| 0.3 |
0.8 |
GO:0021793 |
chemorepulsion of branchiomotor axon(GO:0021793) |
| 0.3 |
1.0 |
GO:1904049 |
negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.2 |
0.7 |
GO:1905246 |
regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.2 |
1.7 |
GO:0086048 |
membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.2 |
1.0 |
GO:1902228 |
mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.2 |
0.5 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.2 |
1.0 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.2 |
0.5 |
GO:0086047 |
membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 0.2 |
0.2 |
GO:0035249 |
synaptic transmission, glutamatergic(GO:0035249) |
| 0.1 |
1.5 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.1 |
0.6 |
GO:1900248 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 |
0.4 |
GO:0051389 |
inactivation of MAPKK activity(GO:0051389) |
| 0.1 |
0.4 |
GO:0071812 |
circadian temperature homeostasis(GO:0060086) regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.1 |
0.8 |
GO:0061107 |
seminal vesicle development(GO:0061107) |
| 0.1 |
0.5 |
GO:0042247 |
morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.1 |
0.6 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.1 |
0.2 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 0.1 |
0.4 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.1 |
0.4 |
GO:0034445 |
regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) phenylpropanoid catabolic process(GO:0046271) |
| 0.1 |
0.5 |
GO:0002528 |
regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.1 |
0.3 |
GO:0007509 |
mesoderm migration involved in gastrulation(GO:0007509) |
| 0.1 |
0.4 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) Wnt signaling pathway involved in somitogenesis(GO:0090244) negative regulation of non-canonical Wnt signaling pathway(GO:2000051) regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.1 |
0.9 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.1 |
1.3 |
GO:0021636 |
trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.1 |
0.3 |
GO:0009138 |
pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.1 |
0.7 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.1 |
1.5 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.1 |
0.2 |
GO:0060054 |
positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.1 |
0.2 |
GO:0090222 |
centrosome-templated microtubule nucleation(GO:0090222) |
| 0.1 |
0.3 |
GO:1902161 |
positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.1 |
0.6 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 |
0.4 |
GO:0090031 |
positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.1 |
0.2 |
GO:0034164 |
negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.1 |
0.5 |
GO:0034154 |
toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 |
0.2 |
GO:0044313 |
protein K6-linked deubiquitination(GO:0044313) |
| 0.1 |
0.3 |
GO:0035408 |
histone H3-T6 phosphorylation(GO:0035408) |
| 0.1 |
0.2 |
GO:0036023 |
limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.1 |
0.2 |
GO:0035625 |
epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.1 |
0.4 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 0.1 |
0.5 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.1 |
0.3 |
GO:1904647 |
response to rotenone(GO:1904647) |
| 0.1 |
0.2 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 |
0.2 |
GO:0021538 |
epithalamus development(GO:0021538) habenula development(GO:0021986) general adaptation syndrome(GO:0051866) |
| 0.1 |
0.4 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 |
0.3 |
GO:2000097 |
regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.1 |
0.3 |
GO:1904978 |
regulation of endosome organization(GO:1904978) |
| 0.1 |
0.2 |
GO:0060730 |
regulation of intestinal epithelial structure maintenance(GO:0060730) |
| 0.1 |
1.1 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.1 |
0.4 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.1 |
0.9 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 |
0.7 |
GO:0045964 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 |
0.4 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 |
0.4 |
GO:0060666 |
dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.1 |
0.1 |
GO:0097267 |
omega-hydroxylase P450 pathway(GO:0097267) |
| 0.1 |
0.2 |
GO:0003131 |
mesodermal-endodermal cell signaling(GO:0003131) programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) histone H2A-S139 phosphorylation(GO:0035978) positive regulation of cellular response to X-ray(GO:2000685) |
| 0.1 |
0.2 |
GO:0097187 |
dentinogenesis(GO:0097187) |
| 0.1 |
0.2 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.1 |
0.1 |
GO:1900077 |
negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.1 |
0.3 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.1 |
0.1 |
GO:0034139 |
regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.1 |
0.3 |
GO:1904209 |
regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.1 |
0.2 |
GO:0052151 |
positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.1 |
0.1 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.1 |
0.2 |
GO:0021718 |
superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.1 |
0.7 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 |
0.3 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 |
0.4 |
GO:0046618 |
drug export(GO:0046618) |
| 0.0 |
0.1 |
GO:0034402 |
recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.0 |
0.1 |
GO:0019230 |
pathogenesis(GO:0009405) proprioception(GO:0019230) |
| 0.0 |
0.2 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.0 |
0.1 |
GO:0052553 |
induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.0 |
0.1 |
GO:2001226 |
negative regulation of chloride transport(GO:2001226) |
| 0.0 |
0.3 |
GO:1903281 |
protein transport into plasma membrane raft(GO:0044861) positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.0 |
0.4 |
GO:0015811 |
L-cystine transport(GO:0015811) |
| 0.0 |
0.8 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 |
0.5 |
GO:0032224 |
positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 |
0.1 |
GO:1903410 |
lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.0 |
0.1 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.0 |
0.2 |
GO:1905075 |
occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.0 |
0.2 |
GO:1904933 |
regulation of cell proliferation in midbrain(GO:1904933) |
| 0.0 |
0.2 |
GO:0032912 |
negative regulation of transforming growth factor beta2 production(GO:0032912) |
| 0.0 |
0.2 |
GO:2001106 |
regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.0 |
2.0 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 |
0.4 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.0 |
0.2 |
GO:0002545 |
chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
| 0.0 |
0.4 |
GO:0051549 |
positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 |
0.7 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 |
0.3 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.0 |
0.2 |
GO:1905167 |
positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.0 |
0.2 |
GO:0042412 |
taurine biosynthetic process(GO:0042412) |
| 0.0 |
0.4 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.0 |
0.3 |
GO:0050653 |
chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.0 |
0.2 |
GO:1990535 |
regulation of intracellular calcium activated chloride channel activity(GO:1902938) neuron projection maintenance(GO:1990535) |
| 0.0 |
0.9 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 |
0.2 |
GO:0019747 |
regulation of isoprenoid metabolic process(GO:0019747) |
| 0.0 |
0.1 |
GO:1904717 |
excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.0 |
0.1 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.0 |
0.1 |
GO:0036071 |
N-glycan fucosylation(GO:0036071) |
| 0.0 |
0.2 |
GO:0050917 |
sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
| 0.0 |
0.1 |
GO:1904899 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.0 |
1.1 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.0 |
0.1 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.0 |
0.1 |
GO:0045994 |
positive regulation of translational initiation by iron(GO:0045994) |
| 0.0 |
0.1 |
GO:1903393 |
positive regulation of adherens junction organization(GO:1903393) |
| 0.0 |
0.2 |
GO:0033274 |
response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 |
0.1 |
GO:0018277 |
protein deamination(GO:0018277) |
| 0.0 |
0.3 |
GO:2001300 |
lipoxin metabolic process(GO:2001300) |
| 0.0 |
0.2 |
GO:0098532 |
histone H3-K27 trimethylation(GO:0098532) |
| 0.0 |
0.1 |
GO:0048250 |
mitochondrial iron ion transport(GO:0048250) |
| 0.0 |
0.1 |
GO:0006814 |
sodium ion transport(GO:0006814) |
| 0.0 |
0.0 |
GO:0031958 |
corticosteroid receptor signaling pathway(GO:0031958) glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.0 |
0.2 |
GO:0035672 |
oligopeptide transmembrane transport(GO:0035672) |
| 0.0 |
0.1 |
GO:0051005 |
negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 |
0.5 |
GO:0015684 |
ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
| 0.0 |
0.1 |
GO:1903756 |
regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.0 |
0.1 |
GO:0000472 |
endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.0 |
0.2 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.0 |
0.0 |
GO:0006816 |
calcium ion transport(GO:0006816) |
| 0.0 |
0.7 |
GO:0030011 |
maintenance of cell polarity(GO:0030011) |
| 0.0 |
0.1 |
GO:0006864 |
pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.0 |
0.1 |
GO:1990502 |
dense core granule maturation(GO:1990502) |
| 0.0 |
0.5 |
GO:0015732 |
prostaglandin transport(GO:0015732) |
| 0.0 |
0.2 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.0 |
0.2 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 |
0.2 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 |
0.3 |
GO:0060120 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.0 |
0.2 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 |
0.4 |
GO:0046325 |
negative regulation of glucose import(GO:0046325) |
| 0.0 |
0.1 |
GO:0006478 |
peptidyl-tyrosine sulfation(GO:0006478) |
| 0.0 |
0.4 |
GO:0071786 |
endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 |
0.3 |
GO:0044341 |
sodium-dependent phosphate transport(GO:0044341) |
| 0.0 |
0.3 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.0 |
0.1 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.0 |
0.1 |
GO:0001994 |
norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 |
0.2 |
GO:0008295 |
spermidine biosynthetic process(GO:0008295) |
| 0.0 |
0.7 |
GO:0006646 |
phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 |
0.1 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.0 |
0.4 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.0 |
0.0 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.0 |
0.5 |
GO:0019373 |
epoxygenase P450 pathway(GO:0019373) |
| 0.0 |
0.3 |
GO:0048671 |
negative regulation of collateral sprouting(GO:0048671) |
| 0.0 |
0.1 |
GO:0050882 |
voluntary musculoskeletal movement(GO:0050882) |
| 0.0 |
0.5 |
GO:0015012 |
heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.0 |
0.2 |
GO:0019885 |
antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.0 |
0.1 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.0 |
0.1 |
GO:0034146 |
toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.0 |
0.0 |
GO:0060372 |
regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.0 |
0.3 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.0 |
0.2 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.0 |
0.1 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.0 |
0.3 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 |
0.2 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 |
0.1 |
GO:1903028 |
positive regulation of opsonization(GO:1903028) |
| 0.0 |
0.2 |
GO:0038028 |
insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.0 |
0.0 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.0 |
0.1 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 |
0.5 |
GO:0034375 |
high-density lipoprotein particle remodeling(GO:0034375) |
| 0.0 |
0.3 |
GO:0043116 |
negative regulation of vascular permeability(GO:0043116) |
| 0.0 |
0.2 |
GO:1903764 |
regulation of potassium ion export across plasma membrane(GO:1903764) |
| 0.0 |
0.2 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) pyramidal neuron development(GO:0021860) |
| 0.0 |
0.2 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.0 |
0.2 |
GO:0099515 |
nuclear migration along microfilament(GO:0031022) actin filament-based transport(GO:0099515) |
| 0.0 |
0.3 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 |
0.1 |
GO:0030309 |
poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.0 |
0.1 |
GO:1902866 |
regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 |
0.2 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 |
0.4 |
GO:0090331 |
negative regulation of platelet aggregation(GO:0090331) |
| 0.0 |
0.2 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 |
0.1 |
GO:0034499 |
late endosome to Golgi transport(GO:0034499) |
| 0.0 |
0.1 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 |
0.1 |
GO:0023035 |
CD40 signaling pathway(GO:0023035) |
| 0.0 |
0.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.0 |
0.2 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.0 |
0.1 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 |
0.0 |
GO:0010701 |
positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 |
0.1 |
GO:0006049 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 |
0.1 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.0 |
0.4 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.0 |
0.2 |
GO:0090129 |
positive regulation of synapse maturation(GO:0090129) |
| 0.0 |
0.2 |
GO:2000580 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.0 |
0.1 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.0 |
0.0 |
GO:2000110 |
negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.0 |
0.0 |
GO:0048294 |
negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.0 |
0.1 |
GO:0009267 |
cellular response to starvation(GO:0009267) |
| 0.0 |
0.2 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 |
0.2 |
GO:0002031 |
G-protein coupled receptor internalization(GO:0002031) |
| 0.0 |
0.1 |
GO:0019427 |
acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.0 |
0.2 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 |
0.2 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.0 |
0.2 |
GO:0032494 |
response to peptidoglycan(GO:0032494) |
| 0.0 |
0.1 |
GO:0000186 |
activation of MAPKK activity(GO:0000186) |
| 0.0 |
0.2 |
GO:0010508 |
positive regulation of autophagy(GO:0010508) |
| 0.0 |
0.1 |
GO:1900042 |
positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.0 |
0.0 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.0 |
0.1 |
GO:0002154 |
thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.0 |
0.1 |
GO:0032971 |
regulation of muscle filament sliding(GO:0032971) |
| 0.0 |
0.2 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 |
0.1 |
GO:0060979 |
vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.0 |
0.1 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 |
0.2 |
GO:0086073 |
bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 |
0.1 |
GO:0097084 |
vascular smooth muscle cell development(GO:0097084) |
| 0.0 |
0.1 |
GO:0035583 |
sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.0 |
0.0 |
GO:0052405 |
negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.0 |
0.0 |
GO:1902256 |
apoptotic process involved in outflow tract morphogenesis(GO:0003275) glomerular endothelium development(GO:0072011) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
| 0.0 |
0.1 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.0 |
0.0 |
GO:0017186 |
peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.0 |
0.3 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.0 |
0.2 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.0 |
0.2 |
GO:0071372 |
cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.0 |
0.0 |
GO:0043449 |
cellular alkene metabolic process(GO:0043449) olefin metabolic process(GO:1900673) |
| 0.0 |
0.1 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.0 |
0.3 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 |
0.1 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 0.0 |
0.1 |
GO:0048194 |
Golgi vesicle budding(GO:0048194) |
| 0.0 |
0.1 |
GO:1900063 |
regulation of peroxisome organization(GO:1900063) |
| 0.0 |
0.1 |
GO:0031064 |
negative regulation of histone deacetylation(GO:0031064) |
| 0.0 |
0.0 |
GO:0014022 |
neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.0 |
0.2 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 |
0.0 |
GO:0010256 |
endomembrane system organization(GO:0010256) |
| 0.0 |
0.1 |
GO:1903615 |
regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
| 0.0 |
0.2 |
GO:0001502 |
cartilage condensation(GO:0001502) |
| 0.0 |
0.1 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 |
0.0 |
GO:0060268 |
negative regulation of respiratory burst(GO:0060268) |
| 0.0 |
0.1 |
GO:0051546 |
keratinocyte migration(GO:0051546) |
| 0.0 |
0.0 |
GO:1902512 |
positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 0.0 |
0.1 |
GO:1903906 |
plasma membrane raft distribution(GO:0044855) plasma membrane raft localization(GO:0044856) plasma membrane raft polarization(GO:0044858) regulation of plasma membrane raft polarization(GO:1903906) |
| 0.0 |
0.1 |
GO:0009304 |
transcription initiation from RNA polymerase III promoter(GO:0006384) tRNA transcription(GO:0009304) |
| 0.0 |
0.1 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 |
0.1 |
GO:0048743 |
positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 |
0.1 |
GO:1900060 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 |
0.3 |
GO:0039702 |
viral budding via host ESCRT complex(GO:0039702) |
| 0.0 |
0.1 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.0 |
0.0 |
GO:0097359 |
UDP-glucosylation(GO:0097359) |
| 0.0 |
0.0 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.0 |
0.1 |
GO:0045919 |
positive regulation of cytolysis(GO:0045919) |
| 0.0 |
0.2 |
GO:0097119 |
postsynaptic density protein 95 clustering(GO:0097119) |
| 0.0 |
0.0 |
GO:1903400 |
L-arginine transmembrane transport(GO:1903400) mitochondrial L-ornithine transmembrane transport(GO:1990575) |
| 0.0 |
0.1 |
GO:0035105 |
sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.0 |
0.8 |
GO:0015914 |
phospholipid transport(GO:0015914) |
| 0.0 |
0.1 |
GO:0098869 |
detoxification(GO:0098754) cellular oxidant detoxification(GO:0098869) cellular detoxification(GO:1990748) |
| 0.0 |
0.0 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.0 |
0.0 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
