Motif ID: NRF1
Z-value: 1.816
Transcription factors associated with NRF1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| NRF1 | ENSG00000106459.10 | NRF1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| NRF1 | hg19_v2_chr7_+_129251531_129251601 | -0.61 | 7.9e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 4.3 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.6 | 1.9 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.5 | 4.2 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.5 | 1.4 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.4 | 1.3 | GO:0033319 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.4 | 2.6 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.4 | 1.1 | GO:0036482 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.3 | 2.4 | GO:0060356 | leucine import(GO:0060356) |
| 0.3 | 2.7 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.3 | 1.2 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.3 | 0.8 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.3 | 1.6 | GO:0015853 | adenine transport(GO:0015853) |
| 0.3 | 2.5 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.3 | 1.3 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.2 | 1.2 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.2 | 2.4 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.2 | 0.7 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.2 | 1.2 | GO:0036512 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.2 | 0.9 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.2 | 2.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.2 | 0.6 | GO:0097466 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) glycoprotein ERAD pathway(GO:0097466) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.2 | 0.5 | GO:0086047 | membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 0.2 | 1.9 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.2 | 0.9 | GO:1903615 | regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
| 0.2 | 0.5 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.2 | 1.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.2 | 0.5 | GO:0019230 | pathogenesis(GO:0009405) proprioception(GO:0019230) |
| 0.2 | 0.6 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.2 | 0.8 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.2 | 0.6 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.1 | 0.4 | GO:0034164 | negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.1 | 2.4 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.1 | 0.4 | GO:0046709 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.1 | 1.0 | GO:0003172 | primary heart field specification(GO:0003138) sinoatrial valve development(GO:0003172) sinoatrial valve morphogenesis(GO:0003185) |
| 0.1 | 0.5 | GO:0097069 | cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 0.1 | 0.4 | GO:0006043 | glucosamine catabolic process(GO:0006043) |
| 0.1 | 1.3 | GO:1904327 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.1 | 0.5 | GO:0042247 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.1 | 0.4 | GO:0034445 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.1 | 0.6 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.1 | 0.6 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.1 | 0.8 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.1 | 0.3 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.1 | 0.3 | GO:0071030 | nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.1 | 0.3 | GO:0002368 | B cell cytokine production(GO:0002368) |
| 0.1 | 0.3 | GO:1904899 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.1 | 0.5 | GO:0043407 | negative regulation of MAP kinase activity(GO:0043407) |
| 0.1 | 0.5 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.8 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 0.3 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
| 0.1 | 0.4 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.1 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.8 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.1 | 0.3 | GO:0043311 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 0.1 | 0.4 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.1 | 0.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.1 | 0.3 | GO:0010845 | positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.1 | 0.3 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
| 0.1 | 0.2 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
| 0.1 | 0.2 | GO:0036333 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.1 | 0.1 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 0.1 | 0.6 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 1.9 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.3 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 | 0.6 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.2 | GO:0018283 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) |
| 0.1 | 0.4 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 2.1 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.1 | 0.3 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 | 0.4 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.1 | 0.3 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.1 | 0.3 | GO:0006617 | SRP-dependent cotranslational protein targeting to membrane, signal sequence recognition(GO:0006617) |
| 0.1 | 0.2 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.1 | 0.2 | GO:0071139 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.1 | 0.2 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.1 | 0.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.1 | 1.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.1 | 0.9 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.1 | 0.6 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.3 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 | 0.5 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.1 | 1.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.1 | 0.6 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 0.2 | GO:1902559 | 3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.1 | 0.3 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.1 | 1.7 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 0.5 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.5 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.1 | 0.1 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 | 0.2 | GO:0061534 | gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
| 0.1 | 0.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 0.2 | GO:0051780 | mevalonate transport(GO:0015728) behavioral response to nutrient(GO:0051780) |
| 0.1 | 1.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.1 | 0.9 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 0.5 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.1 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.9 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 0.2 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.1 | 0.3 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.1 | 0.8 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.1 | 0.4 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 1.0 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.1 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.1 | 0.3 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.1 | 0.3 | GO:0060214 | endocardium morphogenesis(GO:0003160) endocardium formation(GO:0060214) |
| 0.1 | 1.1 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 0.3 | GO:0010816 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.1 | 0.3 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.1 | 0.3 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) response to aldosterone(GO:1904044) |
| 0.1 | 0.3 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.8 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 | 0.2 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.1 | 0.9 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.2 | GO:1990619 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) positive regulation of chondrocyte proliferation(GO:1902732) histone H3-K9 deacetylation(GO:1990619) |
| 0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 0.6 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.1 | 0.6 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 | 0.4 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.1 | 0.1 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
| 0.1 | 0.2 | GO:0070988 | demethylation(GO:0070988) |
| 0.1 | 0.2 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.1 | 0.3 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.1 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 1.7 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.4 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 1.2 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.0 | 0.1 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.0 | 0.6 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 | 0.2 | GO:0006311 | meiotic gene conversion(GO:0006311) |
| 0.0 | 0.2 | GO:1902728 | mineralocorticoid receptor signaling pathway(GO:0031959) positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.0 | 0.1 | GO:0097581 | lamellipodium organization(GO:0097581) |
| 0.0 | 0.3 | GO:2001171 | regulation of ATP biosynthetic process(GO:2001169) positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.0 | 0.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.3 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.0 | 0.7 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.0 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.0 | 0.2 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.0 | 0.2 | GO:0046725 | negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.8 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.5 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 1.2 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.0 | 0.2 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.1 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.0 | 0.3 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.0 | 0.1 | GO:1903031 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.0 | 0.8 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.0 | 0.7 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.0 | 0.3 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.0 | 0.2 | GO:0071477 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.0 | 0.4 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 0.3 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.9 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.1 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.0 | 0.7 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 | 0.4 | GO:0042148 | strand invasion(GO:0042148) |
| 0.0 | 0.7 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.0 | 0.1 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.5 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.0 | 0.6 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.7 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 0.7 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.0 | 0.2 | GO:0021997 | neural plate axis specification(GO:0021997) |
| 0.0 | 0.1 | GO:1902530 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.0 | 0.5 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.0 | 0.1 | GO:0060086 | circadian temperature homeostasis(GO:0060086) |
| 0.0 | 0.3 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 | 0.0 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
| 0.0 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.2 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.0 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 1.5 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 | 0.4 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.5 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.2 | GO:1904764 | negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.0 | 0.3 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.0 | 0.4 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.0 | 0.5 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.0 | 0.1 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.0 | 0.1 | GO:0097198 | histone H3-K36 trimethylation(GO:0097198) |
| 0.0 | 0.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.0 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.0 | 0.6 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.0 | 0.1 | GO:0051057 | positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.0 | 0.0 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) |
| 0.0 | 0.1 | GO:0035750 | protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.0 | 0.6 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.2 | GO:1903401 | L-lysine transmembrane transport(GO:1903401) |
| 0.0 | 0.3 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.0 | 0.3 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.6 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.0 | 0.4 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.2 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.0 | 0.1 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.0 | 0.1 | GO:1904717 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.0 | 0.2 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.0 | 0.3 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.4 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.0 | 0.5 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.2 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.0 | 0.2 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.0 | 1.1 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.0 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.3 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.2 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.5 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.3 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.0 | 0.1 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.0 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.2 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.4 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.4 | GO:0048813 | dendrite morphogenesis(GO:0048813) |
| 0.0 | 0.4 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.6 | GO:0090190 | positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
| 0.0 | 0.4 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.0 | GO:0035625 | epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.0 | 0.3 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.0 | 0.1 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.0 | 0.3 | GO:0009304 | tRNA transcription(GO:0009304) |
| 0.0 | 0.3 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 | 0.4 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 | 0.1 | GO:0019233 | sensory perception of pain(GO:0019233) |
| 0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.3 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 | 0.1 | GO:0014876 | response to injury involved in regulation of muscle adaptation(GO:0014876) |
| 0.0 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 0.2 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.0 | 0.1 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.0 | 0.3 | GO:0061525 | hindgut development(GO:0061525) |
| 0.0 | 0.0 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.2 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.2 | GO:0006612 | protein targeting to membrane(GO:0006612) |
| 0.0 | 0.1 | GO:0015827 | tryptophan transport(GO:0015827) |
| 0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.1 | GO:1900248 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.0 | 0.1 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.0 | 0.4 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.3 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 | 0.1 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.0 | 0.2 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.0 | 0.5 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 | 0.1 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.2 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.0 | 0.1 | GO:0048664 | Cdc42 protein signal transduction(GO:0032488) neuron fate determination(GO:0048664) |
| 0.0 | 0.1 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.0 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.0 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.1 | GO:0045081 | negative regulation of interleukin-10 biosynthetic process(GO:0045081) |
| 0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 | 0.4 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) gas homeostasis(GO:0033483) |
| 0.0 | 0.1 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.0 | GO:0045210 | negative regulation of dendritic cell cytokine production(GO:0002731) FasL biosynthetic process(GO:0045210) |
| 0.0 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 | 0.3 | GO:0070828 | heterochromatin organization(GO:0070828) |
| 0.0 | 0.6 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.0 | 0.2 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.4 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.8 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.1 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.2 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.0 | 0.0 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 | 0.4 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.0 | 0.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.2 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.0 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
| 0.0 | 0.6 | GO:0032885 | regulation of glycogen biosynthetic process(GO:0005979) regulation of glucan biosynthetic process(GO:0010962) regulation of polysaccharide biosynthetic process(GO:0032885) |
| 0.0 | 0.1 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.0 | 0.3 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 1.3 | GO:0007588 | excretion(GO:0007588) |
| 0.0 | 0.2 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.0 | 0.2 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.0 | 0.1 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.0 | 0.2 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.0 | 0.7 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.3 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.0 | 0.4 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) |
| 0.0 | 0.2 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.1 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.0 | 0.1 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.0 | 0.1 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.1 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.0 | 0.2 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.0 | 0.1 | GO:0030217 | T cell differentiation(GO:0030217) |
| 0.0 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.0 | 0.0 | GO:0033003 | regulation of mast cell activation(GO:0033003) regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.0 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.0 | 0.1 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.0 | 0.0 | GO:2000977 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) regulation of forebrain neuron differentiation(GO:2000977) |
| 0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 0.0 | GO:0035065 | regulation of histone acetylation(GO:0035065) |
| 0.0 | 0.1 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.0 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.0 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.0 | 0.2 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.1 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.5 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.0 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.0 | 0.0 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.2 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.0 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 | 0.0 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.0 | 0.1 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.0 | 0.7 | GO:0007528 | neuromuscular junction development(GO:0007528) |
| 0.0 | 0.1 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.1 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.0 | 0.1 | GO:0010977 | negative regulation of neuron projection development(GO:0010977) |
| 0.0 | 0.1 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 | 0.0 | GO:0031017 | exocrine pancreas development(GO:0031017) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.9 | GO:0043257 | laminin-8 complex(GO:0043257) |
| 0.2 | 0.5 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.2 | 2.7 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.2 | 1.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.6 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.1 | 2.4 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 3.1 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.5 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 0.4 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.1 | 0.9 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 1.3 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 0.4 | GO:0031592 | centrosomal corona(GO:0031592) |
| 0.1 | 1.6 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 1.0 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.1 | 0.5 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.1 | 0.3 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 6.0 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.6 | GO:0032059 | bleb(GO:0032059) |
| 0.1 | 0.4 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 0.3 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 0.9 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 0.2 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.1 | 0.6 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.5 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.6 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.2 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.1 | 0.1 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.1 | 0.3 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.1 | 0.2 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.1 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 0.3 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.6 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 1.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.3 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.1 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.3 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.1 | 0.1 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.1 | 0.4 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 0.1 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.0 | 0.2 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.0 | 0.2 | GO:0042585 | female germ cell nucleus(GO:0001674) germinal vesicle(GO:0042585) |
| 0.0 | 1.3 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.0 | 0.3 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.0 | 0.7 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 6.0 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.2 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.0 | 0.2 | GO:0098845 | postsynaptic recycling endosome(GO:0098837) postsynaptic endosome(GO:0098845) |
| 0.0 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.3 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 1.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.2 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.0 | 0.5 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.4 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.3 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.5 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.7 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.6 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.9 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.0 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.0 | 0.1 | GO:0072563 | endothelial microparticle(GO:0072563) |
| 0.0 | 0.3 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.8 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.5 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.0 | 0.4 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 1.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.3 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
| 0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.1 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.0 | 0.3 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.0 | 0.1 | GO:0060187 | cell pole(GO:0060187) |
| 0.0 | 0.1 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.0 | 0.7 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.2 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.0 | 0.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.4 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.5 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 0.9 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.2 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.8 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.4 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 1.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.2 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.7 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.2 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.3 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.0 | 0.1 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.1 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.2 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.4 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 1.9 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.4 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.0 | 0.0 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 0.5 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.1 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 1.9 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.4 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.0 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.0 | 0.5 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 0.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.9 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 4.4 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.1 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.0 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 1.0 | GO:0001726 | ruffle(GO:0001726) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 3.1 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.5 | 1.6 | GO:0086057 | voltage-gated calcium channel activity involved in bundle of His cell action potential(GO:0086057) |
| 0.5 | 1.4 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.4 | 1.3 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
| 0.3 | 1.0 | GO:0070260 | tyrosyl-RNA phosphodiesterase activity(GO:0036317) 5'-tyrosyl-DNA phosphodiesterase activity(GO:0070260) |
| 0.3 | 1.2 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.3 | 1.4 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.3 | 1.4 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.2 | 1.7 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.2 | 0.6 | GO:0016964 | alpha-2 macroglobulin receptor activity(GO:0016964) |
| 0.2 | 0.7 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.2 | 0.5 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.2 | 1.1 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.1 | 1.9 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.1 | 1.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.5 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.1 | 0.5 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 0.4 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.1 | 0.4 | GO:0019961 | interferon binding(GO:0019961) |
| 0.1 | 0.4 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
| 0.1 | 0.8 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.4 | GO:0005135 | erythropoietin receptor binding(GO:0005128) interleukin-3 receptor binding(GO:0005135) |
| 0.1 | 1.6 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.4 | GO:0005365 | myo-inositol transmembrane transporter activity(GO:0005365) |
| 0.1 | 1.8 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.3 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.1 | 2.0 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.1 | 0.5 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.1 | 1.9 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.6 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.5 | GO:0050115 | myosin-light-chain-phosphatase activity(GO:0050115) |
| 0.1 | 0.6 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.3 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.1 | 0.4 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.1 | 0.3 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.1 | 0.3 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.1 | 1.0 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.1 | 0.3 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.1 | 0.8 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.3 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.1 | 0.7 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 0.3 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.1 | 0.4 | GO:0019144 | ADP-sugar diphosphatase activity(GO:0019144) |
| 0.1 | 0.2 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
| 0.1 | 0.3 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.1 | 0.8 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.7 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 0.8 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.1 | 0.2 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.1 | 0.9 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.1 | 0.3 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.1 | 2.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 1.4 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.3 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.8 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.2 | GO:0015130 | mevalonate transmembrane transporter activity(GO:0015130) |
| 0.1 | 1.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.3 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 0.6 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 0.5 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.1 | 1.0 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.1 | 0.2 | GO:0005477 | pyruvate secondary active transmembrane transporter activity(GO:0005477) |
| 0.1 | 0.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.4 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 0.2 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.1 | 0.3 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.1 | 0.3 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 0.6 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.2 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
| 0.1 | 0.4 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.1 | 0.2 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.0 | 1.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.3 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 1.0 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.2 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.0 | 0.2 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.0 | 1.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.9 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.3 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.9 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.0 | 1.1 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.0 | 1.3 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.2 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.0 | 0.4 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 1.4 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.9 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.7 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 0.1 | GO:0097158 | pre-mRNA intronic pyrimidine-rich binding(GO:0097158) |
| 0.0 | 0.2 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 0.1 | GO:0070336 | flap-structured DNA binding(GO:0070336) |
| 0.0 | 0.4 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.8 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.3 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.8 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.1 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.0 | 0.2 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.2 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.0 | 0.2 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 0.1 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.0 | 0.3 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.0 | 0.3 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.7 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
| 0.0 | 0.7 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.7 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.5 | GO:0036122 | BMP binding(GO:0036122) |
| 0.0 | 0.6 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.0 | 0.4 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.5 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.8 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.4 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.0 | 0.8 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.2 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.0 | 0.2 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.1 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.0 | 1.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 1.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.3 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.0 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.9 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.5 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.1 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.0 | 0.2 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.7 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.1 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.0 | 0.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 1.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 3.8 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 1.5 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.0 | 0.2 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.2 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.0 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.3 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.9 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.7 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.1 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.0 | 0.7 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.6 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.6 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.1 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.0 | 3.0 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.0 | 0.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.7 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.1 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
| 0.0 | 0.3 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 0.1 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.1 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.0 | 0.1 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.0 | 0.3 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.2 | GO:0050544 | arachidonic acid binding(GO:0050544) |
| 0.0 | 0.1 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.0 | 0.1 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.0 | 0.0 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.0 | 1.0 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.1 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.1 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.0 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.0 | 0.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.0 | 0.1 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.4 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.0 | GO:0004781 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.0 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.7 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.1 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.0 | 0.2 | GO:0016301 | kinase activity(GO:0016301) |
| 0.0 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0072545 | tyrosine binding(GO:0072545) |
| 0.0 | 0.5 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.5 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.1 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.5 | GO:0004871 | signal transducer activity(GO:0004871) |
| 0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.2 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.0 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.0 | 0.2 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.2 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.3 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.0 | 0.0 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 0.4 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
| 0.0 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.8 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.2 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.6 | ST_TYPE_I_INTERFERON_PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.0 | PID_P38_GAMMA_DELTA_PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.2 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.9 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 1.6 | PID_MYC_PATHWAY | C-MYC pathway |
| 0.0 | 1.6 | PID_RXR_VDR_PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 1.1 | PID_IL12_STAT4_PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.9 | PID_ARF_3PATHWAY | Arf1 pathway |
| 0.0 | 0.4 | ST_STAT3_PATHWAY | STAT3 Pathway |
| 0.0 | 2.5 | PID_NOTCH_PATHWAY | Notch signaling pathway |
| 0.0 | 2.0 | PID_NFAT_TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.4 | PID_NFKAPPAB_ATYPICAL_PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.9 | ST_WNT_CA2_CYCLIC_GMP_PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 1.4 | ST_WNT_BETA_CATENIN_PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 1.2 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.3 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.9 | PID_CD40_PATHWAY | CD40/CD40L signaling |
| 0.0 | 1.3 | PID_P38_ALPHA_BETA_DOWNSTREAM_PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.2 | PID_SYNDECAN_3_PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 1.1 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.3 | PID_TCR_RAS_PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.3 | ST_GAQ_PATHWAY | G alpha q Pathway |
| 0.0 | 0.4 | PID_ALPHA_SYNUCLEIN_PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.2 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.7 | PID_IL1_PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.8 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.0 | 0.6 | PID_CDC42_PATHWAY | CDC42 signaling events |
| 0.0 | 0.3 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.8 | REACTOME_BINDING_AND_ENTRY_OF_HIV_VIRION | Genes involved in Binding and entry of HIV virion |
| 0.1 | 5.8 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.1 | 3.8 | REACTOME_INTERACTION_BETWEEN_L1_AND_ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.1 | 1.0 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_ATF6_ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.1 | 1.7 | REACTOME_CALNEXIN_CALRETICULIN_CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.1 | 0.9 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 1.4 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 0.9 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 1.1 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 0.8 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 2.5 | REACTOME_BASIGIN_INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 1.1 | REACTOME_PROLACTIN_RECEPTOR_SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 1.7 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 1.0 | REACTOME_VIRAL_MESSENGER_RNA_SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.0 | 1.3 | REACTOME_CRMPS_IN_SEMA3A_SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.6 | REACTOME_ROLE_OF_DCC_IN_REGULATING_APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.8 | REACTOME_SPRY_REGULATION_OF_FGF_SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 2.9 | REACTOME_O_LINKED_GLYCOSYLATION_OF_MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 1.2 | REACTOME_N_GLYCAN_ANTENNAE_ELONGATION_IN_THE_MEDIAL_TRANS_GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.5 | REACTOME_NRIF_SIGNALS_CELL_DEATH_FROM_THE_NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.0 | 0.5 | REACTOME_IL_6_SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.2 | REACTOME_INFLUENZA_VIRAL_RNA_TRANSCRIPTION_AND_REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.2 | REACTOME_GROWTH_HORMONE_RECEPTOR_SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.4 | REACTOME_APOPTOTIC_CLEAVAGE_OF_CELL_ADHESION_PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.3 | REACTOME_REGULATION_OF_IFNA_SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.4 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.8 | REACTOME_TRANSPORT_TO_THE_GOLGI_AND_SUBSEQUENT_MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.5 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.8 | REACTOME_CIRCADIAN_REPRESSION_OF_EXPRESSION_BY_REV_ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.1 | REACTOME_CONVERSION_FROM_APC_C_CDC20_TO_APC_C_CDH1_IN_LATE_ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 1.1 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.5 | REACTOME_ACTIVATED_NOTCH1_TRANSMITS_SIGNAL_TO_THE_NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.5 | REACTOME_CTNNB1_PHOSPHORYLATION_CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.4 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.2 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.2 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.9 | REACTOME_IRON_UPTAKE_AND_TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.7 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.5 | REACTOME_SYNTHESIS_OF_GLYCOSYLPHOSPHATIDYLINOSITOL_GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 7.4 | REACTOME_GENERIC_TRANSCRIPTION_PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.0 | 0.2 | REACTOME_DESTABILIZATION_OF_MRNA_BY_AUF1_HNRNP_D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.2 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_LATE_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.1 | REACTOME_PLATELET_SENSITIZATION_BY_LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.5 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_ACTIVATES_SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 0.6 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.2 | REACTOME_ORGANIC_CATION_ANION_ZWITTERION_TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.8 | REACTOME_NCAM1_INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.6 | REACTOME_CIRCADIAN_CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.3 | REACTOME_ADENYLATE_CYCLASE_INHIBITORY_PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.0 | 0.5 | REACTOME_TRANSPORT_OF_GLUCOSE_AND_OTHER_SUGARS_BILE_SALTS_AND_ORGANIC_ACIDS_METAL_IONS_AND_AMINE_COMPOUNDS | Genes involved in Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds |
| 0.0 | 0.3 | REACTOME_CREB_PHOSPHORYLATION_THROUGH_THE_ACTIVATION_OF_CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.0 | 0.1 | REACTOME_MRNA_CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.4 | REACTOME_TRAFFICKING_OF_GLUR2_CONTAINING_AMPA_RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.0 | REACTOME_DOWNSTREAM_SIGNALING_OF_ACTIVATED_FGFR | Genes involved in Downstream signaling of activated FGFR |
| 0.0 | 0.5 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.3 | REACTOME_PROTEOLYTIC_CLEAVAGE_OF_SNARE_COMPLEX_PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
