| 0.1 |
0.2 |
GO:1901202 |
negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.1 |
0.2 |
GO:0043181 |
vacuolar sequestering(GO:0043181) |
| 0.1 |
0.2 |
GO:0070429 |
regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) tolerance induction to lipopolysaccharide(GO:0072573) negative regulation of CD40 signaling pathway(GO:2000349) |
| 0.0 |
0.1 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.0 |
0.3 |
GO:0003065 |
positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.0 |
0.2 |
GO:2000569 |
T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.0 |
0.1 |
GO:0090290 |
positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 |
0.2 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 |
0.0 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.1 |
GO:0043328 |
protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 |
0.2 |
GO:0090063 |
positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 |
0.1 |
GO:2001037 |
tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.0 |
0.1 |
GO:0061184 |
Spemann organizer formation(GO:0060061) dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) positive regulation of dermatome development(GO:0061184) |
| 0.0 |
0.2 |
GO:0090258 |
negative regulation of mitochondrial fission(GO:0090258) |
| 0.0 |
0.1 |
GO:1901421 |
positive regulation of response to alcohol(GO:1901421) |
| 0.0 |
0.1 |
GO:0014740 |
negative regulation of muscle hyperplasia(GO:0014740) |
| 0.0 |
0.1 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 |
0.1 |
GO:0018153 |
isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.0 |
0.1 |
GO:1903412 |
response to bile acid(GO:1903412) |
| 0.0 |
0.1 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.0 |
0.1 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.0 |
0.1 |
GO:0009257 |
10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.0 |
0.1 |
GO:2000276 |
negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.0 |
0.1 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.0 |
0.1 |
GO:2000418 |
positive regulation of eosinophil migration(GO:2000418) |
| 0.0 |
0.1 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 |
0.1 |
GO:1904808 |
regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.0 |
0.1 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.0 |
0.0 |
GO:0071529 |
cementum mineralization(GO:0071529) |
| 0.0 |
0.1 |
GO:0016185 |
synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.0 |
0.2 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.0 |
0.1 |
GO:0002384 |
hepatic immune response(GO:0002384) |
| 0.0 |
0.0 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) positive regulation of chromatin assembly or disassembly(GO:0045799) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.0 |
0.1 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.0 |
0.0 |
GO:0002268 |
follicular dendritic cell differentiation(GO:0002268) |
| 0.0 |
0.0 |
GO:0034970 |
histone H3-R2 methylation(GO:0034970) |
| 0.0 |
0.2 |
GO:1901750 |
leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.0 |
0.1 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 |
0.0 |
GO:0018312 |
peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.0 |
0.2 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.0 |
0.1 |
GO:0006226 |
dUMP biosynthetic process(GO:0006226) |
| 0.0 |
0.0 |
GO:0002188 |
translation reinitiation(GO:0002188) |
| 0.0 |
0.0 |
GO:1900104 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 |
0.0 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 |
0.1 |
GO:0060492 |
foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
