| 0.3 |
1.5 |
GO:0072053 |
renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.2 |
0.7 |
GO:0071879 |
positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.2 |
0.9 |
GO:0060721 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.2 |
0.7 |
GO:1905246 |
regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.2 |
0.6 |
GO:0007506 |
gonadal mesoderm development(GO:0007506) |
| 0.2 |
1.1 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.2 |
0.5 |
GO:0044313 |
protein K6-linked deubiquitination(GO:0044313) |
| 0.1 |
0.4 |
GO:0098582 |
innate vocalization behavior(GO:0098582) |
| 0.1 |
0.6 |
GO:0010652 |
regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) |
| 0.1 |
0.4 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.1 |
0.2 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 |
0.4 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 |
1.5 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.1 |
0.4 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 |
0.2 |
GO:0052553 |
induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.1 |
0.2 |
GO:0003289 |
septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
| 0.1 |
0.2 |
GO:0098972 |
dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
| 0.1 |
0.2 |
GO:0021793 |
chemorepulsion of branchiomotor axon(GO:0021793) |
| 0.1 |
0.2 |
GO:0002541 |
activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.1 |
0.2 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 0.1 |
0.2 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 |
0.3 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 |
0.2 |
GO:0042247 |
morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.1 |
0.3 |
GO:0061364 |
apoptotic process involved in luteolysis(GO:0061364) |
| 0.1 |
0.3 |
GO:0008050 |
female courtship behavior(GO:0008050) |
| 0.1 |
0.2 |
GO:0002605 |
negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) negative regulation of dendritic cell antigen processing and presentation(GO:0002605) negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.1 |
0.2 |
GO:0019230 |
pathogenesis(GO:0009405) proprioception(GO:0019230) |
| 0.1 |
0.2 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 |
0.3 |
GO:2000035 |
positive regulation of somatic stem cell population maintenance(GO:1904674) regulation of stem cell division(GO:2000035) |
| 0.1 |
0.1 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.0 |
0.3 |
GO:2000661 |
positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.0 |
0.2 |
GO:1904647 |
response to rotenone(GO:1904647) |
| 0.0 |
0.1 |
GO:1900020 |
regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 |
0.1 |
GO:1904761 |
negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.0 |
0.4 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 |
0.2 |
GO:0046619 |
optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.0 |
0.1 |
GO:0060490 |
orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.0 |
0.1 |
GO:0061386 |
closure of optic fissure(GO:0061386) |
| 0.0 |
1.2 |
GO:0045332 |
phospholipid translocation(GO:0045332) |
| 0.0 |
0.2 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 |
0.2 |
GO:0071409 |
cellular response to cycloheximide(GO:0071409) |
| 0.0 |
0.3 |
GO:0003402 |
planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.0 |
0.7 |
GO:0044320 |
cellular response to leptin stimulus(GO:0044320) |
| 0.0 |
0.1 |
GO:0090427 |
regulation of fertilization(GO:0080154) activation of meiosis(GO:0090427) |
| 0.0 |
0.4 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 |
0.2 |
GO:2000795 |
negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.0 |
0.2 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.0 |
0.2 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.0 |
0.3 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.0 |
0.1 |
GO:1900365 |
positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.0 |
0.0 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 |
0.4 |
GO:0048845 |
venous blood vessel morphogenesis(GO:0048845) |
| 0.0 |
0.1 |
GO:0045875 |
negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 |
0.2 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 |
0.3 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.0 |
0.5 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) negative regulation of neuron projection regeneration(GO:0070571) |
| 0.0 |
0.3 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 |
0.6 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.0 |
0.5 |
GO:0002430 |
complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 |
0.1 |
GO:1905154 |
negative regulation of membrane invagination(GO:1905154) |
| 0.0 |
0.4 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 |
0.0 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.0 |
0.0 |
GO:0061184 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) positive regulation of dermatome development(GO:0061184) |
| 0.0 |
0.3 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.0 |
0.2 |
GO:0071895 |
odontoblast differentiation(GO:0071895) |
| 0.0 |
0.5 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.0 |
0.4 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 |
0.1 |
GO:0006408 |
snRNA export from nucleus(GO:0006408) |
| 0.0 |
0.6 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 |
0.2 |
GO:1903593 |
regulation of histamine secretion by mast cell(GO:1903593) |
| 0.0 |
0.5 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 |
0.1 |
GO:0070649 |
polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.0 |
0.1 |
GO:0003408 |
optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 |
0.1 |
GO:0052151 |
positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.0 |
0.1 |
GO:0007509 |
mesoderm migration involved in gastrulation(GO:0007509) |
| 0.0 |
0.0 |
GO:0032915 |
positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.0 |
0.1 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.0 |
0.3 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.0 |
0.1 |
GO:0071638 |
negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.0 |
0.1 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 |
0.2 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 |
0.2 |
GO:0035434 |
copper ion transmembrane transport(GO:0035434) |
| 0.0 |
0.0 |
GO:2000687 |
negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.0 |
0.1 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 |
0.2 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 |
0.1 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 |
0.2 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.0 |
0.4 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.0 |
0.2 |
GO:0051608 |
histamine transport(GO:0051608) |
| 0.0 |
0.9 |
GO:0051973 |
positive regulation of telomerase activity(GO:0051973) |
| 0.0 |
0.2 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 |
0.2 |
GO:0055089 |
fatty acid homeostasis(GO:0055089) |
| 0.0 |
0.3 |
GO:0007638 |
mechanosensory behavior(GO:0007638) |
| 0.0 |
0.1 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.0 |
0.1 |
GO:0075044 |
autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.0 |
0.1 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 |
0.2 |
GO:0051195 |
negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 |
0.0 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 0.0 |
0.3 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.0 |
0.1 |
GO:1903433 |
regulation of constitutive secretory pathway(GO:1903433) |
| 0.0 |
0.1 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.0 |
0.3 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
1.3 |
GO:0061178 |
regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
| 0.0 |
0.2 |
GO:0001574 |
ganglioside biosynthetic process(GO:0001574) |
| 0.0 |
0.1 |
GO:0035494 |
SNARE complex disassembly(GO:0035494) |
| 0.0 |
0.2 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 |
0.1 |
GO:0099552 |
trans-synaptic signaling by lipid, modulating synaptic transmission(GO:0099552) trans-synaptic signaling by endocannabinoid, modulating synaptic transmission(GO:0099553) |
| 0.0 |
0.0 |
GO:0046041 |
ITP metabolic process(GO:0046041) |
| 0.0 |
0.0 |
GO:0019085 |
early viral transcription(GO:0019085) |
| 0.0 |
0.1 |
GO:0010265 |
SCF complex assembly(GO:0010265) |
| 0.0 |
0.0 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
