| 0.7 |
2.0 |
GO:0070175 |
positive regulation of enamel mineralization(GO:0070175) |
| 0.3 |
0.8 |
GO:0070563 |
negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 0.2 |
1.2 |
GO:0048842 |
positive regulation of axon extension involved in axon guidance(GO:0048842) |
| 0.2 |
0.9 |
GO:1903045 |
neural crest cell migration involved in sympathetic nervous system development(GO:1903045) |
| 0.2 |
0.9 |
GO:0021562 |
vestibulocochlear nerve development(GO:0021562) |
| 0.2 |
0.9 |
GO:0042138 |
meiotic DNA double-strand break formation(GO:0042138) |
| 0.2 |
0.6 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.2 |
1.2 |
GO:1904970 |
brush border assembly(GO:1904970) |
| 0.2 |
0.6 |
GO:0090427 |
positive regulation of catagen(GO:0051795) activation of meiosis(GO:0090427) |
| 0.2 |
0.5 |
GO:0070105 |
positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.2 |
0.7 |
GO:0000270 |
peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.2 |
0.8 |
GO:0009441 |
glycolate metabolic process(GO:0009441) |
| 0.2 |
1.2 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.2 |
2.3 |
GO:0097475 |
motor neuron migration(GO:0097475) |
| 0.2 |
4.1 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.1 |
0.4 |
GO:0010621 |
negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.1 |
0.1 |
GO:0001502 |
cartilage condensation(GO:0001502) |
| 0.1 |
0.7 |
GO:0072658 |
maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.1 |
2.6 |
GO:0097264 |
self proteolysis(GO:0097264) |
| 0.1 |
0.5 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 0.1 |
0.4 |
GO:0016062 |
adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.1 |
0.9 |
GO:0090063 |
positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 |
0.3 |
GO:0060738 |
epithelial-mesenchymal signaling involved in prostate gland development(GO:0060738) |
| 0.1 |
4.4 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 |
2.2 |
GO:0098828 |
positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.1 |
0.4 |
GO:0032072 |
plasmacytoid dendritic cell activation(GO:0002270) regulation of restriction endodeoxyribonuclease activity(GO:0032072) negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.1 |
0.6 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.1 |
0.5 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 |
0.5 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.1 |
2.3 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 |
1.9 |
GO:0006068 |
ethanol catabolic process(GO:0006068) |
| 0.1 |
0.5 |
GO:1903435 |
positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.1 |
0.3 |
GO:0009822 |
alkaloid catabolic process(GO:0009822) |
| 0.1 |
0.6 |
GO:0043305 |
negative regulation of mast cell degranulation(GO:0043305) |
| 0.1 |
0.1 |
GO:0034113 |
heterotypic cell-cell adhesion(GO:0034113) |
| 0.1 |
0.2 |
GO:0071418 |
cellular response to amine stimulus(GO:0071418) |
| 0.1 |
0.5 |
GO:0090234 |
regulation of kinetochore assembly(GO:0090234) |
| 0.1 |
1.5 |
GO:0035589 |
G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.1 |
0.5 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.1 |
0.2 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.1 |
0.2 |
GO:1901421 |
positive regulation of response to alcohol(GO:1901421) |
| 0.1 |
0.3 |
GO:0090362 |
positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.1 |
0.5 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 |
0.3 |
GO:0071460 |
cellular response to cell-matrix adhesion(GO:0071460) |
| 0.1 |
0.2 |
GO:0019417 |
sulfur oxidation(GO:0019417) |
| 0.1 |
0.2 |
GO:0002384 |
hepatic immune response(GO:0002384) |
| 0.1 |
0.3 |
GO:1904823 |
pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.1 |
0.2 |
GO:0035038 |
female pronucleus assembly(GO:0035038) |
| 0.0 |
0.1 |
GO:0055008 |
cardiac muscle tissue morphogenesis(GO:0055008) |
| 0.0 |
0.2 |
GO:0030311 |
poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 |
0.1 |
GO:0016999 |
antibiotic metabolic process(GO:0016999) |
| 0.0 |
0.5 |
GO:2001300 |
lipoxin metabolic process(GO:2001300) |
| 0.0 |
1.1 |
GO:0010886 |
positive regulation of cholesterol storage(GO:0010886) |
| 0.0 |
1.3 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.0 |
0.1 |
GO:1904395 |
retinal rod cell differentiation(GO:0060221) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) negative regulation of neuromuscular junction development(GO:1904397) |
| 0.0 |
0.1 |
GO:1904428 |
negative regulation of tubulin deacetylation(GO:1904428) |
| 0.0 |
0.5 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.0 |
0.5 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.0 |
0.1 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 0.0 |
0.1 |
GO:0003331 |
regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.0 |
0.4 |
GO:0097338 |
response to clozapine(GO:0097338) |
| 0.0 |
0.1 |
GO:0072579 |
molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.0 |
0.2 |
GO:0061107 |
seminal vesicle development(GO:0061107) |
| 0.0 |
0.1 |
GO:0007499 |
ectoderm and mesoderm interaction(GO:0007499) female genitalia morphogenesis(GO:0048807) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
| 0.0 |
0.2 |
GO:2000691 |
regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.0 |
0.3 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 |
0.5 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) |
| 0.0 |
0.2 |
GO:0035063 |
nuclear speck organization(GO:0035063) |
| 0.0 |
0.1 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.0 |
1.1 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.0 |
0.2 |
GO:0006710 |
androgen catabolic process(GO:0006710) |
| 0.0 |
0.2 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 0.0 |
0.1 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.0 |
0.6 |
GO:0090050 |
positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.0 |
0.0 |
GO:0061341 |
non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.0 |
0.8 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.0 |
0.1 |
GO:0019082 |
viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.0 |
0.2 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.0 |
0.0 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.1 |
GO:0098507 |
polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.0 |
0.2 |
GO:0021993 |
initiation of neural tube closure(GO:0021993) |
| 0.0 |
0.2 |
GO:0072156 |
distal tubule morphogenesis(GO:0072156) |
| 0.0 |
0.2 |
GO:2000253 |
positive regulation of feeding behavior(GO:2000253) |
| 0.0 |
0.5 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.0 |
0.4 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 |
0.3 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.0 |
0.1 |
GO:0033123 |
positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) positive regulation of purine nucleotide catabolic process(GO:0033123) |
| 0.0 |
0.2 |
GO:1903575 |
cornified envelope assembly(GO:1903575) |
| 0.0 |
0.1 |
GO:0032796 |
uropod organization(GO:0032796) |
| 0.0 |
0.1 |
GO:0001878 |
response to yeast(GO:0001878) |
| 0.0 |
0.1 |
GO:0021965 |
spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.0 |
0.7 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 |
0.4 |
GO:0061088 |
sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 |
0.2 |
GO:0032468 |
Golgi calcium ion homeostasis(GO:0032468) |
| 0.0 |
0.1 |
GO:0045726 |
positive regulation of integrin biosynthetic process(GO:0045726) |
| 0.0 |
0.2 |
GO:1903826 |
arginine transmembrane transport(GO:1903826) |
| 0.0 |
0.4 |
GO:1902260 |
negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.0 |
0.2 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 |
0.2 |
GO:0061458 |
reproductive system development(GO:0061458) |
| 0.0 |
0.0 |
GO:0070562 |
regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 |
0.0 |
GO:0051598 |
meiotic recombination checkpoint(GO:0051598) |
| 0.0 |
0.2 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.1 |
GO:0043091 |
L-arginine import(GO:0043091) arginine import(GO:0090467) |
| 0.0 |
0.1 |
GO:1900133 |
regulation of renin secretion into blood stream(GO:1900133) |
| 0.0 |
0.1 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.0 |
0.1 |
GO:1902523 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) positive regulation of protein K63-linked ubiquitination(GO:1902523) |
| 0.0 |
0.1 |
GO:0045209 |
MAPK phosphatase export from nucleus(GO:0045208) MAPK phosphatase export from nucleus, leptomycin B sensitive(GO:0045209) |
| 0.0 |
0.2 |
GO:0010908 |
regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) myoblast fate commitment(GO:0048625) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.0 |
0.3 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 |
0.3 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.0 |
0.2 |
GO:0050955 |
thermoception(GO:0050955) |
| 0.0 |
0.1 |
GO:0002729 |
positive regulation of natural killer cell cytokine production(GO:0002729) |
| 0.0 |
0.0 |
GO:0002819 |
regulation of adaptive immune response(GO:0002819) |
| 0.0 |
0.1 |
GO:0002282 |
microglial cell activation involved in immune response(GO:0002282) |
| 0.0 |
0.1 |
GO:0061357 |
positive regulation of Wnt protein secretion(GO:0061357) |
| 0.0 |
0.5 |
GO:0016024 |
CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 |
0.1 |
GO:1990737 |
response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
| 0.0 |
0.9 |
GO:0090162 |
establishment of epithelial cell polarity(GO:0090162) |
| 0.0 |
0.1 |
GO:1904844 |
response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.0 |
0.1 |
GO:0097498 |
endothelial tube lumen extension(GO:0097498) |
| 0.0 |
0.1 |
GO:0060382 |
regulation of DNA strand elongation(GO:0060382) |
| 0.0 |
0.1 |
GO:0002260 |
lymphocyte homeostasis(GO:0002260) |
| 0.0 |
0.1 |
GO:1902475 |
L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 |
0.1 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 |
0.1 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.0 |
0.1 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.0 |
0.1 |
GO:0044210 |
'de novo' CTP biosynthetic process(GO:0044210) |
| 0.0 |
0.1 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.0 |
0.1 |
GO:1901876 |
regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.0 |
0.1 |
GO:0048840 |
otolith development(GO:0048840) |
| 0.0 |
0.0 |
GO:0090291 |
negative regulation of osteoclast proliferation(GO:0090291) |
| 0.0 |
0.2 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 |
0.1 |
GO:0034627 |
'de novo' NAD biosynthetic process(GO:0034627) |
| 0.0 |
0.1 |
GO:0034239 |
macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 |
0.1 |
GO:0003073 |
regulation of systemic arterial blood pressure(GO:0003073) |
| 0.0 |
1.2 |
GO:0010972 |
negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.0 |
0.2 |
GO:0050869 |
negative regulation of B cell activation(GO:0050869) |
| 0.0 |
1.6 |
GO:0050911 |
detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 |
0.1 |
GO:0030805 |
regulation of cyclic nucleotide catabolic process(GO:0030805) negative regulation of cyclic nucleotide catabolic process(GO:0030806) regulation of cAMP catabolic process(GO:0030820) negative regulation of cAMP catabolic process(GO:0030821) regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.0 |
0.1 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 |
0.1 |
GO:0006422 |
aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.0 |
0.5 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 |
0.1 |
GO:1900169 |
activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.0 |
0.2 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.0 |
0.0 |
GO:1903674 |
regulation of cap-dependent translational initiation(GO:1903674) positive regulation of cap-dependent translational initiation(GO:1903676) |
| 0.0 |
0.2 |
GO:0071963 |
establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 |
0.0 |
GO:0006286 |
base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
| 0.0 |
0.2 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.0 |
0.1 |
GO:0032071 |
regulation of endodeoxyribonuclease activity(GO:0032071) |
| 0.0 |
0.1 |
GO:1900825 |
regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.0 |
0.1 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.0 |
0.0 |
GO:0010760 |
negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.0 |
0.1 |
GO:0006642 |
triglyceride mobilization(GO:0006642) |
| 0.0 |
0.1 |
GO:0006183 |
GTP biosynthetic process(GO:0006183) |
| 0.0 |
0.5 |
GO:0071108 |
protein K48-linked deubiquitination(GO:0071108) |
| 0.0 |
0.0 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) protein K33-linked deubiquitination(GO:1990168) |
| 0.0 |
0.0 |
GO:0034204 |
lipid translocation(GO:0034204) phospholipid translocation(GO:0045332) |
| 0.0 |
0.0 |
GO:0070408 |
carbamoyl phosphate metabolic process(GO:0070408) carbamoyl phosphate biosynthetic process(GO:0070409) response to ammonia(GO:1903717) cellular response to ammonia(GO:1903718) |
| 0.0 |
0.0 |
GO:0006173 |
dADP biosynthetic process(GO:0006173) |
| 0.0 |
0.1 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.0 |
0.2 |
GO:0042738 |
exogenous drug catabolic process(GO:0042738) |
| 0.0 |
0.2 |
GO:0090160 |
Golgi to lysosome transport(GO:0090160) |
| 0.0 |
0.0 |
GO:0030186 |
melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.0 |
0.0 |
GO:0006258 |
UDP-glucose catabolic process(GO:0006258) |
| 0.0 |
0.1 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.0 |
0.1 |
GO:0014043 |
negative regulation of neuron maturation(GO:0014043) |
| 0.0 |
0.1 |
GO:0006789 |
bilirubin conjugation(GO:0006789) |
| 0.0 |
0.2 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 |
0.1 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 |
0.0 |
GO:0002188 |
translation reinitiation(GO:0002188) |
| 0.0 |
0.2 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 |
0.0 |
GO:0030505 |
inorganic diphosphate transport(GO:0030505) |
| 0.0 |
0.1 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 |
0.2 |
GO:0090331 |
negative regulation of platelet aggregation(GO:0090331) |
| 0.0 |
0.2 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 |
0.1 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.0 |
0.0 |
GO:2000342 |
negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.0 |
0.2 |
GO:1901078 |
negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.0 |
0.3 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.0 |
0.1 |
GO:0090219 |
negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 |
0.2 |
GO:0070257 |
positive regulation of mucus secretion(GO:0070257) |
| 0.0 |
0.5 |
GO:1904659 |
hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.0 |
0.1 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.0 |
2.6 |
GO:0002223 |
stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
| 0.0 |
0.1 |
GO:0002051 |
osteoblast fate commitment(GO:0002051) |
| 0.0 |
0.2 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.0 |
0.4 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.0 |
0.0 |
GO:0032804 |
negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) |
| 0.0 |
0.0 |
GO:0002416 |
IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.0 |
0.3 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 |
0.1 |
GO:0019255 |
glucose 1-phosphate metabolic process(GO:0019255) |
| 0.0 |
0.0 |
GO:0010650 |
positive regulation of cell communication by electrical coupling(GO:0010650) |
| 0.0 |
0.1 |
GO:0071461 |
cellular response to redox state(GO:0071461) |
| 0.0 |
0.0 |
GO:0007079 |
mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.0 |
0.1 |
GO:0000722 |
telomere maintenance via recombination(GO:0000722) |
| 0.0 |
0.1 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.0 |
0.0 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 |
0.0 |
GO:0018969 |
thiocyanate metabolic process(GO:0018969) |
| 0.0 |
0.1 |
GO:0001920 |
negative regulation of receptor recycling(GO:0001920) |
| 0.0 |
0.1 |
GO:1901545 |
cellular response to raffinose(GO:0097403) response to raffinose(GO:1901545) |
| 0.0 |
0.0 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 |
0.1 |
GO:0034374 |
low-density lipoprotein particle remodeling(GO:0034374) |
| 0.0 |
0.0 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.0 |
0.1 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.0 |
0.2 |
GO:0045773 |
positive regulation of axon extension(GO:0045773) |
| 0.0 |
0.2 |
GO:0016446 |
somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 |
0.1 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.0 |
0.0 |
GO:0043010 |
camera-type eye development(GO:0043010) |
| 0.0 |
0.0 |
GO:1904798 |
positive regulation of core promoter binding(GO:1904798) |
| 0.0 |
0.4 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 |
0.0 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.0 |
0.0 |
GO:1903288 |
regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) positive regulation of potassium ion import(GO:1903288) |
| 0.0 |
0.2 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 |
0.0 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 |
0.2 |
GO:0001558 |
regulation of cell growth(GO:0001558) |
| 0.0 |
0.1 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 |
0.6 |
GO:1904837 |
beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 |
0.0 |
GO:0006174 |
dADP phosphorylation(GO:0006174) dGDP phosphorylation(GO:0006186) AMP phosphorylation(GO:0006756) CDP phosphorylation(GO:0061508) dAMP phosphorylation(GO:0061565) CMP phosphorylation(GO:0061566) dCMP phosphorylation(GO:0061567) GDP phosphorylation(GO:0061568) UDP phosphorylation(GO:0061569) dCDP phosphorylation(GO:0061570) TDP phosphorylation(GO:0061571) |
| 0.0 |
0.1 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 |
0.2 |
GO:0002544 |
chronic inflammatory response(GO:0002544) |
