| 0.1 |
0.4 |
GO:0072053 |
renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.1 |
0.3 |
GO:0060721 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.1 |
0.2 |
GO:1990709 |
presynaptic active zone organization(GO:1990709) |
| 0.1 |
0.3 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.1 |
0.4 |
GO:0097646 |
calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.1 |
0.2 |
GO:1901860 |
positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.1 |
0.2 |
GO:0033341 |
regulation of collagen binding(GO:0033341) |
| 0.1 |
0.2 |
GO:1900248 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 |
0.2 |
GO:0010652 |
regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) |
| 0.0 |
0.2 |
GO:0042369 |
vitamin D catabolic process(GO:0042369) |
| 0.0 |
0.1 |
GO:0021538 |
epithalamus development(GO:0021538) habenula development(GO:0021986) general adaptation syndrome(GO:0051866) |
| 0.0 |
0.2 |
GO:0098942 |
regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) cytoskeletal matrix organization at active zone(GO:0048789) neurexin clustering involved in presynaptic membrane assembly(GO:0097115) retrograde trans-synaptic signaling by trans-synaptic protein complex(GO:0098942) |
| 0.0 |
0.2 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 |
0.2 |
GO:0003430 |
growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.0 |
0.1 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.0 |
0.1 |
GO:0007206 |
phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.0 |
0.2 |
GO:0032912 |
negative regulation of transforming growth factor beta2 production(GO:0032912) |
| 0.0 |
0.3 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 |
0.1 |
GO:0001300 |
chronological cell aging(GO:0001300) |
| 0.0 |
0.1 |
GO:2000312 |
regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 |
0.1 |
GO:0018352 |
protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.0 |
0.1 |
GO:0097069 |
cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 0.0 |
0.1 |
GO:0002372 |
myeloid dendritic cell cytokine production(GO:0002372) |
| 0.0 |
0.1 |
GO:0061092 |
regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.0 |
0.3 |
GO:0042492 |
gamma-delta T cell differentiation(GO:0042492) |
| 0.0 |
0.1 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.0 |
0.1 |
GO:0034239 |
macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.0 |
0.1 |
GO:0003289 |
septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
| 0.0 |
0.1 |
GO:1904761 |
negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.0 |
0.1 |
GO:0060214 |
endocardium formation(GO:0060214) |
| 0.0 |
0.1 |
GO:0007509 |
mesoderm migration involved in gastrulation(GO:0007509) |
| 0.0 |
0.1 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 0.0 |
0.1 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.0 |
0.1 |
GO:0048861 |
oncostatin-M-mediated signaling pathway(GO:0038165) leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 |
0.2 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 |
0.1 |
GO:0044336 |
canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.0 |
0.0 |
GO:0046619 |
optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.0 |
0.2 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 |
0.0 |
GO:0061534 |
gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
| 0.0 |
0.0 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 |
0.1 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.0 |
0.0 |
GO:0051389 |
inactivation of MAPKK activity(GO:0051389) |
| 0.0 |
0.1 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 |
0.0 |
GO:0072134 |
nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 0.0 |
0.1 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.0 |
0.2 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 |
0.1 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.0 |
0.1 |
GO:0032487 |
regulation of Rap protein signal transduction(GO:0032487) |
| 0.0 |
0.1 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.0 |
0.0 |
GO:0003213 |
cardiac right atrium morphogenesis(GO:0003213) |
| 0.0 |
0.1 |
GO:1900245 |
positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 |
0.3 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.0 |
0.0 |
GO:0044335 |
external genitalia morphogenesis(GO:0035261) canonical Wnt signaling pathway involved in neural crest cell differentiation(GO:0044335) |
| 0.0 |
0.0 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.1 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 |
0.1 |
GO:0097466 |
protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) glycoprotein ERAD pathway(GO:0097466) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.0 |
0.1 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 |
0.2 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.0 |
0.0 |
GO:0061535 |
glutamate secretion, neurotransmission(GO:0061535) |
