Motif ID: GTF2I
Z-value: 1.074
Transcription factors associated with GTF2I:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| GTF2I | ENSG00000077809.8 | GTF2I |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| GTF2I | hg19_v2_chr7_+_74072011_74072119 | -0.91 | 6.2e-04 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 8.1 | GO:1902748 | mammillary body development(GO:0021767) mammillary axonal complex development(GO:0061373) positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.5 | 2.8 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.4 | 2.2 | GO:0072166 | posterior mesonephric tubule development(GO:0072166) |
| 0.4 | 1.2 | GO:0007037 | vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.4 | 1.9 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.4 | 2.3 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.4 | 1.8 | GO:0048389 | intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
| 0.4 | 0.4 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.4 | 4.0 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.3 | 1.6 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.3 | 1.5 | GO:0072053 | renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.3 | 1.4 | GO:0048749 | compound eye development(GO:0048749) |
| 0.3 | 1.9 | GO:1903281 | protein transport into plasma membrane raft(GO:0044861) positive regulation of calcium:sodium antiporter activity(GO:1903281) positive regulation of potassium ion import(GO:1903288) |
| 0.3 | 5.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.3 | 1.1 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
| 0.3 | 0.8 | GO:0052553 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.3 | 1.0 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.2 | 1.2 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.2 | 1.0 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.2 | 0.2 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.2 | 1.0 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.2 | 1.8 | GO:0021842 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.2 | 0.6 | GO:1903570 | regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 0.2 | 0.6 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.2 | 0.7 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.2 | 0.8 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 2.6 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.4 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.1 | 0.7 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.5 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.1 | 0.4 | GO:0019230 | pathogenesis(GO:0009405) proprioception(GO:0019230) |
| 0.1 | 0.5 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.1 | 2.0 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.1 | 0.8 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.1 | 0.9 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.5 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.1 | 2.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 | 0.4 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.1 | 2.5 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.1 | 0.5 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 1.1 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.1 | 0.6 | GO:0090285 | negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.1 | 0.4 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.1 | 0.6 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.1 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
| 0.1 | 0.8 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.1 | 0.7 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.3 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.1 | 0.3 | GO:0050823 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.1 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 0.8 | GO:1900194 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.3 | GO:0021793 | chemorepulsion of branchiomotor axon(GO:0021793) |
| 0.1 | 0.4 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.1 | 0.3 | GO:0003032 | detection of oxygen(GO:0003032) uterine wall breakdown(GO:0042704) |
| 0.1 | 0.3 | GO:0072011 | glomerular endothelium development(GO:0072011) |
| 0.1 | 1.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.9 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.1 | 0.8 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.1 | 0.3 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.1 | 0.5 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.1 | 0.2 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.1 | 0.3 | GO:0045041 | B cell cytokine production(GO:0002368) protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.1 | 0.9 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.1 | 1.0 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.9 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.1 | 0.2 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.1 | 1.0 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.1 | 0.2 | GO:0032765 | positive regulation of mast cell cytokine production(GO:0032765) |
| 0.1 | 1.5 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.1 | 0.2 | GO:0090425 | hepatocyte cell migration(GO:0002194) otic placode formation(GO:0043049) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 0.1 | 0.5 | GO:1901490 | regulation of lymphangiogenesis(GO:1901490) |
| 0.1 | 0.9 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.1 | 0.3 | GO:1900248 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 | 0.4 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.1 | 1.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.1 | 0.4 | GO:1902378 | vestibulocochlear nerve structural organization(GO:0021649) neuropilin signaling pathway(GO:0038189) VEGF-activated neuropilin signaling pathway(GO:0038190) positive regulation of cytokine activity(GO:0060301) ganglion morphogenesis(GO:0061552) sensory neuron axon guidance(GO:0097374) positive regulation of retinal ganglion cell axon guidance(GO:1902336) VEGF-activated neuropilin signaling pathway involved in axon guidance(GO:1902378) dorsal root ganglion morphogenesis(GO:1904835) otic placode development(GO:1905040) |
| 0.1 | 1.0 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.1 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.1 | 0.2 | GO:1902559 | 3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.1 | 0.7 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 0.2 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.1 | 0.9 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 1.3 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) negative regulation of neuron projection regeneration(GO:0070571) |
| 0.1 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.1 | 0.2 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.1 | 0.3 | GO:0061364 | apoptotic process involved in luteolysis(GO:0061364) |
| 0.1 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 | 0.4 | GO:0034371 | chylomicron remodeling(GO:0034371) |
| 0.1 | 0.2 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.1 | 0.9 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 0.2 | GO:0044335 | canonical Wnt signaling pathway involved in neural crest cell differentiation(GO:0044335) |
| 0.1 | 0.4 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.1 | 1.1 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.1 | 0.2 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 | 0.5 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.5 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.1 | 0.4 | GO:0071603 | endothelial cell-cell adhesion(GO:0071603) |
| 0.1 | 0.5 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 | 0.1 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.1 | 0.2 | GO:0060981 | cell migration involved in coronary angiogenesis(GO:0060981) |
| 0.1 | 0.6 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.1 | 0.2 | GO:1903762 | regulation of heart looping(GO:1901207) positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
| 0.1 | 0.2 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.1 | 0.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.1 | 0.2 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.1 | 0.1 | GO:0021539 | subthalamus development(GO:0021539) |
| 0.1 | 0.2 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.1 | 1.7 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 0.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.1 | 0.4 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.4 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.1 | 1.4 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.1 | 0.4 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
| 0.1 | 0.5 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.1 | 0.5 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 0.5 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 | 0.7 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 | 0.2 | GO:1904647 | response to rotenone(GO:1904647) |
| 0.0 | 1.6 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.0 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.0 | 1.4 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.1 | GO:0015817 | histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) mitochondrial L-ornithine transmembrane transport(GO:1990575) |
| 0.0 | 0.5 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) negative regulation of cytolysis(GO:0045918) |
| 0.0 | 1.9 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.0 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.4 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.0 | 0.5 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.0 | 0.2 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.0 | 0.2 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.0 | 0.5 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 1.0 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.0 | 0.2 | GO:1905205 | positive regulation of connective tissue replacement(GO:1905205) |
| 0.0 | 0.3 | GO:0060356 | leucine import(GO:0060356) |
| 0.0 | 0.3 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.0 | 0.3 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.0 | 0.1 | GO:0043006 | activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 0.0 | 0.3 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.1 | GO:0051780 | mevalonate transport(GO:0015728) behavioral response to nutrient(GO:0051780) |
| 0.0 | 0.5 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.0 | 0.0 | GO:0060147 | regulation of posttranscriptional gene silencing(GO:0060147) regulation of gene silencing by miRNA(GO:0060964) regulation of gene silencing by RNA(GO:0060966) |
| 0.0 | 0.2 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.0 | 0.4 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.0 | 0.1 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.6 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.5 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.2 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 | 0.3 | GO:0032095 | regulation of response to food(GO:0032095) |
| 0.0 | 0.0 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.0 | 0.6 | GO:0060242 | contact inhibition(GO:0060242) |
| 0.0 | 1.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.6 | GO:0044320 | cellular response to leptin stimulus(GO:0044320) |
| 0.0 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.2 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 0.6 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.3 | GO:1990834 | response to odorant(GO:1990834) |
| 0.0 | 0.7 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.0 | 0.3 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.0 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 | 0.1 | GO:0046725 | negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.0 | 0.5 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.3 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.1 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.0 | 0.8 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.1 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.0 | 0.1 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.0 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.5 | GO:0051195 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 | 0.1 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.3 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.1 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.0 | 0.4 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 | 0.2 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.4 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.2 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.0 | 0.1 | GO:0035397 | helper T cell enhancement of adaptive immune response(GO:0035397) |
| 0.0 | 0.1 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.0 | 0.7 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.0 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.2 | GO:0030574 | collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.0 | 0.1 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 | 0.5 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 | 0.3 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 0.1 | GO:0008052 | sensory organ boundary specification(GO:0008052) formation of organ boundary(GO:0010160) taste bud development(GO:0061193) |
| 0.0 | 0.1 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.0 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.0 | 0.5 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.2 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.0 | 0.1 | GO:1901804 | beta-glucoside metabolic process(GO:1901804) beta-glucoside catabolic process(GO:1901805) positive regulation of neuronal action potential(GO:1904457) |
| 0.0 | 0.2 | GO:0021781 | glial cell fate commitment(GO:0021781) |
| 0.0 | 1.4 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
| 0.0 | 1.0 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.8 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.0 | 0.5 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.3 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.0 | 0.9 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 | 0.0 | GO:0071306 | cellular response to vitamin E(GO:0071306) |
| 0.0 | 0.1 | GO:0050928 | negative regulation of positive chemotaxis(GO:0050928) |
| 0.0 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.0 | 0.5 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
| 0.0 | 0.1 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.0 | 0.2 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.0 | 0.3 | GO:0015684 | ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
| 0.0 | 0.3 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.1 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.0 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.9 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 | 0.1 | GO:1901569 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.0 | 0.5 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.0 | 0.1 | GO:1902530 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.0 | 0.8 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
| 0.0 | 4.7 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.3 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.0 | 0.3 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 | 0.1 | GO:1905146 | lysosomal protein catabolic process(GO:1905146) |
| 0.0 | 0.2 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.1 | GO:1903515 | calcium ion transport from cytosol to endoplasmic reticulum(GO:1903515) |
| 0.0 | 0.4 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 | 0.7 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.0 | GO:1902109 | negative regulation of mitochondrial membrane permeability(GO:0035795) negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.0 | 0.2 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.0 | 1.2 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.2 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.0 | GO:0072262 | metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 0.0 | 0.2 | GO:1904327 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.0 | 0.3 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.3 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.0 | 0.1 | GO:0031100 | organ regeneration(GO:0031100) |
| 0.0 | 0.1 | GO:1903615 | regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
| 0.0 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.1 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.1 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.0 | GO:1903595 | positive regulation of histamine secretion by mast cell(GO:1903595) |
| 0.0 | 0.0 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.0 | 0.1 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.3 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.4 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.3 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.2 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
| 0.0 | 0.3 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.0 | 0.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.5 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.6 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.1 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) late viral transcription(GO:0019086) positive regulation of transcription by glucose(GO:0046016) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.2 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.0 | 0.0 | GO:1904017 | cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 | 0.2 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.1 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 0.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.2 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 1.0 | GO:0051058 | negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.0 | 0.3 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.0 | 0.5 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.2 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 | 0.4 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.0 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.2 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.1 | GO:0035826 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.0 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.4 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 | 0.1 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.0 | 0.1 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.7 | GO:0048678 | response to axon injury(GO:0048678) |
| 0.0 | 0.1 | GO:0036376 | sodium ion export from cell(GO:0036376) |
| 0.0 | 0.2 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.0 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.0 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.0 | 0.3 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.0 | 0.1 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.0 | GO:1903280 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) negative regulation of calcium:sodium antiporter activity(GO:1903280) |
| 0.0 | 0.3 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.0 | 0.1 | GO:0060318 | definitive erythrocyte differentiation(GO:0060318) |
| 0.0 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.1 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.2 | 2.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.4 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.1 | 0.5 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 0.2 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 0.5 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 0.3 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.1 | 0.9 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.1 | 1.5 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.3 | GO:0005595 | collagen type XII trimer(GO:0005595) |
| 0.1 | 0.6 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 0.4 | GO:0071665 | gamma-catenin-TCF7L2 complex(GO:0071665) |
| 0.1 | 0.6 | GO:0031673 | H zone(GO:0031673) |
| 0.1 | 0.5 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.1 | 0.4 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.1 | 0.5 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 0.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.4 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 2.0 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 1.0 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.7 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.1 | 1.9 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 0.2 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.1 | 0.7 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.5 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.1 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 2.6 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.1 | 0.2 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 1.3 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 1.2 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 2.5 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.0 | 0.7 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.3 | GO:0042825 | TAP complex(GO:0042825) |
| 0.0 | 0.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.2 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.0 | 0.6 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.9 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.5 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.2 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.0 | 0.1 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.0 | 0.1 | GO:0097489 | multivesicular body, internal vesicle lumen(GO:0097489) |
| 0.0 | 1.2 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.2 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.0 | 0.3 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 1.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.0 | 0.9 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.3 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 1.4 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.2 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.0 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 1.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.2 | GO:0001740 | Barr body(GO:0001740) |
| 0.0 | 0.1 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.0 | 0.5 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.2 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.0 | 0.5 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 1.0 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.7 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.2 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.0 | 0.8 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.6 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.3 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.2 | GO:0042627 | chylomicron(GO:0042627) |
| 0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.6 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.2 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.3 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.0 | 0.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 9.1 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.5 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.4 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 1.0 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.3 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.4 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0072589 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.0 | 0.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.4 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.3 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.3 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.0 | 0.8 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.1 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.5 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.3 | GO:0016964 | alpha-2 macroglobulin receptor activity(GO:0016964) |
| 0.3 | 3.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.3 | 1.7 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.3 | 1.5 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.3 | 0.8 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.2 | 1.9 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.2 | 1.1 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.2 | 0.8 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.2 | 0.6 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
| 0.2 | 5.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.2 | 0.7 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.2 | 1.1 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.2 | 0.5 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.2 | 0.5 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
| 0.2 | 1.9 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.3 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.1 | 0.7 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.1 | 1.1 | GO:0042835 | BRE binding(GO:0042835) |
| 0.1 | 1.1 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 2.1 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 9.4 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 1.8 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.1 | 0.3 | GO:0005135 | interleukin-3 receptor binding(GO:0005135) |
| 0.1 | 2.2 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.4 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
| 0.1 | 0.9 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 0.5 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 0.9 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 0.6 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 1.3 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 1.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 2.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.4 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.1 | 2.0 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.1 | 0.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.3 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.1 | 0.7 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 0.6 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 0.3 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.1 | 0.3 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 0.4 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.6 | GO:0015186 | L-cystine transmembrane transporter activity(GO:0015184) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.1 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 1.5 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 1.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 0.2 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.1 | 0.3 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
| 0.1 | 1.5 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 0.5 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.4 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.1 | 0.6 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.2 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.1 | 0.2 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.1 | 0.4 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.1 | 0.3 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.1 | 0.6 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.1 | 0.7 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.3 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.3 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.1 | 0.5 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.1 | 0.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.1 | 0.7 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.3 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.1 | 0.3 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 0.2 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.1 | 0.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.2 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.0 | 1.0 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.1 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.0 | 0.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.0 | 0.5 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.0 | 0.2 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.0 | 0.4 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.0 | 0.1 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.0 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.4 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.1 | GO:0015130 | mevalonate transmembrane transporter activity(GO:0015130) |
| 0.0 | 0.4 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.2 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.0 | 0.1 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.0 | 0.1 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.5 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 2.5 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.6 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.4 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.6 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.2 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.0 | 0.1 | GO:0036440 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
| 0.0 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.0 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.1 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.0 | 0.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 1.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.3 | GO:0015368 | calcium:sodium antiporter activity(GO:0005432) calcium:cation antiporter activity(GO:0015368) |
| 0.0 | 0.2 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.0 | 0.3 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 1.5 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.2 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.0 | 0.2 | GO:0043394 | proteoglycan binding(GO:0043394) |
| 0.0 | 0.3 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.3 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.0 | 0.3 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.3 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.0 | 0.5 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.7 | GO:0043236 | laminin binding(GO:0043236) |
| 0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.4 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.9 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.1 | GO:0086039 | lutropin-choriogonadotropic hormone receptor binding(GO:0031775) calcium-transporting ATPase activity involved in regulation of cardiac muscle cell membrane potential(GO:0086039) |
| 0.0 | 0.8 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.1 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.0 | 0.9 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 1.2 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.1 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.5 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.0 | 0.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.0 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.3 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.4 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.4 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.1 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.6 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.4 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.0 | 0.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.2 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.4 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.2 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.6 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.1 | GO:0016614 | oxidoreductase activity, acting on CH-OH group of donors(GO:0016614) |
| 0.0 | 0.0 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.0 | 0.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.4 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.7 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.0 | 0.5 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.8 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 4.9 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 1.3 | PID_VEGF_VEGFR_PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 3.7 | PID_GLYPICAN_1PATHWAY | Glypican 1 network |
| 0.1 | 3.8 | NABA_BASEMENT_MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 4.4 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.0 | 2.4 | PID_RXR_VDR_PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 1.2 | PID_ANTHRAX_PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 1.5 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.0 | 1.5 | ST_WNT_CA2_CYCLIC_GMP_PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.2 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.9 | PID_UPA_UPAR_PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.5 | SA_PROGRAMMED_CELL_DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.6 | PID_IGF1_PATHWAY | IGF1 pathway |
| 0.0 | 0.8 | SA_B_CELL_RECEPTOR_COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 1.6 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.7 | PID_ARF_3PATHWAY | Arf1 pathway |
| 0.0 | 0.4 | PID_SYNDECAN_3_PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 1.9 | PID_NFAT_TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 1.4 | PID_ARF6_PATHWAY | Arf6 signaling events |
| 0.0 | 1.0 | PID_GMCSF_PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 1.6 | PID_RB_1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.6 | PID_A6B1_A6B4_INTEGRIN_PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.3 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 1.4 | PID_P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.1 | PID_S1P_S1P4_PATHWAY | S1P4 pathway |
| 0.0 | 1.7 | PID_REG_GR_PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.2 | ST_JAK_STAT_PATHWAY | Jak-STAT Pathway |
| 0.0 | 1.3 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.5 | PID_ECADHERIN_KERATINOCYTE_PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.7 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.7 | PID_LIS1_PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.6 | PID_P38_ALPHA_BETA_PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 1.7 | PID_CASPASE_PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.6 | PID_IL12_STAT4_PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.6 | PID_IL8_CXCR2_PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.3 | PID_INTEGRIN5_PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.1 | PID_ARF6_DOWNSTREAM_PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.5 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 1.9 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 3.5 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.8 | PID_P75_NTR_PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.8 | PID_ECADHERIN_STABILIZATION_PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.1 | PID_THROMBIN_PAR4_PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.2 | ST_PHOSPHOINOSITIDE_3_KINASE_PATHWAY | PI3K Pathway |
| 0.0 | 0.8 | PID_NOTCH_PATHWAY | Notch signaling pathway |
| 0.0 | 0.2 | PID_FAK_PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.6 | PID_RAC1_PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.2 | PID_SYNDECAN_2_PATHWAY | Syndecan-2-mediated signaling events |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.5 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 1.3 | REACTOME_SIGNALING_BY_ACTIVATED_POINT_MUTANTS_OF_FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.1 | 2.0 | REACTOME_MTORC1_MEDIATED_SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 4.1 | REACTOME_ADHERENS_JUNCTIONS_INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 1.3 | REACTOME_HDL_MEDIATED_LIPID_TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 0.6 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 2.3 | REACTOME_DOWNREGULATION_OF_ERBB2_ERBB3_SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 1.4 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 2.1 | REACTOME_CRMPS_IN_SEMA3A_SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.7 | REACTOME_CDC6_ASSOCIATION_WITH_THE_ORC_ORIGIN_COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.6 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_24_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.9 | REACTOME_ACETYLCHOLINE_NEUROTRANSMITTER_RELEASE_CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 2.1 | REACTOME_BASIGIN_INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 1.7 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.5 | REACTOME_GLUTAMATE_NEUROTRANSMITTER_RELEASE_CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.6 | REACTOME_INHIBITION_OF_REPLICATION_INITIATION_OF_DAMAGED_DNA_BY_RB1_E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.5 | REACTOME_NFKB_IS_ACTIVATED_AND_SIGNALS_SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.7 | REACTOME_SOS_MEDIATED_SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 0.1 | REACTOME_SHC1_EVENTS_IN_EGFR_SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.0 | 0.9 | REACTOME_PRE_NOTCH_TRANSCRIPTION_AND_TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.5 | REACTOME_COMMON_PATHWAY | Genes involved in Common Pathway |
| 0.0 | 1.9 | REACTOME_TRAFFICKING_OF_AMPA_RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.0 | 0.4 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.1 | REACTOME_BINDING_AND_ENTRY_OF_HIV_VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.4 | REACTOME_INITIAL_TRIGGERING_OF_COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.1 | REACTOME_G_ALPHA1213_SIGNALLING_EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.4 | REACTOME_CLASS_C_3_METABOTROPIC_GLUTAMATE_PHEROMONE_RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.2 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.8 | REACTOME_SYNTHESIS_OF_PA | Genes involved in Synthesis of PA |
| 0.0 | 0.8 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.7 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.9 | REACTOME_SPHINGOLIPID_DE_NOVO_BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.8 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.2 | REACTOME_MEMBRANE_BINDING_AND_TARGETTING_OF_GAG_PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.8 | REACTOME_IL_RECEPTOR_SHC_SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 1.3 | REACTOME_PHASE1_FUNCTIONALIZATION_OF_COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.4 | REACTOME_PLATELET_SENSITIZATION_BY_LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.6 | REACTOME_HS_GAG_BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.5 | REACTOME_RNA_POL_III_TRANSCRIPTION_TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.0 | 1.0 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 1.1 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.5 | REACTOME_INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.5 | REACTOME_STEROID_HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.3 | REACTOME_REGULATION_OF_GENE_EXPRESSION_IN_BETA_CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.2 | REACTOME_AKT_PHOSPHORYLATES_TARGETS_IN_THE_CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.5 | REACTOME_ACTIVATED_NOTCH1_TRANSMITS_SIGNAL_TO_THE_NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.2 | REACTOME_CHYLOMICRON_MEDIATED_LIPID_TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.3 | REACTOME_P75_NTR_RECEPTOR_MEDIATED_SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.5 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.5 | REACTOME_AMINO_ACID_TRANSPORT_ACROSS_THE_PLASMA_MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.3 | REACTOME_FACILITATIVE_NA_INDEPENDENT_GLUCOSE_TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.5 | REACTOME_SMAD2_SMAD3_SMAD4_HETEROTRIMER_REGULATES_TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.4 | REACTOME_CASPASE_MEDIATED_CLEAVAGE_OF_CYTOSKELETAL_PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
