| 0.2 |
0.5 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 |
0.2 |
GO:1905246 |
regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.1 |
0.3 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.1 |
0.2 |
GO:2000312 |
regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 |
0.1 |
GO:0070309 |
lens fiber cell morphogenesis(GO:0070309) |
| 0.0 |
0.3 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 |
0.1 |
GO:1990709 |
presynaptic active zone organization(GO:1990709) |
| 0.0 |
0.1 |
GO:0060061 |
Spemann organizer formation(GO:0060061) |
| 0.0 |
0.3 |
GO:0015811 |
L-cystine transport(GO:0015811) |
| 0.0 |
0.3 |
GO:0086048 |
membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.0 |
0.2 |
GO:0060214 |
endocardium formation(GO:0060214) |
| 0.0 |
0.2 |
GO:0032912 |
negative regulation of transforming growth factor beta2 production(GO:0032912) |
| 0.0 |
0.1 |
GO:0061075 |
regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.0 |
0.1 |
GO:0090427 |
regulation of fertilization(GO:0080154) activation of meiosis(GO:0090427) |
| 0.0 |
0.1 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.0 |
0.1 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.0 |
0.2 |
GO:0003430 |
growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.0 |
0.1 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.0 |
0.1 |
GO:0021526 |
medial motor column neuron differentiation(GO:0021526) |
| 0.0 |
0.1 |
GO:0032223 |
negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.0 |
0.3 |
GO:0045964 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.0 |
0.1 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.0 |
0.1 |
GO:1903410 |
lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.0 |
0.0 |
GO:1901503 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.0 |
0.3 |
GO:1904352 |
positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.0 |
0.1 |
GO:0008050 |
female courtship behavior(GO:0008050) |
| 0.0 |
0.1 |
GO:0097156 |
fasciculation of motor neuron axon(GO:0097156) |
| 0.0 |
0.0 |
GO:0046619 |
optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.0 |
0.1 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 |
0.1 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.0 |
0.3 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.0 |
0.1 |
GO:0072709 |
cellular response to sorbitol(GO:0072709) |
| 0.0 |
0.1 |
GO:1904798 |
positive regulation of core promoter binding(GO:1904798) negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.0 |
0.2 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.0 |
0.1 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 |
0.1 |
GO:1904761 |
negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.0 |
0.1 |
GO:0090031 |
positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.0 |
0.1 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 |
0.3 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 |
0.0 |
GO:0060979 |
vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.0 |
0.2 |
GO:0042492 |
gamma-delta T cell differentiation(GO:0042492) |
| 0.0 |
0.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.1 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.0 |
0.0 |
GO:1904294 |
positive regulation of ERAD pathway(GO:1904294) |
| 0.0 |
0.1 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 |
0.1 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.0 |
0.1 |
GO:0006127 |
glycerophosphate shuttle(GO:0006127) |
| 0.0 |
0.3 |
GO:1902285 |
semaphorin-plexin signaling pathway involved in neuron projection guidance(GO:1902285) |
| 0.0 |
0.0 |
GO:0051780 |
mevalonate transport(GO:0015728) behavioral response to nutrient(GO:0051780) |
| 0.0 |
0.0 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 0.0 |
0.1 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 |
0.1 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.0 |
0.1 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 |
0.3 |
GO:0006853 |
carnitine shuttle(GO:0006853) |
| 0.0 |
0.0 |
GO:0032290 |
peripheral nervous system myelin formation(GO:0032290) |
| 0.0 |
0.0 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.0 |
0.1 |
GO:1903593 |
regulation of histamine secretion by mast cell(GO:1903593) |
| 0.0 |
0.0 |
GO:0048294 |
negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.0 |
0.1 |
GO:0003263 |
cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
| 0.0 |
0.3 |
GO:0032354 |
response to follicle-stimulating hormone(GO:0032354) |
| 0.0 |
0.1 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.0 |
0.1 |
GO:0010459 |
negative regulation of heart rate(GO:0010459) |
| 0.0 |
0.1 |
GO:0034436 |
glycoprotein transport(GO:0034436) |
| 0.0 |
0.2 |
GO:0060087 |
relaxation of vascular smooth muscle(GO:0060087) |
| 0.0 |
0.1 |
GO:1903903 |
regulation of establishment of T cell polarity(GO:1903903) |
| 0.0 |
0.1 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.0 |
0.1 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 |
0.2 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 |
0.0 |
GO:0005988 |
lactose metabolic process(GO:0005988) lactose biosynthetic process(GO:0005989) positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.0 |
0.0 |
GO:0036333 |
hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.0 |
0.1 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.0 |
0.0 |
GO:0048250 |
mitochondrial iron ion transport(GO:0048250) |
| 0.0 |
0.0 |
GO:0060147 |
regulation of posttranscriptional gene silencing(GO:0060147) regulation of gene silencing by miRNA(GO:0060964) regulation of gene silencing by RNA(GO:0060966) |
| 0.0 |
0.1 |
GO:0060431 |
primary lung bud formation(GO:0060431) |
| 0.0 |
0.1 |
GO:0051611 |
negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
