| 0.1 |
0.5 |
GO:1990926 |
short-term synaptic potentiation(GO:1990926) |
| 0.1 |
0.1 |
GO:0010868 |
negative regulation of triglyceride biosynthetic process(GO:0010868) |
| 0.1 |
0.4 |
GO:1900248 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 |
0.3 |
GO:0071879 |
positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 |
0.5 |
GO:1902228 |
mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.1 |
0.3 |
GO:0007506 |
gonadal mesoderm development(GO:0007506) |
| 0.1 |
0.6 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 |
0.2 |
GO:0044313 |
protein K6-linked deubiquitination(GO:0044313) |
| 0.0 |
0.1 |
GO:0003289 |
atrial septum primum morphogenesis(GO:0003289) |
| 0.0 |
0.2 |
GO:0010652 |
regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) |
| 0.0 |
0.2 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.0 |
0.1 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.0 |
0.1 |
GO:0019230 |
pathogenesis(GO:0009405) proprioception(GO:0019230) |
| 0.0 |
0.1 |
GO:0033319 |
UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.0 |
0.1 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) otic placode formation(GO:0043049) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 0.0 |
0.0 |
GO:0060599 |
lateral sprouting involved in mammary gland duct morphogenesis(GO:0060599) |
| 0.0 |
0.1 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 |
0.1 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 0.0 |
0.4 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 |
0.1 |
GO:1905075 |
occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.0 |
0.1 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 |
0.2 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 |
0.2 |
GO:1905098 |
negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.0 |
0.1 |
GO:0061364 |
apoptotic process involved in luteolysis(GO:0061364) |
| 0.0 |
0.1 |
GO:0060574 |
intestinal epithelial cell maturation(GO:0060574) |
| 0.0 |
0.1 |
GO:0090427 |
regulation of fertilization(GO:0080154) activation of meiosis(GO:0090427) |
| 0.0 |
0.2 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.0 |
0.2 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 |
0.1 |
GO:0061386 |
closure of optic fissure(GO:0061386) |
| 0.0 |
0.2 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 |
0.2 |
GO:0060087 |
relaxation of vascular smooth muscle(GO:0060087) |
| 0.0 |
0.1 |
GO:1902378 |
vestibulocochlear nerve structural organization(GO:0021649) positive regulation of cytokine activity(GO:0060301) ganglion morphogenesis(GO:0061552) sensory neuron axon guidance(GO:0097374) VEGF-activated neuropilin signaling pathway involved in axon guidance(GO:1902378) dorsal root ganglion morphogenesis(GO:1904835) otic placode development(GO:1905040) |
| 0.0 |
0.2 |
GO:0060029 |
convergent extension involved in organogenesis(GO:0060029) |
| 0.0 |
0.1 |
GO:0060613 |
fat pad development(GO:0060613) |
| 0.0 |
0.1 |
GO:0032487 |
regulation of Rap protein signal transduction(GO:0032487) |
| 0.0 |
0.3 |
GO:0044320 |
cellular response to leptin stimulus(GO:0044320) |
| 0.0 |
0.3 |
GO:0072178 |
nephric duct morphogenesis(GO:0072178) |
| 0.0 |
0.0 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 |
0.1 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.0 |
0.1 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 |
0.0 |
GO:1903031 |
regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.0 |
0.2 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 |
0.0 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 |
0.0 |
GO:0061184 |
Spemann organizer formation(GO:0060061) dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) positive regulation of dermatome development(GO:0061184) |
| 0.0 |
0.0 |
GO:0044335 |
external genitalia morphogenesis(GO:0035261) canonical Wnt signaling pathway involved in neural crest cell differentiation(GO:0044335) |
| 0.0 |
0.5 |
GO:0071625 |
vocalization behavior(GO:0071625) |
| 0.0 |
0.0 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
0.1 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.0 |
0.1 |
GO:0070649 |
polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.0 |
0.0 |
GO:0035624 |
receptor transactivation(GO:0035624) |
| 0.0 |
0.1 |
GO:2000795 |
negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.0 |
0.0 |
GO:0072025 |
distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) |
| 0.0 |
0.2 |
GO:1904322 |
response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 |
0.0 |
GO:0021603 |
cranial nerve formation(GO:0021603) |
| 0.0 |
0.0 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 |
0.0 |
GO:0009138 |
pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.0 |
0.1 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
