| 5.4 |
16.3 |
GO:0015891 |
iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 4.0 |
12.1 |
GO:0071629 |
cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 3.1 |
9.4 |
GO:2000657 |
regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
| 2.3 |
7.0 |
GO:0090340 |
positive regulation of high-density lipoprotein particle assembly(GO:0090108) positive regulation of pancreatic juice secretion(GO:0090187) positive regulation of secretion of lysosomal enzymes(GO:0090340) |
| 2.3 |
9.1 |
GO:0006535 |
cysteine biosynthetic process from serine(GO:0006535) |
| 2.1 |
6.2 |
GO:1902463 |
protein localization to cell leading edge(GO:1902463) |
| 2.0 |
5.9 |
GO:1905000 |
regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 2.0 |
5.9 |
GO:0038193 |
thromboxane A2 signaling pathway(GO:0038193) |
| 2.0 |
7.8 |
GO:0072287 |
metanephric distal tubule morphogenesis(GO:0072287) |
| 1.9 |
7.4 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 1.8 |
1.8 |
GO:0072053 |
renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 1.8 |
14.5 |
GO:0038195 |
urokinase plasminogen activator signaling pathway(GO:0038195) |
| 1.8 |
7.2 |
GO:0036483 |
neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 1.7 |
7.0 |
GO:0002432 |
granuloma formation(GO:0002432) |
| 1.7 |
6.9 |
GO:0009183 |
purine deoxyribonucleoside diphosphate biosynthetic process(GO:0009183) |
| 1.7 |
6.7 |
GO:0098968 |
neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 1.6 |
4.9 |
GO:1903461 |
Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 1.6 |
7.8 |
GO:0001306 |
age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 1.6 |
4.7 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 1.5 |
6.1 |
GO:0002268 |
follicular dendritic cell differentiation(GO:0002268) |
| 1.5 |
4.4 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 1.5 |
4.4 |
GO:0050823 |
peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 1.5 |
5.9 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 1.4 |
1.4 |
GO:0032808 |
lacrimal gland development(GO:0032808) |
| 1.4 |
7.0 |
GO:0044501 |
modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 1.4 |
8.4 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 1.4 |
9.7 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 1.4 |
9.7 |
GO:0071603 |
endothelial cell-cell adhesion(GO:0071603) |
| 1.4 |
5.4 |
GO:0098838 |
reduced folate transmembrane transport(GO:0098838) |
| 1.3 |
7.9 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 1.3 |
7.9 |
GO:0043163 |
cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 1.3 |
5.2 |
GO:0071348 |
cellular response to interleukin-11(GO:0071348) |
| 1.3 |
3.9 |
GO:2000588 |
positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 1.3 |
5.1 |
GO:2000342 |
negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 1.3 |
3.8 |
GO:0003192 |
mitral valve formation(GO:0003192) |
| 1.3 |
1.3 |
GO:0010482 |
epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 1.2 |
3.7 |
GO:2000625 |
regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
| 1.2 |
1.2 |
GO:0090311 |
regulation of protein deacetylation(GO:0090311) |
| 1.2 |
3.6 |
GO:2000564 |
CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 1.2 |
3.6 |
GO:0045994 |
positive regulation of translational initiation by iron(GO:0045994) |
| 1.2 |
7.2 |
GO:1900245 |
positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 1.2 |
4.8 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.2 |
4.7 |
GO:0001560 |
regulation of cell growth by extracellular stimulus(GO:0001560) |
| 1.2 |
15.0 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 1.2 |
3.5 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 1.1 |
4.5 |
GO:0000412 |
histone peptidyl-prolyl isomerization(GO:0000412) |
| 1.1 |
7.9 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 1.1 |
4.4 |
GO:1904398 |
positive regulation of neuromuscular junction development(GO:1904398) |
| 1.1 |
3.3 |
GO:0060381 |
regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 1.1 |
5.4 |
GO:0009439 |
cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 1.1 |
3.2 |
GO:0006117 |
acetaldehyde metabolic process(GO:0006117) |
| 1.1 |
6.4 |
GO:0090034 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 1.1 |
2.1 |
GO:0014046 |
dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 1.1 |
3.2 |
GO:0035283 |
central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 1.1 |
3.2 |
GO:1903926 |
signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 1.1 |
7.4 |
GO:0045079 |
negative regulation of chemokine biosynthetic process(GO:0045079) |
| 1.1 |
1.1 |
GO:0071421 |
manganese ion transmembrane transport(GO:0071421) |
| 1.0 |
4.2 |
GO:0014022 |
neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 1.0 |
3.1 |
GO:0034343 |
type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 1.0 |
3.1 |
GO:0097114 |
NMDA glutamate receptor clustering(GO:0097114) |
| 1.0 |
2.0 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 1.0 |
2.0 |
GO:2001184 |
positive regulation of interleukin-12 secretion(GO:2001184) |
| 1.0 |
6.9 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 1.0 |
5.0 |
GO:0000738 |
DNA catabolic process, exonucleolytic(GO:0000738) |
| 1.0 |
7.9 |
GO:0045007 |
depurination(GO:0045007) |
| 1.0 |
8.6 |
GO:0006049 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.9 |
10.4 |
GO:0045078 |
positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.9 |
3.8 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.9 |
2.8 |
GO:0019516 |
lactate oxidation(GO:0019516) |
| 0.9 |
3.7 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.9 |
2.8 |
GO:0001743 |
optic placode formation(GO:0001743) |
| 0.9 |
2.8 |
GO:0046901 |
tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.9 |
0.9 |
GO:0043317 |
regulation of cytotoxic T cell degranulation(GO:0043317) negative regulation of cytotoxic T cell degranulation(GO:0043318) |
| 0.9 |
4.6 |
GO:0035105 |
sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.9 |
0.9 |
GO:0002042 |
cell migration involved in sprouting angiogenesis(GO:0002042) |
| 0.9 |
3.6 |
GO:1903721 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.9 |
10.0 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.9 |
4.5 |
GO:0035063 |
nuclear speck organization(GO:0035063) |
| 0.9 |
3.5 |
GO:0002316 |
follicular B cell differentiation(GO:0002316) |
| 0.9 |
2.6 |
GO:1905166 |
negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 0.9 |
2.6 |
GO:0052151 |
positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.9 |
3.5 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.9 |
2.6 |
GO:2001037 |
tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.9 |
2.6 |
GO:0060721 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.8 |
0.8 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.8 |
2.5 |
GO:0015729 |
thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.8 |
4.2 |
GO:0015817 |
histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
| 0.8 |
6.5 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.8 |
0.8 |
GO:0008612 |
peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.8 |
4.8 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.8 |
0.8 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.8 |
3.1 |
GO:1903691 |
positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.8 |
1.5 |
GO:0060425 |
lung morphogenesis(GO:0060425) |
| 0.8 |
1.5 |
GO:0032185 |
septin cytoskeleton organization(GO:0032185) |
| 0.8 |
4.6 |
GO:0010512 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.8 |
2.3 |
GO:0030806 |
negative regulation of cyclic nucleotide catabolic process(GO:0030806) negative regulation of cAMP catabolic process(GO:0030821) negative regulation of purine nucleotide catabolic process(GO:0033122) regulation of ERK5 cascade(GO:0070376) negative regulation of ERK5 cascade(GO:0070377) |
| 0.8 |
12.2 |
GO:0006183 |
GTP biosynthetic process(GO:0006183) |
| 0.8 |
5.3 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.8 |
0.8 |
GO:0098907 |
regulation of SA node cell action potential(GO:0098907) |
| 0.8 |
3.8 |
GO:1904844 |
response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.7 |
2.9 |
GO:2001178 |
mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.7 |
11.0 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.7 |
4.3 |
GO:0002159 |
desmosome assembly(GO:0002159) |
| 0.7 |
6.4 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.7 |
2.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.7 |
5.7 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.7 |
0.7 |
GO:0046710 |
GDP metabolic process(GO:0046710) |
| 0.7 |
4.9 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.7 |
3.5 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.7 |
2.1 |
GO:0070902 |
mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.7 |
2.1 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.7 |
2.8 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.7 |
4.1 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.7 |
2.1 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.7 |
3.4 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.7 |
4.1 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.7 |
10.0 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.7 |
0.7 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.7 |
2.7 |
GO:0099640 |
axo-dendritic protein transport(GO:0099640) |
| 0.7 |
2.0 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.7 |
4.6 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) |
| 0.7 |
3.3 |
GO:0060268 |
negative regulation of respiratory burst(GO:0060268) |
| 0.7 |
2.0 |
GO:0032581 |
ER-dependent peroxisome organization(GO:0032581) |
| 0.7 |
5.2 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.6 |
0.6 |
GO:0048754 |
branching morphogenesis of an epithelial tube(GO:0048754) |
| 0.6 |
3.9 |
GO:0015887 |
biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 0.6 |
4.5 |
GO:0035879 |
plasma membrane lactate transport(GO:0035879) |
| 0.6 |
14.8 |
GO:0016024 |
CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.6 |
1.9 |
GO:0042660 |
positive regulation of cell fate specification(GO:0042660) |
| 0.6 |
1.9 |
GO:0032679 |
TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) TRAIL biosynthetic process(GO:0045553) regulation of TRAIL biosynthetic process(GO:0045554) positive regulation of TRAIL biosynthetic process(GO:0045556) |
| 0.6 |
3.8 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.6 |
0.6 |
GO:0090107 |
regulation of high-density lipoprotein particle assembly(GO:0090107) |
| 0.6 |
0.6 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.6 |
1.3 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.6 |
23.2 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.6 |
1.3 |
GO:0048170 |
positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.6 |
1.9 |
GO:2001033 |
negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.6 |
4.3 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.6 |
3.1 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 0.6 |
3.1 |
GO:0050668 |
cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.6 |
4.3 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.6 |
3.0 |
GO:0008295 |
spermidine biosynthetic process(GO:0008295) |
| 0.6 |
2.4 |
GO:2000182 |
regulation of progesterone biosynthetic process(GO:2000182) |
| 0.6 |
0.6 |
GO:1902954 |
regulation of early endosome to recycling endosome transport(GO:1902954) |
| 0.6 |
1.8 |
GO:0007185 |
transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.6 |
2.4 |
GO:1990569 |
UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.6 |
2.4 |
GO:0060374 |
mast cell differentiation(GO:0060374) |
| 0.6 |
0.6 |
GO:0046351 |
disaccharide biosynthetic process(GO:0046351) |
| 0.6 |
2.9 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.6 |
0.6 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.6 |
4.0 |
GO:0090625 |
mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.6 |
0.6 |
GO:1904397 |
regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) negative regulation of neuromuscular junction development(GO:1904397) |
| 0.6 |
1.7 |
GO:0018194 |
N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.6 |
13.7 |
GO:0042635 |
positive regulation of hair cycle(GO:0042635) |
| 0.6 |
1.7 |
GO:0031247 |
actin rod assembly(GO:0031247) |
| 0.6 |
2.3 |
GO:0018262 |
isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.6 |
1.7 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.6 |
0.6 |
GO:0003193 |
pulmonary valve formation(GO:0003193) foramen ovale closure(GO:0035922) |
| 0.6 |
4.5 |
GO:2000857 |
positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.6 |
6.7 |
GO:0036486 |
trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
| 0.6 |
2.2 |
GO:0090410 |
malonate catabolic process(GO:0090410) |
| 0.6 |
0.6 |
GO:1904294 |
positive regulation of ERAD pathway(GO:1904294) |
| 0.6 |
2.2 |
GO:0046338 |
phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.5 |
2.2 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.5 |
2.2 |
GO:1903939 |
regulation of TORC2 signaling(GO:1903939) |
| 0.5 |
1.6 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.5 |
2.2 |
GO:0006218 |
uridine catabolic process(GO:0006218) |
| 0.5 |
1.1 |
GO:0006987 |
activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.5 |
2.2 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.5 |
0.5 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.5 |
3.2 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.5 |
2.1 |
GO:1902723 |
negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.5 |
1.6 |
GO:0034970 |
histone H3-R2 methylation(GO:0034970) |
| 0.5 |
2.7 |
GO:0019242 |
methylglyoxal biosynthetic process(GO:0019242) |
| 0.5 |
3.7 |
GO:0055129 |
L-proline biosynthetic process(GO:0055129) |
| 0.5 |
3.2 |
GO:0034154 |
toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.5 |
0.5 |
GO:0003197 |
endocardial cushion development(GO:0003197) |
| 0.5 |
2.1 |
GO:0038089 |
positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.5 |
0.5 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.5 |
3.1 |
GO:0030037 |
actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.5 |
3.1 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.5 |
1.0 |
GO:0036146 |
cellular response to mycotoxin(GO:0036146) |
| 0.5 |
3.1 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.5 |
2.0 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.5 |
3.6 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.5 |
2.5 |
GO:0070346 |
positive regulation of fat cell proliferation(GO:0070346) |
| 0.5 |
1.5 |
GO:0042450 |
arginine biosynthetic process via ornithine(GO:0042450) |
| 0.5 |
10.0 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.5 |
1.0 |
GO:0035385 |
Roundabout signaling pathway(GO:0035385) |
| 0.5 |
5.0 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.5 |
4.0 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.5 |
1.5 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.5 |
1.0 |
GO:0080120 |
CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.5 |
1.0 |
GO:0051958 |
methotrexate transport(GO:0051958) |
| 0.5 |
3.9 |
GO:0009794 |
regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.5 |
2.9 |
GO:0042494 |
detection of bacterial lipoprotein(GO:0042494) |
| 0.5 |
1.5 |
GO:0046521 |
sphingoid catabolic process(GO:0046521) |
| 0.5 |
1.0 |
GO:0010621 |
negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.5 |
1.9 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.5 |
7.2 |
GO:0060180 |
female mating behavior(GO:0060180) |
| 0.5 |
1.4 |
GO:0010701 |
positive regulation of norepinephrine secretion(GO:0010701) |
| 0.5 |
1.4 |
GO:0007019 |
microtubule depolymerization(GO:0007019) |
| 0.5 |
1.9 |
GO:0060947 |
cardiac vascular smooth muscle cell differentiation(GO:0060947) |
| 0.5 |
1.4 |
GO:0048250 |
mitochondrial iron ion transport(GO:0048250) |
| 0.5 |
0.5 |
GO:0071332 |
cellular response to fructose stimulus(GO:0071332) |
| 0.5 |
3.8 |
GO:0090336 |
positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.5 |
1.9 |
GO:0033564 |
anterior/posterior axon guidance(GO:0033564) |
| 0.5 |
2.3 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.5 |
0.9 |
GO:0032796 |
uropod organization(GO:0032796) |
| 0.5 |
1.9 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.5 |
1.4 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.5 |
8.3 |
GO:0021819 |
layer formation in cerebral cortex(GO:0021819) |
| 0.5 |
5.0 |
GO:0035897 |
proteolysis in other organism(GO:0035897) |
| 0.5 |
4.6 |
GO:0032329 |
serine transport(GO:0032329) |
| 0.5 |
1.8 |
GO:0035279 |
mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.5 |
1.8 |
GO:0090202 |
transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.5 |
2.3 |
GO:0015783 |
GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.5 |
1.4 |
GO:0034164 |
negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.4 |
2.7 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.4 |
1.3 |
GO:0046586 |
regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.4 |
1.3 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.4 |
4.4 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.4 |
1.8 |
GO:1905045 |
Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
| 0.4 |
2.2 |
GO:0030311 |
poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.4 |
2.2 |
GO:0003430 |
growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.4 |
2.6 |
GO:0033152 |
immunoglobulin V(D)J recombination(GO:0033152) |
| 0.4 |
1.3 |
GO:0070407 |
oxidation-dependent protein catabolic process(GO:0070407) |
| 0.4 |
1.7 |
GO:0090402 |
oncogene-induced cell senescence(GO:0090402) |
| 0.4 |
10.0 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.4 |
3.0 |
GO:0001712 |
ectodermal cell fate commitment(GO:0001712) |
| 0.4 |
1.3 |
GO:0060697 |
positive regulation of phospholipid catabolic process(GO:0060697) |
| 0.4 |
4.8 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.4 |
3.0 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.4 |
1.7 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.4 |
3.4 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.4 |
1.3 |
GO:1902396 |
protein localization to bicellular tight junction(GO:1902396) |
| 0.4 |
2.1 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.4 |
0.4 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 0.4 |
1.3 |
GO:0060988 |
lipid tube assembly(GO:0060988) |
| 0.4 |
0.8 |
GO:0070781 |
response to biotin(GO:0070781) |
| 0.4 |
1.3 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.4 |
3.8 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.4 |
2.9 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.4 |
2.5 |
GO:0070981 |
L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.4 |
2.5 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.4 |
2.5 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.4 |
15.0 |
GO:0071526 |
semaphorin-plexin signaling pathway(GO:0071526) |
| 0.4 |
1.2 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.4 |
0.4 |
GO:2001183 |
negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.4 |
3.3 |
GO:1990668 |
vesicle fusion with endoplasmic reticulum-Golgi intermediate compartment (ERGIC) membrane(GO:1990668) |
| 0.4 |
0.4 |
GO:0061357 |
positive regulation of Wnt protein secretion(GO:0061357) |
| 0.4 |
0.4 |
GO:2000646 |
positive regulation of receptor catabolic process(GO:2000646) |
| 0.4 |
1.2 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.4 |
2.4 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.4 |
0.4 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.4 |
1.6 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.4 |
1.2 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.4 |
0.4 |
GO:1903862 |
positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.4 |
1.6 |
GO:0070426 |
positive regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070426) positive regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070434) |
| 0.4 |
0.8 |
GO:1904862 |
inhibitory synapse assembly(GO:1904862) |
| 0.4 |
3.2 |
GO:0046618 |
drug export(GO:0046618) |
| 0.4 |
2.0 |
GO:0032479 |
regulation of type I interferon production(GO:0032479) |
| 0.4 |
2.0 |
GO:0009609 |
response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 0.4 |
2.4 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.4 |
2.8 |
GO:0045059 |
positive thymic T cell selection(GO:0045059) |
| 0.4 |
0.4 |
GO:1903984 |
regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.4 |
0.8 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.4 |
3.9 |
GO:0021891 |
olfactory bulb interneuron development(GO:0021891) |
| 0.4 |
2.0 |
GO:2000341 |
regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000341) positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.4 |
5.5 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.4 |
0.8 |
GO:1990926 |
short-term synaptic potentiation(GO:1990926) |
| 0.4 |
4.7 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.4 |
0.4 |
GO:1903903 |
regulation of establishment of T cell polarity(GO:1903903) |
| 0.4 |
2.7 |
GO:0035986 |
senescence-associated heterochromatin focus assembly(GO:0035986) |
| 0.4 |
1.1 |
GO:2000118 |
regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.4 |
0.8 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.4 |
2.3 |
GO:1902499 |
positive regulation of protein autoubiquitination(GO:1902499) |
| 0.4 |
3.0 |
GO:0071802 |
negative regulation of podosome assembly(GO:0071802) |
| 0.4 |
1.1 |
GO:0072011 |
glomerular endothelium development(GO:0072011) |
| 0.4 |
2.3 |
GO:0003404 |
optic vesicle morphogenesis(GO:0003404) |
| 0.4 |
1.9 |
GO:1902669 |
positive regulation of axon guidance(GO:1902669) |
| 0.4 |
1.1 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.4 |
1.5 |
GO:0072334 |
UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.4 |
1.1 |
GO:0070245 |
positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.4 |
6.8 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.4 |
1.1 |
GO:0001579 |
medium-chain fatty acid transport(GO:0001579) |
| 0.4 |
3.3 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.4 |
1.1 |
GO:0090598 |
male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.4 |
1.8 |
GO:1902661 |
positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.4 |
1.8 |
GO:0010716 |
negative regulation of extracellular matrix disassembly(GO:0010716) |
| 0.4 |
1.8 |
GO:0038098 |
sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.4 |
1.1 |
GO:0010725 |
regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.4 |
8.1 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.4 |
1.5 |
GO:0042631 |
cellular response to water deprivation(GO:0042631) |
| 0.4 |
4.4 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.4 |
0.7 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.4 |
0.7 |
GO:0010877 |
lipid transport involved in lipid storage(GO:0010877) |
| 0.4 |
1.1 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.4 |
0.7 |
GO:0031627 |
telomeric loop formation(GO:0031627) |
| 0.4 |
1.1 |
GO:2001247 |
positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 0.4 |
3.2 |
GO:0042758 |
long-chain fatty acid catabolic process(GO:0042758) |
| 0.4 |
1.1 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.4 |
3.5 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.4 |
0.4 |
GO:0046340 |
diacylglycerol catabolic process(GO:0046340) |
| 0.4 |
0.4 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.4 |
0.4 |
GO:0021855 |
hypothalamus cell migration(GO:0021855) |
| 0.4 |
1.1 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 0.4 |
2.1 |
GO:0035771 |
interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.4 |
2.8 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.3 |
0.3 |
GO:0045210 |
FasL biosynthetic process(GO:0045210) |
| 0.3 |
0.7 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.3 |
1.4 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.3 |
1.0 |
GO:1903401 |
L-lysine transmembrane transport(GO:1903401) |
| 0.3 |
1.4 |
GO:0033591 |
response to L-ascorbic acid(GO:0033591) |
| 0.3 |
9.5 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.3 |
4.0 |
GO:0070586 |
cell-cell adhesion involved in gastrulation(GO:0070586) |
| 0.3 |
1.7 |
GO:0031959 |
mineralocorticoid receptor signaling pathway(GO:0031959) |
| 0.3 |
0.3 |
GO:0050717 |
positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.3 |
1.0 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.3 |
2.0 |
GO:1904431 |
positive regulation of t-circle formation(GO:1904431) |
| 0.3 |
4.7 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.3 |
0.3 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.3 |
1.3 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.3 |
2.0 |
GO:0070295 |
renal water absorption(GO:0070295) |
| 0.3 |
0.3 |
GO:0098905 |
regulation of bundle of His cell action potential(GO:0098905) |
| 0.3 |
2.3 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.3 |
2.0 |
GO:0043128 |
regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.3 |
1.6 |
GO:0045073 |
regulation of chemokine biosynthetic process(GO:0045073) positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.3 |
1.3 |
GO:0060178 |
regulation of exocyst assembly(GO:0001928) regulation of exocyst localization(GO:0060178) |
| 0.3 |
2.0 |
GO:0046985 |
positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.3 |
1.3 |
GO:0019046 |
release from viral latency(GO:0019046) |
| 0.3 |
1.6 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.3 |
1.0 |
GO:0070221 |
sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.3 |
1.9 |
GO:0036343 |
psychomotor behavior(GO:0036343) |
| 0.3 |
1.9 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.3 |
17.6 |
GO:0050650 |
chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.3 |
6.1 |
GO:0043097 |
pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.3 |
8.3 |
GO:2000188 |
regulation of cholesterol homeostasis(GO:2000188) |
| 0.3 |
1.6 |
GO:0071477 |
hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.3 |
3.2 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 |
1.6 |
GO:0019427 |
acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.3 |
4.1 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.3 |
1.6 |
GO:0060154 |
cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.3 |
2.5 |
GO:0048295 |
positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.3 |
0.6 |
GO:0035407 |
histone H3-T11 phosphorylation(GO:0035407) |
| 0.3 |
0.3 |
GO:0021769 |
orbitofrontal cortex development(GO:0021769) |
| 0.3 |
2.8 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.3 |
0.9 |
GO:0031117 |
positive regulation of microtubule depolymerization(GO:0031117) |
| 0.3 |
0.9 |
GO:0070235 |
regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.3 |
8.1 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.3 |
0.9 |
GO:0070676 |
intralumenal vesicle formation(GO:0070676) |
| 0.3 |
0.6 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 0.3 |
0.6 |
GO:0010046 |
response to mycotoxin(GO:0010046) |
| 0.3 |
1.9 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.3 |
1.2 |
GO:0072186 |
metanephric cap development(GO:0072185) metanephric cap morphogenesis(GO:0072186) metanephric cap mesenchymal cell proliferation involved in metanephros development(GO:0090094) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 0.3 |
0.6 |
GO:0035546 |
interferon-beta secretion(GO:0035546) regulation of interferon-beta secretion(GO:0035547) positive regulation of interferon-beta secretion(GO:0035549) |
| 0.3 |
3.0 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.3 |
8.5 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.3 |
3.3 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.3 |
5.8 |
GO:0071468 |
cellular response to acidic pH(GO:0071468) |
| 0.3 |
0.3 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.3 |
2.1 |
GO:0048845 |
venous blood vessel morphogenesis(GO:0048845) |
| 0.3 |
3.6 |
GO:1904153 |
negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.3 |
1.2 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.3 |
1.5 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.3 |
1.5 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.3 |
2.1 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.3 |
0.6 |
GO:1900239 |
phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.3 |
1.5 |
GO:1902534 |
single-organism membrane invagination(GO:1902534) |
| 0.3 |
1.2 |
GO:0010133 |
proline catabolic process to glutamate(GO:0010133) |
| 0.3 |
1.2 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.3 |
2.0 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.3 |
0.9 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.3 |
1.4 |
GO:1903361 |
protein localization to basolateral plasma membrane(GO:1903361) |
| 0.3 |
0.9 |
GO:1904617 |
negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.3 |
1.1 |
GO:0003335 |
corneocyte development(GO:0003335) |
| 0.3 |
0.6 |
GO:0034983 |
peptidyl-lysine deacetylation(GO:0034983) |
| 0.3 |
0.3 |
GO:2000777 |
positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.3 |
1.4 |
GO:0046958 |
nonassociative learning(GO:0046958) |
| 0.3 |
0.8 |
GO:1903762 |
positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
| 0.3 |
1.4 |
GO:0034755 |
iron ion transmembrane transport(GO:0034755) |
| 0.3 |
0.8 |
GO:0021538 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.3 |
3.9 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.3 |
0.8 |
GO:0035811 |
negative regulation of urine volume(GO:0035811) |
| 0.3 |
0.6 |
GO:0033081 |
regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.3 |
6.1 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.3 |
1.1 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.3 |
0.3 |
GO:0090186 |
regulation of pancreatic juice secretion(GO:0090186) |
| 0.3 |
1.9 |
GO:0031507 |
heterochromatin assembly(GO:0031507) |
| 0.3 |
3.0 |
GO:0061469 |
regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.3 |
0.5 |
GO:0072244 |
metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.3 |
2.4 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.3 |
0.5 |
GO:0033024 |
mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.3 |
2.7 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.3 |
1.3 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.3 |
1.3 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.3 |
1.6 |
GO:1902045 |
negative regulation of Fas signaling pathway(GO:1902045) |
| 0.3 |
1.6 |
GO:0030047 |
actin modification(GO:0030047) |
| 0.3 |
0.8 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 0.3 |
1.6 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.3 |
1.6 |
GO:0015781 |
pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.3 |
1.1 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.3 |
1.1 |
GO:1905224 |
clathrin-coated pit assembly(GO:1905224) |
| 0.3 |
0.8 |
GO:1901873 |
regulation of post-translational protein modification(GO:1901873) |
| 0.3 |
1.0 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
| 0.3 |
0.8 |
GO:0032026 |
response to magnesium ion(GO:0032026) |
| 0.3 |
1.6 |
GO:1904048 |
regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 0.3 |
0.3 |
GO:2000364 |
regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.3 |
1.3 |
GO:0010760 |
negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.3 |
0.5 |
GO:0032765 |
positive regulation of mast cell cytokine production(GO:0032765) |
| 0.3 |
2.1 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.3 |
0.3 |
GO:0060449 |
bud elongation involved in lung branching(GO:0060449) |
| 0.3 |
1.3 |
GO:1990414 |
replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.3 |
1.5 |
GO:0060012 |
synaptic transmission, glycinergic(GO:0060012) |
| 0.3 |
0.3 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.3 |
1.3 |
GO:0035234 |
ectopic germ cell programmed cell death(GO:0035234) |
| 0.3 |
4.3 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.3 |
0.3 |
GO:0071409 |
cellular response to cycloheximide(GO:0071409) |
| 0.3 |
1.0 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.3 |
2.8 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.2 |
0.2 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 0.2 |
3.5 |
GO:0006975 |
DNA damage induced protein phosphorylation(GO:0006975) |
| 0.2 |
0.2 |
GO:0044597 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 |
3.5 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.2 |
1.5 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.2 |
2.0 |
GO:0003322 |
pancreatic A cell development(GO:0003322) |
| 0.2 |
2.2 |
GO:1902284 |
axon extension involved in axon guidance(GO:0048846) neuron projection extension involved in neuron projection guidance(GO:1902284) |
| 0.2 |
1.7 |
GO:0071461 |
cellular response to redox state(GO:0071461) |
| 0.2 |
4.4 |
GO:0006878 |
cellular copper ion homeostasis(GO:0006878) |
| 0.2 |
1.0 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.2 |
3.4 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.2 |
1.0 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.2 |
0.5 |
GO:1900113 |
negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.2 |
1.7 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.2 |
1.7 |
GO:1904779 |
regulation of protein localization to centrosome(GO:1904779) |
| 0.2 |
0.7 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.2 |
3.1 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.2 |
2.9 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.2 |
1.2 |
GO:0036496 |
regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.2 |
0.9 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.2 |
3.3 |
GO:0019317 |
fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.2 |
0.7 |
GO:0001694 |
histamine biosynthetic process(GO:0001694) |
| 0.2 |
0.5 |
GO:0052553 |
induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.2 |
0.2 |
GO:0036493 |
positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.2 |
0.9 |
GO:0072081 |
proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) specification of loop of Henle identity(GO:0072086) |
| 0.2 |
1.2 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.2 |
0.9 |
GO:0008588 |
release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.2 |
0.5 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.2 |
2.3 |
GO:0023035 |
CD40 signaling pathway(GO:0023035) |
| 0.2 |
0.9 |
GO:0008355 |
olfactory learning(GO:0008355) |
| 0.2 |
1.9 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.2 |
2.8 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.2 |
1.2 |
GO:0033274 |
response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.2 |
1.2 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 |
0.9 |
GO:0045648 |
positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.2 |
1.8 |
GO:2001168 |
regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.2 |
0.7 |
GO:2000395 |
regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.2 |
0.9 |
GO:0036309 |
protein localization to M-band(GO:0036309) |
| 0.2 |
1.6 |
GO:0032878 |
regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.2 |
0.2 |
GO:0097252 |
oligodendrocyte apoptotic process(GO:0097252) negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.2 |
0.5 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.2 |
1.1 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.2 |
1.8 |
GO:0071321 |
cellular response to cGMP(GO:0071321) |
| 0.2 |
1.6 |
GO:0044154 |
histone H3-K14 acetylation(GO:0044154) |
| 0.2 |
2.0 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.2 |
5.4 |
GO:0071243 |
cellular response to arsenic-containing substance(GO:0071243) |
| 0.2 |
1.3 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 |
0.9 |
GO:0060620 |
regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.2 |
1.3 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.2 |
1.3 |
GO:0098746 |
fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.2 |
1.8 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.2 |
0.7 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.2 |
0.2 |
GO:0090345 |
cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.2 |
2.6 |
GO:0046498 |
S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.2 |
1.1 |
GO:0010820 |
positive regulation of T cell chemotaxis(GO:0010820) |
| 0.2 |
0.7 |
GO:0043000 |
Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.2 |
0.7 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.2 |
2.8 |
GO:0098734 |
macromolecule depalmitoylation(GO:0098734) |
| 0.2 |
0.6 |
GO:0002024 |
diet induced thermogenesis(GO:0002024) |
| 0.2 |
0.6 |
GO:0000305 |
response to superoxide(GO:0000303) response to oxygen radical(GO:0000305) |
| 0.2 |
0.4 |
GO:1900365 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.2 |
0.9 |
GO:0035669 |
TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.2 |
0.9 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.2 |
2.4 |
GO:0097167 |
circadian regulation of translation(GO:0097167) |
| 0.2 |
0.4 |
GO:0019521 |
aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.2 |
1.1 |
GO:2000354 |
regulation of ovarian follicle development(GO:2000354) |
| 0.2 |
0.4 |
GO:0045410 |
positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.2 |
3.4 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.2 |
2.1 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.2 |
0.6 |
GO:0043653 |
mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.2 |
1.1 |
GO:0009233 |
menaquinone metabolic process(GO:0009233) |
| 0.2 |
1.1 |
GO:2000288 |
positive regulation of myoblast proliferation(GO:2000288) |
| 0.2 |
0.2 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.2 |
0.6 |
GO:0019243 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.2 |
1.5 |
GO:0035865 |
cellular response to potassium ion(GO:0035865) |
| 0.2 |
0.2 |
GO:0021555 |
midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.2 |
0.6 |
GO:0072616 |
interleukin-18 secretion(GO:0072616) |
| 0.2 |
0.4 |
GO:1904995 |
negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.2 |
0.2 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.2 |
0.2 |
GO:0001755 |
neural crest cell migration(GO:0001755) neural crest cell development(GO:0014032) |
| 0.2 |
1.6 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.2 |
8.6 |
GO:0032456 |
endocytic recycling(GO:0032456) |
| 0.2 |
0.8 |
GO:2000504 |
positive regulation of blood vessel remodeling(GO:2000504) |
| 0.2 |
6.8 |
GO:1904659 |
hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.2 |
4.3 |
GO:0035589 |
G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.2 |
0.2 |
GO:0035357 |
peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.2 |
0.4 |
GO:0032119 |
sequestering of zinc ion(GO:0032119) |
| 0.2 |
1.4 |
GO:0036500 |
ATF6-mediated unfolded protein response(GO:0036500) |
| 0.2 |
0.2 |
GO:0051968 |
positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.2 |
0.8 |
GO:0001302 |
replicative cell aging(GO:0001302) |
| 0.2 |
6.0 |
GO:0071353 |
cellular response to interleukin-4(GO:0071353) |
| 0.2 |
0.6 |
GO:0060730 |
regulation of intestinal epithelial structure maintenance(GO:0060730) |
| 0.2 |
4.2 |
GO:0002115 |
store-operated calcium entry(GO:0002115) |
| 0.2 |
1.6 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.2 |
0.2 |
GO:0006561 |
proline biosynthetic process(GO:0006561) |
| 0.2 |
2.6 |
GO:0070294 |
renal sodium ion absorption(GO:0070294) |
| 0.2 |
1.6 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.2 |
3.8 |
GO:2000480 |
negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.2 |
1.2 |
GO:2000538 |
regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.2 |
0.4 |
GO:0034088 |
maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.2 |
5.9 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.2 |
4.9 |
GO:0046339 |
diacylglycerol metabolic process(GO:0046339) |
| 0.2 |
1.4 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.2 |
0.6 |
GO:1900126 |
negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.2 |
0.2 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.2 |
5.9 |
GO:0035729 |
cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.2 |
0.6 |
GO:0071677 |
positive regulation of mononuclear cell migration(GO:0071677) negative regulation of immunological synapse formation(GO:2000521) negative regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001189) |
| 0.2 |
2.1 |
GO:0042492 |
gamma-delta T cell differentiation(GO:0042492) |
| 0.2 |
0.4 |
GO:1902474 |
positive regulation of protein localization to synapse(GO:1902474) |
| 0.2 |
6.5 |
GO:0021904 |
dorsal/ventral neural tube patterning(GO:0021904) |
| 0.2 |
2.7 |
GO:0032793 |
positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.2 |
0.8 |
GO:0022028 |
tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
| 0.2 |
1.7 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.2 |
0.2 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.2 |
1.1 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 |
5.1 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.2 |
1.5 |
GO:2000628 |
regulation of miRNA metabolic process(GO:2000628) |
| 0.2 |
3.9 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.2 |
1.9 |
GO:0090043 |
tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.2 |
0.9 |
GO:0002739 |
regulation of cytokine secretion involved in immune response(GO:0002739) |
| 0.2 |
4.2 |
GO:0045730 |
respiratory burst(GO:0045730) |
| 0.2 |
5.7 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.2 |
2.0 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.2 |
0.2 |
GO:0002543 |
activation of blood coagulation via clotting cascade(GO:0002543) |
| 0.2 |
5.3 |
GO:2001046 |
positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.2 |
4.5 |
GO:0006490 |
oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.2 |
1.1 |
GO:0019919 |
peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.2 |
0.4 |
GO:1901656 |
glycoside transport(GO:1901656) |
| 0.2 |
2.5 |
GO:1901970 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.2 |
0.7 |
GO:2000672 |
regulation of motor neuron apoptotic process(GO:2000671) negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.2 |
0.4 |
GO:0060086 |
circadian temperature homeostasis(GO:0060086) |
| 0.2 |
2.3 |
GO:0032785 |
negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.2 |
3.0 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.2 |
2.1 |
GO:0009629 |
response to gravity(GO:0009629) |
| 0.2 |
0.5 |
GO:0032203 |
telomere formation via telomerase(GO:0032203) |
| 0.2 |
0.5 |
GO:0042048 |
olfactory behavior(GO:0042048) |
| 0.2 |
0.5 |
GO:0060020 |
Bergmann glial cell differentiation(GO:0060020) |
| 0.2 |
0.9 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.2 |
0.4 |
GO:0006296 |
nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.2 |
0.5 |
GO:0021938 |
ventral midline development(GO:0007418) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) notochord regression(GO:0060032) |
| 0.2 |
0.9 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.2 |
1.2 |
GO:0097201 |
negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.2 |
4.5 |
GO:0098780 |
response to mitochondrial depolarisation(GO:0098780) |
| 0.2 |
0.2 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.2 |
0.2 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 0.2 |
3.4 |
GO:0018149 |
peptide cross-linking(GO:0018149) |
| 0.2 |
0.3 |
GO:0044691 |
tooth eruption(GO:0044691) |
| 0.2 |
0.5 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.2 |
0.2 |
GO:2000481 |
positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
| 0.2 |
0.2 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.2 |
0.9 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.2 |
0.7 |
GO:0033686 |
positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.2 |
0.3 |
GO:0060490 |
orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.2 |
1.7 |
GO:0002943 |
tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 |
0.7 |
GO:0017198 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.2 |
0.5 |
GO:0051782 |
negative regulation of cell division(GO:0051782) |
| 0.2 |
0.3 |
GO:0035246 |
peptidyl-arginine N-methylation(GO:0035246) |
| 0.2 |
0.2 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.2 |
0.2 |
GO:0031670 |
cellular response to nutrient(GO:0031670) |
| 0.2 |
0.2 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.2 |
0.7 |
GO:0002826 |
negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.2 |
0.5 |
GO:0045062 |
extrathymic T cell selection(GO:0045062) |
| 0.2 |
0.5 |
GO:0042713 |
sperm ejaculation(GO:0042713) |
| 0.2 |
0.7 |
GO:1902047 |
polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.2 |
2.2 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.2 |
0.7 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.2 |
0.2 |
GO:0046543 |
development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.2 |
3.6 |
GO:0070734 |
histone H3-K27 methylation(GO:0070734) |
| 0.2 |
1.3 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.2 |
0.2 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.2 |
0.7 |
GO:0005997 |
xylulose metabolic process(GO:0005997) |
| 0.2 |
0.7 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.2 |
1.8 |
GO:0046325 |
negative regulation of glucose import(GO:0046325) |
| 0.2 |
0.2 |
GO:0050968 |
detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.2 |
3.1 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.2 |
0.2 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 0.2 |
4.9 |
GO:0097320 |
membrane tubulation(GO:0097320) |
| 0.2 |
1.1 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.2 |
0.6 |
GO:0019285 |
glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.2 |
1.6 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.2 |
1.0 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 0.2 |
0.5 |
GO:0034553 |
respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.2 |
1.0 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.2 |
1.1 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.2 |
4.8 |
GO:0090140 |
regulation of mitochondrial fission(GO:0090140) |
| 0.2 |
3.7 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.2 |
0.5 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 0.2 |
1.1 |
GO:0007625 |
grooming behavior(GO:0007625) |
| 0.2 |
0.3 |
GO:0000294 |
nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.2 |
0.9 |
GO:1901264 |
carbohydrate derivative transport(GO:1901264) |
| 0.2 |
0.9 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.2 |
1.1 |
GO:0017121 |
phospholipid scrambling(GO:0017121) |
| 0.2 |
2.4 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.2 |
0.8 |
GO:0045990 |
carbon catabolite regulation of transcription(GO:0045990) |
| 0.2 |
0.5 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.2 |
0.6 |
GO:0060700 |
regulation of ribonuclease activity(GO:0060700) |
| 0.2 |
0.8 |
GO:0036512 |
trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.2 |
1.2 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.2 |
0.2 |
GO:0090212 |
regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 0.2 |
1.9 |
GO:0090344 |
negative regulation of cell aging(GO:0090344) |
| 0.2 |
0.6 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.2 |
0.2 |
GO:0002731 |
negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.2 |
1.1 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.2 |
1.1 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.2 |
0.6 |
GO:0090119 |
vesicle-mediated cholesterol transport(GO:0090119) |
| 0.2 |
2.3 |
GO:0051092 |
positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
| 0.2 |
0.6 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.2 |
0.5 |
GO:1990697 |
protein depalmitoleylation(GO:1990697) |
| 0.2 |
2.4 |
GO:0045747 |
positive regulation of Notch signaling pathway(GO:0045747) |
| 0.2 |
0.5 |
GO:0033385 |
geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.2 |
0.5 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.2 |
2.1 |
GO:0090022 |
regulation of neutrophil chemotaxis(GO:0090022) |
| 0.2 |
0.8 |
GO:0002829 |
negative regulation of type 2 immune response(GO:0002829) |
| 0.2 |
0.8 |
GO:0034128 |
negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.1 |
2.8 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 |
0.7 |
GO:0035751 |
regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 |
0.9 |
GO:0010728 |
regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.1 |
0.7 |
GO:0055069 |
zinc ion homeostasis(GO:0055069) |
| 0.1 |
3.9 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.1 |
5.4 |
GO:0048025 |
negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.1 |
0.3 |
GO:0031064 |
negative regulation of histone deacetylation(GO:0031064) |
| 0.1 |
0.9 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
0.3 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 |
0.6 |
GO:0034499 |
late endosome to Golgi transport(GO:0034499) |
| 0.1 |
0.7 |
GO:0010735 |
positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 |
0.4 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.1 |
0.7 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.1 |
0.3 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.1 |
0.3 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 |
0.3 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.1 |
2.6 |
GO:0060850 |
regulation of transcription involved in cell fate commitment(GO:0060850) |
| 0.1 |
1.9 |
GO:2000615 |
regulation of histone H3-K9 acetylation(GO:2000615) |
| 0.1 |
2.0 |
GO:1903543 |
positive regulation of exosomal secretion(GO:1903543) |
| 0.1 |
0.7 |
GO:0009082 |
branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.1 |
1.6 |
GO:0017183 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 |
0.6 |
GO:0042335 |
cuticle development(GO:0042335) |
| 0.1 |
2.0 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.1 |
1.2 |
GO:0043923 |
positive regulation by host of viral transcription(GO:0043923) |
| 0.1 |
0.6 |
GO:0051823 |
regulation of synapse structural plasticity(GO:0051823) |
| 0.1 |
1.5 |
GO:0046078 |
dUMP metabolic process(GO:0046078) |
| 0.1 |
1.0 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.1 |
0.9 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 0.1 |
0.4 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 |
1.2 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.1 |
0.4 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.1 |
0.9 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.1 |
0.6 |
GO:0046813 |
receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.1 |
0.6 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 |
2.1 |
GO:0071816 |
tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 |
0.8 |
GO:2000369 |
regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 |
0.4 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 |
1.0 |
GO:0098989 |
NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.1 |
1.3 |
GO:0098703 |
calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.1 |
0.1 |
GO:0060684 |
epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.1 |
2.6 |
GO:0070129 |
regulation of mitochondrial translation(GO:0070129) |
| 0.1 |
0.3 |
GO:0032696 |
negative regulation of interleukin-13 production(GO:0032696) |
| 0.1 |
0.1 |
GO:0015680 |
intracellular copper ion transport(GO:0015680) |
| 0.1 |
0.3 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 |
0.4 |
GO:0000349 |
generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.1 |
0.7 |
GO:0006203 |
dGTP catabolic process(GO:0006203) |
| 0.1 |
0.4 |
GO:0071460 |
cellular response to cell-matrix adhesion(GO:0071460) |
| 0.1 |
0.4 |
GO:0019082 |
viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.1 |
5.0 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
5.0 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 0.1 |
0.3 |
GO:0070374 |
positive regulation of ERK1 and ERK2 cascade(GO:0070374) |
| 0.1 |
1.7 |
GO:0040015 |
negative regulation of multicellular organism growth(GO:0040015) |
| 0.1 |
0.1 |
GO:2001076 |
thorax and anterior abdomen determination(GO:0007356) regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.1 |
0.3 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 |
0.7 |
GO:0009209 |
pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
| 0.1 |
0.1 |
GO:0008356 |
asymmetric cell division(GO:0008356) |
| 0.1 |
0.1 |
GO:1904180 |
negative regulation of membrane depolarization(GO:1904180) |
| 0.1 |
0.1 |
GO:0014839 |
unidimensional cell growth(GO:0009826) myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.1 |
1.5 |
GO:2000786 |
positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 |
0.4 |
GO:0042984 |
amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.1 |
1.5 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
7.1 |
GO:0080171 |
lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.1 |
0.5 |
GO:1902910 |
regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of transforming growth factor beta2 production(GO:0032912) catagen(GO:0042637) regulation of catagen(GO:0051794) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
| 0.1 |
0.9 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.1 |
0.4 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 0.1 |
0.3 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 |
1.2 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.1 |
0.1 |
GO:0060413 |
atrial septum morphogenesis(GO:0060413) |
| 0.1 |
0.6 |
GO:0071051 |
polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 |
0.8 |
GO:1903223 |
positive regulation of oxidative stress-induced neuron death(GO:1903223) positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.1 |
1.3 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 |
0.3 |
GO:0097534 |
somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.1 |
1.2 |
GO:0060445 |
branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.1 |
0.4 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.1 |
3.0 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.1 |
1.9 |
GO:0035116 |
embryonic hindlimb morphogenesis(GO:0035116) |
| 0.1 |
4.4 |
GO:0006884 |
cell volume homeostasis(GO:0006884) |
| 0.1 |
0.5 |
GO:0098910 |
regulation of atrial cardiac muscle cell action potential(GO:0098910) |
| 0.1 |
0.3 |
GO:0098967 |
exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 |
0.8 |
GO:0070445 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 |
1.0 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.1 |
1.0 |
GO:0034380 |
high-density lipoprotein particle assembly(GO:0034380) |
| 0.1 |
0.6 |
GO:0032815 |
negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 |
0.1 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.1 |
0.4 |
GO:0031657 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) |
| 0.1 |
0.1 |
GO:0042249 |
establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.1 |
0.4 |
GO:1900194 |
negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.1 |
1.3 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.1 |
1.3 |
GO:0044341 |
sodium-dependent phosphate transport(GO:0044341) |
| 0.1 |
0.4 |
GO:0038031 |
non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 |
0.6 |
GO:1902659 |
regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.1 |
2.9 |
GO:0032201 |
telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 |
2.0 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.1 |
0.3 |
GO:0061074 |
regulation of neural retina development(GO:0061074) |
| 0.1 |
0.1 |
GO:1902527 |
positive regulation of protein monoubiquitination(GO:1902527) |
| 0.1 |
0.5 |
GO:0070417 |
cellular response to cold(GO:0070417) |
| 0.1 |
0.2 |
GO:1901800 |
positive regulation of proteasomal protein catabolic process(GO:1901800) |
| 0.1 |
0.1 |
GO:1903541 |
regulation of exosomal secretion(GO:1903541) |
| 0.1 |
2.1 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 |
2.6 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.1 |
1.5 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.1 |
0.2 |
GO:1900193 |
regulation of oocyte development(GO:0060281) regulation of oocyte maturation(GO:1900193) |
| 0.1 |
1.6 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.1 |
0.2 |
GO:0035641 |
locomotory exploration behavior(GO:0035641) |
| 0.1 |
0.2 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 |
0.7 |
GO:0000023 |
maltose metabolic process(GO:0000023) |
| 0.1 |
2.3 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 |
0.1 |
GO:0035802 |
adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
| 0.1 |
1.9 |
GO:0090050 |
positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 |
1.9 |
GO:0061003 |
positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.1 |
0.2 |
GO:1904017 |
cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.1 |
1.0 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.1 |
0.2 |
GO:0036023 |
limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.1 |
0.2 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) |
| 0.1 |
0.5 |
GO:0050902 |
leukocyte adhesive activation(GO:0050902) |
| 0.1 |
3.1 |
GO:0006027 |
glycosaminoglycan catabolic process(GO:0006027) |
| 0.1 |
0.1 |
GO:0007439 |
ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) right lung development(GO:0060458) |
| 0.1 |
2.1 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.1 |
0.4 |
GO:0060027 |
convergent extension involved in gastrulation(GO:0060027) |
| 0.1 |
0.8 |
GO:0006196 |
AMP catabolic process(GO:0006196) |
| 0.1 |
0.5 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 0.1 |
4.5 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.1 |
0.5 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.1 |
0.4 |
GO:0070563 |
negative regulation of vitamin D receptor signaling pathway(GO:0070563) negative regulation of response to alcohol(GO:1901420) |
| 0.1 |
0.6 |
GO:0002378 |
immunoglobulin biosynthetic process(GO:0002378) |
| 0.1 |
0.2 |
GO:0015809 |
arginine transport(GO:0015809) |
| 0.1 |
0.5 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 |
1.4 |
GO:0030262 |
cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
| 0.1 |
0.6 |
GO:0042412 |
taurine biosynthetic process(GO:0042412) |
| 0.1 |
2.0 |
GO:0006929 |
substrate-dependent cell migration(GO:0006929) |
| 0.1 |
5.5 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.1 |
0.5 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 |
0.3 |
GO:0038178 |
complement component C5a signaling pathway(GO:0038178) |
| 0.1 |
0.9 |
GO:1902036 |
regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 |
0.5 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.5 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 0.1 |
1.3 |
GO:0034356 |
NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.1 |
0.3 |
GO:0070898 |
RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 |
0.5 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 |
0.2 |
GO:0032680 |
regulation of tumor necrosis factor production(GO:0032680) |
| 0.1 |
0.6 |
GO:2000535 |
regulation of entry of bacterium into host cell(GO:2000535) |
| 0.1 |
1.8 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.1 |
0.2 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.1 |
1.6 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.1 |
0.5 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 |
0.6 |
GO:0071344 |
diphosphate metabolic process(GO:0071344) |
| 0.1 |
4.2 |
GO:0030252 |
growth hormone secretion(GO:0030252) |
| 0.1 |
0.4 |
GO:0014911 |
positive regulation of smooth muscle cell migration(GO:0014911) |
| 0.1 |
0.3 |
GO:0060743 |
epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 |
1.0 |
GO:2000507 |
positive regulation of energy homeostasis(GO:2000507) |
| 0.1 |
2.0 |
GO:0007097 |
nuclear migration(GO:0007097) |
| 0.1 |
0.9 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.1 |
0.3 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 |
0.2 |
GO:0050772 |
positive regulation of axonogenesis(GO:0050772) |
| 0.1 |
1.4 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.1 |
0.2 |
GO:0060214 |
endocardium formation(GO:0060214) |
| 0.1 |
0.2 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.1 |
0.2 |
GO:0001172 |
transcription, RNA-templated(GO:0001172) |
| 0.1 |
0.3 |
GO:0043095 |
regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.1 |
0.5 |
GO:0030241 |
skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.1 |
0.5 |
GO:0036018 |
cellular response to erythropoietin(GO:0036018) |
| 0.1 |
0.1 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
| 0.1 |
0.4 |
GO:1905232 |
cellular response to L-glutamate(GO:1905232) |
| 0.1 |
1.6 |
GO:0070544 |
histone H3-K36 demethylation(GO:0070544) |
| 0.1 |
0.2 |
GO:1901421 |
positive regulation of response to alcohol(GO:1901421) |
| 0.1 |
2.2 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.1 |
2.5 |
GO:1902236 |
negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.1 |
1.2 |
GO:0071372 |
cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.1 |
0.1 |
GO:0071035 |
nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.1 |
0.1 |
GO:1903626 |
positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.1 |
0.2 |
GO:1900363 |
regulation of mRNA polyadenylation(GO:1900363) |
| 0.1 |
0.1 |
GO:0045347 |
negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 |
0.2 |
GO:0071624 |
positive regulation of granulocyte chemotaxis(GO:0071624) |
| 0.1 |
0.4 |
GO:1903896 |
positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.1 |
2.3 |
GO:0006750 |
glutathione biosynthetic process(GO:0006750) |
| 0.1 |
1.6 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 |
0.1 |
GO:0042489 |
negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.1 |
0.5 |
GO:0031999 |
negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 |
1.0 |
GO:0070911 |
global genome nucleotide-excision repair(GO:0070911) |
| 0.1 |
1.3 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 |
0.6 |
GO:0033490 |
cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.1 |
0.6 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 |
0.8 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
0.3 |
GO:0006423 |
cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.1 |
0.9 |
GO:0042659 |
regulation of cell fate specification(GO:0042659) |
| 0.1 |
3.5 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
7.8 |
GO:0036498 |
IRE1-mediated unfolded protein response(GO:0036498) |
| 0.1 |
0.5 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 |
0.6 |
GO:0032703 |
negative regulation of interleukin-2 production(GO:0032703) |
| 0.1 |
0.8 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
0.7 |
GO:0006273 |
lagging strand elongation(GO:0006273) |
| 0.1 |
0.3 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.1 |
0.5 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.1 |
1.5 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.1 |
0.9 |
GO:0006002 |
fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 |
0.9 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 |
0.5 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.1 |
0.7 |
GO:1900623 |
regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.1 |
0.1 |
GO:0048009 |
insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.1 |
2.2 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.1 |
2.0 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 |
1.0 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.1 |
0.9 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 |
0.3 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.1 |
0.3 |
GO:0010644 |
cell communication by electrical coupling(GO:0010644) |
| 0.1 |
0.7 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 |
0.1 |
GO:0036072 |
intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.1 |
0.2 |
GO:0046070 |
dGTP metabolic process(GO:0046070) |
| 0.1 |
1.9 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 |
4.3 |
GO:0042339 |
keratan sulfate metabolic process(GO:0042339) |
| 0.1 |
0.5 |
GO:0009757 |
hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.1 |
0.3 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 0.1 |
1.3 |
GO:0006972 |
hyperosmotic response(GO:0006972) |
| 0.1 |
0.4 |
GO:0038169 |
somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.1 |
0.1 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 0.1 |
10.9 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.3 |
GO:0070408 |
carbamoyl phosphate metabolic process(GO:0070408) carbamoyl phosphate biosynthetic process(GO:0070409) response to ammonia(GO:1903717) cellular response to ammonia(GO:1903718) |
| 0.1 |
2.1 |
GO:0031167 |
rRNA methylation(GO:0031167) |
| 0.1 |
0.4 |
GO:0048743 |
positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.1 |
0.1 |
GO:1990009 |
retinal cell apoptotic process(GO:1990009) |
| 0.1 |
7.4 |
GO:0030574 |
collagen catabolic process(GO:0030574) |
| 0.1 |
0.2 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.1 |
0.8 |
GO:0001574 |
ganglioside biosynthetic process(GO:0001574) |
| 0.1 |
0.4 |
GO:1903281 |
positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.1 |
0.7 |
GO:0032264 |
IMP salvage(GO:0032264) |
| 0.1 |
0.2 |
GO:0006171 |
cAMP biosynthetic process(GO:0006171) |
| 0.1 |
0.3 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 |
1.0 |
GO:0048296 |
regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.1 |
1.5 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.1 |
2.0 |
GO:0032570 |
response to progesterone(GO:0032570) |
| 0.1 |
0.1 |
GO:0044240 |
multicellular organism lipid catabolic process(GO:0044240) |
| 0.1 |
7.9 |
GO:0071479 |
cellular response to ionizing radiation(GO:0071479) |
| 0.1 |
0.6 |
GO:0075044 |
autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.1 |
1.3 |
GO:0036336 |
dendritic cell migration(GO:0036336) |
| 0.1 |
0.5 |
GO:0045792 |
negative regulation of cell size(GO:0045792) |
| 0.1 |
0.3 |
GO:1902559 |
3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.1 |
0.1 |
GO:0036515 |
serotonergic neuron axon guidance(GO:0036515) |
| 0.1 |
0.3 |
GO:0014002 |
astrocyte development(GO:0014002) |
| 0.1 |
1.8 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.1 |
0.5 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.3 |
GO:1904116 |
response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.1 |
0.1 |
GO:1900181 |
negative regulation of protein localization to nucleus(GO:1900181) |
| 0.1 |
0.6 |
GO:0051533 |
positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 |
0.4 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 |
0.2 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.1 |
0.6 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 0.1 |
0.4 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 |
0.3 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.1 |
0.3 |
GO:1904808 |
regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 |
5.0 |
GO:0045773 |
positive regulation of axon extension(GO:0045773) |
| 0.1 |
0.1 |
GO:0072720 |
response to dithiothreitol(GO:0072720) |
| 0.1 |
0.8 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.1 |
0.1 |
GO:0002339 |
regulation of type I hypersensitivity(GO:0001810) response to molecule of fungal origin(GO:0002238) B cell selection(GO:0002339) type I hypersensitivity(GO:0016068) cellular response to molecule of fungal origin(GO:0071226) |
| 0.1 |
0.9 |
GO:0030207 |
chondroitin sulfate catabolic process(GO:0030207) |
| 0.1 |
0.3 |
GO:2001287 |
negative regulation of caveolin-mediated endocytosis(GO:2001287) |
| 0.1 |
0.2 |
GO:1990502 |
dense core granule maturation(GO:1990502) |
| 0.1 |
0.1 |
GO:0003032 |
detection of oxygen(GO:0003032) |
| 0.1 |
5.8 |
GO:0030433 |
ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.1 |
1.0 |
GO:0021895 |
cerebral cortex neuron differentiation(GO:0021895) |
| 0.1 |
1.4 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.1 |
0.2 |
GO:0060025 |
regulation of synaptic activity(GO:0060025) |
| 0.1 |
1.0 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
1.6 |
GO:0015937 |
coenzyme A biosynthetic process(GO:0015937) |
| 0.1 |
1.4 |
GO:0019388 |
galactose catabolic process(GO:0019388) |
| 0.1 |
0.7 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.1 |
0.2 |
GO:0002426 |
immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 |
0.9 |
GO:0060965 |
negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.1 |
0.6 |
GO:0045717 |
negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 |
0.4 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 |
0.7 |
GO:0031441 |
negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.1 |
0.2 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.1 |
0.9 |
GO:2000304 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 |
2.3 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.1 |
0.8 |
GO:0006782 |
protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.1 |
0.2 |
GO:0061386 |
closure of optic fissure(GO:0061386) |
| 0.1 |
0.2 |
GO:0003056 |
regulation of vascular smooth muscle contraction(GO:0003056) |
| 0.1 |
1.3 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.1 |
0.5 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.1 |
0.4 |
GO:0019075 |
virus maturation(GO:0019075) |
| 0.1 |
0.2 |
GO:0072199 |
mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
| 0.1 |
0.1 |
GO:0035502 |
metanephric part of ureteric bud development(GO:0035502) |
| 0.1 |
0.5 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
0.2 |
GO:1902744 |
negative regulation of lamellipodium organization(GO:1902744) |
| 0.1 |
0.1 |
GO:0071877 |
regulation of adrenergic receptor signaling pathway(GO:0071877) positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 |
0.2 |
GO:0035720 |
intraciliary anterograde transport(GO:0035720) |
| 0.1 |
0.4 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.1 |
2.2 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.1 |
5.2 |
GO:0045669 |
positive regulation of osteoblast differentiation(GO:0045669) |
| 0.1 |
0.1 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.1 |
0.3 |
GO:0010936 |
negative regulation of macrophage cytokine production(GO:0010936) |
| 0.1 |
0.1 |
GO:0003408 |
optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.1 |
0.4 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 |
0.5 |
GO:0016191 |
synaptic vesicle uncoating(GO:0016191) |
| 0.1 |
0.4 |
GO:0035313 |
wound healing, spreading of epidermal cells(GO:0035313) |
| 0.1 |
0.1 |
GO:1902525 |
regulation of protein monoubiquitination(GO:1902525) |
| 0.1 |
0.5 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 |
0.8 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.1 |
0.5 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.1 |
0.8 |
GO:0046485 |
ether lipid metabolic process(GO:0046485) |
| 0.1 |
0.1 |
GO:1900102 |
negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
| 0.1 |
0.2 |
GO:0019344 |
cysteine biosynthetic process(GO:0019344) |
| 0.1 |
0.8 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.1 |
0.2 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.1 |
0.4 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 |
6.7 |
GO:0034340 |
response to type I interferon(GO:0034340) |
| 0.1 |
0.6 |
GO:0009109 |
coenzyme catabolic process(GO:0009109) |
| 0.1 |
0.2 |
GO:0097237 |
cellular response to toxic substance(GO:0097237) |
| 0.1 |
2.2 |
GO:0045932 |
negative regulation of muscle contraction(GO:0045932) |
| 0.1 |
0.1 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 |
5.9 |
GO:0042058 |
regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.1 |
0.4 |
GO:0090206 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 |
0.6 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 |
0.1 |
GO:0021943 |
formation of radial glial scaffolds(GO:0021943) |
| 0.1 |
1.2 |
GO:0001514 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
0.1 |
GO:0061351 |
neural precursor cell proliferation(GO:0061351) |
| 0.1 |
0.3 |
GO:0015742 |
alpha-ketoglutarate transport(GO:0015742) |
| 0.1 |
0.1 |
GO:0032490 |
detection of molecule of bacterial origin(GO:0032490) |
| 0.1 |
0.1 |
GO:1902732 |
positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.1 |
4.3 |
GO:0018279 |
protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.1 |
0.4 |
GO:0051595 |
response to methylglyoxal(GO:0051595) |
| 0.1 |
0.1 |
GO:0019401 |
glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.1 |
0.2 |
GO:0035623 |
regulation of pronephros size(GO:0035565) renal glucose absorption(GO:0035623) |
| 0.1 |
2.1 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.1 |
0.4 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.1 |
1.3 |
GO:0042481 |
regulation of odontogenesis(GO:0042481) |
| 0.1 |
0.2 |
GO:0003050 |
regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.1 |
0.5 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.1 |
0.2 |
GO:1905050 |
positive regulation of metallopeptidase activity(GO:1905050) |
| 0.1 |
0.1 |
GO:0019417 |
sulfur oxidation(GO:0019417) |
| 0.1 |
0.6 |
GO:0098722 |
asymmetric stem cell division(GO:0098722) |
| 0.1 |
0.2 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.1 |
0.3 |
GO:0051005 |
negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.1 |
0.2 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.1 |
1.7 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.1 |
0.2 |
GO:0060325 |
head morphogenesis(GO:0060323) face morphogenesis(GO:0060325) |
| 0.1 |
0.6 |
GO:1903147 |
negative regulation of mitophagy(GO:1903147) |
| 0.1 |
5.5 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.1 |
0.4 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.1 |
0.2 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 |
4.1 |
GO:0006636 |
unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.1 |
0.9 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 |
1.1 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.1 |
0.1 |
GO:0007227 |
signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.1 |
0.3 |
GO:0033148 |
positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 |
1.5 |
GO:0046475 |
glycerophospholipid catabolic process(GO:0046475) |
| 0.1 |
1.0 |
GO:0006700 |
C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.1 |
5.0 |
GO:0002479 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) |
| 0.1 |
0.1 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.1 |
6.0 |
GO:0070268 |
cornification(GO:0070268) |
| 0.1 |
0.6 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 |
1.0 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.1 |
7.9 |
GO:0090630 |
activation of GTPase activity(GO:0090630) |
| 0.1 |
0.1 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.1 |
0.1 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.1 |
0.3 |
GO:1902766 |
skeletal muscle satellite cell migration(GO:1902766) |
| 0.1 |
1.8 |
GO:0006487 |
protein N-linked glycosylation(GO:0006487) |
| 0.1 |
0.3 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.1 |
0.1 |
GO:0061550 |
cranial ganglion development(GO:0061550) |
| 0.1 |
0.2 |
GO:0061525 |
hindgut development(GO:0061525) |
| 0.1 |
0.7 |
GO:0034472 |
snRNA 3'-end processing(GO:0034472) |
| 0.1 |
0.1 |
GO:0072387 |
flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.1 |
0.8 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.1 |
1.2 |
GO:0050919 |
negative chemotaxis(GO:0050919) |
| 0.1 |
0.3 |
GO:2000330 |
interleukin-23-mediated signaling pathway(GO:0038155) positive regulation of T-helper 17 cell lineage commitment(GO:2000330) |
| 0.1 |
0.1 |
GO:0044803 |
multi-organism membrane organization(GO:0044803) |
| 0.1 |
0.4 |
GO:0045109 |
intermediate filament organization(GO:0045109) |
| 0.1 |
0.3 |
GO:0042634 |
regulation of hair cycle(GO:0042634) |
| 0.1 |
1.2 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.1 |
0.4 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 0.1 |
1.1 |
GO:1902358 |
sulfate transmembrane transport(GO:1902358) |
| 0.1 |
0.2 |
GO:1903028 |
positive regulation of opsonization(GO:1903028) |
| 0.1 |
0.1 |
GO:0030947 |
regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 0.1 |
0.1 |
GO:0010002 |
cardioblast differentiation(GO:0010002) |
| 0.1 |
0.8 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 |
0.2 |
GO:0042214 |
terpene metabolic process(GO:0042214) |
| 0.1 |
0.1 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.1 |
0.4 |
GO:0015811 |
sulfur amino acid transport(GO:0000101) L-cystine transport(GO:0015811) |
| 0.1 |
0.4 |
GO:0007416 |
synapse assembly(GO:0007416) |
| 0.1 |
0.1 |
GO:0032097 |
positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.1 |
0.1 |
GO:0019086 |
late viral transcription(GO:0019086) |
| 0.1 |
0.1 |
GO:0007206 |
phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.1 |
0.2 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.1 |
0.2 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 0.1 |
1.1 |
GO:0042755 |
eating behavior(GO:0042755) |
| 0.1 |
0.2 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 0.1 |
0.1 |
GO:0060081 |
membrane hyperpolarization(GO:0060081) |
| 0.1 |
1.8 |
GO:0014902 |
myotube differentiation(GO:0014902) |
| 0.1 |
0.1 |
GO:0031938 |
regulation of chromatin silencing at telomere(GO:0031938) |
| 0.1 |
0.3 |
GO:0017185 |
peptidyl-lysine hydroxylation(GO:0017185) |
| 0.1 |
0.3 |
GO:0071277 |
cellular response to calcium ion(GO:0071277) |
| 0.1 |
0.1 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.1 |
6.0 |
GO:1902476 |
chloride transmembrane transport(GO:1902476) |
| 0.1 |
0.3 |
GO:0006308 |
DNA catabolic process(GO:0006308) |
| 0.1 |
0.3 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 |
0.1 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.1 |
0.3 |
GO:0003266 |
regulation of secondary heart field cardioblast proliferation(GO:0003266) |
| 0.1 |
2.8 |
GO:0031295 |
T cell costimulation(GO:0031295) |
| 0.1 |
0.7 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 |
0.1 |
GO:0098507 |
polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.1 |
0.1 |
GO:0099525 |
presynaptic dense core granule exocytosis(GO:0099525) |
| 0.1 |
0.2 |
GO:0086021 |
SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.1 |
1.1 |
GO:0048536 |
spleen development(GO:0048536) |
| 0.1 |
0.5 |
GO:0050691 |
regulation of defense response to virus by host(GO:0050691) |
| 0.1 |
6.8 |
GO:0038096 |
immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 0.1 |
0.1 |
GO:1900155 |
regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.1 |
0.2 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.1 |
0.5 |
GO:0009650 |
UV protection(GO:0009650) |
| 0.1 |
0.3 |
GO:0045903 |
positive regulation of translational fidelity(GO:0045903) |
| 0.1 |
0.1 |
GO:0019346 |
homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.1 |
0.1 |
GO:0006565 |
L-serine catabolic process(GO:0006565) |
| 0.1 |
0.3 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) |
| 0.1 |
0.2 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.1 |
0.1 |
GO:1903364 |
positive regulation of cellular protein catabolic process(GO:1903364) |
| 0.1 |
0.2 |
GO:0048262 |
determination of dorsal/ventral asymmetry(GO:0048262) |
| 0.1 |
0.2 |
GO:0070670 |
response to interleukin-4(GO:0070670) |
| 0.1 |
0.3 |
GO:0045104 |
intermediate filament cytoskeleton organization(GO:0045104) |
| 0.1 |
0.4 |
GO:0050829 |
defense response to Gram-negative bacterium(GO:0050829) |
| 0.1 |
0.5 |
GO:1902592 |
viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
| 0.1 |
1.4 |
GO:0072583 |
clathrin-mediated endocytosis(GO:0072583) |
| 0.1 |
0.9 |
GO:0001964 |
startle response(GO:0001964) |
| 0.1 |
0.2 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) pyramidal neuron development(GO:0021860) |
| 0.1 |
0.4 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) |
| 0.1 |
0.2 |
GO:0071542 |
dopaminergic neuron differentiation(GO:0071542) |
| 0.0 |
0.1 |
GO:0060026 |
convergent extension(GO:0060026) |
| 0.0 |
0.3 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 |
0.0 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.0 |
0.2 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 |
0.0 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.0 |
0.5 |
GO:0034199 |
activation of protein kinase A activity(GO:0034199) |
| 0.0 |
0.9 |
GO:2000052 |
positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 |
0.4 |
GO:0010818 |
T cell chemotaxis(GO:0010818) |
| 0.0 |
0.2 |
GO:1902667 |
regulation of axon guidance(GO:1902667) |
| 0.0 |
0.9 |
GO:0007216 |
G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 |
0.1 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 |
0.4 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 |
0.1 |
GO:0070091 |
glucagon secretion(GO:0070091) |
| 0.0 |
0.1 |
GO:0044804 |
nucleophagy(GO:0044804) |
| 0.0 |
0.3 |
GO:0030010 |
establishment of cell polarity(GO:0030010) |
| 0.0 |
0.2 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 |
0.4 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.0 |
0.3 |
GO:0051705 |
multi-organism behavior(GO:0051705) |
| 0.0 |
1.0 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 |
0.1 |
GO:0050893 |
sensory processing(GO:0050893) |
| 0.0 |
0.1 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.0 |
0.2 |
GO:0060675 |
ureteric bud morphogenesis(GO:0060675) mesonephric tubule morphogenesis(GO:0072171) |
| 0.0 |
0.2 |
GO:1903204 |
neuron death in response to oxidative stress(GO:0036475) regulation of oxidative stress-induced neuron death(GO:1903203) negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.0 |
0.3 |
GO:0010447 |
response to acidic pH(GO:0010447) |
| 0.0 |
0.1 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 |
0.5 |
GO:0010803 |
regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 |
0.1 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.0 |
0.0 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.0 |
0.0 |
GO:0034285 |
response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.0 |
0.3 |
GO:0006102 |
isocitrate metabolic process(GO:0006102) |
| 0.0 |
0.1 |
GO:0008214 |
protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.0 |
0.5 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 |
0.7 |
GO:0045736 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) |
| 0.0 |
0.0 |
GO:0021984 |
adenohypophysis development(GO:0021984) |
| 0.0 |
0.6 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.0 |
0.1 |
GO:1905244 |
regulation of modification of synaptic structure(GO:1905244) |
| 0.0 |
0.2 |
GO:0090004 |
positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 |
0.1 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 0.0 |
0.5 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 |
0.2 |
GO:0002040 |
sprouting angiogenesis(GO:0002040) |
| 0.0 |
0.1 |
GO:0060382 |
regulation of DNA strand elongation(GO:0060382) |
| 0.0 |
0.2 |
GO:0002483 |
antigen processing and presentation of endogenous peptide antigen(GO:0002483) |
| 0.0 |
0.2 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 |
0.6 |
GO:0006658 |
phosphatidylserine metabolic process(GO:0006658) |
| 0.0 |
0.0 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.0 |
0.8 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.0 |
0.2 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 |
1.4 |
GO:0000079 |
regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.0 |
0.2 |
GO:0031179 |
peptide amidation(GO:0001519) protein amidation(GO:0018032) peptide modification(GO:0031179) |
| 0.0 |
0.2 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 |
2.1 |
GO:1901998 |
toxin transport(GO:1901998) |
| 0.0 |
1.4 |
GO:0007032 |
endosome organization(GO:0007032) |
| 0.0 |
0.6 |
GO:0043402 |
glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 |
0.5 |
GO:0090110 |
cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 |
0.2 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.0 |
0.1 |
GO:0072017 |
distal tubule development(GO:0072017) |
| 0.0 |
1.8 |
GO:1901385 |
regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 |
0.1 |
GO:0048243 |
norepinephrine secretion(GO:0048243) |
| 0.0 |
0.2 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.0 |
0.3 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.0 |
0.1 |
GO:0046416 |
D-amino acid metabolic process(GO:0046416) |
| 0.0 |
0.1 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.0 |
0.0 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.0 |
0.6 |
GO:1901407 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.0 |
0.3 |
GO:0098661 |
inorganic anion transmembrane transport(GO:0098661) |
| 0.0 |
0.1 |
GO:0043144 |
snoRNA processing(GO:0043144) |
| 0.0 |
0.8 |
GO:0070498 |
interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 |
0.0 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 |
0.0 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 |
0.2 |
GO:0061668 |
mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 |
0.1 |
GO:0080154 |
regulation of fertilization(GO:0080154) |
| 0.0 |
0.4 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.0 |
0.8 |
GO:0042475 |
odontogenesis of dentin-containing tooth(GO:0042475) |
| 0.0 |
0.2 |
GO:0097300 |
programmed necrotic cell death(GO:0097300) |
| 0.0 |
0.1 |
GO:1904885 |
beta-catenin destruction complex assembly(GO:1904885) |
| 0.0 |
0.0 |
GO:1990266 |
neutrophil migration(GO:1990266) |
| 0.0 |
0.2 |
GO:0098877 |
neurotransmitter receptor transport to plasma membrane(GO:0098877) |
| 0.0 |
0.1 |
GO:0002590 |
regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.0 |
0.3 |
GO:0050995 |
negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 |
0.3 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.0 |
0.2 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.0 |
0.1 |
GO:0006549 |
isoleucine metabolic process(GO:0006549) |
| 0.0 |
0.2 |
GO:0010719 |
negative regulation of epithelial to mesenchymal transition(GO:0010719) |
| 0.0 |
0.1 |
GO:1901838 |
positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 |
0.2 |
GO:0097475 |
motor neuron migration(GO:0097475) |
| 0.0 |
0.4 |
GO:0003159 |
morphogenesis of an endothelium(GO:0003159) |
| 0.0 |
0.5 |
GO:0051601 |
exocyst localization(GO:0051601) |
| 0.0 |
0.6 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.0 |
2.2 |
GO:0042787 |
protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 |
0.1 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 0.0 |
0.2 |
GO:0035553 |
oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 |
0.2 |
GO:0060638 |
mesenchymal-epithelial cell signaling(GO:0060638) |
| 0.0 |
1.2 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.0 |
0.7 |
GO:0016558 |
protein import into peroxisome matrix(GO:0016558) |
| 0.0 |
0.1 |
GO:0042144 |
vacuole fusion, non-autophagic(GO:0042144) |
| 0.0 |
0.0 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.0 |
0.2 |
GO:0022617 |
extracellular matrix disassembly(GO:0022617) |
| 0.0 |
0.2 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.0 |
0.4 |
GO:0000729 |
DNA double-strand break processing(GO:0000729) |
| 0.0 |
0.1 |
GO:0035404 |
histone-serine phosphorylation(GO:0035404) |
| 0.0 |
0.2 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.0 |
0.2 |
GO:0006021 |
inositol biosynthetic process(GO:0006021) |
| 0.0 |
0.1 |
GO:0072106 |
regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 0.0 |
0.6 |
GO:0043011 |
myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 |
0.1 |
GO:0032306 |
regulation of prostaglandin secretion(GO:0032306) positive regulation of prostaglandin secretion(GO:0032308) |
| 0.0 |
0.2 |
GO:0031290 |
retinal ganglion cell axon guidance(GO:0031290) |
| 0.0 |
0.1 |
GO:0044533 |
induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.0 |
0.1 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 |
0.1 |
GO:0000722 |
telomere maintenance via recombination(GO:0000722) |
| 0.0 |
0.1 |
GO:0032354 |
response to follicle-stimulating hormone(GO:0032354) |
| 0.0 |
0.6 |
GO:0042092 |
type 2 immune response(GO:0042092) |
| 0.0 |
0.0 |
GO:0061035 |
regulation of cartilage development(GO:0061035) |
| 0.0 |
0.5 |
GO:0006026 |
aminoglycan catabolic process(GO:0006026) |
| 0.0 |
0.4 |
GO:0007339 |
binding of sperm to zona pellucida(GO:0007339) |
| 0.0 |
0.2 |
GO:0000066 |
mitochondrial ornithine transport(GO:0000066) |
| 0.0 |
0.0 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.0 |
0.1 |
GO:0010659 |
cardiac muscle cell apoptotic process(GO:0010659) |
| 0.0 |
0.1 |
GO:1901419 |
regulation of response to alcohol(GO:1901419) |
| 0.0 |
0.1 |
GO:0043496 |
regulation of protein homodimerization activity(GO:0043496) |
| 0.0 |
0.1 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.0 |
0.1 |
GO:0051001 |
negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.0 |
0.5 |
GO:2001197 |
regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 |
0.1 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.0 |
0.3 |
GO:0034058 |
endosomal vesicle fusion(GO:0034058) |
| 0.0 |
0.0 |
GO:2001053 |
regulation of mesenchymal cell apoptotic process(GO:2001053) |
| 0.0 |
0.5 |
GO:0007212 |
dopamine receptor signaling pathway(GO:0007212) |
| 0.0 |
0.1 |
GO:0016062 |
adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.0 |
0.2 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 |
0.0 |
GO:0050955 |
thermoception(GO:0050955) |
| 0.0 |
0.1 |
GO:0050916 |
sensory perception of sweet taste(GO:0050916) |
| 0.0 |
0.1 |
GO:0060742 |
epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.0 |
0.1 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.0 |
0.3 |
GO:0030277 |
maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 |
0.8 |
GO:0010812 |
negative regulation of cell-substrate adhesion(GO:0010812) |
| 0.0 |
0.1 |
GO:0010566 |
regulation of ketone biosynthetic process(GO:0010566) |
| 0.0 |
0.0 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 |
0.4 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.0 |
0.1 |
GO:0030174 |
regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 |
0.7 |
GO:0010811 |
positive regulation of cell-substrate adhesion(GO:0010811) |
| 0.0 |
0.1 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.0 |
0.4 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 |
0.0 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 0.0 |
0.0 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.0 |
0.1 |
GO:0051898 |
negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 |
1.2 |
GO:0042267 |
natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.0 |
0.1 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) |
| 0.0 |
0.0 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 |
0.1 |
GO:0002118 |
aggressive behavior(GO:0002118) inter-male aggressive behavior(GO:0002121) |
| 0.0 |
0.1 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 |
0.2 |
GO:0098706 |
copper ion import(GO:0015677) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.0 |
0.0 |
GO:0010800 |
positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 |
0.1 |
GO:0060294 |
cilium movement involved in cell motility(GO:0060294) |
| 0.0 |
0.0 |
GO:0006622 |
protein targeting to lysosome(GO:0006622) protein targeting to vacuole(GO:0006623) |
| 0.0 |
1.0 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.0 |
1.6 |
GO:0032436 |
positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.0 |
0.3 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.0 |
0.0 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 |
0.3 |
GO:0090102 |
cochlea development(GO:0090102) |
| 0.0 |
0.2 |
GO:0051973 |
positive regulation of telomerase activity(GO:0051973) |
| 0.0 |
0.2 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 0.0 |
0.5 |
GO:0016233 |
telomere capping(GO:0016233) |
| 0.0 |
0.0 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.0 |
0.1 |
GO:2001182 |
regulation of interleukin-12 secretion(GO:2001182) |
| 0.0 |
0.4 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.0 |
0.0 |
GO:0035860 |
glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.0 |
0.1 |
GO:0007350 |
blastoderm segmentation(GO:0007350) |
| 0.0 |
0.7 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.0 |
0.3 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 |
0.1 |
GO:0019072 |
viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.0 |
0.0 |
GO:0032757 |
positive regulation of interleukin-8 production(GO:0032757) |
| 0.0 |
0.0 |
GO:0071484 |
cellular response to light intensity(GO:0071484) |
| 0.0 |
1.1 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.6 |
GO:0060071 |
Wnt signaling pathway, planar cell polarity pathway(GO:0060071) |
| 0.0 |
0.0 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.0 |
0.1 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.0 |
0.3 |
GO:0010762 |
regulation of fibroblast migration(GO:0010762) |
| 0.0 |
0.1 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 |
0.0 |
GO:0003352 |
regulation of cilium movement(GO:0003352) regulation of microtubule-based movement(GO:0060632) |
| 0.0 |
0.1 |
GO:0010896 |
regulation of triglyceride catabolic process(GO:0010896) |
| 0.0 |
0.1 |
GO:0040036 |
regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.0 |
0.0 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 |
0.3 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 |
0.1 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.0 |
0.1 |
GO:0033028 |
myeloid cell apoptotic process(GO:0033028) |
| 0.0 |
0.1 |
GO:0001778 |
plasma membrane repair(GO:0001778) |
| 0.0 |
0.1 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.0 |
0.0 |
GO:0090085 |
regulation of protein deubiquitination(GO:0090085) |
| 0.0 |
1.0 |
GO:0006383 |
transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 |
0.0 |
GO:0016198 |
axon choice point recognition(GO:0016198) |
| 0.0 |
0.0 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 |
0.0 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.0 |
0.0 |
GO:0003176 |
aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.0 |
0.0 |
GO:0071104 |
response to interleukin-9(GO:0071104) |
| 0.0 |
0.8 |
GO:0030593 |
neutrophil chemotaxis(GO:0030593) |
| 0.0 |
0.4 |
GO:0006303 |
double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.0 |
0.2 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.0 |
0.1 |
GO:0061365 |
positive regulation of lipoprotein lipase activity(GO:0051006) positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.0 |
0.2 |
GO:0050771 |
negative regulation of axonogenesis(GO:0050771) |
| 0.0 |
0.1 |
GO:0061511 |
centriole elongation(GO:0061511) |
| 0.0 |
0.0 |
GO:0035021 |
negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 |
0.1 |
GO:0042228 |
interleukin-8 biosynthetic process(GO:0042228) |
| 0.0 |
0.0 |
GO:0046686 |
response to cadmium ion(GO:0046686) |
| 0.0 |
0.1 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.0 |
0.1 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.0 |
0.0 |
GO:0071340 |
skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.0 |
0.1 |
GO:0014051 |
gamma-aminobutyric acid secretion(GO:0014051) |
| 0.0 |
0.1 |
GO:1902903 |
regulation of fibril organization(GO:1902903) |
| 0.0 |
0.0 |
GO:0071422 |
succinate transport(GO:0015744) succinate transmembrane transport(GO:0071422) |
| 0.0 |
0.0 |
GO:1903298 |
regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.0 |
0.0 |
GO:0036295 |
cellular response to increased oxygen levels(GO:0036295) |
| 0.0 |
0.0 |
GO:0022615 |
protein to membrane docking(GO:0022615) |
| 0.0 |
0.3 |
GO:0010833 |
telomere maintenance via telomere lengthening(GO:0010833) |
| 0.0 |
0.1 |
GO:0045176 |
apical protein localization(GO:0045176) |
| 0.0 |
0.1 |
GO:0002155 |
regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 |
0.1 |
GO:0010518 |
positive regulation of phospholipase activity(GO:0010518) |
| 0.0 |
0.1 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 |
0.1 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 |
0.0 |
GO:0018352 |
protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.0 |
0.0 |
GO:0016556 |
mRNA modification(GO:0016556) |
| 0.0 |
0.1 |
GO:0061669 |
spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 |
0.1 |
GO:0033119 |
negative regulation of RNA splicing(GO:0033119) |
| 0.0 |
0.0 |
GO:0042262 |
DNA protection(GO:0042262) |
| 0.0 |
0.0 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.0 |
0.0 |
GO:0052314 |
isoquinoline alkaloid metabolic process(GO:0033076) phytoalexin metabolic process(GO:0052314) |
| 0.0 |
0.2 |
GO:0036152 |
phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 |
0.6 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.0 |
0.1 |
GO:0019054 |
modulation by virus of host process(GO:0019054) |
| 0.0 |
0.0 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.0 |
1.8 |
GO:0043123 |
positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 |
0.1 |
GO:0048840 |
otolith development(GO:0048840) |
| 0.0 |
0.0 |
GO:0071242 |
cellular response to ammonium ion(GO:0071242) |
| 0.0 |
0.3 |
GO:0007190 |
activation of adenylate cyclase activity(GO:0007190) |
| 0.0 |
0.5 |
GO:0002220 |
innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
| 0.0 |
0.1 |
GO:0051066 |
dihydrobiopterin metabolic process(GO:0051066) |
| 0.0 |
0.0 |
GO:0097118 |
neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.0 |
0.0 |
GO:0051148 |
negative regulation of muscle cell differentiation(GO:0051148) |
| 0.0 |
0.1 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.0 |
0.0 |
GO:0060074 |
synapse maturation(GO:0060074) |
| 0.0 |
0.1 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 0.0 |
0.1 |
GO:0001702 |
gastrulation with mouth forming second(GO:0001702) |
| 0.0 |
0.0 |
GO:0097156 |
fasciculation of motor neuron axon(GO:0097156) |
| 0.0 |
0.5 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 |
0.1 |
GO:0035728 |
response to hepatocyte growth factor(GO:0035728) |
| 0.0 |
0.4 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 |
0.1 |
GO:0002291 |
T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 |
0.1 |
GO:0051083 |
'de novo' cotranslational protein folding(GO:0051083) |
| 0.0 |
0.0 |
GO:1902172 |
keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
| 0.0 |
0.4 |
GO:0051591 |
response to cAMP(GO:0051591) |
| 0.0 |
1.0 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 |
0.0 |
GO:0033604 |
negative regulation of catecholamine secretion(GO:0033604) |
| 0.0 |
1.1 |
GO:0007519 |
skeletal muscle tissue development(GO:0007519) |
| 0.0 |
0.0 |
GO:0030579 |
ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 |
0.0 |
GO:0010727 |
negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
| 0.0 |
0.1 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.0 |
0.1 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.0 |
0.1 |
GO:0043368 |
positive T cell selection(GO:0043368) |
| 0.0 |
1.0 |
GO:0045765 |
regulation of angiogenesis(GO:0045765) |
| 0.0 |
0.1 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 |
0.0 |
GO:0032725 |
positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 0.0 |
0.0 |
GO:0045964 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
