Motif ID: NKX2-2
Z-value: 1.332
Transcription factors associated with NKX2-2:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| NKX2-2 | ENSG00000125820.5 | NKX2-2 |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 8.7 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.8 | 9.4 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.6 | 4.3 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.4 | 3.1 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.3 | 1.4 | GO:0052214 | multi-organism catabolic process(GO:0044035) development of symbiont involved in interaction with host(GO:0044115) modulation of development of symbiont involved in interaction with host(GO:0044145) negative regulation of development of symbiont involved in interaction with host(GO:0044147) metabolism of substance in other organism involved in symbiotic interaction(GO:0052214) catabolism of substance in other organism involved in symbiotic interaction(GO:0052227) metabolism of macromolecule in other organism involved in symbiotic interaction(GO:0052229) catabolism by host of symbiont macromolecule(GO:0052360) catabolism by organism of macromolecule in other organism involved in symbiotic interaction(GO:0052361) catabolism by host of symbiont protein(GO:0052362) catabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052363) catabolism by host of substance in symbiont(GO:0052364) metabolism by host of symbiont macromolecule(GO:0052416) metabolism by host of symbiont protein(GO:0052417) metabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052418) metabolism by host of substance in symbiont(GO:0052419) |
| 0.3 | 0.9 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.3 | 3.9 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.2 | 0.7 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.2 | 0.4 | GO:0044111 | development involved in symbiotic interaction(GO:0044111) |
| 0.2 | 0.6 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 0.2 | 0.4 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.1 | 0.4 | GO:0098884 | postsynaptic neurotransmitter receptor internalization(GO:0098884) |
| 0.1 | 0.7 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
| 0.1 | 0.4 | GO:0014839 | myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.1 | 0.4 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.1 | 0.3 | GO:1904404 | cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
| 0.1 | 0.5 | GO:0035936 | testosterone secretion(GO:0035936) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.1 | 0.4 | GO:1905045 | Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
| 0.1 | 0.3 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.1 | 0.7 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.3 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.1 | 0.2 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 | 0.2 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 | 0.4 | GO:1900920 | lactate biosynthetic process(GO:0019249) regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.1 | 0.5 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.1 | 0.4 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 | 0.2 | GO:0010877 | lipid transport involved in lipid storage(GO:0010877) |
| 0.1 | 0.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.4 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.1 | 1.0 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) regulation of GTP binding(GO:1904424) |
| 0.1 | 0.5 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.1 | 0.9 | GO:0043161 | proteasome-mediated ubiquitin-dependent protein catabolic process(GO:0043161) |
| 0.0 | 0.2 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.0 | 0.3 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.7 | GO:0019317 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.3 | GO:0035947 | regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
| 0.0 | 0.5 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.2 | GO:0046671 | negative regulation of cellular pH reduction(GO:0032848) CD8-positive, alpha-beta T cell lineage commitment(GO:0043375) negative regulation of retinal cell programmed cell death(GO:0046671) |
| 0.0 | 0.6 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.6 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.7 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.0 | 0.4 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.3 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.0 | 0.3 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.0 | 0.2 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.0 | 0.5 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.4 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.2 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.0 | 0.2 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.0 | 1.2 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.5 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.1 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.0 | 0.1 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
| 0.0 | 0.4 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.3 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.6 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.4 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
| 0.0 | 0.2 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.6 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.1 | GO:0050960 | detection of temperature stimulus involved in thermoception(GO:0050960) response to capsazepine(GO:1901594) |
| 0.0 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.4 | GO:0090292 | nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.7 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.0 | 0.2 | GO:0030207 | chondroitin sulfate catabolic process(GO:0030207) |
| 0.0 | 0.1 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.0 | 0.5 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.0 | 0.1 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.0 | 0.3 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.4 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.1 | GO:0071030 | nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.0 | 0.1 | GO:0044179 | hemolysis by symbiont of host erythrocytes(GO:0019836) hemolysis in other organism(GO:0044179) hemolysis in other organism involved in symbiotic interaction(GO:0052331) |
| 0.0 | 0.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.3 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.0 | 0.3 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.3 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.2 | GO:0046543 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.4 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.0 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.0 | 0.2 | GO:0040008 | regulation of growth(GO:0040008) |
| 0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.0 | GO:1990637 | response to prolactin(GO:1990637) |
| 0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.1 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.0 | 0.1 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.0 | 0.1 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) |
| 0.0 | 0.4 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.7 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
| 0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.4 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.2 | 0.9 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.2 | 1.0 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.2 | 3.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.1 | 0.4 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) postsynaptic endocytic zone membrane(GO:0098844) |
| 0.1 | 1.0 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 2.7 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.7 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.7 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.5 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.3 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.1 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.0 | 8.6 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.5 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.7 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.2 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.3 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.0 | 0.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.4 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 1.0 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 1.1 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.1 | GO:0071020 | post-spliceosomal complex(GO:0071020) |
| 0.0 | 0.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.2 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.4 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.2 | GO:0036038 | MKS complex(GO:0036038) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.1 | 8.3 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 1.6 | 4.8 | GO:0002113 | interleukin-33 binding(GO:0002113) |
| 1.5 | 8.7 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.8 | 3.4 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.4 | 3.1 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.2 | 2.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.2 | 0.6 | GO:0050146 | nucleoside phosphotransferase activity(GO:0050146) |
| 0.2 | 0.9 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.4 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.1 | 0.4 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.1 | 1.4 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.1 | 1.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.1 | 0.5 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.3 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
| 0.1 | 0.6 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.1 | 0.4 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 0.5 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.1 | 0.2 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.1 | 0.3 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.1 | 0.7 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.1 | 0.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.4 | GO:0050816 | phosphoserine binding(GO:0050815) phosphothreonine binding(GO:0050816) |
| 0.0 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.5 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.0 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.3 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.0 | 0.8 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.4 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.4 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.5 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 1.2 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.5 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 1.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.4 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.0 | 0.5 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.2 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.6 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.6 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.0 | 0.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.8 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 1.1 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.4 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.7 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.1 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.4 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 8.5 | PID_CXCR3_PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 3.1 | PID_ARF6_DOWNSTREAM_PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.4 | ST_PAC1_RECEPTOR_PATHWAY | PAC1 Receptor Pathway |
| 0.0 | 2.5 | PID_ARF6_PATHWAY | Arf6 signaling events |
| 0.0 | 0.6 | PID_S1P_S1P1_PATHWAY | S1P1 pathway |
| 0.0 | 0.7 | PID_CIRCADIAN_PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.7 | PID_IL2_STAT5_PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 1.3 | PID_AURORA_A_PATHWAY | Aurora A signaling |
| 0.0 | 0.8 | PID_IL3_PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.9 | ST_DIFFERENTIATION_PATHWAY_IN_PC12_CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 1.3 | PID_RB_1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 1.2 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 8.7 | REACTOME_CYTOSOLIC_TRNA_AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.1 | 8.3 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 3.4 | REACTOME_IL_7_SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 3.1 | REACTOME_POST_TRANSLATIONAL_MODIFICATION_SYNTHESIS_OF_GPI_ANCHORED_PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.6 | REACTOME_ABACAVIR_TRANSPORT_AND_METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 1.1 | REACTOME_POST_CHAPERONIN_TUBULIN_FOLDING_PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.4 | REACTOME_ROLE_OF_DCC_IN_REGULATING_APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 1.0 | REACTOME_SIGNALING_BY_HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.6 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 1.1 | REACTOME_REGULATION_OF_GLUCOKINASE_BY_GLUCOKINASE_REGULATORY_PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 1.1 | REACTOME_SPHINGOLIPID_DE_NOVO_BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.7 | REACTOME_NEPHRIN_INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.7 | REACTOME_BMAL1_CLOCK_NPAS2_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.2 | REACTOME_RAF_MAP_KINASE_CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.0 | 0.4 | REACTOME_ACTIVATION_OF_RAC | Genes involved in Activation of Rac |
| 0.0 | 0.7 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.4 | REACTOME_CYTOSOLIC_SULFONATION_OF_SMALL_MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.4 | REACTOME_AMINE_LIGAND_BINDING_RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.5 | REACTOME_HORMONE_SENSITIVE_LIPASE_HSL_MEDIATED_TRIACYLGLYCEROL_HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.5 | REACTOME_ANTIGEN_PRESENTATION_FOLDING_ASSEMBLY_AND_PEPTIDE_LOADING_OF_CLASS_I_MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.6 | REACTOME_ANTIGEN_ACTIVATES_B_CELL_RECEPTOR_LEADING_TO_GENERATION_OF_SECOND_MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.3 | REACTOME_TRANSPORT_OF_ORGANIC_ANIONS | Genes involved in Transport of organic anions |
