| 2.2 |
23.7 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 2.1 |
12.7 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 2.0 |
13.7 |
GO:0071603 |
endothelial cell-cell adhesion(GO:0071603) |
| 1.9 |
5.8 |
GO:2000724 |
nuclear fragmentation involved in apoptotic nuclear change(GO:0030264) positive regulation of cardiac vascular smooth muscle cell differentiation(GO:2000724) |
| 1.8 |
12.3 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 1.5 |
13.6 |
GO:0060482 |
lobar bronchus development(GO:0060482) |
| 1.5 |
7.3 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 1.3 |
1.3 |
GO:0032425 |
positive regulation of mismatch repair(GO:0032425) |
| 1.2 |
3.7 |
GO:0017186 |
peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 1.2 |
12.3 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 1.2 |
2.4 |
GO:0034165 |
positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 1.1 |
4.5 |
GO:0061092 |
regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 1.1 |
6.4 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 1.0 |
3.1 |
GO:0016539 |
intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 1.0 |
5.0 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 1.0 |
2.9 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.9 |
3.6 |
GO:1904049 |
negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.9 |
1.8 |
GO:0001954 |
positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.9 |
10.5 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.9 |
6.0 |
GO:0060372 |
regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.8 |
7.0 |
GO:0021842 |
directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.7 |
0.7 |
GO:0006498 |
N-terminal protein lipidation(GO:0006498) |
| 0.7 |
5.9 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.7 |
2.2 |
GO:0038169 |
somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.7 |
3.7 |
GO:0097029 |
mature conventional dendritic cell differentiation(GO:0097029) |
| 0.7 |
10.4 |
GO:0035878 |
nail development(GO:0035878) |
| 0.7 |
2.0 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 0.7 |
2.7 |
GO:0034395 |
regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.7 |
0.7 |
GO:0010726 |
positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.6 |
1.9 |
GO:0042214 |
terpene metabolic process(GO:0042214) |
| 0.6 |
0.6 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.6 |
5.0 |
GO:0015811 |
L-cystine transport(GO:0015811) |
| 0.6 |
2.9 |
GO:0033274 |
response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.6 |
1.7 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.6 |
1.7 |
GO:0021538 |
epithalamus development(GO:0021538) habenula development(GO:0021986) general adaptation syndrome(GO:0051866) |
| 0.6 |
2.3 |
GO:0034343 |
type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.6 |
1.7 |
GO:0060061 |
Spemann organizer formation(GO:0060061) |
| 0.6 |
1.7 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.5 |
4.4 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.5 |
2.2 |
GO:0042231 |
interleukin-13 biosynthetic process(GO:0042231) |
| 0.5 |
4.9 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.5 |
2.7 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.5 |
1.6 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.5 |
3.2 |
GO:0035633 |
maintenance of blood-brain barrier(GO:0035633) |
| 0.5 |
2.6 |
GO:0044752 |
response to human chorionic gonadotropin(GO:0044752) |
| 0.5 |
1.6 |
GO:0097252 |
oligodendrocyte apoptotic process(GO:0097252) |
| 0.5 |
1.5 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.5 |
1.5 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.5 |
1.5 |
GO:1901860 |
positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.5 |
5.9 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.5 |
0.5 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.5 |
1.4 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.5 |
2.4 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.5 |
1.9 |
GO:0072299 |
visceral serous pericardium development(GO:0061032) negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.5 |
1.9 |
GO:1902361 |
mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.5 |
1.4 |
GO:0071812 |
circadian temperature homeostasis(GO:0060086) regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.5 |
4.2 |
GO:0060267 |
positive regulation of respiratory burst(GO:0060267) |
| 0.5 |
1.4 |
GO:0002731 |
negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.5 |
3.2 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.5 |
6.4 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.5 |
2.3 |
GO:0002399 |
MHC class II protein complex assembly(GO:0002399) |
| 0.5 |
1.4 |
GO:0036269 |
swimming behavior(GO:0036269) |
| 0.4 |
2.2 |
GO:0002415 |
immune response in mucosal-associated lymphoid tissue(GO:0002386) immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.4 |
1.3 |
GO:0007509 |
mesoderm migration involved in gastrulation(GO:0007509) |
| 0.4 |
2.2 |
GO:0018101 |
protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.4 |
2.2 |
GO:0035995 |
detection of muscle stretch(GO:0035995) |
| 0.4 |
1.8 |
GO:0098942 |
regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) cytoskeletal matrix organization at active zone(GO:0048789) neurexin clustering involved in presynaptic membrane assembly(GO:0097115) retrograde trans-synaptic signaling by trans-synaptic protein complex(GO:0098942) |
| 0.4 |
1.8 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.4 |
1.3 |
GO:0021793 |
chemorepulsion of branchiomotor axon(GO:0021793) |
| 0.4 |
2.6 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.4 |
3.0 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.4 |
3.8 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.4 |
1.3 |
GO:0043095 |
regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.4 |
1.3 |
GO:0021775 |
smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.4 |
9.7 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.4 |
2.9 |
GO:0035879 |
plasma membrane lactate transport(GO:0035879) |
| 0.4 |
2.5 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 0.4 |
13.5 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.4 |
3.3 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.4 |
1.6 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.4 |
1.2 |
GO:0060054 |
positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.4 |
3.6 |
GO:0039663 |
fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.4 |
1.2 |
GO:0032223 |
negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.4 |
1.2 |
GO:0008057 |
eye pigment granule organization(GO:0008057) |
| 0.4 |
1.6 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.4 |
1.1 |
GO:0097187 |
dentinogenesis(GO:0097187) |
| 0.4 |
2.3 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.4 |
1.1 |
GO:0034130 |
toll-like receptor 1 signaling pathway(GO:0034130) |
| 0.4 |
1.5 |
GO:0097021 |
lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.4 |
3.0 |
GO:0060154 |
cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.4 |
1.8 |
GO:0015891 |
iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.4 |
2.6 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.4 |
2.5 |
GO:0060356 |
leucine import(GO:0060356) |
| 0.4 |
2.5 |
GO:1900194 |
negative regulation of oocyte maturation(GO:1900194) |
| 0.4 |
1.1 |
GO:0034553 |
respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.4 |
1.1 |
GO:2001226 |
negative regulation of chloride transport(GO:2001226) |
| 0.4 |
1.4 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.4 |
2.8 |
GO:1902998 |
macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.4 |
7.1 |
GO:0046520 |
sphingoid biosynthetic process(GO:0046520) |
| 0.3 |
1.0 |
GO:0003147 |
neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
| 0.3 |
1.0 |
GO:2000224 |
regulation of testosterone biosynthetic process(GO:2000224) |
| 0.3 |
0.3 |
GO:0060266 |
respiratory burst involved in inflammatory response(GO:0002536) regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.3 |
5.2 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.3 |
1.0 |
GO:1902283 |
negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.3 |
0.3 |
GO:0035634 |
response to stilbenoid(GO:0035634) |
| 0.3 |
2.4 |
GO:1902896 |
terminal web assembly(GO:1902896) |
| 0.3 |
1.0 |
GO:0002541 |
activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.3 |
0.7 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.3 |
1.3 |
GO:0018352 |
protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.3 |
2.3 |
GO:0045229 |
cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.3 |
4.9 |
GO:0042501 |
serine phosphorylation of STAT protein(GO:0042501) |
| 0.3 |
1.0 |
GO:0032849 |
positive regulation of cellular pH reduction(GO:0032849) |
| 0.3 |
2.2 |
GO:1900242 |
regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.3 |
1.3 |
GO:0090119 |
vesicle-mediated cholesterol transport(GO:0090119) |
| 0.3 |
0.9 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.3 |
1.9 |
GO:0010193 |
response to ozone(GO:0010193) |
| 0.3 |
3.1 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 0.3 |
1.2 |
GO:0046271 |
phenylpropanoid catabolic process(GO:0046271) |
| 0.3 |
0.6 |
GO:0043335 |
protein unfolding(GO:0043335) |
| 0.3 |
1.8 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.3 |
3.0 |
GO:0006552 |
leucine catabolic process(GO:0006552) |
| 0.3 |
1.2 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.3 |
3.0 |
GO:0045343 |
MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.3 |
1.2 |
GO:1902161 |
positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.3 |
4.1 |
GO:1904352 |
positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.3 |
0.3 |
GO:0000305 |
response to superoxide(GO:0000303) response to oxygen radical(GO:0000305) |
| 0.3 |
0.3 |
GO:0010828 |
positive regulation of glucose transport(GO:0010828) positive regulation of glucose import(GO:0046326) |
| 0.3 |
2.0 |
GO:0008295 |
spermidine biosynthetic process(GO:0008295) |
| 0.3 |
0.9 |
GO:2000563 |
positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.3 |
0.3 |
GO:0048880 |
sensory system development(GO:0048880) |
| 0.3 |
1.1 |
GO:0002426 |
immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.3 |
0.6 |
GO:1902897 |
regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.3 |
1.4 |
GO:1902866 |
regulation of retina development in camera-type eye(GO:1902866) |
| 0.3 |
0.8 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.3 |
2.8 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.3 |
0.8 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.3 |
0.3 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.3 |
3.8 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.3 |
0.8 |
GO:0032455 |
nerve growth factor processing(GO:0032455) |
| 0.3 |
1.1 |
GO:0016267 |
O-glycan processing, core 1(GO:0016267) |
| 0.3 |
0.3 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.3 |
0.3 |
GO:0001755 |
neural crest cell migration(GO:0001755) |
| 0.3 |
1.3 |
GO:0097327 |
response to antineoplastic agent(GO:0097327) |
| 0.3 |
4.3 |
GO:0015684 |
ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
| 0.3 |
0.8 |
GO:0060545 |
positive regulation of necroptotic process(GO:0060545) |
| 0.3 |
3.4 |
GO:0060120 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.3 |
1.8 |
GO:0008218 |
bioluminescence(GO:0008218) |
| 0.3 |
3.7 |
GO:0045836 |
positive regulation of meiotic nuclear division(GO:0045836) |
| 0.3 |
0.8 |
GO:0099558 |
maintenance of synapse structure(GO:0099558) |
| 0.3 |
1.8 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.3 |
1.0 |
GO:0006740 |
NADPH regeneration(GO:0006740) |
| 0.3 |
0.8 |
GO:0002372 |
myeloid dendritic cell cytokine production(GO:0002372) |
| 0.3 |
0.3 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.3 |
0.8 |
GO:0003430 |
growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.2 |
1.2 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.2 |
1.2 |
GO:0003404 |
optic vesicle morphogenesis(GO:0003404) optic cup structural organization(GO:0003409) |
| 0.2 |
0.7 |
GO:0061075 |
regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.2 |
1.0 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.2 |
1.2 |
GO:0048749 |
compound eye development(GO:0048749) |
| 0.2 |
0.7 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.2 |
0.7 |
GO:0010751 |
negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.2 |
1.2 |
GO:0072709 |
cellular response to sorbitol(GO:0072709) |
| 0.2 |
4.1 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.2 |
1.2 |
GO:0010716 |
negative regulation of extracellular matrix disassembly(GO:0010716) |
| 0.2 |
1.0 |
GO:1904647 |
response to rotenone(GO:1904647) |
| 0.2 |
0.7 |
GO:0060490 |
orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.2 |
0.5 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.2 |
1.7 |
GO:0071461 |
cellular response to redox state(GO:0071461) |
| 0.2 |
0.7 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.2 |
1.9 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.2 |
1.6 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.2 |
2.1 |
GO:0035754 |
B cell chemotaxis(GO:0035754) |
| 0.2 |
2.3 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.2 |
0.5 |
GO:0051005 |
negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.2 |
0.9 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.2 |
0.5 |
GO:0042816 |
vitamin B6 metabolic process(GO:0042816) |
| 0.2 |
0.7 |
GO:0050823 |
peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.2 |
0.9 |
GO:0050712 |
negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.2 |
1.2 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.2 |
1.4 |
GO:2001271 |
negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.2 |
0.2 |
GO:0032417 |
positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.2 |
0.7 |
GO:1902938 |
regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.2 |
0.9 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.2 |
0.2 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.2 |
2.0 |
GO:0071277 |
cellular response to calcium ion(GO:0071277) |
| 0.2 |
1.1 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.2 |
1.1 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 |
3.2 |
GO:0070070 |
proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 |
1.1 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 |
0.2 |
GO:0050731 |
positive regulation of peptidyl-tyrosine phosphorylation(GO:0050731) |
| 0.2 |
3.4 |
GO:2000507 |
positive regulation of energy homeostasis(GO:2000507) |
| 0.2 |
1.3 |
GO:0051971 |
positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.2 |
7.0 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.2 |
0.8 |
GO:1905075 |
occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.2 |
1.0 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.2 |
0.6 |
GO:0001994 |
norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.2 |
1.3 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.2 |
5.2 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.2 |
0.6 |
GO:0071030 |
nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.2 |
3.9 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.2 |
1.8 |
GO:0007351 |
tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.2 |
3.5 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.2 |
0.4 |
GO:0051963 |
regulation of synapse assembly(GO:0051963) |
| 0.2 |
0.2 |
GO:1903566 |
positive regulation of protein localization to cilium(GO:1903566) |
| 0.2 |
0.8 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.2 |
1.2 |
GO:0097646 |
calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.2 |
3.0 |
GO:0070424 |
regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.2 |
0.2 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.2 |
1.2 |
GO:0007500 |
mesodermal cell fate determination(GO:0007500) |
| 0.2 |
4.3 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.2 |
1.4 |
GO:1904338 |
regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.2 |
1.7 |
GO:0006021 |
inositol biosynthetic process(GO:0006021) |
| 0.2 |
1.0 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.2 |
0.4 |
GO:0060809 |
mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.2 |
1.7 |
GO:0042268 |
regulation of cytolysis(GO:0042268) |
| 0.2 |
0.8 |
GO:2000660 |
negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.2 |
0.2 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.2 |
0.4 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.2 |
0.6 |
GO:1903625 |
negative regulation of DNA catabolic process(GO:1903625) |
| 0.2 |
0.8 |
GO:1905232 |
cellular response to L-glutamate(GO:1905232) |
| 0.2 |
3.2 |
GO:0021785 |
branchiomotor neuron axon guidance(GO:0021785) |
| 0.2 |
0.6 |
GO:0034146 |
toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.2 |
0.2 |
GO:0060363 |
cranial suture morphogenesis(GO:0060363) |
| 0.2 |
0.4 |
GO:0098917 |
retrograde trans-synaptic signaling(GO:0098917) |
| 0.2 |
1.5 |
GO:0043129 |
surfactant homeostasis(GO:0043129) |
| 0.2 |
1.1 |
GO:0010816 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.2 |
0.7 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 |
1.1 |
GO:0009052 |
pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.2 |
0.4 |
GO:0097267 |
omega-hydroxylase P450 pathway(GO:0097267) |
| 0.2 |
1.1 |
GO:0071316 |
cellular response to nicotine(GO:0071316) |
| 0.2 |
2.0 |
GO:0043152 |
induction of bacterial agglutination(GO:0043152) |
| 0.2 |
1.4 |
GO:0051611 |
negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.2 |
0.5 |
GO:1904404 |
cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
| 0.2 |
2.0 |
GO:1903027 |
regulation of opsonization(GO:1903027) |
| 0.2 |
2.3 |
GO:0015884 |
folic acid transport(GO:0015884) |
| 0.2 |
1.2 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 |
2.0 |
GO:0060291 |
long-term synaptic potentiation(GO:0060291) |
| 0.2 |
1.4 |
GO:0030011 |
maintenance of cell polarity(GO:0030011) |
| 0.2 |
0.4 |
GO:0060956 |
cardiac endothelial cell differentiation(GO:0003348) endocardial cell differentiation(GO:0060956) |
| 0.2 |
4.4 |
GO:0045104 |
intermediate filament cytoskeleton organization(GO:0045104) |
| 0.2 |
0.2 |
GO:0060149 |
negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by RNA(GO:0060967) |
| 0.2 |
1.7 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.2 |
0.2 |
GO:1902995 |
regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) |
| 0.2 |
0.9 |
GO:1902228 |
mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.2 |
0.5 |
GO:0036482 |
neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.2 |
4.6 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.2 |
0.7 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.2 |
1.2 |
GO:0002158 |
osteoclast proliferation(GO:0002158) |
| 0.2 |
11.7 |
GO:0050690 |
regulation of defense response to virus by virus(GO:0050690) |
| 0.2 |
1.0 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.2 |
0.3 |
GO:0071281 |
cellular response to iron ion(GO:0071281) |
| 0.2 |
0.8 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.2 |
0.3 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.2 |
2.2 |
GO:0034058 |
endosomal vesicle fusion(GO:0034058) |
| 0.2 |
0.8 |
GO:0008050 |
female courtship behavior(GO:0008050) |
| 0.2 |
0.3 |
GO:0019521 |
aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.2 |
2.8 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.2 |
0.8 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.2 |
1.5 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 |
1.0 |
GO:0052551 |
response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
| 0.2 |
1.0 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.2 |
1.3 |
GO:0034134 |
toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.2 |
0.5 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.2 |
0.6 |
GO:0090598 |
male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.2 |
1.1 |
GO:0035457 |
cellular response to interferon-alpha(GO:0035457) |
| 0.2 |
0.6 |
GO:0021812 |
neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.2 |
0.9 |
GO:0036111 |
very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.2 |
0.5 |
GO:0043438 |
acetoacetic acid metabolic process(GO:0043438) |
| 0.2 |
1.1 |
GO:0070164 |
negative regulation of adiponectin secretion(GO:0070164) |
| 0.2 |
0.5 |
GO:0010725 |
regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.2 |
0.2 |
GO:0019858 |
cytosine metabolic process(GO:0019858) |
| 0.2 |
2.5 |
GO:0016102 |
retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.2 |
0.6 |
GO:2000097 |
regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.2 |
0.5 |
GO:0046709 |
IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.2 |
0.5 |
GO:0090191 |
negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.2 |
0.5 |
GO:1901030 |
regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.2 |
0.5 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.2 |
3.9 |
GO:0034063 |
stress granule assembly(GO:0034063) |
| 0.2 |
2.0 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.2 |
1.2 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.2 |
0.5 |
GO:1901383 |
negative regulation of chorionic trophoblast cell proliferation(GO:1901383) |
| 0.2 |
10.7 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.1 |
0.1 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 |
2.1 |
GO:0044341 |
sodium-dependent phosphate transport(GO:0044341) |
| 0.1 |
0.4 |
GO:1904383 |
response to sodium phosphate(GO:1904383) |
| 0.1 |
0.3 |
GO:2000412 |
positive regulation of thymocyte migration(GO:2000412) |
| 0.1 |
1.5 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.1 |
2.7 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.1 |
0.4 |
GO:0031635 |
adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
| 0.1 |
0.9 |
GO:0009233 |
menaquinone metabolic process(GO:0009233) |
| 0.1 |
0.4 |
GO:0021526 |
medial motor column neuron differentiation(GO:0021526) |
| 0.1 |
0.4 |
GO:0008037 |
cell recognition(GO:0008037) |
| 0.1 |
0.6 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.1 |
0.7 |
GO:1904995 |
negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 |
0.3 |
GO:1902613 |
regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 0.1 |
0.1 |
GO:0033591 |
response to L-ascorbic acid(GO:0033591) |
| 0.1 |
2.3 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 |
0.6 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.1 |
0.4 |
GO:0002025 |
vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.1 |
0.6 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 |
0.4 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.1 |
3.2 |
GO:1903830 |
magnesium ion transmembrane transport(GO:1903830) |
| 0.1 |
1.0 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 |
0.6 |
GO:0071934 |
thiamine transmembrane transport(GO:0071934) |
| 0.1 |
1.5 |
GO:0018377 |
protein myristoylation(GO:0018377) |
| 0.1 |
0.8 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 |
1.0 |
GO:0010579 |
regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.1 |
0.8 |
GO:0051216 |
cartilage development(GO:0051216) |
| 0.1 |
2.9 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.1 |
0.4 |
GO:0060287 |
epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.1 |
5.4 |
GO:0045124 |
regulation of bone resorption(GO:0045124) |
| 0.1 |
0.8 |
GO:0015853 |
adenine transport(GO:0015853) |
| 0.1 |
2.3 |
GO:0002430 |
complement receptor mediated signaling pathway(GO:0002430) |
| 0.1 |
0.5 |
GO:1902715 |
positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.1 |
1.5 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.1 |
0.7 |
GO:0010165 |
response to X-ray(GO:0010165) |
| 0.1 |
0.8 |
GO:0031064 |
negative regulation of histone deacetylation(GO:0031064) |
| 0.1 |
0.3 |
GO:1904744 |
positive regulation of telomeric DNA binding(GO:1904744) |
| 0.1 |
1.6 |
GO:0046855 |
inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 |
0.5 |
GO:0006617 |
SRP-dependent cotranslational protein targeting to membrane, signal sequence recognition(GO:0006617) |
| 0.1 |
1.2 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
12.1 |
GO:0006081 |
cellular aldehyde metabolic process(GO:0006081) |
| 0.1 |
0.7 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.1 |
0.1 |
GO:0046543 |
development of secondary female sexual characteristics(GO:0046543) |
| 0.1 |
3.8 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.1 |
0.5 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 |
1.0 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.1 |
0.1 |
GO:0003220 |
left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 0.1 |
0.3 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.1 |
6.9 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.1 |
1.0 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 |
1.7 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 |
1.4 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.6 |
GO:0007525 |
somatic muscle development(GO:0007525) |
| 0.1 |
0.1 |
GO:0071545 |
inositol phosphate catabolic process(GO:0071545) |
| 0.1 |
0.6 |
GO:1900245 |
positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 |
1.5 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 |
0.3 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.1 |
0.5 |
GO:0019747 |
regulation of isoprenoid metabolic process(GO:0019747) |
| 0.1 |
0.5 |
GO:0042473 |
outer ear morphogenesis(GO:0042473) |
| 0.1 |
1.9 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.1 |
0.9 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.1 |
0.7 |
GO:0030309 |
poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.1 |
0.6 |
GO:0009107 |
lipoate biosynthetic process(GO:0009107) |
| 0.1 |
0.2 |
GO:0007497 |
posterior midgut development(GO:0007497) |
| 0.1 |
0.4 |
GO:0007037 |
vacuolar phosphate transport(GO:0007037) negative regulation of fibroblast growth factor production(GO:0090272) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.1 |
1.0 |
GO:0022605 |
oogenesis stage(GO:0022605) |
| 0.1 |
0.4 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.1 |
1.2 |
GO:0043116 |
negative regulation of vascular permeability(GO:0043116) |
| 0.1 |
2.5 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.1 |
0.4 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 |
0.2 |
GO:1904220 |
regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.1 |
0.5 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 0.1 |
0.7 |
GO:0070358 |
actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 |
0.4 |
GO:0048213 |
Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.1 |
1.0 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 |
0.8 |
GO:0072719 |
cellular response to cisplatin(GO:0072719) |
| 0.1 |
2.2 |
GO:0019373 |
epoxygenase P450 pathway(GO:0019373) |
| 0.1 |
0.5 |
GO:0009138 |
pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.1 |
0.1 |
GO:1904815 |
negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.1 |
0.6 |
GO:0035986 |
senescence-associated heterochromatin focus assembly(GO:0035986) oncogene-induced cell senescence(GO:0090402) |
| 0.1 |
0.1 |
GO:0003197 |
endocardial cushion development(GO:0003197) |
| 0.1 |
0.3 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.1 |
1.3 |
GO:0070673 |
response to interleukin-18(GO:0070673) |
| 0.1 |
0.1 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.1 |
0.6 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.9 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.1 |
0.2 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 |
2.8 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.1 |
1.1 |
GO:0010666 |
positive regulation of muscle cell apoptotic process(GO:0010661) positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 |
1.0 |
GO:0006049 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.1 |
0.7 |
GO:0031179 |
peptide amidation(GO:0001519) protein amidation(GO:0018032) peptide modification(GO:0031179) |
| 0.1 |
1.4 |
GO:0019722 |
calcium-mediated signaling(GO:0019722) |
| 0.1 |
1.1 |
GO:2001300 |
lipoxin metabolic process(GO:2001300) |
| 0.1 |
0.3 |
GO:0006511 |
ubiquitin-dependent protein catabolic process(GO:0006511) |
| 0.1 |
0.2 |
GO:0044331 |
cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.1 |
0.2 |
GO:0052805 |
histidine metabolic process(GO:0006547) histidine catabolic process(GO:0006548) imidazole-containing compound metabolic process(GO:0052803) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 |
0.4 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 |
0.2 |
GO:0060748 |
tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.1 |
1.4 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.1 |
0.3 |
GO:0033319 |
UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.1 |
0.6 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.1 |
0.4 |
GO:0061034 |
olfactory bulb mitral cell layer development(GO:0061034) |
| 0.1 |
0.3 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
1.0 |
GO:0010044 |
response to aluminum ion(GO:0010044) |
| 0.1 |
1.8 |
GO:0019388 |
galactose catabolic process(GO:0019388) |
| 0.1 |
0.7 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 |
0.3 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 0.1 |
0.4 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 |
0.5 |
GO:1901978 |
positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.1 |
1.8 |
GO:0003374 |
dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.1 |
0.3 |
GO:0090611 |
ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.1 |
0.4 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.1 |
1.0 |
GO:0050428 |
purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 |
0.1 |
GO:0061386 |
closure of optic fissure(GO:0061386) |
| 0.1 |
0.4 |
GO:1900063 |
regulation of peroxisome organization(GO:1900063) |
| 0.1 |
9.7 |
GO:0007422 |
peripheral nervous system development(GO:0007422) |
| 0.1 |
0.6 |
GO:1902412 |
regulation of mitotic cytokinesis(GO:1902412) |
| 0.1 |
1.6 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.1 |
0.1 |
GO:0032730 |
positive regulation of interleukin-1 alpha production(GO:0032730) |
| 0.1 |
0.2 |
GO:1905244 |
regulation of modification of synaptic structure(GO:1905244) |
| 0.1 |
0.1 |
GO:0060268 |
negative regulation of respiratory burst(GO:0060268) |
| 0.1 |
0.4 |
GO:0071880 |
adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.1 |
0.2 |
GO:0060662 |
tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 |
1.5 |
GO:0001963 |
synaptic transmission, dopaminergic(GO:0001963) |
| 0.1 |
0.7 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 |
0.3 |
GO:1902630 |
regulation of membrane hyperpolarization(GO:1902630) |
| 0.1 |
1.4 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.1 |
0.3 |
GO:0034405 |
response to fluid shear stress(GO:0034405) |
| 0.1 |
0.3 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.1 |
0.9 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.1 |
1.6 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.1 |
0.7 |
GO:0010759 |
positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 |
0.3 |
GO:0044240 |
multicellular organism lipid catabolic process(GO:0044240) |
| 0.1 |
0.9 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.1 |
1.5 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 |
0.4 |
GO:0060633 |
negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.1 |
0.3 |
GO:0019401 |
glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.1 |
0.4 |
GO:2000252 |
negative regulation of feeding behavior(GO:2000252) |
| 0.1 |
0.7 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.1 |
1.4 |
GO:0071816 |
tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 |
0.7 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.1 |
0.2 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.1 |
0.1 |
GO:0014717 |
regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) regulation of skeletal muscle tissue regeneration(GO:0043416) |
| 0.1 |
0.3 |
GO:1901727 |
positive regulation of histone deacetylase activity(GO:1901727) |
| 0.1 |
0.3 |
GO:0006433 |
prolyl-tRNA aminoacylation(GO:0006433) |
| 0.1 |
0.1 |
GO:0006680 |
glucosylceramide catabolic process(GO:0006680) |
| 0.1 |
1.2 |
GO:0043542 |
endothelial cell migration(GO:0043542) |
| 0.1 |
1.3 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 |
0.2 |
GO:1903721 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 |
0.4 |
GO:0071477 |
hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.1 |
0.6 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 |
0.1 |
GO:1990641 |
regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) response to iron ion starvation(GO:1990641) |
| 0.1 |
0.8 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.1 |
0.5 |
GO:0044245 |
polysaccharide digestion(GO:0044245) |
| 0.1 |
0.4 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.1 |
0.9 |
GO:0098967 |
exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 |
1.3 |
GO:0070257 |
positive regulation of mucus secretion(GO:0070257) |
| 0.1 |
1.4 |
GO:0051450 |
myoblast proliferation(GO:0051450) |
| 0.1 |
0.4 |
GO:0002353 |
kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.1 |
1.7 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.1 |
0.5 |
GO:0048845 |
venous blood vessel morphogenesis(GO:0048845) |
| 0.1 |
0.3 |
GO:1904899 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.1 |
0.7 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.1 |
0.3 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 |
0.3 |
GO:0050955 |
thermoception(GO:0050955) |
| 0.1 |
1.0 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.1 |
1.5 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.1 |
0.6 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 |
0.5 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 |
0.7 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.1 |
0.3 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 |
0.5 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 |
0.6 |
GO:0090625 |
mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.1 |
0.5 |
GO:0071955 |
recycling endosome to Golgi transport(GO:0071955) |
| 0.1 |
0.2 |
GO:0015881 |
creatine transport(GO:0015881) creatine transmembrane transport(GO:1902598) |
| 0.1 |
0.3 |
GO:0019442 |
tryptophan catabolic process to acetyl-CoA(GO:0019442) |
| 0.1 |
0.1 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 |
1.6 |
GO:0035791 |
platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
| 0.1 |
0.3 |
GO:0010760 |
negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.1 |
0.4 |
GO:0090156 |
cellular sphingolipid homeostasis(GO:0090156) |
| 0.1 |
0.9 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 0.1 |
0.4 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.1 |
0.4 |
GO:0036499 |
PERK-mediated unfolded protein response(GO:0036499) |
| 0.1 |
0.3 |
GO:0072144 |
glomerular mesangial cell development(GO:0072144) |
| 0.1 |
0.3 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.1 |
0.2 |
GO:0043449 |
cellular alkene metabolic process(GO:0043449) olefin metabolic process(GO:1900673) |
| 0.1 |
0.2 |
GO:0048850 |
hypophysis morphogenesis(GO:0048850) |
| 0.1 |
2.1 |
GO:0009437 |
carnitine metabolic process(GO:0009437) |
| 0.1 |
1.8 |
GO:1900103 |
positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 |
0.3 |
GO:0031577 |
spindle checkpoint(GO:0031577) |
| 0.1 |
0.4 |
GO:0003366 |
cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.1 |
0.2 |
GO:1904781 |
positive regulation of protein localization to centrosome(GO:1904781) |
| 0.1 |
1.2 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 |
0.8 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.1 |
0.2 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 |
0.2 |
GO:0042439 |
ethanolamine-containing compound metabolic process(GO:0042439) |
| 0.1 |
4.3 |
GO:0006376 |
mRNA splice site selection(GO:0006376) |
| 0.1 |
0.3 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.1 |
0.1 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.1 |
0.1 |
GO:1903320 |
regulation of protein modification by small protein conjugation or removal(GO:1903320) |
| 0.1 |
0.2 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.1 |
0.2 |
GO:0002378 |
immunoglobulin biosynthetic process(GO:0002378) |
| 0.1 |
0.6 |
GO:0023041 |
neuronal signal transduction(GO:0023041) |
| 0.1 |
0.3 |
GO:0003214 |
cardiac left ventricle morphogenesis(GO:0003214) |
| 0.1 |
0.4 |
GO:0060332 |
positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.1 |
0.9 |
GO:0070197 |
meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 |
0.3 |
GO:0000729 |
DNA double-strand break processing(GO:0000729) |
| 0.1 |
0.4 |
GO:0034351 |
regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
| 0.1 |
0.3 |
GO:0036483 |
neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.1 |
0.2 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.1 |
0.9 |
GO:0048806 |
genitalia development(GO:0048806) |
| 0.1 |
0.2 |
GO:0009080 |
alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.1 |
0.9 |
GO:2001256 |
regulation of store-operated calcium entry(GO:2001256) |
| 0.1 |
1.3 |
GO:1901678 |
iron coordination entity transport(GO:1901678) |
| 0.1 |
0.3 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.1 |
0.3 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 |
0.2 |
GO:0097084 |
vascular smooth muscle cell development(GO:0097084) |
| 0.1 |
1.3 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.1 |
1.3 |
GO:0097296 |
activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.1 |
0.3 |
GO:0006883 |
cellular sodium ion homeostasis(GO:0006883) |
| 0.1 |
0.1 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.1 |
0.5 |
GO:1903788 |
mycotoxin metabolic process(GO:0043385) mycotoxin catabolic process(GO:0043387) aflatoxin metabolic process(GO:0046222) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound metabolic process(GO:1901376) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.1 |
0.7 |
GO:0043589 |
skin morphogenesis(GO:0043589) |
| 0.1 |
0.7 |
GO:0035965 |
cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.1 |
0.8 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.1 |
0.2 |
GO:0006670 |
sphingosine metabolic process(GO:0006670) |
| 0.1 |
0.2 |
GO:0080120 |
CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.1 |
0.9 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 |
0.8 |
GO:0038028 |
insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 |
0.6 |
GO:0060526 |
prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.1 |
0.2 |
GO:2000360 |
negative regulation of binding of sperm to zona pellucida(GO:2000360) |
| 0.1 |
6.3 |
GO:0061178 |
regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
| 0.1 |
0.1 |
GO:0035038 |
female pronucleus assembly(GO:0035038) |
| 0.1 |
0.1 |
GO:0036115 |
fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.1 |
0.3 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 |
0.1 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 |
0.2 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 |
0.3 |
GO:0086042 |
cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
| 0.1 |
0.7 |
GO:2000344 |
positive regulation of acrosome reaction(GO:2000344) |
| 0.1 |
0.1 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 |
1.2 |
GO:0019371 |
cyclooxygenase pathway(GO:0019371) |
| 0.1 |
0.2 |
GO:0071442 |
positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 |
1.4 |
GO:0060445 |
branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.1 |
0.1 |
GO:0010730 |
negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.1 |
0.4 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.1 |
1.0 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.1 |
0.9 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.1 |
0.5 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.1 |
0.4 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.1 |
7.8 |
GO:0070268 |
cornification(GO:0070268) |
| 0.1 |
0.1 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 |
0.1 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.1 |
0.1 |
GO:0007439 |
ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.1 |
0.2 |
GO:0008090 |
retrograde axonal transport(GO:0008090) |
| 0.1 |
1.5 |
GO:0050718 |
positive regulation of interleukin-1 beta secretion(GO:0050718) |
| 0.1 |
0.4 |
GO:1903301 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 |
0.2 |
GO:0060664 |
epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
| 0.1 |
0.4 |
GO:0010734 |
protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.1 |
0.1 |
GO:0045994 |
positive regulation of translational initiation by iron(GO:0045994) |
| 0.1 |
1.3 |
GO:0032354 |
response to follicle-stimulating hormone(GO:0032354) |
| 0.1 |
0.7 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.1 |
0.4 |
GO:0072092 |
ureteric bud invasion(GO:0072092) |
| 0.1 |
0.1 |
GO:0014878 |
response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 |
0.2 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.1 |
0.3 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 |
0.8 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.1 |
GO:0060027 |
convergent extension involved in gastrulation(GO:0060027) |
| 0.1 |
1.1 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 |
0.4 |
GO:1900164 |
nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.1 |
0.3 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 |
0.2 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 0.1 |
1.2 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 |
0.1 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 |
0.1 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.1 |
0.3 |
GO:0060161 |
positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.1 |
0.9 |
GO:0090179 |
planar cell polarity pathway involved in neural tube closure(GO:0090179) |
| 0.1 |
0.7 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.1 |
0.4 |
GO:0072752 |
cellular response to rapamycin(GO:0072752) response to rapamycin(GO:1901355) |
| 0.1 |
0.1 |
GO:0044843 |
cell cycle G1/S phase transition(GO:0044843) |
| 0.1 |
0.6 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 |
1.8 |
GO:0007520 |
myoblast fusion(GO:0007520) |
| 0.1 |
0.5 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 |
0.2 |
GO:0006478 |
peptidyl-tyrosine sulfation(GO:0006478) |
| 0.1 |
0.1 |
GO:0010609 |
mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.1 |
0.2 |
GO:0090649 |
response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.1 |
0.3 |
GO:0046629 |
gamma-delta T cell activation(GO:0046629) |
| 0.1 |
0.4 |
GO:0019228 |
neuronal action potential(GO:0019228) |
| 0.1 |
0.1 |
GO:0035865 |
cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.4 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 |
0.3 |
GO:0046338 |
phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 |
0.2 |
GO:0051352 |
negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.1 |
0.5 |
GO:0070987 |
error-free translesion synthesis(GO:0070987) |
| 0.1 |
0.1 |
GO:0005988 |
lactose metabolic process(GO:0005988) lactose biosynthetic process(GO:0005989) |
| 0.1 |
0.4 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.1 |
0.3 |
GO:0010459 |
negative regulation of heart rate(GO:0010459) |
| 0.1 |
0.6 |
GO:0021799 |
cerebral cortex radially oriented cell migration(GO:0021799) |
| 0.1 |
0.1 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.1 |
2.3 |
GO:2000171 |
negative regulation of dendrite development(GO:2000171) |
| 0.1 |
0.2 |
GO:2000609 |
regulation of thyroid hormone generation(GO:2000609) |
| 0.1 |
0.3 |
GO:0009258 |
10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.1 |
0.2 |
GO:0003050 |
regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.1 |
0.1 |
GO:0032351 |
negative regulation of hormone metabolic process(GO:0032351) |
| 0.1 |
2.4 |
GO:0051973 |
positive regulation of telomerase activity(GO:0051973) |
| 0.1 |
0.3 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.4 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 |
0.1 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.1 |
0.2 |
GO:0051446 |
positive regulation of meiotic cell cycle(GO:0051446) |
| 0.1 |
0.4 |
GO:0031282 |
regulation of guanylate cyclase activity(GO:0031282) |
| 0.1 |
2.4 |
GO:0033198 |
response to ATP(GO:0033198) |
| 0.1 |
0.2 |
GO:0071468 |
cellular response to acidic pH(GO:0071468) |
| 0.1 |
0.6 |
GO:0002860 |
positive regulation of natural killer cell mediated immune response to tumor cell(GO:0002857) positive regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002860) |
| 0.1 |
0.6 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.1 |
0.6 |
GO:0002084 |
protein depalmitoylation(GO:0002084) |
| 0.1 |
1.1 |
GO:0051255 |
spindle midzone assembly(GO:0051255) |
| 0.1 |
0.3 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 |
0.4 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.1 |
0.1 |
GO:0002232 |
leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.1 |
1.0 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.1 |
0.9 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.1 |
0.5 |
GO:0044070 |
regulation of anion transport(GO:0044070) |
| 0.1 |
0.3 |
GO:0048630 |
skeletal muscle tissue growth(GO:0048630) |
| 0.1 |
1.6 |
GO:0090280 |
positive regulation of calcium ion import(GO:0090280) |
| 0.1 |
0.2 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 |
2.8 |
GO:0051785 |
positive regulation of nuclear division(GO:0051785) |
| 0.1 |
0.4 |
GO:0071374 |
cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.1 |
0.4 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.1 |
0.6 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.1 |
1.6 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.1 |
0.4 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 |
0.2 |
GO:1900365 |
positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.1 |
2.1 |
GO:0032007 |
negative regulation of TOR signaling(GO:0032007) |
| 0.1 |
0.7 |
GO:0022038 |
corpus callosum development(GO:0022038) |
| 0.1 |
0.1 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.1 |
0.3 |
GO:0032057 |
negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.1 |
0.2 |
GO:0072135 |
negative regulation by virus of viral protein levels in host cell(GO:0046725) kidney mesenchymal cell proliferation(GO:0072135) metanephric mesenchymal cell proliferation involved in metanephros development(GO:0072136) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.1 |
1.1 |
GO:0001574 |
ganglioside biosynthetic process(GO:0001574) |
| 0.1 |
0.6 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.1 |
0.1 |
GO:2000295 |
regulation of hydrogen peroxide catabolic process(GO:2000295) |
| 0.1 |
0.5 |
GO:0090190 |
positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
| 0.1 |
0.2 |
GO:0034103 |
regulation of tissue remodeling(GO:0034103) |
| 0.1 |
0.5 |
GO:0032727 |
positive regulation of interferon-alpha production(GO:0032727) |
| 0.1 |
1.8 |
GO:0032878 |
regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.1 |
0.7 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 |
0.3 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.2 |
GO:0071675 |
mononuclear cell migration(GO:0071674) regulation of mononuclear cell migration(GO:0071675) |
| 0.1 |
0.2 |
GO:1900042 |
positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 |
0.9 |
GO:1904893 |
negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.1 |
0.2 |
GO:0090222 |
centrosome-templated microtubule nucleation(GO:0090222) |
| 0.1 |
0.2 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.1 |
0.2 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.1 |
0.2 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.1 |
1.7 |
GO:0051482 |
positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.1 |
0.6 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 |
0.2 |
GO:0014911 |
positive regulation of smooth muscle cell migration(GO:0014911) |
| 0.1 |
2.7 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.1 |
1.5 |
GO:0036152 |
phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.1 |
0.2 |
GO:0006102 |
isocitrate metabolic process(GO:0006102) |
| 0.1 |
0.7 |
GO:1901550 |
regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.1 |
0.2 |
GO:0051590 |
positive regulation of neurotransmitter transport(GO:0051590) |
| 0.1 |
0.6 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.0 |
0.3 |
GO:0019563 |
glycerol catabolic process(GO:0019563) |
| 0.0 |
0.2 |
GO:0009730 |
detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.0 |
1.4 |
GO:1900047 |
negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
| 0.0 |
0.6 |
GO:0070294 |
renal sodium ion absorption(GO:0070294) |
| 0.0 |
0.2 |
GO:0038026 |
reelin-mediated signaling pathway(GO:0038026) |
| 0.0 |
0.8 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.0 |
0.4 |
GO:0071692 |
protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.0 |
0.3 |
GO:0040031 |
snRNA pseudouridine synthesis(GO:0031120) snRNA modification(GO:0040031) |
| 0.0 |
0.2 |
GO:0035574 |
histone H4-K20 demethylation(GO:0035574) |
| 0.0 |
0.1 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.0 |
0.0 |
GO:0070305 |
renin-angiotensin regulation of aldosterone production(GO:0002018) response to cGMP(GO:0070305) |
| 0.0 |
1.3 |
GO:0044364 |
killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.0 |
0.1 |
GO:0021514 |
ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.0 |
0.3 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.0 |
0.3 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 0.0 |
0.5 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 0.0 |
2.0 |
GO:1904031 |
positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.0 |
0.3 |
GO:0021590 |
cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
| 0.0 |
0.2 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.0 |
0.1 |
GO:0035408 |
histone H3-T6 phosphorylation(GO:0035408) |
| 0.0 |
0.2 |
GO:0036371 |
protein localization to T-tubule(GO:0036371) |
| 0.0 |
0.2 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 |
0.2 |
GO:0010286 |
heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 |
0.5 |
GO:0001964 |
startle response(GO:0001964) |
| 0.0 |
1.0 |
GO:0071786 |
endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 |
0.2 |
GO:0019098 |
reproductive behavior(GO:0019098) |
| 0.0 |
0.6 |
GO:0045670 |
regulation of osteoclast differentiation(GO:0045670) |
| 0.0 |
0.5 |
GO:0008637 |
apoptotic mitochondrial changes(GO:0008637) |
| 0.0 |
0.1 |
GO:0010040 |
response to iron(II) ion(GO:0010040) |
| 0.0 |
0.4 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.0 |
0.2 |
GO:0010756 |
regulation of plasminogen activation(GO:0010755) positive regulation of plasminogen activation(GO:0010756) |
| 0.0 |
0.1 |
GO:0086018 |
SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) |
| 0.0 |
0.0 |
GO:0070633 |
transepithelial transport(GO:0070633) |
| 0.0 |
0.6 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 |
0.1 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 |
0.1 |
GO:0098532 |
histone H3-K27 trimethylation(GO:0098532) |
| 0.0 |
0.1 |
GO:0042045 |
epithelial fluid transport(GO:0042045) |
| 0.0 |
0.3 |
GO:0015808 |
L-alanine transport(GO:0015808) |
| 0.0 |
0.3 |
GO:2001293 |
malonyl-CoA metabolic process(GO:2001293) malonyl-CoA biosynthetic process(GO:2001295) |
| 0.0 |
0.8 |
GO:0042554 |
superoxide anion generation(GO:0042554) |
| 0.0 |
0.9 |
GO:0033540 |
fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.0 |
0.5 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.0 |
0.1 |
GO:2001178 |
mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.0 |
0.1 |
GO:0033037 |
polysaccharide localization(GO:0033037) |
| 0.0 |
0.2 |
GO:2001106 |
regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.0 |
0.1 |
GO:0055064 |
chloride ion homeostasis(GO:0055064) |
| 0.0 |
0.2 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.0 |
0.1 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.0 |
0.2 |
GO:0009164 |
nucleoside catabolic process(GO:0009164) |
| 0.0 |
6.8 |
GO:0042742 |
defense response to bacterium(GO:0042742) |
| 0.0 |
0.2 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.0 |
0.2 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.0 |
2.2 |
GO:0070059 |
intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
| 0.0 |
0.1 |
GO:0072583 |
clathrin-mediated endocytosis(GO:0072583) |
| 0.0 |
0.4 |
GO:0002634 |
regulation of germinal center formation(GO:0002634) |
| 0.0 |
0.3 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 |
0.2 |
GO:0006311 |
meiotic gene conversion(GO:0006311) |
| 0.0 |
0.6 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 |
0.2 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.0 |
0.2 |
GO:0009155 |
purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.0 |
0.2 |
GO:0035672 |
oligopeptide transmembrane transport(GO:0035672) |
| 0.0 |
0.1 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.0 |
0.6 |
GO:0010800 |
positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 |
1.6 |
GO:0048488 |
synaptic vesicle endocytosis(GO:0048488) |
| 0.0 |
0.1 |
GO:0032608 |
interferon-beta production(GO:0032608) |
| 0.0 |
1.9 |
GO:0008347 |
glial cell migration(GO:0008347) |
| 0.0 |
0.2 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.0 |
1.7 |
GO:0007029 |
endoplasmic reticulum organization(GO:0007029) |
| 0.0 |
0.1 |
GO:0070309 |
lens fiber cell morphogenesis(GO:0070309) |
| 0.0 |
0.1 |
GO:0031291 |
Ran protein signal transduction(GO:0031291) |
| 0.0 |
0.3 |
GO:0048268 |
clathrin coat assembly(GO:0048268) |
| 0.0 |
0.2 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.0 |
0.8 |
GO:0097696 |
JAK-STAT cascade(GO:0007259) STAT cascade(GO:0097696) |
| 0.0 |
0.2 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 |
0.3 |
GO:0061003 |
positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 |
0.2 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 |
0.3 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 |
0.5 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.0 |
0.3 |
GO:0030299 |
intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.0 |
0.1 |
GO:0050966 |
detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.0 |
0.2 |
GO:1900227 |
positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 |
0.3 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 0.0 |
0.3 |
GO:0019885 |
antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.0 |
0.2 |
GO:0007598 |
blood coagulation, extrinsic pathway(GO:0007598) |
| 0.0 |
0.5 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.0 |
0.3 |
GO:0060339 |
negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.0 |
0.4 |
GO:2000580 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.0 |
0.5 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.0 |
0.5 |
GO:0034250 |
positive regulation of cellular amide metabolic process(GO:0034250) |
| 0.0 |
0.5 |
GO:0043627 |
response to estrogen(GO:0043627) |
| 0.0 |
0.1 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.0 |
0.1 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 |
0.1 |
GO:1903363 |
negative regulation of cellular protein catabolic process(GO:1903363) |
| 0.0 |
0.1 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.0 |
0.1 |
GO:0097119 |
postsynaptic density protein 95 clustering(GO:0097119) |
| 0.0 |
0.6 |
GO:2000786 |
positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 |
0.1 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.0 |
0.7 |
GO:0090110 |
cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 |
0.0 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.0 |
0.1 |
GO:0046041 |
ITP metabolic process(GO:0046041) |
| 0.0 |
0.3 |
GO:0042491 |
auditory receptor cell differentiation(GO:0042491) |
| 0.0 |
0.1 |
GO:0009448 |
gamma-aminobutyric acid metabolic process(GO:0009448) |
| 0.0 |
0.2 |
GO:0044501 |
modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.0 |
0.2 |
GO:0002076 |
osteoblast development(GO:0002076) |
| 0.0 |
1.9 |
GO:0010803 |
regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 |
0.3 |
GO:0042487 |
regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.0 |
0.1 |
GO:0021794 |
thalamus development(GO:0021794) |
| 0.0 |
2.5 |
GO:0030574 |
collagen catabolic process(GO:0030574) |
| 0.0 |
0.3 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 |
0.1 |
GO:0032474 |
otolith morphogenesis(GO:0032474) otolith development(GO:0048840) |
| 0.0 |
0.2 |
GO:0030879 |
mammary gland development(GO:0030879) |
| 0.0 |
0.1 |
GO:0033034 |
positive regulation of neutrophil apoptotic process(GO:0033031) positive regulation of myeloid cell apoptotic process(GO:0033034) |
| 0.0 |
0.1 |
GO:0060711 |
labyrinthine layer development(GO:0060711) |
| 0.0 |
0.1 |
GO:0007228 |
positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 |
0.3 |
GO:0034629 |
cellular protein complex localization(GO:0034629) |
| 0.0 |
0.1 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 |
0.8 |
GO:0006958 |
complement activation, classical pathway(GO:0006958) |
| 0.0 |
0.2 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.0 |
0.6 |
GO:0060338 |
regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.0 |
0.3 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.0 |
0.1 |
GO:0006480 |
N-terminal protein amino acid methylation(GO:0006480) |
| 0.0 |
0.1 |
GO:0042253 |
granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) |
| 0.0 |
0.1 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 |
0.1 |
GO:0051466 |
corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
| 0.0 |
0.1 |
GO:0038044 |
transforming growth factor-beta secretion(GO:0038044) |
| 0.0 |
1.0 |
GO:0006884 |
cell volume homeostasis(GO:0006884) |
| 0.0 |
0.0 |
GO:1990822 |
basic amino acid transmembrane transport(GO:1990822) |
| 0.0 |
0.1 |
GO:1903756 |
regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.0 |
0.2 |
GO:0061589 |
calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 |
0.3 |
GO:0034551 |
respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 |
0.3 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 |
0.1 |
GO:0038145 |
macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.0 |
2.2 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.4 |
GO:0032331 |
negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.0 |
0.0 |
GO:0002154 |
thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 |
0.1 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.0 |
0.5 |
GO:0045453 |
bone resorption(GO:0045453) |
| 0.0 |
0.1 |
GO:0010891 |
negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 |
0.1 |
GO:0006844 |
acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.0 |
0.2 |
GO:0015722 |
canalicular bile acid transport(GO:0015722) |
| 0.0 |
0.3 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 |
0.2 |
GO:0002903 |
negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 |
0.3 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 |
0.3 |
GO:0010831 |
positive regulation of myotube differentiation(GO:0010831) |
| 0.0 |
0.1 |
GO:0097105 |
presynaptic membrane assembly(GO:0097105) |
| 0.0 |
0.0 |
GO:0042320 |
regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) |
| 0.0 |
0.2 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 |
0.1 |
GO:1990569 |
UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.0 |
0.4 |
GO:1904037 |
positive regulation of epithelial cell apoptotic process(GO:1904037) |
| 0.0 |
0.2 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.0 |
0.1 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.0 |
2.4 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.0 |
0.5 |
GO:0008045 |
motor neuron axon guidance(GO:0008045) |
| 0.0 |
0.1 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 |
0.4 |
GO:2000251 |
positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 |
0.0 |
GO:0045080 |
positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.0 |
0.1 |
GO:0035897 |
proteolysis in other organism(GO:0035897) |
| 0.0 |
0.1 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 |
0.1 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 0.0 |
0.2 |
GO:0010657 |
muscle cell apoptotic process(GO:0010657) |
| 0.0 |
0.2 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.0 |
0.1 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.0 |
1.5 |
GO:0051965 |
positive regulation of synapse assembly(GO:0051965) |
| 0.0 |
0.1 |
GO:0072387 |
flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.0 |
0.2 |
GO:0018149 |
peptide cross-linking(GO:0018149) |
| 0.0 |
0.3 |
GO:0034122 |
negative regulation of toll-like receptor signaling pathway(GO:0034122) |
| 0.0 |
0.1 |
GO:0071400 |
cellular response to oleic acid(GO:0071400) |
| 0.0 |
0.2 |
GO:0099500 |
synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 |
0.5 |
GO:0035024 |
negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 |
0.2 |
GO:0050779 |
RNA destabilization(GO:0050779) |
| 0.0 |
0.3 |
GO:0098751 |
bone cell development(GO:0098751) |
| 0.0 |
0.1 |
GO:0046901 |
tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.0 |
0.2 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 |
0.1 |
GO:0010522 |
regulation of calcium ion transport into cytosol(GO:0010522) regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 |
0.1 |
GO:0019417 |
sulfur oxidation(GO:0019417) |
| 0.0 |
0.1 |
GO:0036512 |
trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.0 |
0.7 |
GO:0045332 |
phospholipid translocation(GO:0045332) |
| 0.0 |
0.6 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 |
0.0 |
GO:1902527 |
positive regulation of protein monoubiquitination(GO:1902527) |
| 0.0 |
0.4 |
GO:0035729 |
cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.0 |
0.3 |
GO:0035826 |
rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.0 |
0.2 |
GO:0001502 |
cartilage condensation(GO:0001502) |
| 0.0 |
0.0 |
GO:0006527 |
arginine catabolic process(GO:0006527) |
| 0.0 |
0.1 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.0 |
0.1 |
GO:0050766 |
positive regulation of phagocytosis(GO:0050766) |
| 0.0 |
0.3 |
GO:0008612 |
peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.0 |
0.1 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.3 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.0 |
0.5 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
0.1 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 |
0.2 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 |
0.1 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.0 |
0.1 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 |
0.1 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 |
0.6 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 0.0 |
0.2 |
GO:1904322 |
response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 |
0.0 |
GO:0010133 |
proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) 4-hydroxyproline catabolic process(GO:0019470) |
| 0.0 |
0.1 |
GO:0048250 |
mitochondrial iron ion transport(GO:0048250) |
| 0.0 |
0.1 |
GO:0002385 |
mucosal immune response(GO:0002385) |
| 0.0 |
0.2 |
GO:0045577 |
regulation of B cell differentiation(GO:0045577) |
| 0.0 |
0.3 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.0 |
0.1 |
GO:0099541 |
negative regulation of dopamine secretion(GO:0033602) trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
| 0.0 |
0.1 |
GO:0031054 |
pre-miRNA processing(GO:0031054) |
| 0.0 |
1.0 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.0 |
0.0 |
GO:0032481 |
positive regulation of type I interferon production(GO:0032481) |
| 0.0 |
0.0 |
GO:0038109 |
response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.0 |
0.4 |
GO:1904380 |
endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 |
0.1 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.0 |
0.3 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.0 |
0.1 |
GO:0060576 |
intestinal epithelial cell development(GO:0060576) |
| 0.0 |
0.1 |
GO:0061737 |
leukotriene signaling pathway(GO:0061737) |
| 0.0 |
0.6 |
GO:0032012 |
regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 |
0.0 |
GO:1903061 |
positive regulation of lipoprotein metabolic process(GO:0050747) regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.0 |
0.5 |
GO:0006646 |
phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 |
0.4 |
GO:0060644 |
mammary gland epithelial cell differentiation(GO:0060644) |
| 0.0 |
1.0 |
GO:0051306 |
mitotic sister chromatid separation(GO:0051306) |
| 0.0 |
0.0 |
GO:0010155 |
regulation of proton transport(GO:0010155) |
| 0.0 |
0.1 |
GO:0097091 |
synaptic vesicle clustering(GO:0097091) |
| 0.0 |
0.1 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.0 |
0.1 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.0 |
0.2 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.0 |
0.4 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) |
| 0.0 |
0.1 |
GO:0006408 |
snRNA export from nucleus(GO:0006408) |
| 0.0 |
0.2 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.0 |
0.1 |
GO:0051580 |
regulation of neurotransmitter uptake(GO:0051580) |
| 0.0 |
0.2 |
GO:0002643 |
regulation of tolerance induction(GO:0002643) |
| 0.0 |
0.2 |
GO:0086069 |
bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.0 |
0.1 |
GO:0060318 |
regulation of definitive erythrocyte differentiation(GO:0010724) definitive erythrocyte differentiation(GO:0060318) |
| 0.0 |
0.3 |
GO:0017121 |
phospholipid scrambling(GO:0017121) |
| 0.0 |
0.1 |
GO:0098706 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.0 |
0.1 |
GO:0006288 |
base-excision repair, DNA ligation(GO:0006288) |
| 0.0 |
0.3 |
GO:0019532 |
oxalate transport(GO:0019532) |
| 0.0 |
0.1 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 |
0.4 |
GO:0031290 |
retinal ganglion cell axon guidance(GO:0031290) |
| 0.0 |
0.2 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 |
0.1 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 |
0.5 |
GO:0017004 |
cytochrome complex assembly(GO:0017004) |
| 0.0 |
0.2 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 |
0.1 |
GO:0006574 |
valine catabolic process(GO:0006574) |
| 0.0 |
0.2 |
GO:0014002 |
astrocyte development(GO:0014002) |
| 0.0 |
0.1 |
GO:0030101 |
natural killer cell activation(GO:0030101) |
| 0.0 |
0.1 |
GO:0097190 |
apoptotic signaling pathway(GO:0097190) |
| 0.0 |
0.1 |
GO:0035092 |
sperm chromatin condensation(GO:0035092) |
| 0.0 |
0.1 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) arterial endothelial cell differentiation(GO:0060842) |
| 0.0 |
0.2 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 |
0.1 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 |
0.6 |
GO:1901799 |
negative regulation of proteasomal protein catabolic process(GO:1901799) |
| 0.0 |
0.2 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 |
1.0 |
GO:2000117 |
negative regulation of cysteine-type endopeptidase activity(GO:2000117) |
| 0.0 |
0.0 |
GO:2000569 |
T-helper 2 cell activation(GO:0035712) negative regulation of T-helper 1 cell differentiation(GO:0045626) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.0 |
0.1 |
GO:0001829 |
trophectodermal cell differentiation(GO:0001829) |
| 0.0 |
0.1 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 |
0.6 |
GO:0006986 |
response to unfolded protein(GO:0006986) response to topologically incorrect protein(GO:0035966) |
| 0.0 |
0.1 |
GO:0006598 |
polyamine catabolic process(GO:0006598) |
| 0.0 |
0.0 |
GO:0000301 |
retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 |
0.2 |
GO:0090129 |
regulation of synapse maturation(GO:0090128) positive regulation of synapse maturation(GO:0090129) |
| 0.0 |
0.9 |
GO:0032006 |
regulation of TOR signaling(GO:0032006) |
| 0.0 |
0.1 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.0 |
0.2 |
GO:0042340 |
keratan sulfate catabolic process(GO:0042340) |
| 0.0 |
0.0 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.0 |
0.1 |
GO:0002224 |
toll-like receptor signaling pathway(GO:0002224) |
| 0.0 |
0.2 |
GO:0009268 |
response to pH(GO:0009268) |
| 0.0 |
0.0 |
GO:0050918 |
positive chemotaxis(GO:0050918) |
| 0.0 |
0.1 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.0 |
0.0 |
GO:0000711 |
meiotic DNA repair synthesis(GO:0000711) |
| 0.0 |
0.1 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) |
| 0.0 |
0.2 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 |
0.1 |
GO:0018243 |
protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 |
0.1 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.0 |
0.1 |
GO:0032620 |
interleukin-17 production(GO:0032620) |
| 0.0 |
0.0 |
GO:0044878 |
mitotic cytokinesis checkpoint(GO:0044878) |
| 0.0 |
0.1 |
GO:0002347 |
response to tumor cell(GO:0002347) |
| 0.0 |
0.0 |
GO:1905051 |
regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.0 |
0.0 |
GO:0071503 |
response to heparin(GO:0071503) |
| 0.0 |
0.2 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 |
0.0 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.0 |
0.0 |
GO:1901569 |
leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.0 |
0.0 |
GO:0051354 |
negative regulation of oxidoreductase activity(GO:0051354) |
| 0.0 |
0.1 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.0 |
0.0 |
GO:0002323 |
natural killer cell activation involved in immune response(GO:0002323) |
| 0.0 |
0.1 |
GO:0002296 |
T-helper 1 cell lineage commitment(GO:0002296) |
| 0.0 |
0.0 |
GO:0046603 |
negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.0 |
0.3 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.0 |
0.0 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.0 |
0.1 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 |
0.1 |
GO:0021983 |
pituitary gland development(GO:0021983) |
| 0.0 |
0.0 |
GO:1902804 |
negative regulation of synaptic vesicle transport(GO:1902804) |
| 0.0 |
0.0 |
GO:0001820 |
serotonin secretion(GO:0001820) |
| 0.0 |
0.1 |
GO:0090481 |
pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.0 |
0.0 |
GO:0001555 |
oocyte growth(GO:0001555) |
| 0.0 |
0.3 |
GO:0000042 |
protein targeting to Golgi(GO:0000042) |
| 0.0 |
0.2 |
GO:0043402 |
glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 |
0.1 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 |
0.1 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.0 |
0.1 |
GO:0002548 |
monocyte chemotaxis(GO:0002548) |
| 0.0 |
0.1 |
GO:0070541 |
response to platinum ion(GO:0070541) |
| 0.0 |
0.1 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 |
0.2 |
GO:0090022 |
regulation of neutrophil chemotaxis(GO:0090022) |
| 0.0 |
0.2 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 |
0.0 |
GO:0045076 |
regulation of interleukin-2 biosynthetic process(GO:0045076) |
| 0.0 |
0.1 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.0 |
0.3 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.0 |
0.0 |
GO:0071971 |
extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
| 0.0 |
0.2 |
GO:0060044 |
negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.0 |
0.2 |
GO:0051894 |
positive regulation of focal adhesion assembly(GO:0051894) positive regulation of adherens junction organization(GO:1903393) |
| 0.0 |
0.0 |
GO:0090340 |
positive regulation of high-density lipoprotein particle assembly(GO:0090108) positive regulation of secretion of lysosomal enzymes(GO:0090340) |
| 0.0 |
0.1 |
GO:0034116 |
positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.0 |
0.1 |
GO:1903902 |
positive regulation of viral life cycle(GO:1903902) |
| 0.0 |
0.2 |
GO:0032728 |
positive regulation of interferon-beta production(GO:0032728) |
| 0.0 |
0.1 |
GO:2001222 |
regulation of neuron migration(GO:2001222) |
| 0.0 |
0.0 |
GO:0072737 |
response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
| 0.0 |
0.0 |
GO:0032526 |
response to retinoic acid(GO:0032526) |
| 0.0 |
0.7 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.0 |
0.0 |
GO:0050748 |
regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.0 |
0.1 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.0 |
0.2 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 |
0.0 |
GO:0071106 |
coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 0.0 |
0.6 |
GO:0030433 |
ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.0 |
0.0 |
GO:1904017 |
response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 |
0.0 |
GO:0001660 |
fever generation(GO:0001660) |
| 0.0 |
0.1 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 |
0.1 |
GO:2000096 |
positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.0 |
0.0 |
GO:2001034 |
positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.0 |
0.3 |
GO:0010863 |
positive regulation of phospholipase C activity(GO:0010863) regulation of phospholipase C activity(GO:1900274) |
| 0.0 |
0.2 |
GO:0045744 |
negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.0 |
0.1 |
GO:1901386 |
negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 |
0.2 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.0 |
0.0 |
GO:0001919 |
regulation of receptor recycling(GO:0001919) |
| 0.0 |
0.1 |
GO:0071467 |
cellular response to pH(GO:0071467) |
| 0.0 |
0.0 |
GO:0097035 |
regulation of membrane lipid distribution(GO:0097035) |
| 0.0 |
0.1 |
GO:0048339 |
paraxial mesoderm development(GO:0048339) |
| 0.0 |
0.1 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 |
0.0 |
GO:0099566 |
regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.0 |
0.0 |
GO:0035696 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) positive regulation of monocyte extravasation(GO:2000439) |
| 0.0 |
0.1 |
GO:0035646 |
endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 |
0.1 |
GO:0030149 |
sphingolipid catabolic process(GO:0030149) |
| 0.0 |
0.2 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.0 |
0.2 |
GO:2001275 |
positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
