| 0.3 |
0.9 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.3 |
1.1 |
GO:0060721 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.3 |
0.8 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.2 |
1.2 |
GO:0048749 |
compound eye development(GO:0048749) |
| 0.1 |
0.9 |
GO:0007500 |
mesodermal cell fate determination(GO:0007500) |
| 0.1 |
0.7 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 |
0.9 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 |
0.3 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 |
0.3 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 0.1 |
0.5 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 |
0.3 |
GO:0007037 |
vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.1 |
0.4 |
GO:0006127 |
glycerophosphate shuttle(GO:0006127) |
| 0.1 |
0.4 |
GO:1903347 |
negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.1 |
0.6 |
GO:0060356 |
leucine import(GO:0060356) |
| 0.1 |
0.7 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 |
0.1 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.1 |
0.4 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 |
0.3 |
GO:0009107 |
lipoate biosynthetic process(GO:0009107) |
| 0.1 |
0.3 |
GO:0019747 |
regulation of isoprenoid metabolic process(GO:0019747) |
| 0.1 |
0.9 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 |
0.8 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.0 |
0.1 |
GO:1904899 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.0 |
0.4 |
GO:0039663 |
fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 |
0.1 |
GO:1903570 |
regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 0.0 |
0.1 |
GO:1902559 |
3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.0 |
0.3 |
GO:0009233 |
menaquinone metabolic process(GO:0009233) |
| 0.0 |
0.1 |
GO:1990619 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) positive regulation of chondrocyte proliferation(GO:1902732) histone H3-K9 deacetylation(GO:1990619) |
| 0.0 |
0.1 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.0 |
0.3 |
GO:0002155 |
regulation of thyroid hormone mediated signaling pathway(GO:0002155) kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.0 |
0.2 |
GO:0042412 |
taurine biosynthetic process(GO:0042412) |
| 0.0 |
0.2 |
GO:0043335 |
protein unfolding(GO:0043335) |
| 0.0 |
0.2 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.0 |
0.2 |
GO:0097021 |
lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.0 |
0.1 |
GO:1904116 |
response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.0 |
0.5 |
GO:0002051 |
osteoblast fate commitment(GO:0002051) |
| 0.0 |
0.2 |
GO:0010756 |
positive regulation of plasminogen activation(GO:0010756) |
| 0.0 |
0.2 |
GO:0035802 |
adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
| 0.0 |
0.1 |
GO:0060585 |
vein smooth muscle contraction(GO:0014826) regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.0 |
0.3 |
GO:0035583 |
sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.0 |
0.1 |
GO:0042489 |
negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.0 |
0.3 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.0 |
0.1 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 0.0 |
0.4 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 |
0.1 |
GO:0019230 |
pathogenesis(GO:0009405) proprioception(GO:0019230) |
| 0.0 |
0.2 |
GO:0070358 |
actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 |
0.4 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 |
0.1 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 |
0.2 |
GO:0060339 |
negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.0 |
0.7 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 |
0.1 |
GO:0042986 |
positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.0 |
0.2 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.0 |
0.3 |
GO:0090385 |
phagosome-lysosome fusion(GO:0090385) |
| 0.0 |
0.0 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.0 |
0.1 |
GO:1904978 |
regulation of endosome organization(GO:1904978) |
| 0.0 |
0.0 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.0 |
0.1 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 |
0.1 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 |
0.1 |
GO:1902378 |
vestibulocochlear nerve structural organization(GO:0021649) neuropilin signaling pathway(GO:0038189) VEGF-activated neuropilin signaling pathway(GO:0038190) positive regulation of cytokine activity(GO:0060301) ganglion morphogenesis(GO:0061552) sensory neuron axon guidance(GO:0097374) positive regulation of retinal ganglion cell axon guidance(GO:1902336) VEGF-activated neuropilin signaling pathway involved in axon guidance(GO:1902378) dorsal root ganglion morphogenesis(GO:1904835) otic placode development(GO:1905040) |
| 0.0 |
0.5 |
GO:0006972 |
hyperosmotic response(GO:0006972) |
| 0.0 |
0.2 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 |
0.0 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.0 |
0.1 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.0 |
0.1 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.0 |
0.2 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 |
0.1 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.0 |
0.1 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.0 |
0.1 |
GO:0035279 |
mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 |
0.4 |
GO:0016254 |
preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 |
0.7 |
GO:0045022 |
early endosome to late endosome transport(GO:0045022) |
| 0.0 |
0.0 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 |
0.5 |
GO:0060765 |
regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.0 |
0.1 |
GO:0093001 |
glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.0 |
0.3 |
GO:0039702 |
viral budding via host ESCRT complex(GO:0039702) |
| 0.0 |
0.0 |
GO:0044205 |
'de novo' UMP biosynthetic process(GO:0044205) |
| 0.0 |
0.0 |
GO:1904815 |
negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.0 |
0.1 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 |
0.1 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
