487 |
lung epithelial cell differentiation(GO:0060487) |
| 0.0 |
0.1 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 |
0.0 |
GO:0000472 |
endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.0 |
0.6 |
GO:0007520 |
myoblast fusion(GO:0007520) |
| 0.0 |
0.2 |
GO:0060965 |
negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.0 |
0.1 |
GO:0038095 |
Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 |
0.1 |
GO:0009972 |
cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.0 |
0.1 |
GO:0036499 |
PERK-mediated unfolded protein response(GO:0036499) |
| 0.0 |
0.1 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 |
0.1 |
GO:0014741 |
negative regulation of cardiac muscle hypertrophy(GO:0010614) negative regulation of muscle hypertrophy(GO:0014741) |
| 0.0 |
0.1 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.0 |
0.0 |
GO:0006572 |
tyrosine catabolic process(GO:0006572) |
| 0.0 |
0.0 |
GO:0034755 |
iron ion transmembrane transport(GO:0034755) |
| 0.0 |
0.2 |
GO:0034656 |
nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 |
0.8 |
GO:0051965 |
positive regulation of synapse assembly(GO:0051965) |
| 0.0 |
0.0 |
GO:2000360 |
negative regulation of fertilization(GO:0060467) negative regulation of binding of sperm to zona pellucida(GO:2000360) |
| 0.0 |
0.2 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.0 |
0.1 |
GO:0070358 |
actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 |
0.1 |
GO:0051560 |
mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.0 |
0.7 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.0 |
0.0 |
GO:0035720 |
intraciliary anterograde transport(GO:0035720) |
| 0.0 |
0.1 |
GO:0010508 |
positive regulation of autophagy(GO:0010508) |
| 0.0 |
0.2 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 |
0.6 |
GO:0045670 |
regulation of osteoclast differentiation(GO:0045670) |
| 0.0 |
0.1 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.0 |
0.2 |
GO:0036152 |
phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 |
0.1 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 0.0 |
0.1 |
GO:0045187 |
regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.0 |
0.1 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.0 |
0.0 |
GO:0048736 |
appendage development(GO:0048736) limb development(GO:0060173) |
| 0.0 |
0.1 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.0 |
0.1 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.0 |
0.0 |
GO:0030854 |
eosinophil differentiation(GO:0030222) positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 |
0.1 |
GO:0002175 |
protein localization to paranode region of axon(GO:0002175) |
| 0.0 |
0.1 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.0 |
0.1 |
GO:0048820 |
hair follicle maturation(GO:0048820) |
| 0.0 |
0.0 |
GO:2000505 |
regulation of energy homeostasis(GO:2000505) |
| 0.0 |
0.3 |
GO:0044364 |
killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.0 |
0.1 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.0 |
0.0 |
GO:0060372 |
regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.0 |
0.2 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.0 |
0.1 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.0 |
0.1 |
GO:0048741 |
skeletal muscle fiber development(GO:0048741) |
| 0.0 |
0.2 |
GO:0021988 |
olfactory bulb development(GO:0021772) olfactory lobe development(GO:0021988) |
| 0.0 |
0.1 |
GO:0015742 |
alpha-ketoglutarate transport(GO:0015742) |
| 0.0 |
0.1 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.1 |
GO:0072321 |
chaperone-mediated protein transport(GO:0072321) |
| 0.0 |
0.1 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 |
0.1 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.0 |
1.7 |
GO:0046328 |
regulation of JNK cascade(GO:0046328) |
| 0.0 |
0.1 |
GO:0042357 |
thiamine diphosphate metabolic process(GO:0042357) |
| 0.0 |
0.1 |
GO:0006878 |
cellular copper ion homeostasis(GO:0006878) |
| 0.0 |
0.1 |
GO:0035494 |
SNARE complex disassembly(GO:0035494) |
| 0.0 |
0.1 |
GO:0006777 |
Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 |
0.5 |
GO:0061178 |
regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
| 0.0 |
0.2 |
GO:0009312 |
oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 |
0.2 |
GO:0007194 |
negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 |
0.1 |
GO:0090481 |
pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.0 |
0.1 |
GO:0045161 |
neuronal ion channel clustering(GO:0045161) |
| 0.0 |
0.1 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 |
0.8 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 |
0.1 |
GO:0046449 |
creatinine metabolic process(GO:0046449) |
| 0.0 |
0.0 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.0 |
0.0 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.0 |
0.1 |
GO:0071549 |
cellular response to dexamethasone stimulus(GO:0071549) |
| 0.0 |
0.2 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.0 |
0.0 |
GO:0042182 |
ketone catabolic process(GO:0042182) |
| 0.0 |
0.1 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 |
0.8 |
GO:0002576 |
platelet degranulation(GO:0002576) |
| 0.0 |
0.1 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 |
0.0 |
GO:0072656 |
maintenance of protein location in mitochondrion(GO:0072656) |
