| 0.7 |
3.0 |
GO:0061349 |
chemoattraction of serotonergic neuron axon(GO:0036517) planar cell polarity pathway involved in outflow tract morphogenesis(GO:0061347) planar cell polarity pathway involved in ventricular septum morphogenesis(GO:0061348) planar cell polarity pathway involved in cardiac right atrium morphogenesis(GO:0061349) planar cell polarity pathway involved in cardiac muscle tissue morphogenesis(GO:0061350) planar cell polarity pathway involved in pericardium morphogenesis(GO:0061354) chemoattraction of axon(GO:0061642) negative regulation of cell proliferation in midbrain(GO:1904934) planar cell polarity pathway involved in midbrain dopaminergic neuron differentiation(GO:1904955) |
| 0.6 |
2.3 |
GO:0000412 |
histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.4 |
0.4 |
GO:0060775 |
mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.4 |
0.4 |
GO:0070570 |
regulation of axon regeneration(GO:0048679) regulation of neuron projection regeneration(GO:0070570) |
| 0.3 |
1.9 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.3 |
1.2 |
GO:0017198 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.3 |
1.6 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.3 |
1.5 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.3 |
1.3 |
GO:0048749 |
compound eye development(GO:0048749) |
| 0.3 |
0.3 |
GO:0010666 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.2 |
1.0 |
GO:0042323 |
negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 0.2 |
1.2 |
GO:2000691 |
regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.2 |
0.7 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 0.2 |
0.9 |
GO:0042361 |
menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 0.2 |
0.6 |
GO:0070105 |
positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.2 |
0.6 |
GO:1901076 |
positive regulation of engulfment of apoptotic cell(GO:1901076) |
| 0.2 |
0.8 |
GO:1904199 |
positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
| 0.2 |
0.6 |
GO:0036146 |
cellular response to mycotoxin(GO:0036146) |
| 0.2 |
0.6 |
GO:1901383 |
negative regulation of chorionic trophoblast cell proliferation(GO:1901383) |
| 0.2 |
1.1 |
GO:0097021 |
lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.2 |
0.6 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.2 |
0.5 |
GO:0050720 |
interleukin-1 beta biosynthetic process(GO:0050720) |
| 0.2 |
0.5 |
GO:1901052 |
sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.2 |
0.2 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.2 |
0.5 |
GO:1905000 |
regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.2 |
0.5 |
GO:0050894 |
determination of affect(GO:0050894) |
| 0.2 |
0.5 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.2 |
0.5 |
GO:0006173 |
dADP biosynthetic process(GO:0006173) |
| 0.2 |
1.0 |
GO:1904674 |
positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.2 |
0.5 |
GO:2000824 |
negative regulation of androgen receptor activity(GO:2000824) |
| 0.2 |
0.5 |
GO:0051145 |
smooth muscle cell differentiation(GO:0051145) |
| 0.2 |
0.5 |
GO:0045956 |
positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.2 |
0.2 |
GO:0044333 |
Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.1 |
1.0 |
GO:0071279 |
cellular response to cobalt ion(GO:0071279) |
| 0.1 |
0.3 |
GO:0061289 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.1 |
0.6 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.1 |
0.9 |
GO:0010512 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.1 |
0.3 |
GO:0022029 |
forebrain cell migration(GO:0021885) telencephalon cell migration(GO:0022029) |
| 0.1 |
0.6 |
GO:0042369 |
vitamin D catabolic process(GO:0042369) |
| 0.1 |
0.7 |
GO:0003366 |
cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.1 |
0.6 |
GO:0010133 |
proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
| 0.1 |
0.8 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 |
0.1 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.1 |
1.8 |
GO:0030259 |
lipid glycosylation(GO:0030259) |
| 0.1 |
0.5 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 0.1 |
1.2 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 |
0.4 |
GO:0098884 |
postsynaptic neurotransmitter receptor internalization(GO:0098884) |
| 0.1 |
0.1 |
GO:0051932 |
synaptic transmission, GABAergic(GO:0051932) |
| 0.1 |
0.1 |
GO:1900736 |
regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 0.1 |
0.4 |
GO:1990641 |
response to iron ion starvation(GO:1990641) |
| 0.1 |
0.5 |
GO:0098942 |
regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) cytoskeletal matrix organization at active zone(GO:0048789) neurexin clustering involved in presynaptic membrane assembly(GO:0097115) retrograde trans-synaptic signaling by trans-synaptic protein complex(GO:0098942) |
| 0.1 |
0.4 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.1 |
0.5 |
GO:1903979 |
negative regulation of microglial cell activation(GO:1903979) |
| 0.1 |
0.4 |
GO:0060988 |
lipid tube assembly(GO:0060988) |
| 0.1 |
0.2 |
GO:0019322 |
pentose biosynthetic process(GO:0019322) |
| 0.1 |
0.4 |
GO:0009080 |
alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.1 |
0.6 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.1 |
0.5 |
GO:0046340 |
diacylglycerol catabolic process(GO:0046340) |
| 0.1 |
0.1 |
GO:0019395 |
fatty acid oxidation(GO:0019395) |
| 0.1 |
0.6 |
GO:0045007 |
depurination(GO:0045007) |
| 0.1 |
0.1 |
GO:1902074 |
response to salt(GO:1902074) |
| 0.1 |
2.7 |
GO:0070262 |
peptidyl-serine dephosphorylation(GO:0070262) |
| 0.1 |
0.3 |
GO:1904761 |
negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.1 |
0.2 |
GO:0019732 |
antifungal humoral response(GO:0019732) |
| 0.1 |
0.3 |
GO:1990697 |
protein depalmitoleylation(GO:1990697) |
| 0.1 |
0.9 |
GO:0071918 |
urea transmembrane transport(GO:0071918) |
| 0.1 |
0.3 |
GO:0007198 |
adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.1 |
0.9 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 |
0.4 |
GO:0032097 |
positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.1 |
0.7 |
GO:2001151 |
regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 0.1 |
0.3 |
GO:0034755 |
iron ion transmembrane transport(GO:0034755) |
| 0.1 |
0.3 |
GO:0060054 |
positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.1 |
0.3 |
GO:1903450 |
regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.1 |
0.5 |
GO:0034224 |
cellular response to zinc ion starvation(GO:0034224) |
| 0.1 |
0.3 |
GO:0040040 |
thermosensory behavior(GO:0040040) |
| 0.1 |
0.3 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 |
0.6 |
GO:0050925 |
negative regulation of negative chemotaxis(GO:0050925) |
| 0.1 |
0.4 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 |
0.1 |
GO:0044839 |
cell cycle G2/M phase transition(GO:0044839) |
| 0.1 |
0.3 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 |
0.3 |
GO:0000711 |
meiotic DNA repair synthesis(GO:0000711) |
| 0.1 |
0.6 |
GO:1902474 |
positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 |
1.0 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.1 |
0.1 |
GO:0006091 |
generation of precursor metabolites and energy(GO:0006091) |
| 0.1 |
0.6 |
GO:0014806 |
smooth muscle hyperplasia(GO:0014806) |
| 0.1 |
0.2 |
GO:1900039 |
positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.1 |
0.3 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 |
0.9 |
GO:0032264 |
IMP salvage(GO:0032264) |
| 0.1 |
0.4 |
GO:0072709 |
cellular response to sorbitol(GO:0072709) |
| 0.1 |
0.1 |
GO:0071288 |
cellular response to mercury ion(GO:0071288) |
| 0.1 |
0.3 |
GO:1900276 |
regulation of proteinase activated receptor activity(GO:1900276) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
| 0.1 |
0.6 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.1 |
1.0 |
GO:0070560 |
protein secretion by platelet(GO:0070560) |
| 0.1 |
0.9 |
GO:0018916 |
nitrobenzene metabolic process(GO:0018916) |
| 0.1 |
0.4 |
GO:0097049 |
motor neuron apoptotic process(GO:0097049) |
| 0.1 |
0.2 |
GO:1903010 |
regulation of bone development(GO:1903010) |
| 0.1 |
0.3 |
GO:1903061 |
regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.1 |
0.2 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 |
0.1 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.1 |
0.4 |
GO:0051122 |
hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 |
0.3 |
GO:0043012 |
regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.1 |
0.5 |
GO:0046092 |
deoxycytidine metabolic process(GO:0046092) |
| 0.1 |
0.5 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.1 |
0.4 |
GO:1900104 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.1 |
0.8 |
GO:0002074 |
extraocular skeletal muscle development(GO:0002074) |
| 0.1 |
0.4 |
GO:0000270 |
peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.1 |
0.4 |
GO:1903412 |
response to bile acid(GO:1903412) |
| 0.1 |
0.3 |
GO:0071901 |
negative regulation of protein serine/threonine kinase activity(GO:0071901) |
| 0.1 |
0.2 |
GO:0032098 |
regulation of appetite(GO:0032098) |
| 0.1 |
0.4 |
GO:0044210 |
'de novo' CTP biosynthetic process(GO:0044210) |
| 0.1 |
0.2 |
GO:0060809 |
mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.1 |
0.4 |
GO:0097069 |
cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 0.1 |
1.4 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.1 |
0.1 |
GO:0035634 |
response to stilbenoid(GO:0035634) |
| 0.1 |
0.5 |
GO:2000253 |
positive regulation of feeding behavior(GO:2000253) |
| 0.1 |
0.3 |
GO:0044537 |
regulation of circulating fibrinogen levels(GO:0044537) |
| 0.1 |
0.3 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.1 |
0.1 |
GO:0048372 |
lateral mesodermal cell fate commitment(GO:0048372) lateral mesodermal cell fate specification(GO:0048377) regulation of lateral mesodermal cell fate specification(GO:0048378) |
| 0.1 |
0.4 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.1 |
0.2 |
GO:0043553 |
negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 |
0.3 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.1 |
0.3 |
GO:0043317 |
regulation of cytotoxic T cell degranulation(GO:0043317) negative regulation of cytotoxic T cell degranulation(GO:0043318) |
| 0.1 |
0.3 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 |
0.2 |
GO:1903203 |
regulation of oxidative stress-induced neuron death(GO:1903203) |
| 0.1 |
0.3 |
GO:0099558 |
maintenance of synapse structure(GO:0099558) |
| 0.1 |
1.9 |
GO:0098828 |
positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.1 |
0.6 |
GO:1903788 |
mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.1 |
0.1 |
GO:0019748 |
secondary metabolic process(GO:0019748) |
| 0.1 |
0.1 |
GO:0006071 |
glycerol metabolic process(GO:0006071) |
| 0.1 |
0.2 |
GO:0044571 |
[2Fe-2S] cluster assembly(GO:0044571) |
| 0.1 |
0.2 |
GO:0016185 |
synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.1 |
0.1 |
GO:0003190 |
atrioventricular valve formation(GO:0003190) |
| 0.1 |
0.3 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.1 |
0.3 |
GO:0014028 |
notochord formation(GO:0014028) |
| 0.1 |
0.4 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.1 |
0.2 |
GO:0060823 |
canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 0.1 |
0.5 |
GO:0009181 |
purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.1 |
0.7 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.1 |
0.1 |
GO:0051602 |
response to electrical stimulus(GO:0051602) |
| 0.1 |
0.4 |
GO:1903597 |
negative regulation of gap junction assembly(GO:1903597) |
| 0.1 |
0.2 |
GO:0098972 |
dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
| 0.1 |
0.1 |
GO:0006714 |
sesquiterpenoid metabolic process(GO:0006714) sesquiterpenoid catabolic process(GO:0016107) farnesol metabolic process(GO:0016487) farnesol catabolic process(GO:0016488) |
| 0.1 |
0.1 |
GO:0061056 |
sclerotome development(GO:0061056) |
| 0.1 |
0.1 |
GO:0021684 |
cerebellar granular layer formation(GO:0021684) cerebellar cortex formation(GO:0021697) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 |
0.2 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 |
0.1 |
GO:0043497 |
regulation of protein heterodimerization activity(GO:0043497) |
| 0.1 |
0.6 |
GO:0055014 |
atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.1 |
0.1 |
GO:2000583 |
regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 0.1 |
0.4 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 |
0.2 |
GO:0045041 |
protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.1 |
0.1 |
GO:0046878 |
positive regulation of saliva secretion(GO:0046878) |
| 0.1 |
0.3 |
GO:1901491 |
negative regulation of lymphangiogenesis(GO:1901491) |
| 0.1 |
0.4 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.1 |
0.5 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 |
0.2 |
GO:0045062 |
extrathymic T cell selection(GO:0045062) |
| 0.1 |
0.3 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.1 |
0.2 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 |
0.4 |
GO:0008050 |
female courtship behavior(GO:0008050) |
| 0.1 |
0.5 |
GO:1903903 |
regulation of establishment of T cell polarity(GO:1903903) |
| 0.1 |
0.2 |
GO:0090675 |
intermicrovillar adhesion(GO:0090675) |
| 0.1 |
0.2 |
GO:0002025 |
vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.1 |
0.1 |
GO:0010482 |
epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 |
0.2 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.1 |
1.7 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.1 |
0.4 |
GO:0038027 |
apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 0.1 |
0.4 |
GO:0045200 |
establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 |
0.2 |
GO:0086055 |
atrial ventricular junction remodeling(GO:0003294) atrial cardiac muscle cell to AV node cell communication by electrical coupling(GO:0086044) bundle of His cell to Purkinje myocyte communication by electrical coupling(GO:0086054) Purkinje myocyte to ventricular cardiac muscle cell communication by electrical coupling(GO:0086055) regulation of Purkinje myocyte action potential(GO:0098906) vasomotion(GO:1990029) |
| 0.1 |
0.2 |
GO:0043181 |
vacuolar sequestering(GO:0043181) |
| 0.1 |
0.1 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.1 |
0.4 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 |
0.2 |
GO:0034650 |
cortisol metabolic process(GO:0034650) cortisol biosynthetic process(GO:0034651) |
| 0.1 |
0.5 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 |
0.7 |
GO:2001300 |
lipoxin metabolic process(GO:2001300) |
| 0.1 |
0.1 |
GO:0060940 |
epithelial to mesenchymal transition involved in cardiac fibroblast development(GO:0060940) |
| 0.1 |
1.4 |
GO:0019532 |
oxalate transport(GO:0019532) |
| 0.1 |
0.4 |
GO:0044027 |
hypermethylation of CpG island(GO:0044027) |
| 0.1 |
1.4 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 |
0.3 |
GO:1904800 |
regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.1 |
0.1 |
GO:0044849 |
estrous cycle(GO:0044849) |
| 0.1 |
0.1 |
GO:0070358 |
actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 |
0.6 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.1 |
0.1 |
GO:1902809 |
regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 |
0.1 |
GO:0003104 |
positive regulation of glomerular filtration(GO:0003104) |
| 0.1 |
0.2 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
0.4 |
GO:0010751 |
negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.1 |
0.3 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 |
1.0 |
GO:0023041 |
neuronal signal transduction(GO:0023041) |
| 0.1 |
1.0 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 |
0.3 |
GO:1904886 |
beta-catenin destruction complex disassembly(GO:1904886) |
| 0.1 |
0.1 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 |
0.3 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.1 |
0.2 |
GO:1901569 |
leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.1 |
0.2 |
GO:1903697 |
negative regulation of microvillus assembly(GO:1903697) |
| 0.1 |
0.3 |
GO:1905232 |
cellular response to L-glutamate(GO:1905232) |
| 0.1 |
0.1 |
GO:0006090 |
pyruvate metabolic process(GO:0006090) |
| 0.1 |
0.9 |
GO:2001016 |
positive regulation of skeletal muscle cell differentiation(GO:2001016) |
| 0.1 |
0.2 |
GO:0002541 |
activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.1 |
0.3 |
GO:0060721 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.1 |
0.2 |
GO:0042137 |
sequestering of neurotransmitter(GO:0042137) |
| 0.1 |
0.2 |
GO:0021912 |
regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.1 |
0.1 |
GO:1904398 |
positive regulation of neuromuscular junction development(GO:1904398) |
| 0.1 |
0.2 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.1 |
0.2 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.1 |
0.2 |
GO:0071373 |
cellular response to luteinizing hormone stimulus(GO:0071373) |
| 0.1 |
0.1 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 |
0.4 |
GO:0044805 |
late nucleophagy(GO:0044805) |
| 0.1 |
0.2 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.1 |
0.3 |
GO:1903028 |
positive regulation of opsonization(GO:1903028) |
| 0.1 |
0.3 |
GO:1903778 |
protein localization to vacuolar membrane(GO:1903778) |
| 0.1 |
0.1 |
GO:0007195 |
adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.1 |
0.1 |
GO:1901656 |
glycoside transport(GO:1901656) |
| 0.1 |
0.3 |
GO:0019442 |
tryptophan catabolic process to acetyl-CoA(GO:0019442) |
| 0.1 |
0.3 |
GO:2000435 |
regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.1 |
0.3 |
GO:0070901 |
mitochondrial tRNA methylation(GO:0070901) |
| 0.1 |
0.7 |
GO:0036112 |
medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 |
0.1 |
GO:0032455 |
nerve growth factor processing(GO:0032455) |
| 0.1 |
0.1 |
GO:0061341 |
non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.1 |
0.3 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.1 |
0.4 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 |
0.1 |
GO:0035864 |
response to potassium ion(GO:0035864) |
| 0.1 |
0.3 |
GO:1901073 |
N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.1 |
0.1 |
GO:0033014 |
tetrapyrrole biosynthetic process(GO:0033014) |
| 0.1 |
0.1 |
GO:0050885 |
neuromuscular process controlling balance(GO:0050885) |
| 0.1 |
0.1 |
GO:0033600 |
negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.1 |
0.1 |
GO:1905166 |
negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 0.1 |
0.1 |
GO:0042320 |
regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) |
| 0.1 |
0.3 |
GO:0097327 |
response to antineoplastic agent(GO:0097327) |
| 0.1 |
2.9 |
GO:0071276 |
cellular response to cadmium ion(GO:0071276) |
| 0.1 |
0.1 |
GO:0034144 |
negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 0.1 |
0.1 |
GO:0050882 |
voluntary musculoskeletal movement(GO:0050882) |
| 0.1 |
0.2 |
GO:0001543 |
ovarian follicle rupture(GO:0001543) |
| 0.1 |
0.2 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 |
0.4 |
GO:0072658 |
maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.1 |
0.2 |
GO:0051597 |
response to methylmercury(GO:0051597) |
| 0.1 |
0.1 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 |
0.2 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.1 |
0.2 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.1 |
0.4 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.1 |
0.2 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 |
0.3 |
GO:0042351 |
'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.1 |
0.1 |
GO:0032289 |
central nervous system myelin formation(GO:0032289) |
| 0.1 |
0.2 |
GO:0007509 |
mesoderm migration involved in gastrulation(GO:0007509) |
| 0.1 |
0.2 |
GO:1903461 |
Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.1 |
0.4 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.1 |
0.3 |
GO:0000738 |
DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.1 |
0.3 |
GO:0099601 |
regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.1 |
0.3 |
GO:0001661 |
conditioned taste aversion(GO:0001661) |
| 0.1 |
0.5 |
GO:0000066 |
mitochondrial ornithine transport(GO:0000066) |
| 0.1 |
0.2 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.1 |
0.1 |
GO:0036115 |
fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.1 |
0.1 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 |
0.2 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.1 |
0.1 |
GO:1904844 |
response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.1 |
0.1 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.1 |
0.3 |
GO:0038108 |
negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.1 |
0.1 |
GO:0018352 |
protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.1 |
0.1 |
GO:1900138 |
negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.1 |
0.1 |
GO:0071372 |
cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.1 |
0.2 |
GO:0042308 |
negative regulation of protein import into nucleus(GO:0042308) negative regulation of protein import(GO:1904590) |
| 0.1 |
0.2 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
0.2 |
GO:1902490 |
regulation of sperm capacitation(GO:1902490) |
| 0.1 |
0.1 |
GO:0051138 |
positive regulation of NK T cell differentiation(GO:0051138) |
| 0.1 |
0.4 |
GO:0034182 |
regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
| 0.1 |
0.2 |
GO:0033385 |
geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.1 |
0.4 |
GO:0015791 |
polyol transport(GO:0015791) |
| 0.1 |
0.2 |
GO:1904428 |
negative regulation of tubulin deacetylation(GO:1904428) |
| 0.1 |
1.8 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.1 |
0.7 |
GO:0048563 |
post-embryonic organ morphogenesis(GO:0048563) |
| 0.1 |
0.7 |
GO:0006655 |
phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.1 |
0.1 |
GO:0006258 |
UDP-glucose catabolic process(GO:0006258) |
| 0.1 |
0.2 |
GO:0002232 |
leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.1 |
0.1 |
GO:0010224 |
response to UV-B(GO:0010224) |
| 0.1 |
0.5 |
GO:0060267 |
positive regulation of respiratory burst(GO:0060267) |
| 0.1 |
0.2 |
GO:1902109 |
negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.1 |
0.2 |
GO:2000276 |
negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.1 |
0.5 |
GO:0021842 |
directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.1 |
0.6 |
GO:0021894 |
cerebral cortex GABAergic interneuron development(GO:0021894) |
| 0.1 |
0.2 |
GO:1903707 |
negative regulation of hemopoiesis(GO:1903707) |
| 0.1 |
0.4 |
GO:0001757 |
somite specification(GO:0001757) |
| 0.1 |
1.1 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.1 |
1.2 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.1 |
0.3 |
GO:0032425 |
positive regulation of mismatch repair(GO:0032425) |
| 0.1 |
0.2 |
GO:0051685 |
maintenance of ER location(GO:0051685) |
| 0.1 |
0.2 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.1 |
0.3 |
GO:0042412 |
taurine biosynthetic process(GO:0042412) |
| 0.1 |
0.1 |
GO:0005988 |
lactose metabolic process(GO:0005988) lactose biosynthetic process(GO:0005989) |
| 0.1 |
0.1 |
GO:0021830 |
interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.1 |
0.1 |
GO:0061370 |
testosterone biosynthetic process(GO:0061370) |
| 0.1 |
0.2 |
GO:1903280 |
negative regulation of calcium:sodium antiporter activity(GO:1903280) |
| 0.1 |
0.1 |
GO:0009149 |
pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 0.1 |
0.2 |
GO:0010950 |
positive regulation of endopeptidase activity(GO:0010950) |
| 0.1 |
0.1 |
GO:1904815 |
negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.1 |
0.2 |
GO:2000230 |
regulation of cholesterol transporter activity(GO:0060694) negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 0.1 |
0.1 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 |
0.2 |
GO:0009753 |
response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 0.1 |
0.6 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.1 |
0.8 |
GO:1904714 |
regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 |
0.2 |
GO:0010812 |
negative regulation of cell-substrate adhesion(GO:0010812) |
| 0.1 |
0.2 |
GO:0010845 |
positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.1 |
0.1 |
GO:0014067 |
negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.1 |
0.2 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 |
0.2 |
GO:0051311 |
meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
| 0.1 |
0.2 |
GO:0006680 |
glucosylceramide catabolic process(GO:0006680) |
| 0.1 |
0.1 |
GO:0071874 |
cellular response to norepinephrine stimulus(GO:0071874) |
| 0.1 |
0.2 |
GO:0006679 |
glucosylceramide biosynthetic process(GO:0006679) |
| 0.1 |
0.4 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.1 |
0.5 |
GO:0006704 |
glucocorticoid biosynthetic process(GO:0006704) |
| 0.1 |
0.4 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 |
0.1 |
GO:0072025 |
distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) |
| 0.1 |
0.1 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.1 |
0.1 |
GO:0060574 |
intestinal epithelial cell maturation(GO:0060574) |
| 0.1 |
0.2 |
GO:0046725 |
negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.1 |
0.7 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 |
0.3 |
GO:0051167 |
glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.1 |
0.1 |
GO:0097476 |
spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.1 |
0.2 |
GO:0002372 |
myeloid dendritic cell cytokine production(GO:0002372) |
| 0.1 |
0.2 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.1 |
0.1 |
GO:0060352 |
cell adhesion molecule production(GO:0060352) |
| 0.1 |
0.4 |
GO:1903244 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.1 |
1.3 |
GO:0060044 |
negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.1 |
0.6 |
GO:0051694 |
pointed-end actin filament capping(GO:0051694) |
| 0.1 |
0.2 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.1 |
0.3 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 |
0.3 |
GO:0016559 |
peroxisome fission(GO:0016559) |
| 0.1 |
0.1 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.1 |
0.5 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 0.1 |
0.3 |
GO:0010387 |
COP9 signalosome assembly(GO:0010387) |
| 0.1 |
0.2 |
GO:0032581 |
ER-dependent peroxisome organization(GO:0032581) |
| 0.1 |
0.2 |
GO:0002276 |
basophil activation involved in immune response(GO:0002276) |
| 0.1 |
0.4 |
GO:0098989 |
NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.1 |
0.2 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 |
0.2 |
GO:0010901 |
regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.1 |
0.2 |
GO:1900369 |
negative regulation of RNA interference(GO:1900369) |
| 0.1 |
0.1 |
GO:0090191 |
negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.1 |
0.2 |
GO:0070841 |
inclusion body assembly(GO:0070841) |
| 0.1 |
0.3 |
GO:0006572 |
tyrosine catabolic process(GO:0006572) |
| 0.1 |
0.2 |
GO:0002728 |
negative regulation of natural killer cell cytokine production(GO:0002728) |
| 0.1 |
0.6 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 |
0.9 |
GO:0014848 |
urinary bladder smooth muscle contraction(GO:0014832) urinary tract smooth muscle contraction(GO:0014848) |
| 0.1 |
0.2 |
GO:0035752 |
lysosomal lumen pH elevation(GO:0035752) |
| 0.1 |
3.0 |
GO:0061718 |
NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.1 |
0.5 |
GO:0046078 |
dUMP metabolic process(GO:0046078) |
| 0.1 |
0.2 |
GO:0051970 |
negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.1 |
0.8 |
GO:0015884 |
folic acid transport(GO:0015884) |
| 0.1 |
0.2 |
GO:0032849 |
positive regulation of cellular pH reduction(GO:0032849) |
| 0.1 |
0.3 |
GO:0038123 |
toll-like receptor TLR1:TLR2 signaling pathway(GO:0038123) response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.1 |
0.3 |
GO:0060512 |
prostate gland morphogenesis(GO:0060512) |
| 0.1 |
0.3 |
GO:0070124 |
mitochondrial translational initiation(GO:0070124) |
| 0.1 |
0.2 |
GO:0042596 |
fear response(GO:0042596) |
| 0.1 |
0.1 |
GO:0051450 |
myoblast proliferation(GO:0051450) |
| 0.1 |
0.5 |
GO:0046940 |
nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.1 |
0.8 |
GO:0006771 |
riboflavin metabolic process(GO:0006771) |
| 0.1 |
0.1 |
GO:0061763 |
multivesicular body-lysosome fusion(GO:0061763) |
| 0.1 |
0.2 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.1 |
0.2 |
GO:0010193 |
response to ozone(GO:0010193) |
| 0.1 |
0.5 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.1 |
0.2 |
GO:0051673 |
membrane disruption in other organism(GO:0051673) |
| 0.1 |
0.1 |
GO:0097187 |
dentinogenesis(GO:0097187) |
| 0.1 |
0.2 |
GO:0036378 |
calcitriol biosynthetic process from calciol(GO:0036378) |
| 0.1 |
0.1 |
GO:0060287 |
epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.1 |
0.3 |
GO:0019896 |
axonal transport of mitochondrion(GO:0019896) |
| 0.1 |
0.2 |
GO:0021586 |
pons maturation(GO:0021586) |
| 0.1 |
0.3 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 0.1 |
0.1 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.1 |
0.1 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.1 |
0.2 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 |
0.2 |
GO:0060398 |
regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.1 |
0.5 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.1 |
0.6 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.1 |
0.1 |
GO:0071300 |
cellular response to retinoic acid(GO:0071300) |
| 0.1 |
0.7 |
GO:0071420 |
cellular response to histamine(GO:0071420) |
| 0.1 |
0.2 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.1 |
0.1 |
GO:0021678 |
third ventricle development(GO:0021678) |
| 0.1 |
0.2 |
GO:0046041 |
ITP metabolic process(GO:0046041) |
| 0.1 |
0.2 |
GO:0045776 |
negative regulation of blood pressure(GO:0045776) |
| 0.1 |
0.4 |
GO:0097056 |
selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.1 |
0.2 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.0 |
0.1 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 |
0.2 |
GO:0099563 |
modification of synaptic structure(GO:0099563) |
| 0.0 |
0.8 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 |
0.0 |
GO:0045113 |
regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 |
0.2 |
GO:0070895 |
transposon integration(GO:0070893) regulation of transposon integration(GO:0070894) negative regulation of transposon integration(GO:0070895) |
| 0.0 |
0.1 |
GO:0071418 |
cellular response to amine stimulus(GO:0071418) |
| 0.0 |
0.2 |
GO:0032415 |
regulation of sodium:proton antiporter activity(GO:0032415) positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 |
0.1 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 0.0 |
0.1 |
GO:0006423 |
cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 |
0.5 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 |
0.2 |
GO:0042182 |
ketone catabolic process(GO:0042182) |
| 0.0 |
0.9 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 |
0.1 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 |
0.2 |
GO:0071344 |
diphosphate metabolic process(GO:0071344) |
| 0.0 |
0.0 |
GO:0003032 |
detection of oxygen(GO:0003032) |
| 0.0 |
0.4 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 0.0 |
0.1 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.0 |
0.6 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.0 |
0.3 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.0 |
0.2 |
GO:0032227 |
negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 |
0.9 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 |
0.0 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 |
0.4 |
GO:0046618 |
drug export(GO:0046618) |
| 0.0 |
0.0 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.0 |
0.0 |
GO:1901205 |
regulation of adrenergic receptor signaling pathway involved in heart process(GO:1901204) negative regulation of adrenergic receptor signaling pathway involved in heart process(GO:1901205) |
| 0.0 |
0.0 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 0.0 |
1.2 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 |
0.1 |
GO:0045226 |
extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.0 |
0.2 |
GO:0019303 |
D-ribose catabolic process(GO:0019303) |
| 0.0 |
0.1 |
GO:0042701 |
progesterone secretion(GO:0042701) |
| 0.0 |
0.1 |
GO:0007228 |
positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 |
0.0 |
GO:0061668 |
mitochondrial ribosome assembly(GO:0061668) |
| 0.0 |
0.0 |
GO:0051315 |
attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 |
0.3 |
GO:0071257 |
cellular response to electrical stimulus(GO:0071257) |
| 0.0 |
0.2 |
GO:1904393 |
regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) |
| 0.0 |
0.0 |
GO:1902617 |
response to fluoride(GO:1902617) |
| 0.0 |
0.1 |
GO:1903423 |
positive regulation of synaptic vesicle endocytosis(GO:1900244) positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.0 |
0.4 |
GO:0031282 |
regulation of guanylate cyclase activity(GO:0031282) |
| 0.0 |
0.1 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 |
0.2 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 |
0.5 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.0 |
0.7 |
GO:0061088 |
sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 |
0.0 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.0 |
0.3 |
GO:1904526 |
regulation of microtubule binding(GO:1904526) |
| 0.0 |
0.1 |
GO:0070100 |
negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.0 |
0.1 |
GO:0042489 |
negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.0 |
0.1 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 |
0.3 |
GO:0032962 |
positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.0 |
0.9 |
GO:0035414 |
negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 |
0.1 |
GO:0006272 |
leading strand elongation(GO:0006272) |
| 0.0 |
0.1 |
GO:0035811 |
negative regulation of urine volume(GO:0035811) |
| 0.0 |
0.1 |
GO:0021502 |
neural fold elevation formation(GO:0021502) positive regulation of chemokine-mediated signaling pathway(GO:0070101) |
| 0.0 |
0.5 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 |
0.1 |
GO:0030317 |
sperm motility(GO:0030317) |
| 0.0 |
0.0 |
GO:0038162 |
erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.0 |
0.0 |
GO:0051097 |
negative regulation of helicase activity(GO:0051097) |
| 0.0 |
0.1 |
GO:0090232 |
positive regulation of spindle checkpoint(GO:0090232) |
| 0.0 |
0.0 |
GO:1903989 |
positive regulation of iron ion transport(GO:0034758) positive regulation of iron ion transmembrane transport(GO:0034761) regulation of iron ion import(GO:1900390) regulation of ferrous iron import into cell(GO:1903989) positive regulation of ferrous iron import into cell(GO:1903991) regulation of ferrous iron binding(GO:1904432) positive regulation of ferrous iron binding(GO:1904434) regulation of transferrin receptor binding(GO:1904435) positive regulation of transferrin receptor binding(GO:1904437) regulation of ferrous iron import across plasma membrane(GO:1904438) positive regulation of ferrous iron import across plasma membrane(GO:1904440) |
| 0.0 |
0.2 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 |
0.2 |
GO:0010710 |
regulation of collagen catabolic process(GO:0010710) |
| 0.0 |
0.1 |
GO:0019516 |
lactate oxidation(GO:0019516) |
| 0.0 |
0.2 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 |
0.2 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.0 |
0.1 |
GO:2000295 |
regulation of hydrogen peroxide catabolic process(GO:2000295) |
| 0.0 |
0.0 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.0 |
0.0 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 |
0.2 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.0 |
0.0 |
GO:0061438 |
renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) |
| 0.0 |
0.1 |
GO:2000569 |
T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.0 |
0.2 |
GO:0009176 |
pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) |
| 0.0 |
0.3 |
GO:0060480 |
lung goblet cell differentiation(GO:0060480) |
| 0.0 |
0.5 |
GO:2000664 |
positive regulation of interleukin-5 secretion(GO:2000664) |
| 0.0 |
0.0 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.0 |
0.1 |
GO:0009216 |
purine deoxyribonucleoside triphosphate biosynthetic process(GO:0009216) |
| 0.0 |
0.6 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.0 |
0.3 |
GO:0031179 |
peptide amidation(GO:0001519) protein amidation(GO:0018032) peptide modification(GO:0031179) |
| 0.0 |
0.1 |
GO:0042636 |
negative regulation of hair cycle(GO:0042636) |
| 0.0 |
0.1 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.0 |
0.2 |
GO:0060178 |
regulation of exocyst assembly(GO:0001928) regulation of exocyst localization(GO:0060178) |
| 0.0 |
0.0 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.0 |
1.1 |
GO:0061577 |
calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.0 |
0.1 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.0 |
0.1 |
GO:2000721 |
positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.0 |
0.1 |
GO:0046586 |
regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.0 |
0.1 |
GO:0034395 |
regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.0 |
0.3 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 |
0.1 |
GO:0071812 |
regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.0 |
0.2 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.0 |
0.2 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 |
0.1 |
GO:0060535 |
trachea cartilage morphogenesis(GO:0060535) |
| 0.0 |
0.0 |
GO:0002183 |
cytoplasmic translational initiation(GO:0002183) |
| 0.0 |
0.1 |
GO:0002416 |
IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.0 |
0.1 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 |
0.5 |
GO:0043587 |
tongue morphogenesis(GO:0043587) |
| 0.0 |
0.1 |
GO:0036109 |
alpha-linolenic acid metabolic process(GO:0036109) |
| 0.0 |
0.2 |
GO:0010157 |
response to chlorate(GO:0010157) |
| 0.0 |
0.3 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 |
0.1 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.0 |
1.2 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.0 |
0.1 |
GO:1904298 |
positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of neutrophil activation(GO:1902565) positive regulation of leukocyte tethering or rolling(GO:1903238) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
| 0.0 |
0.2 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 |
0.1 |
GO:0035630 |
bone mineralization involved in bone maturation(GO:0035630) |
| 0.0 |
0.1 |
GO:1902299 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.0 |
0.1 |
GO:0042984 |
amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 |
0.3 |
GO:0044036 |
cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.0 |
0.0 |
GO:0009310 |
amine catabolic process(GO:0009310) |
| 0.0 |
0.3 |
GO:0051126 |
negative regulation of actin nucleation(GO:0051126) |
| 0.0 |
1.1 |
GO:0030207 |
chondroitin sulfate catabolic process(GO:0030207) |
| 0.0 |
0.3 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 |
0.1 |
GO:0006433 |
prolyl-tRNA aminoacylation(GO:0006433) |
| 0.0 |
0.3 |
GO:1904798 |
positive regulation of core promoter binding(GO:1904798) |
| 0.0 |
0.3 |
GO:0061767 |
negative regulation of lung blood pressure(GO:0061767) |
| 0.0 |
0.7 |
GO:0006662 |
glycerol ether metabolic process(GO:0006662) |
| 0.0 |
0.6 |
GO:0090129 |
positive regulation of synapse maturation(GO:0090129) |
| 0.0 |
0.5 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.0 |
0.5 |
GO:0021692 |
cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.0 |
0.5 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 |
0.1 |
GO:1904784 |
NLRP1 inflammasome complex assembly(GO:1904784) |
| 0.0 |
0.5 |
GO:1903944 |
regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.0 |
0.2 |
GO:0034499 |
late endosome to Golgi transport(GO:0034499) |
| 0.0 |
0.2 |
GO:1901387 |
positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.0 |
0.2 |
GO:0006422 |
aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.0 |
1.6 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.0 |
0.1 |
GO:0042733 |
embryonic digit morphogenesis(GO:0042733) |
| 0.0 |
0.0 |
GO:0046110 |
xanthine metabolic process(GO:0046110) |
| 0.0 |
0.1 |
GO:0048203 |
vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.0 |
0.7 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 |
1.2 |
GO:0035338 |
long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 |
0.0 |
GO:1904862 |
inhibitory synapse assembly(GO:1904862) |
| 0.0 |
0.1 |
GO:0045903 |
positive regulation of translational fidelity(GO:0045903) |
| 0.0 |
0.5 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.0 |
0.1 |
GO:0051102 |
DNA ligation involved in DNA recombination(GO:0051102) |
| 0.0 |
0.3 |
GO:0016128 |
phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.0 |
0.6 |
GO:0033198 |
response to ATP(GO:0033198) |
| 0.0 |
0.2 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.0 |
0.3 |
GO:0031087 |
deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 |
0.2 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.1 |
GO:1905075 |
occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.0 |
0.7 |
GO:1900746 |
regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.0 |
0.1 |
GO:0033341 |
regulation of collagen binding(GO:0033341) |
| 0.0 |
0.2 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.0 |
0.4 |
GO:2000467 |
positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 |
0.0 |
GO:1904322 |
response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 |
0.2 |
GO:0035627 |
ceramide transport(GO:0035627) |
| 0.0 |
0.7 |
GO:0045141 |
meiotic telomere clustering(GO:0045141) |
| 0.0 |
0.2 |
GO:0002415 |
immune response in mucosal-associated lymphoid tissue(GO:0002386) immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.0 |
0.0 |
GO:0045349 |
interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.0 |
0.3 |
GO:0006003 |
fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 |
0.1 |
GO:1901876 |
regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.0 |
0.2 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.0 |
0.2 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 |
0.8 |
GO:1901685 |
glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
| 0.0 |
0.1 |
GO:0090135 |
actin filament branching(GO:0090135) |
| 0.0 |
0.2 |
GO:0090131 |
mesenchyme migration(GO:0090131) |
| 0.0 |
0.4 |
GO:1905247 |
positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.0 |
0.6 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 |
0.3 |
GO:1903551 |
regulation of extracellular exosome assembly(GO:1903551) |
| 0.0 |
0.1 |
GO:0019860 |
uracil metabolic process(GO:0019860) |
| 0.0 |
0.3 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.0 |
0.1 |
GO:0090080 |
positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 |
0.2 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.0 |
0.0 |
GO:0070563 |
negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 0.0 |
0.0 |
GO:0021769 |
orbitofrontal cortex development(GO:0021769) |
| 0.0 |
0.2 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.0 |
0.2 |
GO:0060474 |
positive regulation of sperm motility involved in capacitation(GO:0060474) |
| 0.0 |
0.3 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.0 |
2.1 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.2 |
GO:0003131 |
mesodermal-endodermal cell signaling(GO:0003131) programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) histone H2A-S139 phosphorylation(GO:0035978) regulation of cellular response to X-ray(GO:2000683) positive regulation of cellular response to X-ray(GO:2000685) |
| 0.0 |
0.0 |
GO:0051445 |
regulation of meiotic cell cycle(GO:0051445) |
| 0.0 |
0.1 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.0 |
0.1 |
GO:1904729 |
regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.0 |
0.3 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 |
0.2 |
GO:0090611 |
ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.0 |
0.0 |
GO:0090269 |
fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
| 0.0 |
0.2 |
GO:1903615 |
regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
| 0.0 |
0.2 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 |
0.2 |
GO:0007598 |
blood coagulation, extrinsic pathway(GO:0007598) |
| 0.0 |
0.5 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 |
0.3 |
GO:0051593 |
response to folic acid(GO:0051593) |
| 0.0 |
0.0 |
GO:0006054 |
N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 |
0.1 |
GO:0030705 |
cytoskeleton-dependent intracellular transport(GO:0030705) |
| 0.0 |
0.2 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.0 |
0.0 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.0 |
0.3 |
GO:0060338 |
regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.0 |
0.0 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.0 |
0.9 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 |
0.2 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.0 |
0.4 |
GO:1900113 |
negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 |
0.2 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 0.0 |
0.2 |
GO:0043128 |
regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.0 |
0.0 |
GO:0070585 |
protein localization to mitochondrion(GO:0070585) |
| 0.0 |
0.5 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.0 |
0.0 |
GO:0008344 |
adult locomotory behavior(GO:0008344) |
| 0.0 |
0.1 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.0 |
0.4 |
GO:0006689 |
ganglioside catabolic process(GO:0006689) |
| 0.0 |
0.1 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.0 |
1.0 |
GO:0035640 |
exploration behavior(GO:0035640) |
| 0.0 |
0.8 |
GO:0070286 |
axonemal dynein complex assembly(GO:0070286) |
| 0.0 |
0.1 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 0.0 |
0.3 |
GO:0002159 |
desmosome assembly(GO:0002159) |
| 0.0 |
0.3 |
GO:0006750 |
glutathione biosynthetic process(GO:0006750) |
| 0.0 |
0.1 |
GO:2000866 |
positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
| 0.0 |
0.1 |
GO:0090170 |
regulation of Golgi inheritance(GO:0090170) |
| 0.0 |
0.1 |
GO:0034343 |
type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.0 |
0.4 |
GO:1902412 |
regulation of mitotic cytokinesis(GO:1902412) |
| 0.0 |
0.3 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.0 |
0.2 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.0 |
0.1 |
GO:0052214 |
multi-organism catabolic process(GO:0044035) development involved in symbiotic interaction(GO:0044111) development of symbiont involved in interaction with host(GO:0044115) modulation of development of symbiont involved in interaction with host(GO:0044145) negative regulation of development of symbiont involved in interaction with host(GO:0044147) metabolism of substance in other organism involved in symbiotic interaction(GO:0052214) catabolism of substance in other organism involved in symbiotic interaction(GO:0052227) metabolism of macromolecule in other organism involved in symbiotic interaction(GO:0052229) catabolism by host of symbiont macromolecule(GO:0052360) catabolism by organism of macromolecule in other organism involved in symbiotic interaction(GO:0052361) catabolism by host of symbiont protein(GO:0052362) catabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052363) catabolism by host of substance in symbiont(GO:0052364) metabolism by host of symbiont macromolecule(GO:0052416) metabolism by host of symbiont protein(GO:0052417) metabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052418) metabolism by host of substance in symbiont(GO:0052419) |
| 0.0 |
0.5 |
GO:0033623 |
regulation of integrin activation(GO:0033623) |
| 0.0 |
0.1 |
GO:0044727 |
DNA demethylation of male pronucleus(GO:0044727) |
| 0.0 |
0.1 |
GO:0070234 |
positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 |
0.2 |
GO:0044878 |
mitotic cytokinesis checkpoint(GO:0044878) |
| 0.0 |
0.0 |
GO:0044752 |
response to human chorionic gonadotropin(GO:0044752) |
| 0.0 |
0.0 |
GO:1902358 |
sulfate transmembrane transport(GO:1902358) |
| 0.0 |
1.1 |
GO:0010669 |
epithelial structure maintenance(GO:0010669) |
| 0.0 |
0.2 |
GO:0048295 |
positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.0 |
0.1 |
GO:0010825 |
positive regulation of centrosome duplication(GO:0010825) |
| 0.0 |
0.1 |
GO:0060956 |
cardiac endothelial cell differentiation(GO:0003348) endocardial cell differentiation(GO:0060956) |
| 0.0 |
0.5 |
GO:0006089 |
lactate metabolic process(GO:0006089) |
| 0.0 |
0.5 |
GO:1901078 |
negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.0 |
0.0 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.0 |
0.1 |
GO:0036500 |
ATF6-mediated unfolded protein response(GO:0036500) |
| 0.0 |
0.2 |
GO:0039506 |
modulation by virus of host molecular function(GO:0039506) suppression by virus of host molecular function(GO:0039507) suppression by virus of host catalytic activity(GO:0039513) modulation by virus of host catalytic activity(GO:0039516) suppression by virus of host cysteine-type endopeptidase activity involved in apoptotic process(GO:0039650) negative regulation by symbiont of host catalytic activity(GO:0052053) negative regulation by symbiont of host molecular function(GO:0052056) modulation by symbiont of host catalytic activity(GO:0052148) |
| 0.0 |
0.8 |
GO:1903830 |
magnesium ion transmembrane transport(GO:1903830) |
| 0.0 |
0.2 |
GO:0010796 |
regulation of multivesicular body size(GO:0010796) |
| 0.0 |
0.1 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.0 |
0.2 |
GO:0070541 |
response to platinum ion(GO:0070541) |
| 0.0 |
0.6 |
GO:1904706 |
negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 |
0.3 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 |
0.1 |
GO:0044376 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 |
0.4 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 |
0.1 |
GO:0034146 |
toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.0 |
0.0 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 |
0.2 |
GO:0070508 |
sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 |
0.1 |
GO:0034088 |
maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.0 |
0.5 |
GO:0015866 |
ADP transport(GO:0015866) |
| 0.0 |
0.1 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 |
0.0 |
GO:0002590 |
regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.0 |
0.1 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.0 |
0.5 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.0 |
0.1 |
GO:0010900 |
negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.0 |
0.1 |
GO:0071285 |
cellular response to lithium ion(GO:0071285) |
| 0.0 |
0.4 |
GO:0043313 |
regulation of neutrophil degranulation(GO:0043313) |
| 0.0 |
0.5 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.0 |
0.1 |
GO:0002384 |
hepatic immune response(GO:0002384) |
| 0.0 |
0.1 |
GO:0030853 |
negative regulation of granulocyte differentiation(GO:0030853) |
| 0.0 |
0.5 |
GO:0043651 |
linoleic acid metabolic process(GO:0043651) |
| 0.0 |
0.0 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.0 |
0.4 |
GO:0033008 |
positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 |
0.4 |
GO:0045078 |
positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.0 |
0.1 |
GO:0007210 |
serotonin receptor signaling pathway(GO:0007210) |
| 0.0 |
0.1 |
GO:0034970 |
histone H3-R2 methylation(GO:0034970) |
| 0.0 |
0.1 |
GO:1900102 |
negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
| 0.0 |
0.1 |
GO:2000465 |
regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.0 |
0.2 |
GO:0003409 |
optic cup structural organization(GO:0003409) |
| 0.0 |
0.2 |
GO:1901897 |
regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 |
0.1 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.0 |
0.1 |
GO:0008588 |
release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 |
0.1 |
GO:0071051 |
U4 snRNA 3'-end processing(GO:0034475) polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.0 |
0.2 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 |
0.1 |
GO:0090403 |
oxidative stress-induced premature senescence(GO:0090403) |
| 0.0 |
0.1 |
GO:0019417 |
sulfur oxidation(GO:0019417) |
| 0.0 |
0.1 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 |
0.6 |
GO:0090168 |
Golgi reassembly(GO:0090168) |
| 0.0 |
0.9 |
GO:0031115 |
negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 |
0.1 |
GO:0051712 |
positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 |
0.1 |
GO:0071630 |
nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.0 |
0.6 |
GO:0098789 |
pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 |
0.1 |
GO:0035166 |
post-embryonic hemopoiesis(GO:0035166) |
| 0.0 |
0.1 |
GO:0072387 |
flavin-containing compound metabolic process(GO:0042726) flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.0 |
0.0 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 |
0.2 |
GO:0071895 |
odontoblast differentiation(GO:0071895) |
| 0.0 |
0.1 |
GO:0046035 |
CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.0 |
0.1 |
GO:0030186 |
melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.0 |
0.0 |
GO:0007135 |
meiosis II(GO:0007135) |
| 0.0 |
0.1 |
GO:0051611 |
negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.0 |
0.2 |
GO:0036309 |
protein localization to M-band(GO:0036309) |
| 0.0 |
0.2 |
GO:0034436 |
glycoprotein transport(GO:0034436) |
| 0.0 |
0.1 |
GO:0010520 |
regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.0 |
0.1 |
GO:0072579 |
molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.0 |
0.1 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.0 |
0.1 |
GO:1900078 |
positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.0 |
0.6 |
GO:0010763 |
positive regulation of fibroblast migration(GO:0010763) |
| 0.0 |
0.2 |
GO:0035553 |
oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 |
0.1 |
GO:0003128 |
heart field specification(GO:0003128) |
| 0.0 |
0.0 |
GO:2000696 |
regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.0 |
0.1 |
GO:0033319 |
UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.0 |
0.5 |
GO:0038007 |
netrin-activated signaling pathway(GO:0038007) |
| 0.0 |
0.3 |
GO:0045329 |
carnitine biosynthetic process(GO:0045329) |
| 0.0 |
0.2 |
GO:0009107 |
lipoate biosynthetic process(GO:0009107) |
| 0.0 |
0.9 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.0 |
0.1 |
GO:0019072 |
viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.0 |
0.5 |
GO:0032074 |
negative regulation of nuclease activity(GO:0032074) |
| 0.0 |
0.1 |
GO:0016344 |
meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.0 |
0.1 |
GO:0051971 |
positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.0 |
0.1 |
GO:1904899 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.0 |
0.2 |
GO:0032185 |
septin cytoskeleton organization(GO:0032185) |
| 0.0 |
0.3 |
GO:0071963 |
establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 |
0.1 |
GO:0014916 |
regulation of lung blood pressure(GO:0014916) |
| 0.0 |
0.1 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.0 |
0.5 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.0 |
0.1 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.0 |
0.1 |
GO:1904529 |
regulation of actin filament binding(GO:1904529) negative regulation of actin filament binding(GO:1904530) regulation of actin binding(GO:1904616) negative regulation of actin binding(GO:1904617) |
| 0.0 |
0.2 |
GO:0007525 |
somatic muscle development(GO:0007525) |
| 0.0 |
0.1 |
GO:0044240 |
multicellular organism lipid catabolic process(GO:0044240) |
| 0.0 |
0.7 |
GO:0015695 |
organic cation transport(GO:0015695) |
| 0.0 |
0.1 |
GO:1904781 |
positive regulation of protein localization to centrosome(GO:1904781) |
| 0.0 |
0.1 |
GO:2000342 |
negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.0 |
0.2 |
GO:2000679 |
positive regulation of transcription regulatory region DNA binding(GO:2000679) |
| 0.0 |
0.3 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.0 |
0.4 |
GO:0009130 |
pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) |
| 0.0 |
0.1 |
GO:0097498 |
endothelial tube lumen extension(GO:0097498) |
| 0.0 |
0.1 |
GO:0072321 |
chaperone-mediated protein transport(GO:0072321) |
| 0.0 |
0.2 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 |
0.0 |
GO:0009447 |
putrescine catabolic process(GO:0009447) |
| 0.0 |
0.1 |
GO:0044597 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 |
0.0 |
GO:0010025 |
wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 |
0.2 |
GO:0003062 |
regulation of heart rate by chemical signal(GO:0003062) |
| 0.0 |
0.3 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.0 |
0.1 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.0 |
0.0 |
GO:1903301 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.0 |
0.0 |
GO:0070059 |
intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
| 0.0 |
0.2 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.0 |
0.2 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.0 |
0.1 |
GO:0071695 |
anatomical structure maturation(GO:0071695) |
| 0.0 |
0.1 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 |
0.2 |
GO:0017144 |
drug metabolic process(GO:0017144) |
| 0.0 |
0.3 |
GO:0070995 |
NADPH oxidation(GO:0070995) |
| 0.0 |
0.0 |
GO:0061620 |
glycolytic process through fructose-6-phosphate(GO:0061615) glycolytic process through glucose-6-phosphate(GO:0061620) |
| 0.0 |
0.2 |
GO:0045794 |
negative regulation of cell volume(GO:0045794) |
| 0.0 |
0.3 |
GO:0015846 |
polyamine transport(GO:0015846) |
| 0.0 |
0.4 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 |
0.1 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 0.0 |
0.3 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.0 |
0.1 |
GO:1903595 |
positive regulation of histamine secretion by mast cell(GO:1903595) |
| 0.0 |
0.1 |
GO:0000961 |
negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.0 |
0.5 |
GO:0071397 |
cellular response to cholesterol(GO:0071397) |
| 0.0 |
0.2 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.0 |
0.2 |
GO:0002933 |
lipid hydroxylation(GO:0002933) |
| 0.0 |
0.1 |
GO:0033141 |
positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 |
0.2 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.0 |
0.1 |
GO:0033046 |
negative regulation of sister chromatid segregation(GO:0033046) negative regulation of chromosome segregation(GO:0051985) |
| 0.0 |
0.2 |
GO:0030311 |
poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 |
0.1 |
GO:1902525 |
regulation of protein monoubiquitination(GO:1902525) |
| 0.0 |
1.1 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 |
0.2 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.0 |
0.0 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.0 |
0.1 |
GO:0051410 |
detoxification of nitrogen compound(GO:0051410) |
| 0.0 |
0.2 |
GO:0021522 |
spinal cord motor neuron differentiation(GO:0021522) |
| 0.0 |
0.1 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 |
0.2 |
GO:2000002 |
negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.0 |
0.2 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.0 |
0.1 |
GO:0018277 |
protein deamination(GO:0018277) |
| 0.0 |
0.2 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.0 |
0.9 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.0 |
0.1 |
GO:0008334 |
histone mRNA metabolic process(GO:0008334) |
| 0.0 |
0.2 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 |
0.2 |
GO:0000973 |
posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.0 |
0.1 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) regulation of RNA binding(GO:1905214) |
| 0.0 |
0.1 |
GO:0044691 |
tooth eruption(GO:0044691) |
| 0.0 |
0.1 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.0 |
0.3 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.0 |
0.1 |
GO:0098968 |
neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.0 |
0.5 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.0 |
0.1 |
GO:0051901 |
positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.0 |
0.2 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 |
0.1 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 |
0.0 |
GO:0014717 |
regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
| 0.0 |
0.0 |
GO:0042494 |
detection of bacterial lipoprotein(GO:0042494) |
| 0.0 |
0.1 |
GO:0032902 |
nerve growth factor production(GO:0032902) |
| 0.0 |
0.6 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.0 |
0.1 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 |
0.2 |
GO:0042473 |
outer ear morphogenesis(GO:0042473) |
| 0.0 |
0.0 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.0 |
0.1 |
GO:0036071 |
N-glycan fucosylation(GO:0036071) |
| 0.0 |
4.2 |
GO:0006614 |
SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 |
0.2 |
GO:2000047 |
regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 0.0 |
0.0 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 |
0.0 |
GO:0000963 |
mitochondrial RNA processing(GO:0000963) |
| 0.0 |
0.8 |
GO:0032012 |
regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 |
0.3 |
GO:0021902 |
commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 |
0.1 |
GO:0071955 |
recycling endosome to Golgi transport(GO:0071955) |
| 0.0 |
1.0 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 |
0.1 |
GO:0006427 |
histidyl-tRNA aminoacylation(GO:0006427) |
| 0.0 |
0.0 |
GO:0036093 |
male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.0 |
0.1 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 |
0.0 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.0 |
0.3 |
GO:0031444 |
slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.0 |
0.1 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 |
0.1 |
GO:1900181 |
negative regulation of protein localization to nucleus(GO:1900181) |
| 0.0 |
0.1 |
GO:0072176 |
nephric duct development(GO:0072176) |
| 0.0 |
0.2 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.0 |
0.1 |
GO:0046185 |
aldehyde catabolic process(GO:0046185) |
| 0.0 |
0.2 |
GO:0000432 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.0 |
0.0 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.0 |
0.5 |
GO:0051898 |
negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 |
0.0 |
GO:1902774 |
late endosome to lysosome transport(GO:1902774) |
| 0.0 |
0.3 |
GO:0046465 |
dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
| 0.0 |
0.1 |
GO:0046886 |
positive regulation of hormone biosynthetic process(GO:0046886) |
| 0.0 |
0.1 |
GO:0001971 |
negative regulation of activation of membrane attack complex(GO:0001971) |
| 0.0 |
0.1 |
GO:2000819 |
regulation of nucleotide-excision repair(GO:2000819) |
| 0.0 |
0.0 |
GO:1903935 |
response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.0 |
0.1 |
GO:0035411 |
catenin import into nucleus(GO:0035411) |
| 0.0 |
0.2 |
GO:0001570 |
vasculogenesis(GO:0001570) |
| 0.0 |
0.6 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 |
0.2 |
GO:0060263 |
regulation of respiratory burst(GO:0060263) |
| 0.0 |
0.1 |
GO:1990654 |
sebum secreting cell proliferation(GO:1990654) |
| 0.0 |
0.2 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.0 |
0.2 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 |
0.0 |
GO:0006754 |
ATP biosynthetic process(GO:0006754) |
| 0.0 |
0.2 |
GO:0090141 |
positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 |
0.1 |
GO:0048213 |
Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.0 |
0.0 |
GO:0035425 |
autocrine signaling(GO:0035425) |
| 0.0 |
0.4 |
GO:0048266 |
behavioral response to pain(GO:0048266) |
| 0.0 |
0.1 |
GO:0051891 |
positive regulation of cardioblast differentiation(GO:0051891) |
| 0.0 |
0.2 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.0 |
0.1 |
GO:1990637 |
response to prolactin(GO:1990637) |
| 0.0 |
0.6 |
GO:1904152 |
regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.0 |
0.1 |
GO:1902361 |
mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.0 |
0.4 |
GO:0046069 |
cGMP catabolic process(GO:0046069) |
| 0.0 |
0.2 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
0.0 |
GO:0010692 |
regulation of alkaline phosphatase activity(GO:0010692) |
| 0.0 |
0.2 |
GO:2000651 |
positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.0 |
0.1 |
GO:0035026 |
leading edge cell differentiation(GO:0035026) |
| 0.0 |
0.0 |
GO:0046368 |
GDP-L-fucose biosynthetic process(GO:0042350) GDP-L-fucose metabolic process(GO:0046368) |
| 0.0 |
0.0 |
GO:0060623 |
regulation of chromosome condensation(GO:0060623) |
| 0.0 |
0.1 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.0 |
0.3 |
GO:0002943 |
tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 |
0.1 |
GO:0042231 |
interleukin-13 biosynthetic process(GO:0042231) |
| 0.0 |
0.1 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.0 |
0.3 |
GO:0001778 |
plasma membrane repair(GO:0001778) |
| 0.0 |
0.0 |
GO:2000645 |
negative regulation of receptor catabolic process(GO:2000645) |
| 0.0 |
0.7 |
GO:0006739 |
NADP metabolic process(GO:0006739) |
| 0.0 |
0.0 |
GO:1902177 |
positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.0 |
0.1 |
GO:0071798 |
response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.0 |
0.1 |
GO:0043328 |
protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 |
0.2 |
GO:0030047 |
actin modification(GO:0030047) |
| 0.0 |
0.1 |
GO:2001160 |
histone H3-K79 methylation(GO:0034729) regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 0.0 |
0.1 |
GO:0050968 |
detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 |
0.1 |
GO:0071907 |
determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.0 |
0.9 |
GO:1904659 |
hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.0 |
0.2 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.0 |
0.1 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.0 |
0.1 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
| 0.0 |
0.1 |
GO:0033578 |
protein glycosylation in Golgi(GO:0033578) |
| 0.0 |
0.1 |
GO:2000542 |
negative regulation of gastrulation(GO:2000542) |
| 0.0 |
0.0 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.0 |
0.1 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 |
0.1 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.0 |
0.2 |
GO:0042226 |
interleukin-6 biosynthetic process(GO:0042226) |
| 0.0 |
0.8 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.0 |
0.4 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 |
0.0 |
GO:0030220 |
platelet formation(GO:0030220) |
| 0.0 |
0.2 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 |
0.1 |
GO:0036363 |
transforming growth factor beta activation(GO:0036363) |
| 0.0 |
0.2 |
GO:0038060 |
nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 0.0 |
0.1 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.0 |
0.1 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.0 |
0.1 |
GO:0002856 |
negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) negative regulation of natural killer cell mediated immune response to tumor cell(GO:0002856) negative regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002859) regulation of interleukin-3 production(GO:0032672) |
| 0.0 |
0.4 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 |
0.3 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 |
0.7 |
GO:0015838 |
quaternary ammonium group transport(GO:0015697) amino-acid betaine transport(GO:0015838) |
| 0.0 |
0.1 |
GO:0051084 |
'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 |
0.3 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.0 |
0.0 |
GO:0046102 |
inosine metabolic process(GO:0046102) |
| 0.0 |
0.2 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.0 |
0.6 |
GO:0032094 |
response to food(GO:0032094) |
| 0.0 |
0.1 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.0 |
0.0 |
GO:0071545 |
inositol phosphate catabolic process(GO:0071545) |
| 0.0 |
0.2 |
GO:0055129 |
L-proline biosynthetic process(GO:0055129) |
| 0.0 |
0.2 |
GO:1904354 |
negative regulation of telomere capping(GO:1904354) |
| 0.0 |
0.2 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.0 |
0.3 |
GO:0060074 |
synapse maturation(GO:0060074) |
| 0.0 |
0.6 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 |
0.0 |
GO:0060481 |
lobar bronchus epithelium development(GO:0060481) |
| 0.0 |
0.1 |
GO:0072009 |
nephron epithelium development(GO:0072009) |
| 0.0 |
0.1 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 |
0.1 |
GO:1900063 |
regulation of peroxisome organization(GO:1900063) |
| 0.0 |
0.1 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.0 |
0.1 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 0.0 |
0.1 |
GO:0042985 |
negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 |
0.0 |
GO:0033363 |
secretory granule organization(GO:0033363) |
| 0.0 |
1.1 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 |
0.0 |
GO:0072530 |
purine-containing compound transmembrane transport(GO:0072530) |
| 0.0 |
0.1 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 0.0 |
0.2 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.0 |
0.0 |
GO:1904431 |
positive regulation of t-circle formation(GO:1904431) |
| 0.0 |
0.2 |
GO:1901660 |
calcium ion export(GO:1901660) |
| 0.0 |
0.1 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.0 |
0.1 |
GO:0090394 |
negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.0 |
0.1 |
GO:0031291 |
Ran protein signal transduction(GO:0031291) |
| 0.0 |
0.1 |
GO:0035865 |
cellular response to potassium ion(GO:0035865) |
| 0.0 |
0.1 |
GO:0043473 |
pigmentation(GO:0043473) |
| 0.0 |
0.2 |
GO:1903351 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.0 |
0.7 |
GO:0006744 |
ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.0 |
0.1 |
GO:0019046 |
release from viral latency(GO:0019046) |
| 0.0 |
0.1 |
GO:0006391 |
transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 |
0.1 |
GO:0046292 |
formaldehyde metabolic process(GO:0046292) |
| 0.0 |
0.4 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.0 |
0.0 |
GO:0015802 |
basic amino acid transport(GO:0015802) |
| 0.0 |
0.0 |
GO:1900242 |
regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 |
0.4 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.0 |
0.1 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.0 |
0.1 |
GO:0051066 |
dihydrobiopterin metabolic process(GO:0051066) |
| 0.0 |
0.2 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.0 |
0.3 |
GO:0046040 |
IMP metabolic process(GO:0046040) |
| 0.0 |
0.0 |
GO:0022605 |
oogenesis stage(GO:0022605) |
| 0.0 |
0.2 |
GO:0071569 |
protein ufmylation(GO:0071569) |
| 0.0 |
0.0 |
GO:0045347 |
negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.0 |
0.3 |
GO:0000479 |
endonucleolytic cleavage involved in rRNA processing(GO:0000478) endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 |
0.2 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.0 |
0.8 |
GO:0048268 |
clathrin coat assembly(GO:0048268) |
| 0.0 |
0.1 |
GO:0006642 |
triglyceride mobilization(GO:0006642) |
| 0.0 |
0.0 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.0 |
0.2 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 |
0.1 |
GO:2000858 |
renin-angiotensin regulation of aldosterone production(GO:0002018) mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
| 0.0 |
0.2 |
GO:0070778 |
L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.0 |
0.1 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 |
0.3 |
GO:0090161 |
Golgi ribbon formation(GO:0090161) |
| 0.0 |
0.1 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) pyramidal neuron development(GO:0021860) |
| 0.0 |
0.2 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.0 |
0.0 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 0.0 |
0.0 |
GO:0016999 |
antibiotic metabolic process(GO:0016999) |
| 0.0 |
0.0 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.0 |
0.0 |
GO:1905123 |
regulation of glucosylceramidase activity(GO:1905123) |
| 0.0 |
0.3 |
GO:0010738 |
regulation of protein kinase A signaling(GO:0010738) |
| 0.0 |
0.2 |
GO:0070664 |
negative regulation of mononuclear cell proliferation(GO:0032945) negative regulation of lymphocyte proliferation(GO:0050672) negative regulation of leukocyte proliferation(GO:0070664) |
| 0.0 |
0.0 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 0.0 |
0.1 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.0 |
0.1 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.0 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 |
0.2 |
GO:1990416 |
cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.0 |
0.1 |
GO:0030148 |
sphingolipid biosynthetic process(GO:0030148) |
| 0.0 |
0.5 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.0 |
0.5 |
GO:0006085 |
acetyl-CoA biosynthetic process(GO:0006085) |
| 0.0 |
0.1 |
GO:0046440 |
L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine metabolic process(GO:0046440) |
| 0.0 |
0.0 |
GO:0001556 |
oocyte maturation(GO:0001556) |
| 0.0 |
0.1 |
GO:0000727 |
double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 |
0.0 |
GO:0051154 |
negative regulation of striated muscle cell differentiation(GO:0051154) |
| 0.0 |
0.0 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.0 |
0.0 |
GO:0007185 |
transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 |
0.2 |
GO:2000785 |
regulation of autophagosome assembly(GO:2000785) |
| 0.0 |
0.1 |
GO:1902913 |
regulation of melanocyte differentiation(GO:0045634) positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.0 |
0.1 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 |
0.1 |
GO:0048149 |
behavioral response to ethanol(GO:0048149) |
| 0.0 |
1.7 |
GO:0016239 |
positive regulation of macroautophagy(GO:0016239) |
| 0.0 |
0.2 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.0 |
0.5 |
GO:0061003 |
positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 |
0.2 |
GO:0097091 |
synaptic vesicle clustering(GO:0097091) |
| 0.0 |
0.1 |
GO:0042816 |
vitamin B6 metabolic process(GO:0042816) |
| 0.0 |
0.2 |
GO:0006069 |
ethanol oxidation(GO:0006069) |
| 0.0 |
0.2 |
GO:0060219 |
camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 |
0.0 |
GO:0051790 |
short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 |
0.2 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.0 |
0.2 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 |
0.0 |
GO:0031952 |
regulation of protein autophosphorylation(GO:0031952) |
| 0.0 |
0.2 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 |
0.1 |
GO:1901873 |
regulation of post-translational protein modification(GO:1901873) |
| 0.0 |
1.6 |
GO:0030071 |
regulation of mitotic metaphase/anaphase transition(GO:0030071) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
| 0.0 |
0.2 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.0 |
0.7 |
GO:0015949 |
nucleobase-containing small molecule interconversion(GO:0015949) |
| 0.0 |
0.1 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.0 |
0.2 |
GO:0070255 |
regulation of mucus secretion(GO:0070255) |
| 0.0 |
0.4 |
GO:1901620 |
regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.0 |
0.2 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.0 |
0.0 |
GO:0097659 |
nucleic acid-templated transcription(GO:0097659) |
| 0.0 |
0.5 |
GO:2000480 |
negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 |
0.1 |
GO:0072160 |
nephron tubule epithelial cell differentiation(GO:0072160) |
| 0.0 |
0.1 |
GO:0048711 |
positive regulation of astrocyte differentiation(GO:0048711) |
| 0.0 |
0.1 |
GO:1901202 |
negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.0 |
0.0 |
GO:0045876 |
positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 |
0.2 |
GO:1902202 |
regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.0 |
0.1 |
GO:0035105 |
sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.0 |
0.2 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 |
0.3 |
GO:0043517 |
positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 |
0.0 |
GO:0031392 |
regulation of prostaglandin biosynthetic process(GO:0031392) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
| 0.0 |
0.0 |
GO:0042747 |
circadian sleep/wake cycle, REM sleep(GO:0042747) |
| 0.0 |
0.1 |
GO:0006145 |
purine nucleobase catabolic process(GO:0006145) guanine catabolic process(GO:0006147) nucleobase catabolic process(GO:0046113) |
| 0.0 |
0.0 |
GO:2000780 |
negative regulation of double-strand break repair(GO:2000780) |
| 0.0 |
0.1 |
GO:0072081 |
proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) specification of loop of Henle identity(GO:0072086) |
| 0.0 |
0.1 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 |
0.0 |
GO:2000323 |
negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.0 |
0.0 |
GO:0008355 |
olfactory learning(GO:0008355) |
| 0.0 |
0.1 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 |
0.5 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.0 |
0.2 |
GO:0017183 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 |
0.1 |
GO:0038112 |
interleukin-8-mediated signaling pathway(GO:0038112) response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.0 |
0.0 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 0.0 |
0.2 |
GO:0034656 |
nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 |
0.1 |
GO:0035879 |
plasma membrane lactate transport(GO:0035879) |
| 0.0 |
0.1 |
GO:0072334 |
UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.0 |
0.1 |
GO:0051414 |
response to cortisol(GO:0051414) |
| 0.0 |
0.1 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.0 |
0.0 |
GO:2001033 |
negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.0 |
0.2 |
GO:0035845 |
photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 |
0.0 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 |
0.0 |
GO:0002268 |
follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.0 |
0.9 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.0 |
0.2 |
GO:0019919 |
peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 |
0.1 |
GO:0002580 |
regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
| 0.0 |
0.1 |
GO:0030573 |
bile acid catabolic process(GO:0030573) |
| 0.0 |
0.1 |
GO:0070221 |
sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.0 |
0.4 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 |
0.1 |
GO:1902897 |
regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.0 |
0.0 |
GO:0061357 |
Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
| 0.0 |
0.0 |
GO:0060039 |
pericardium morphogenesis(GO:0003344) pericardium development(GO:0060039) |
| 0.0 |
0.0 |
GO:1902669 |
positive regulation of axon guidance(GO:1902669) |
| 0.0 |
0.1 |
GO:0042475 |
odontogenesis of dentin-containing tooth(GO:0042475) |
| 0.0 |
0.2 |
GO:0072386 |
plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 |
0.1 |
GO:1904705 |
regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
| 0.0 |
0.7 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 |
0.2 |
GO:0090043 |
regulation of tubulin deacetylation(GO:0090043) |
| 0.0 |
0.1 |
GO:0051552 |
flavone metabolic process(GO:0051552) |
| 0.0 |
0.1 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 |
0.5 |
GO:0071480 |
cellular response to gamma radiation(GO:0071480) |
| 0.0 |
0.3 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 |
0.4 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.0 |
0.4 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.0 |
0.3 |
GO:0033523 |
histone H2B ubiquitination(GO:0033523) |
| 0.0 |
0.4 |
GO:0015014 |
heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 |
0.2 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 |
0.1 |
GO:0071262 |
regulation of eIF2 alpha phosphorylation by amino acid starvation(GO:0060733) regulation of translational initiation in response to starvation(GO:0071262) positive regulation of translational initiation in response to starvation(GO:0071264) |
| 0.0 |
0.3 |
GO:0034116 |
positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.0 |
0.1 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 |
0.1 |
GO:2000698 |
positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.0 |
0.0 |
GO:0046174 |
polyol catabolic process(GO:0046174) |
| 0.0 |
0.9 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.0 |
0.1 |
GO:0001945 |
lymph vessel development(GO:0001945) |
| 0.0 |
0.2 |
GO:0032048 |
cardiolipin metabolic process(GO:0032048) |
| 0.0 |
0.1 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 |
0.2 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.0 |
0.1 |
GO:0051897 |
positive regulation of protein kinase B signaling(GO:0051897) |
| 0.0 |
0.2 |
GO:0019317 |
fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 |
0.0 |
GO:0071478 |
cellular response to radiation(GO:0071478) |
| 0.0 |
0.1 |
GO:0001207 |
histone displacement(GO:0001207) positive regulation of transcription involved in meiotic cell cycle(GO:0051039) |
| 0.0 |
0.0 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.0 |
0.2 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 |
0.1 |
GO:2000857 |
positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 |
0.0 |
GO:0035936 |
testosterone secretion(GO:0035936) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.0 |
0.0 |
GO:2000820 |
negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.0 |
0.1 |
GO:1902930 |
regulation of alcohol biosynthetic process(GO:1902930) |
| 0.0 |
0.0 |
GO:0090662 |
ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 |
0.2 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 |
0.0 |
GO:1904888 |
cranial skeletal system development(GO:1904888) |
| 0.0 |
0.3 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 |
0.0 |
GO:0002101 |
tRNA wobble cytosine modification(GO:0002101) |
| 0.0 |
0.0 |
GO:0048505 |
regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
| 0.0 |
0.1 |
GO:0003357 |
noradrenergic neuron differentiation(GO:0003357) |
| 0.0 |
0.2 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.0 |
0.1 |
GO:0071865 |
regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.0 |
0.0 |
GO:0046653 |
tetrahydrofolate metabolic process(GO:0046653) |
| 0.0 |
0.2 |
GO:0031848 |
protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 |
0.2 |
GO:2000311 |
regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 |
0.0 |
GO:0051037 |
regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 0.0 |
0.1 |
GO:0071348 |
cellular response to interleukin-11(GO:0071348) |
| 0.0 |
0.1 |
GO:1903358 |
regulation of Golgi organization(GO:1903358) |
| 0.0 |
0.0 |
GO:1904896 |
ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.0 |
0.0 |
GO:0046122 |
purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.0 |
0.1 |
GO:2000568 |
memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.0 |
0.2 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.0 |
0.1 |
GO:0009439 |
cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.0 |
0.1 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.0 |
0.2 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.0 |
0.2 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 |
1.1 |
GO:0007602 |
phototransduction(GO:0007602) |
| 0.0 |
0.1 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.0 |
0.1 |
GO:0001514 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 |
0.0 |
GO:0010936 |
negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 |
0.1 |
GO:0042144 |
vacuole fusion, non-autophagic(GO:0042144) |
| 0.0 |
0.3 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.1 |
GO:0061084 |
regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.0 |
0.0 |
GO:0002877 |
acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
| 0.0 |
0.1 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 |
1.2 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.0 |
0.1 |
GO:0009786 |
regulation of asymmetric cell division(GO:0009786) |
| 0.0 |
0.3 |
GO:0071816 |
tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 |
0.0 |
GO:0019530 |
taurine metabolic process(GO:0019530) |
| 0.0 |
0.1 |
GO:1901838 |
positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 |
0.1 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 |
0.1 |
GO:0050993 |
dimethylallyl diphosphate biosynthetic process(GO:0050992) dimethylallyl diphosphate metabolic process(GO:0050993) |
| 0.0 |
0.1 |
GO:0006777 |
Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 |
0.2 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.0 |
0.2 |
GO:0075522 |
IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 |
0.2 |
GO:2000622 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 |
0.2 |
GO:0015812 |
gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 |
0.3 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.0 |
0.0 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 |
0.3 |
GO:2001044 |
regulation of integrin-mediated signaling pathway(GO:2001044) |
| 0.0 |
0.1 |
GO:0043686 |
co-translational protein modification(GO:0043686) |
| 0.0 |
0.2 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 |
0.4 |
GO:0097320 |
membrane tubulation(GO:0097320) |
| 0.0 |
0.1 |
GO:0060856 |
establishment of blood-brain barrier(GO:0060856) |
| 0.0 |
0.0 |
GO:0015853 |
adenine transport(GO:0015853) |
| 0.0 |
0.0 |
GO:0032808 |
lacrimal gland development(GO:0032808) |
| 0.0 |
0.1 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 |
0.1 |
GO:1901143 |
insulin catabolic process(GO:1901143) |
| 0.0 |
0.0 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.0 |
0.2 |
GO:0048147 |
negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 |
0.2 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 0.0 |
0.1 |
GO:0006104 |
succinyl-CoA metabolic process(GO:0006104) |
| 0.0 |
0.0 |
GO:2000288 |
positive regulation of myoblast proliferation(GO:2000288) |
| 0.0 |
0.1 |
GO:0021979 |
hypothalamus cell differentiation(GO:0021979) |
| 0.0 |
0.1 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 |
0.1 |
GO:0006286 |
base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
| 0.0 |
0.5 |
GO:0035767 |
endothelial cell chemotaxis(GO:0035767) |
| 0.0 |
0.3 |
GO:0070584 |
mitochondrion morphogenesis(GO:0070584) |
| 0.0 |
0.2 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.0 |
0.1 |
GO:0000722 |
telomere maintenance via recombination(GO:0000722) |
| 0.0 |
0.9 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 |
0.0 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.0 |
0.0 |
GO:0061428 |
negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 |
0.1 |
GO:0002370 |
natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) positive regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060369) |
| 0.0 |
0.1 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 |
0.4 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 |
0.0 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 |
0.1 |
GO:0071675 |
mononuclear cell migration(GO:0071674) regulation of mononuclear cell migration(GO:0071675) |
| 0.0 |
0.0 |
GO:0090149 |
mitochondrial membrane fission(GO:0090149) |
| 0.0 |
0.1 |
GO:0051481 |
negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 |
0.1 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.0 |
0.1 |
GO:0009642 |
response to light intensity(GO:0009642) |
| 0.0 |
0.0 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.0 |
0.4 |
GO:0017014 |
protein nitrosylation(GO:0017014) peptidyl-cysteine S-nitrosylation(GO:0018119) |
| 0.0 |
0.3 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 0.0 |
0.1 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.0 |
0.5 |
GO:0099517 |
anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 |
0.1 |
GO:0008218 |
bioluminescence(GO:0008218) |
| 0.0 |
0.0 |
GO:0016557 |
peroxisome membrane biogenesis(GO:0016557) |
| 0.0 |
0.1 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 |
0.0 |
GO:0050955 |
thermoception(GO:0050955) |
| 0.0 |
0.2 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.0 |
0.0 |
GO:0046034 |
ATP metabolic process(GO:0046034) |
| 0.0 |
0.0 |
GO:0061187 |
regulation of chromatin silencing at rDNA(GO:0061187) |
| 0.0 |
0.1 |
GO:0021966 |
corticospinal neuron axon guidance(GO:0021966) |
| 0.0 |
0.1 |
GO:0000281 |
mitotic cytokinesis(GO:0000281) |
| 0.0 |
0.1 |
GO:0007501 |
mesodermal cell fate specification(GO:0007501) |
| 0.0 |
0.2 |
GO:0002087 |
regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 |
0.2 |
GO:1990440 |
positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.0 |
0.1 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 |
0.2 |
GO:0036295 |
cellular response to increased oxygen levels(GO:0036295) |
| 0.0 |
0.1 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.0 |
0.1 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.0 |
0.1 |
GO:0061339 |
establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.0 |
0.0 |
GO:0021503 |
neural fold bending(GO:0021503) |
| 0.0 |
0.1 |
GO:0036481 |
intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
| 0.0 |
0.4 |
GO:0006294 |
nucleotide-excision repair, preincision complex assembly(GO:0006294) |
| 0.0 |
0.2 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 |
0.0 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 |
0.1 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.0 |
0.0 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.0 |
0.1 |
GO:0071353 |
cellular response to interleukin-4(GO:0071353) |
| 0.0 |
0.0 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.0 |
0.1 |
GO:0072367 |
regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.0 |
0.1 |
GO:0090070 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 |
0.0 |
GO:0018312 |
peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.0 |
0.2 |
GO:0001510 |
RNA methylation(GO:0001510) |
| 0.0 |
0.0 |
GO:0016198 |
axon choice point recognition(GO:0016198) |
| 0.0 |
0.0 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 |
0.1 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.0 |
0.1 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 |
0.1 |
GO:0003310 |
pancreatic A cell differentiation(GO:0003310) |
| 0.0 |
0.1 |
GO:0046719 |
regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.0 |
0.1 |
GO:0070164 |
negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 |
0.0 |
GO:0008211 |
glucocorticoid metabolic process(GO:0008211) |
| 0.0 |
0.1 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 |
0.5 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.0 |
0.0 |
GO:0006425 |
glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.0 |
0.1 |
GO:0071847 |
TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.0 |
0.1 |
GO:0042796 |
snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 |
0.0 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.0 |
0.0 |
GO:0032655 |
interleukin-12 production(GO:0032615) regulation of interleukin-12 production(GO:0032655) negative regulation of interleukin-12 production(GO:0032695) |
| 0.0 |
0.4 |
GO:2000178 |
negative regulation of neural precursor cell proliferation(GO:2000178) |
| 0.0 |
0.1 |
GO:0035994 |
response to muscle stretch(GO:0035994) |
| 0.0 |
0.0 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 |
0.0 |
GO:0048308 |
organelle inheritance(GO:0048308) Golgi inheritance(GO:0048313) |
| 0.0 |
0.3 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 |
0.1 |
GO:0010820 |
positive regulation of T cell chemotaxis(GO:0010820) |
| 0.0 |
0.0 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.0 |
0.0 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.0 |
0.2 |
GO:0008627 |
intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
| 0.0 |
0.1 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 |
0.2 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 |
0.0 |
GO:2000520 |
regulation of immunological synapse formation(GO:2000520) |
| 0.0 |
0.1 |
GO:0000023 |
maltose metabolic process(GO:0000023) |
| 0.0 |
0.0 |
GO:0003091 |
renal water homeostasis(GO:0003091) |
| 0.0 |
0.1 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 |
0.2 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
1.7 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.0 |
0.0 |
GO:0019626 |
short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 |
0.4 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 |
0.2 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.0 |
0.0 |
GO:0043173 |
nucleotide salvage(GO:0043173) |
| 0.0 |
0.0 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.0 |
0.1 |
GO:0015942 |
formate metabolic process(GO:0015942) |
| 0.0 |
0.0 |
GO:0051709 |
regulation of killing of cells of other organism(GO:0051709) |
| 0.0 |
0.0 |
GO:1904479 |
regulation of intestinal absorption(GO:1904478) negative regulation of intestinal absorption(GO:1904479) |
| 0.0 |
0.3 |
GO:0000291 |
nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 |
0.0 |
GO:0071371 |
cellular response to gonadotropin stimulus(GO:0071371) |
| 0.0 |
0.1 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.0 |
0.1 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.0 |
0.1 |
GO:1905097 |
regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
| 0.0 |
0.0 |
GO:0060020 |
Bergmann glial cell differentiation(GO:0060020) |
| 0.0 |
0.0 |
GO:1900193 |
regulation of oocyte maturation(GO:1900193) |
| 0.0 |
0.1 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.0 |
0.1 |
GO:0035494 |
SNARE complex disassembly(GO:0035494) |
| 0.0 |
0.1 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.0 |
0.1 |
GO:0009236 |
cobalamin biosynthetic process(GO:0009236) |
| 0.0 |
0.1 |
GO:0035246 |
peptidyl-arginine N-methylation(GO:0035246) |
| 0.0 |
0.0 |
GO:0019933 |
cAMP-mediated signaling(GO:0019933) |
| 0.0 |
0.3 |
GO:0071715 |
icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
| 0.0 |
0.1 |
GO:0018197 |
peptidyl-aspartic acid modification(GO:0018197) |
| 0.0 |
0.0 |
GO:0032225 |
regulation of synaptic transmission, dopaminergic(GO:0032225) |
| 0.0 |
0.0 |
GO:0050435 |
beta-amyloid metabolic process(GO:0050435) |
| 0.0 |
0.1 |
GO:0071477 |
hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.0 |
0.0 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 0.0 |
0.2 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.0 |
0.1 |
GO:0010898 |
positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.0 |
0.1 |
GO:0061107 |
seminal vesicle development(GO:0061107) |
| 0.0 |
0.4 |
GO:0080171 |
lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.0 |
0.3 |
GO:0090162 |
establishment of epithelial cell polarity(GO:0090162) |
| 0.0 |
0.1 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.0 |
0.1 |
GO:0097466 |
protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) glycoprotein ERAD pathway(GO:0097466) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.0 |
0.2 |
GO:0006081 |
cellular aldehyde metabolic process(GO:0006081) |
| 0.0 |
0.0 |
GO:0044771 |
meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) |
| 0.0 |
0.1 |
GO:2000647 |
negative regulation of stem cell proliferation(GO:2000647) |
| 0.0 |
0.1 |
GO:1990009 |
retinal cell apoptotic process(GO:1990009) |
| 0.0 |
0.1 |
GO:0032201 |
telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.0 |
0.0 |
GO:0072684 |
tRNA 3'-trailer cleavage, endonucleolytic(GO:0034414) tRNA 3'-trailer cleavage(GO:0042779) mitochondrial tRNA 3'-trailer cleavage, endonucleolytic(GO:0072684) |
| 0.0 |
0.0 |
GO:1900180 |
regulation of protein localization to nucleus(GO:1900180) |
| 0.0 |
0.1 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.0 |
0.3 |
GO:0045162 |
clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 |
0.1 |
GO:1901386 |
negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 |
0.1 |
GO:1905224 |
clathrin-coated pit assembly(GO:1905224) |
| 0.0 |
0.0 |
GO:0090325 |
regulation of locomotion involved in locomotory behavior(GO:0090325) |
| 0.0 |
0.0 |
GO:0071460 |
cellular response to cell-matrix adhesion(GO:0071460) |
| 0.0 |
0.1 |
GO:0060638 |
mesenchymal-epithelial cell signaling(GO:0060638) |
| 0.0 |
0.1 |
GO:0045725 |
positive regulation of glycogen biosynthetic process(GO:0045725) |
| 0.0 |
0.0 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.0 |
0.0 |
GO:2000232 |
regulation of rRNA processing(GO:2000232) |
| 0.0 |
0.1 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.0 |
0.1 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 |
0.0 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) spindle assembly involved in meiosis(GO:0090306) |
| 0.0 |
0.2 |
GO:0070294 |
renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.0 |
0.0 |
GO:0046622 |
positive regulation of organ growth(GO:0046622) |
| 0.0 |
0.1 |
GO:0035610 |
protein side chain deglutamylation(GO:0035610) |
| 0.0 |
0.0 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 |
0.4 |
GO:0051016 |
barbed-end actin filament capping(GO:0051016) |
| 0.0 |
0.0 |
GO:0032571 |
response to vitamin K(GO:0032571) |
| 0.0 |
0.1 |
GO:0051292 |
nuclear pore organization(GO:0006999) nuclear pore complex assembly(GO:0051292) |
| 0.0 |
0.1 |
GO:0009838 |
abscission(GO:0009838) |
| 0.0 |
0.2 |
GO:0006068 |
ethanol catabolic process(GO:0006068) |
| 0.0 |
0.1 |
GO:0010248 |
establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 |
0.0 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.0 |
0.1 |
GO:0021680 |
cerebellar Purkinje cell layer development(GO:0021680) |
| 0.0 |
0.1 |
GO:2000152 |
regulation of ubiquitin-specific protease activity(GO:2000152) positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.0 |
0.0 |
GO:0071033 |
nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.0 |
0.0 |
GO:0006700 |
C21-steroid hormone biosynthetic process(GO:0006700) C21-steroid hormone metabolic process(GO:0008207) |
| 0.0 |
0.2 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 |
0.2 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.0 |
0.0 |
GO:0045792 |
negative regulation of cell size(GO:0045792) |
| 0.0 |
0.1 |
GO:2001240 |
negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.0 |
0.1 |
GO:0051573 |
negative regulation of histone H3-K9 methylation(GO:0051573) |
| 0.0 |
0.0 |
GO:0046013 |
regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 |
0.1 |
GO:0070207 |
protein homotrimerization(GO:0070207) |
| 0.0 |
0.0 |
GO:1900126 |
negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 |
0.1 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 |
0.1 |
GO:0030952 |
establishment or maintenance of cytoskeleton polarity(GO:0030952) |
| 0.0 |
0.1 |
GO:0035434 |
copper ion transmembrane transport(GO:0035434) |
| 0.0 |
0.4 |
GO:0005980 |
polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 |
0.2 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.0 |
0.2 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 0.0 |
0.1 |
GO:0033169 |
histone H3-K9 demethylation(GO:0033169) |
| 0.0 |
0.3 |
GO:0006418 |
tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 |
0.1 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 |
0.2 |
GO:1990573 |
potassium ion import across plasma membrane(GO:1990573) |
| 0.0 |
0.0 |
GO:1900227 |
positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 |
0.1 |
GO:0070986 |
left/right axis specification(GO:0070986) |
| 0.0 |
0.0 |
GO:0046490 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.0 |
0.0 |
GO:0036260 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 |
0.1 |
GO:0001188 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.0 |
0.0 |
GO:1904017 |
cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 |
0.1 |
GO:0016191 |
synaptic vesicle uncoating(GO:0016191) |
| 0.0 |
0.3 |
GO:0055072 |
iron ion homeostasis(GO:0055072) |
| 0.0 |
0.1 |
GO:0009151 |
purine deoxyribonucleotide metabolic process(GO:0009151) purine deoxyribonucleoside triphosphate metabolic process(GO:0009215) |
| 0.0 |
0.0 |
GO:0001569 |
patterning of blood vessels(GO:0001569) |
| 0.0 |
0.0 |
GO:0070131 |
positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 |
0.1 |
GO:0070970 |
interleukin-2 secretion(GO:0070970) |
| 0.0 |
0.1 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 |
0.0 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 |
0.2 |
GO:0015914 |
phospholipid transport(GO:0015914) |
| 0.0 |
0.5 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.0 |
0.1 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.0 |
0.2 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.0 |
1.1 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.0 |
0.3 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.0 |
0.1 |
GO:0051083 |
'de novo' cotranslational protein folding(GO:0051083) |
| 0.0 |
0.0 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.0 |
0.2 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 |
0.0 |
GO:1900005 |
positive regulation of serine-type endopeptidase activity(GO:1900005) positive regulation of serine-type peptidase activity(GO:1902573) |
| 0.0 |
0.0 |
GO:0072643 |
interferon-gamma secretion(GO:0072643) |
| 0.0 |
0.1 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 |
0.2 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 |
0.0 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.0 |
0.0 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.0 |
0.1 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 |
0.0 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.0 |
0.5 |
GO:0016601 |
Rac protein signal transduction(GO:0016601) |
| 0.0 |
0.0 |
GO:0016556 |
mRNA modification(GO:0016556) |
| 0.0 |
0.1 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.0 |
0.0 |
GO:0072186 |
kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) metanephric cap development(GO:0072185) metanephric cap morphogenesis(GO:0072186) metanephric cap mesenchymal cell proliferation involved in metanephros development(GO:0090094) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 0.0 |
0.0 |
GO:0033384 |
geranyl diphosphate metabolic process(GO:0033383) geranyl diphosphate biosynthetic process(GO:0033384) farnesyl diphosphate biosynthetic process(GO:0045337) |
| 0.0 |
0.1 |
GO:0002154 |
thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 |
0.3 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.0 |
0.1 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.0 |
0.2 |
GO:0007026 |
negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 |
0.0 |
GO:0060022 |
hard palate development(GO:0060022) |
| 0.0 |
0.3 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 |
0.1 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 |
0.2 |
GO:0033683 |
nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.0 |
0.0 |
GO:0060152 |
peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.0 |
0.1 |
GO:1900120 |
regulation of receptor binding(GO:1900120) |
| 0.0 |
0.0 |
GO:0060982 |
coronary artery morphogenesis(GO:0060982) |
| 0.0 |
0.2 |
GO:0032958 |
inositol phosphate biosynthetic process(GO:0032958) |
| 0.0 |
0.0 |
GO:0043096 |
purine nucleobase salvage(GO:0043096) |
| 0.0 |
0.9 |
GO:0018279 |
peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 |
0.1 |
GO:1903894 |
regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.0 |
0.1 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.0 |
0.1 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 |
0.0 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 |
0.9 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 |
0.0 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.0 |
0.0 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.0 |
0.0 |
GO:1903333 |
negative regulation of protein folding(GO:1903333) |
| 0.0 |
0.0 |
GO:0075713 |
establishment of integrated proviral latency(GO:0075713) |
| 0.0 |
0.0 |
GO:0006542 |
glutamine biosynthetic process(GO:0006542) |
| 0.0 |
0.1 |
GO:0045722 |
positive regulation of gluconeogenesis(GO:0045722) |
| 0.0 |
0.0 |
GO:0033629 |
negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 |
0.0 |
GO:0045054 |
constitutive secretory pathway(GO:0045054) |
| 0.0 |
0.1 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.0 |
0.1 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 |
0.1 |
GO:0042074 |
cell migration involved in gastrulation(GO:0042074) |
| 0.0 |
0.1 |
GO:0030422 |
production of siRNA involved in RNA interference(GO:0030422) |
| 0.0 |
0.0 |
GO:0032796 |
uropod organization(GO:0032796) |
| 0.0 |
0.1 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.0 |
0.1 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.0 |
0.0 |
GO:1904885 |
beta-catenin destruction complex assembly(GO:1904885) |
| 0.0 |
0.0 |
GO:0001545 |
primary ovarian follicle growth(GO:0001545) |
| 0.0 |
0.0 |
GO:0007346 |
regulation of mitotic cell cycle(GO:0007346) |
| 0.0 |
0.2 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
0.4 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 |
0.0 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 |
0.0 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.0 |
0.1 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 |
0.1 |
GO:0033145 |
positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.0 |
0.0 |
GO:2000304 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 |
0.1 |
GO:0000737 |
DNA catabolic process, endonucleolytic(GO:0000737) |
| 0.0 |
0.0 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.0 |
0.3 |
GO:0045332 |
phospholipid translocation(GO:0045332) |
| 0.0 |
0.0 |
GO:0006891 |
intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 |
0.0 |
GO:0090107 |
regulation of high-density lipoprotein particle assembly(GO:0090107) |
| 0.0 |
0.4 |
GO:0051123 |
RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 |
0.1 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.0 |
0.1 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.0 |
0.0 |
GO:0009597 |
detection of virus(GO:0009597) |
| 0.0 |
0.0 |
GO:0033490 |
cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.0 |
0.2 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 |
0.1 |
GO:0048026 |
positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 |
0.2 |
GO:0031293 |
membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 |
0.1 |
GO:1903147 |
negative regulation of mitophagy(GO:1903147) |
| 0.0 |
0.1 |
GO:0042797 |
5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.0 |
0.0 |
GO:0010993 |
regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.0 |
0.0 |
GO:0060126 |
somatotropin secreting cell differentiation(GO:0060126) |
| 0.0 |
0.0 |
GO:0061737 |
leukotriene signaling pathway(GO:0061737) |
| 0.0 |
0.0 |
GO:0070189 |
kynurenine metabolic process(GO:0070189) |
| 0.0 |
0.1 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
| 0.0 |
0.2 |
GO:0048311 |
mitochondrion distribution(GO:0048311) |
| 0.0 |
0.1 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 |
0.1 |
GO:1902045 |
negative regulation of Fas signaling pathway(GO:1902045) |
