| 0.2 |
0.7 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.2 |
0.2 |
GO:0010868 |
negative regulation of triglyceride biosynthetic process(GO:0010868) |
| 0.1 |
0.4 |
GO:0071879 |
positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 |
0.4 |
GO:0061092 |
regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.1 |
0.5 |
GO:1902228 |
mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.1 |
0.6 |
GO:0042415 |
norepinephrine metabolic process(GO:0042415) |
| 0.1 |
0.2 |
GO:1901860 |
positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.1 |
0.2 |
GO:0007506 |
gonadal mesoderm development(GO:0007506) |
| 0.0 |
0.1 |
GO:0001300 |
chronological cell aging(GO:0001300) |
| 0.0 |
0.1 |
GO:0019230 |
pathogenesis(GO:0009405) proprioception(GO:0019230) |
| 0.0 |
0.6 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 |
0.1 |
GO:2000342 |
negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.0 |
0.2 |
GO:0061364 |
apoptotic process involved in luteolysis(GO:0061364) |
| 0.0 |
0.3 |
GO:0035583 |
sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.0 |
0.3 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 |
0.1 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.0 |
0.1 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 |
0.1 |
GO:1902256 |
apoptotic process involved in outflow tract morphogenesis(GO:0003275) atrial septum primum morphogenesis(GO:0003289) uterine wall breakdown(GO:0042704) positive regulation of catagen(GO:0051795) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
| 0.0 |
0.1 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.0 |
0.1 |
GO:1902378 |
vestibulocochlear nerve structural organization(GO:0021649) positive regulation of cytokine activity(GO:0060301) ganglion morphogenesis(GO:0061552) sensory neuron axon guidance(GO:0097374) VEGF-activated neuropilin signaling pathway involved in axon guidance(GO:1902378) dorsal root ganglion morphogenesis(GO:1904835) otic placode development(GO:1905040) |
| 0.0 |
0.1 |
GO:1905098 |
negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.0 |
0.1 |
GO:0002541 |
activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.0 |
0.1 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 |
0.1 |
GO:0033242 |
regulation of cellular amine catabolic process(GO:0033241) negative regulation of cellular amine catabolic process(GO:0033242) negative regulation of adrenergic receptor signaling pathway(GO:0071878) negative regulation of the force of heart contraction(GO:0098736) regulation of arginine catabolic process(GO:1900081) negative regulation of arginine catabolic process(GO:1900082) regulation of adrenergic receptor signaling pathway involved in heart process(GO:1901204) negative regulation of adrenergic receptor signaling pathway involved in heart process(GO:1901205) regulation of citrulline biosynthetic process(GO:1903248) negative regulation of citrulline biosynthetic process(GO:1903249) negative regulation of cellular amino acid biosynthetic process(GO:2000283) |
| 0.0 |
0.2 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.0 |
0.1 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 |
0.4 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.0 |
0.0 |
GO:1990791 |
dorsal root ganglion development(GO:1990791) |
| 0.0 |
0.1 |
GO:0010265 |
SCF complex assembly(GO:0010265) |
| 0.0 |
0.1 |
GO:0006408 |
snRNA export from nucleus(GO:0006408) |
| 0.0 |
0.0 |
GO:0061184 |
Spemann organizer formation(GO:0060061) dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) positive regulation of dermatome development(GO:0061184) |
| 0.0 |
0.4 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 |
0.0 |
GO:0052151 |
positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.0 |
0.1 |
GO:1901908 |
diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.0 |
0.1 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 |
0.2 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 |
0.1 |
GO:0090156 |
cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 |
0.0 |
GO:0035669 |
TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.0 |
0.0 |
GO:0098972 |
dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
| 0.0 |
0.2 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 |
0.1 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
