| 0.1 |
0.2 |
GO:0090427 |
activation of meiosis(GO:0090427) |
| 0.1 |
0.2 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 |
0.3 |
GO:1900248 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 |
0.2 |
GO:1905246 |
regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.1 |
0.2 |
GO:0060721 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.1 |
0.3 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 |
0.2 |
GO:0010652 |
regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) |
| 0.0 |
0.2 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 |
0.7 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.0 |
0.1 |
GO:0071879 |
positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.0 |
0.1 |
GO:0045210 |
FasL biosynthetic process(GO:0045210) |
| 0.0 |
0.1 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) otic placode formation(GO:0043049) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 0.0 |
0.1 |
GO:0008050 |
female courtship behavior(GO:0008050) |
| 0.0 |
0.4 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 |
0.2 |
GO:0035583 |
sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.0 |
0.0 |
GO:0033024 |
mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.0 |
0.1 |
GO:0097069 |
cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 0.0 |
0.1 |
GO:0061343 |
cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.0 |
0.1 |
GO:0061364 |
apoptotic process involved in luteolysis(GO:0061364) |
| 0.0 |
0.1 |
GO:1905075 |
positive regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905007) occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.0 |
0.1 |
GO:0021718 |
superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.0 |
0.1 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 0.0 |
0.3 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 |
0.1 |
GO:0036333 |
hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.0 |
0.1 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.0 |
0.1 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 |
0.1 |
GO:0071409 |
cellular response to cycloheximide(GO:0071409) |
| 0.0 |
0.1 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 |
0.1 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 |
0.1 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.0 |
0.1 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 |
0.1 |
GO:1900020 |
regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 |
0.1 |
GO:0048294 |
negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.0 |
0.2 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 |
0.0 |
GO:0003408 |
optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 |
0.0 |
GO:0019230 |
pathogenesis(GO:0009405) proprioception(GO:0019230) |
| 0.0 |
0.0 |
GO:0097359 |
UDP-glucosylation(GO:0097359) |
| 0.0 |
0.1 |
GO:0003402 |
planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.0 |
0.0 |
GO:0046619 |
optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.0 |
0.1 |
GO:1900245 |
positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 |
0.1 |
GO:0002071 |
glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
| 0.0 |
0.1 |
GO:0090206 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 |
0.1 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.0 |
0.1 |
GO:2000795 |
negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.0 |
0.1 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
