Motif ID: RAD21_SMC3
Z-value: 1.152
Transcription factors associated with RAD21_SMC3:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| RAD21 | ENSG00000164754.8 | RAD21 |
| SMC3 | ENSG00000108055.9 | SMC3 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| RAD21 | hg19_v2_chr8_-_117886955_117887105 | 0.96 | 3.2e-05 | Click! |
| SMC3 | hg19_v2_chr10_+_112327425_112327516 | 0.93 | 2.7e-04 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | GO:0070429 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) tolerance induction to lipopolysaccharide(GO:0072573) negative regulation of CD40 signaling pathway(GO:2000349) |
| 0.5 | 1.6 | GO:1901202 | negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.3 | 2.7 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.3 | 1.9 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.3 | 0.8 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.3 | 1.0 | GO:2000569 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.2 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 0.6 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) positive regulation of chromatin assembly or disassembly(GO:0045799) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.2 | 0.6 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 0.2 | 0.6 | GO:2001037 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.2 | 0.9 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.2 | 1.3 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.2 | 0.5 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
| 0.2 | 0.9 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.2 | 0.5 | GO:2000625 | regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
| 0.1 | 0.9 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.1 | 1.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.7 | GO:0014740 | negative regulation of muscle hyperplasia(GO:0014740) |
| 0.1 | 0.8 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 | 0.6 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.1 | 1.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.7 | GO:0097052 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) L-kynurenine metabolic process(GO:0097052) |
| 0.1 | 0.3 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.6 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.1 | 0.4 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.1 | 0.3 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.1 | 0.4 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.1 | 0.3 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.1 | 1.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 1.6 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.1 | 0.3 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.1 | 1.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 2.3 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 0.4 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.1 | 0.2 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.1 | 0.7 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 | 0.5 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) histone H2A phosphorylation(GO:1990164) |
| 0.1 | 0.6 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.1 | 0.4 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.1 | 1.0 | GO:0000050 | urea cycle(GO:0000050) |
| 0.1 | 0.2 | GO:0006424 | glutamyl-tRNA aminoacylation(GO:0006424) |
| 0.1 | 0.2 | GO:1904588 | cellular response to glycoprotein(GO:1904588) cellular response to thyrotropin-releasing hormone(GO:1905229) |
| 0.1 | 1.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 0.3 | GO:1903597 | negative regulation of gap junction assembly(GO:1903597) |
| 0.1 | 0.7 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 3.4 | GO:0097435 | fibril organization(GO:0097435) |
| 0.1 | 0.2 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.1 | 0.2 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 | 0.9 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.1 | 0.3 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.1 | 0.3 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.0 | 0.2 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) beta-alanine metabolic process(GO:0019482) thymine metabolic process(GO:0019859) uracil metabolic process(GO:0019860) |
| 0.0 | 0.1 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
| 0.0 | 0.2 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.0 | 0.2 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.0 | 0.2 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 | 0.1 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.0 | 0.6 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.3 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.2 | GO:0044026 | DNA hypermethylation(GO:0044026) |
| 0.0 | 0.2 | GO:0009149 | pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 0.0 | 0.6 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.0 | 0.3 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.0 | 1.1 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.3 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.0 | 0.1 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.0 | 0.2 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.0 | 0.2 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.0 | 0.2 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.0 | 0.3 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.1 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.0 | 0.3 | GO:0070431 | nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.2 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 | 0.2 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.0 | 0.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.0 | 0.1 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.0 | 0.1 | GO:0034402 | recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.0 | 0.3 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.0 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 | 0.2 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.0 | 0.2 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.0 | 0.1 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.0 | 0.2 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.0 | 0.3 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.3 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.0 | 0.3 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.0 | 0.1 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.1 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.0 | 2.1 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.2 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.0 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.5 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.0 | 0.4 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 0.3 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.0 | 0.1 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.0 | 0.4 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.5 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.4 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.1 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
| 0.0 | 0.6 | GO:0006293 | nucleotide-excision repair, preincision complex stabilization(GO:0006293) |
| 0.0 | 0.1 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 1.5 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.1 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.0 | 0.5 | GO:0042493 | response to drug(GO:0042493) |
| 0.0 | 0.3 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.0 | 0.3 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.2 | GO:0014003 | oligodendrocyte development(GO:0014003) |
| 0.0 | 0.1 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.0 | 0.1 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.0 | 0.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.0 | 0.2 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.3 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
| 0.0 | 0.1 | GO:0061188 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.4 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.2 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.2 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 | 0.1 | GO:1903286 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 0.0 | 0.1 | GO:0060492 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.0 | 0.1 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.0 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.3 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.0 | 0.2 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.0 | 1.2 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) |
| 0.0 | 0.3 | GO:0051480 | regulation of cytosolic calcium ion concentration(GO:0051480) |
| 0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.0 | 0.0 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.0 | 0.2 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.0 | GO:0061582 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) intestinal epithelial cell migration(GO:0061582) |
| 0.0 | 0.3 | GO:0051197 | positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.1 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.2 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.9 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.2 | 0.7 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.2 | 1.0 | GO:0031252 | cell leading edge(GO:0031252) |
| 0.1 | 2.7 | GO:0032059 | bleb(GO:0032059) |
| 0.1 | 0.9 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.8 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.4 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.1 | 1.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 0.5 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.1 | 1.4 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 0.2 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.1 | 1.1 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 0.5 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.1 | 2.5 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 0.2 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.1 | 0.4 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.1 | 0.2 | GO:1990423 | Dsl1p complex(GO:0070939) RZZ complex(GO:1990423) |
| 0.1 | 0.2 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 2.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.2 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.7 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.3 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.1 | GO:0097134 | Y chromosome(GO:0000806) cyclin A2-CDK2 complex(GO:0097124) cyclin E1-CDK2 complex(GO:0097134) |
| 0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.5 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.1 | GO:0035101 | FACT complex(GO:0035101) |
| 0.0 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.0 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.5 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.8 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.9 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.2 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
| 0.0 | 0.6 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.3 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.3 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.3 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.2 | GO:0030681 | multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.3 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.1 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.3 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.5 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.0 | 0.5 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 1.0 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.1 | GO:0034272 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
| 0.0 | 0.5 | GO:0043296 | apical junction complex(GO:0043296) |
| 0.0 | 1.8 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.2 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.4 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.7 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
| 0.2 | 1.6 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.2 | 0.7 | GO:0047536 | 2-aminoadipate transaminase activity(GO:0047536) |
| 0.2 | 0.8 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.1 | 0.4 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.1 | 0.8 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.6 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 0.1 | 0.4 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.1 | 0.7 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.1 | 1.9 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.1 | 0.3 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 0.6 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.1 | 0.3 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.1 | 0.3 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.1 | 0.4 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.1 | 0.4 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.1 | 0.7 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.1 | 0.3 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.3 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.1 | 0.2 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
| 0.1 | 0.5 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.1 | 0.2 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.1 | 1.5 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 4.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 1.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 2.0 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.0 | 0.6 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.6 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.0 | 0.3 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.9 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.3 | GO:0031711 | tripeptidyl-peptidase activity(GO:0008240) bradykinin receptor binding(GO:0031711) |
| 0.0 | 0.4 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.6 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 1.0 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.6 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.2 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.0 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.9 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.1 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
| 0.0 | 0.5 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 1.0 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.2 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.7 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.2 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.4 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.3 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.2 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.1 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.0 | 1.4 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.2 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 1.5 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.3 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.3 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.0 | 1.2 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.9 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.5 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 2.9 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.4 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.3 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0051022 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 3.1 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.3 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.0 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.6 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.1 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.0 | 3.6 | GO:0019838 | growth factor binding(GO:0019838) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.1 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.0 | 0.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.9 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.2 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 0.9 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.8 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.1 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.2 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 0.1 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.1 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 1.4 | GO:0005518 | collagen binding(GO:0005518) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.4 | SA_TRKA_RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 1.6 | PID_ANTHRAX_PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.8 | PID_P38_GAMMA_DELTA_PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 2.0 | ST_TUMOR_NECROSIS_FACTOR_PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.4 | PID_S1P_S1P4_PATHWAY | S1P4 pathway |
| 0.0 | 1.4 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 3.1 | PID_E2F_PATHWAY | E2F transcription factor network |
| 0.0 | 0.4 | SA_CASPASE_CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 2.2 | PID_TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.8 | PID_BARD1_PATHWAY | BARD1 signaling events |
| 0.0 | 0.2 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
| 0.0 | 1.0 | NABA_COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.9 | ST_B_CELL_ANTIGEN_RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.5 | PID_LPA4_PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.7 | PID_NCADHERIN_PATHWAY | N-cadherin signaling events |
| 0.0 | 3.7 | NABA_CORE_MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
| 0.0 | 0.2 | PID_P38_ALPHA_BETA_PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.7 | SIG_REGULATION_OF_THE_ACTIN_CYTOSKELETON_BY_RHO_GTPASES | Genes related to regulation of the actin cytoskeleton |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.4 | REACTOME_G_PROTEIN_ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 3.0 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.6 | REACTOME_ROLE_OF_DCC_IN_REGULATING_APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 1.0 | REACTOME_ABCA_TRANSPORTERS_IN_LIPID_HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.9 | REACTOME_PHOSPHORYLATION_OF_CD3_AND_TCR_ZETA_CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.7 | REACTOME_TRYPTOPHAN_CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.8 | REACTOME_RETROGRADE_NEUROTROPHIN_SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 1.4 | REACTOME_INTERACTION_BETWEEN_L1_AND_ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 1.9 | REACTOME_NEGATIVE_REGULATORS_OF_RIG_I_MDA5_SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 0.7 | REACTOME_TETRAHYDROBIOPTERIN_BH4_SYNTHESIS_RECYCLING_SALVAGE_AND_REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.1 | REACTOME_NEGATIVE_REGULATION_OF_THE_PI3K_AKT_NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.9 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.4 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.8 | REACTOME_CASPASE_MEDIATED_CLEAVAGE_OF_CYTOSKELETAL_PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.3 | REACTOME_BIOSYNTHESIS_OF_THE_N_GLYCAN_PRECURSOR_DOLICHOL_LIPID_LINKED_OLIGOSACCHARIDE_LLO_AND_TRANSFER_TO_A_NASCENT_PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.2 | REACTOME_HORMONE_LIGAND_BINDING_RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.9 | REACTOME_DOWNSTREAM_TCR_SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.4 | REACTOME_TRAF6_MEDIATED_NFKB_ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.6 | REACTOME_ENDOSOMAL_SORTING_COMPLEX_REQUIRED_FOR_TRANSPORT_ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.6 | REACTOME_STEROID_HORMONES | Genes involved in Steroid hormones |
| 0.0 | 2.5 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.2 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 0.6 | REACTOME_RECYCLING_PATHWAY_OF_L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.3 | REACTOME_REGULATION_OF_RHEB_GTPASE_ACTIVITY_BY_AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 1.2 | REACTOME_METABOLISM_OF_NON_CODING_RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.2 | REACTOME_FGFR4_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.2 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.3 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.3 | REACTOME_RNA_POL_III_CHAIN_ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.3 | REACTOME_GLYCOGEN_BREAKDOWN_GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.5 | REACTOME_INHIBITION_OF_INSULIN_SECRETION_BY_ADRENALINE_NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.6 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
|
|
|