| 0.5 |
1.4 |
GO:0070429 |
regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) tolerance induction to lipopolysaccharide(GO:0072573) negative regulation of CD40 signaling pathway(GO:2000349) |
| 0.1 |
0.4 |
GO:2000276 |
negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.1 |
0.5 |
GO:0002268 |
follicular dendritic cell differentiation(GO:0002268) |
| 0.1 |
0.4 |
GO:0097069 |
response to human chorionic gonadotropin(GO:0044752) cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 0.1 |
0.6 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 |
0.3 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) positive regulation of chromatin assembly or disassembly(GO:0045799) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.1 |
0.2 |
GO:0048210 |
Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.1 |
0.6 |
GO:0060154 |
cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 |
0.5 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 |
0.2 |
GO:1903774 |
positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 |
0.3 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.1 |
0.5 |
GO:0003065 |
positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.1 |
0.4 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 |
0.4 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.1 |
0.2 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.1 |
0.2 |
GO:0046967 |
cytosol to ER transport(GO:0046967) |
| 0.1 |
0.2 |
GO:1901421 |
positive regulation of response to alcohol(GO:1901421) |
| 0.1 |
0.2 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.1 |
0.2 |
GO:0048597 |
B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 |
0.3 |
GO:0009257 |
10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.1 |
0.2 |
GO:0018008 |
N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
| 0.1 |
0.4 |
GO:0006226 |
dUMP biosynthetic process(GO:0006226) |
| 0.0 |
0.1 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.0 |
1.0 |
GO:0016102 |
retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.0 |
0.1 |
GO:1905000 |
regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.0 |
0.1 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.0 |
0.1 |
GO:0003220 |
left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 0.0 |
0.3 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.0 |
0.2 |
GO:1902766 |
skeletal muscle satellite cell migration(GO:1902766) |
| 0.0 |
0.6 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 |
1.4 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 |
0.3 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 0.0 |
0.1 |
GO:0071284 |
cellular response to lead ion(GO:0071284) positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.0 |
0.1 |
GO:0035574 |
histone H4-K20 demethylation(GO:0035574) |
| 0.0 |
0.4 |
GO:0035754 |
B cell chemotaxis(GO:0035754) |
| 0.0 |
0.5 |
GO:0071351 |
interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.0 |
0.1 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.0 |
0.2 |
GO:1900245 |
positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 |
0.2 |
GO:0090063 |
positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 |
0.2 |
GO:1990164 |
histone H2A phosphorylation(GO:1990164) |
| 0.0 |
0.1 |
GO:0034970 |
histone H3-R2 methylation(GO:0034970) |
| 0.0 |
0.1 |
GO:0030264 |
nuclear fragmentation involved in apoptotic nuclear change(GO:0030264) |
| 0.0 |
0.1 |
GO:0006500 |
N-terminal protein palmitoylation(GO:0006500) |
| 0.0 |
0.1 |
GO:0018283 |
metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) proprioception(GO:0019230) |
| 0.0 |
0.1 |
GO:0014022 |
neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.0 |
0.1 |
GO:0043634 |
polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.0 |
0.1 |
GO:1904404 |
cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
| 0.0 |
0.1 |
GO:0032203 |
telomere formation via telomerase(GO:0032203) |
| 0.0 |
0.2 |
GO:2000288 |
positive regulation of myoblast proliferation(GO:2000288) |
| 0.0 |
0.6 |
GO:0007216 |
G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 |
0.1 |
GO:0002188 |
translation reinitiation(GO:0002188) |
| 0.0 |
0.2 |
GO:0071955 |
recycling endosome to Golgi transport(GO:0071955) |
| 0.0 |
0.2 |
GO:1902045 |
negative regulation of Fas signaling pathway(GO:1902045) |
| 0.0 |
0.2 |
GO:0060800 |
regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.0 |
0.1 |
GO:1902232 |
regulation of positive thymic T cell selection(GO:1902232) |
| 0.0 |
0.2 |
GO:0072425 |
signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
| 0.0 |
0.1 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 |
0.1 |
GO:1901202 |
negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.0 |
0.1 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.0 |
0.2 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.0 |
1.2 |
GO:0019228 |
neuronal action potential(GO:0019228) |
| 0.0 |
0.1 |
GO:0060532 |
bronchus cartilage development(GO:0060532) lung smooth muscle development(GO:0061145) |
| 0.0 |
0.1 |
GO:0034402 |
recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.0 |
0.3 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.0 |
0.3 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.0 |
0.1 |
GO:0051780 |
mevalonate transport(GO:0015728) behavioral response to nutrient(GO:0051780) |
| 0.0 |
0.1 |
GO:0071030 |
nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.0 |
0.3 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 |
0.1 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 |
0.1 |
GO:2000697 |
negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of nephron tubule epithelial cell differentiation(GO:0072183) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) negative regulation of epithelial cell differentiation involved in kidney development(GO:2000697) |
| 0.0 |
0.1 |
GO:0010725 |
regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.0 |
0.2 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 |
0.1 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 |
0.1 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.0 |
0.1 |
GO:0034249 |
negative regulation of cellular amide metabolic process(GO:0034249) |
| 0.0 |
0.0 |
GO:0035990 |
tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 |
0.1 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 |
0.2 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 |
0.2 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.0 |
0.1 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.0 |
0.1 |
GO:1903788 |
mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.0 |
0.1 |
GO:1900194 |
negative regulation of oocyte maturation(GO:1900194) |
| 0.0 |
0.1 |
GO:1904431 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) positive regulation of t-circle formation(GO:1904431) |
| 0.0 |
0.3 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.0 |
0.0 |
GO:0006864 |
pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.0 |
0.3 |
GO:0006878 |
cellular copper ion homeostasis(GO:0006878) |
| 0.0 |
0.2 |
GO:0060020 |
Bergmann glial cell differentiation(GO:0060020) |
| 0.0 |
1.0 |
GO:0007157 |
heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 |
0.1 |
GO:1901536 |
negative regulation of DNA demethylation(GO:1901536) |
| 0.0 |
0.3 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 |
0.1 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.0 |
0.0 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.0 |
0.1 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.0 |
0.0 |
GO:0009149 |
pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 0.0 |
0.1 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 |
0.2 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 |
0.3 |
GO:0000469 |
cleavage involved in rRNA processing(GO:0000469) |
| 0.0 |
0.0 |
GO:1900275 |
negative regulation of phospholipase C activity(GO:1900275) regulation of proteinase activated receptor activity(GO:1900276) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
| 0.0 |
0.0 |
GO:0033091 |
positive regulation of immature T cell proliferation(GO:0033091) response to interleukin-18(GO:0070673) |
| 0.0 |
0.1 |
GO:0042247 |
morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.0 |
0.0 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.0 |
0.1 |
GO:0090625 |
mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.0 |
0.3 |
GO:1902018 |
negative regulation of cilium assembly(GO:1902018) |
| 0.0 |
0.2 |
GO:0034472 |
snRNA 3'-end processing(GO:0034472) |
| 0.0 |
0.1 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.0 |
0.0 |
GO:0060455 |
positive regulation of norepinephrine secretion(GO:0010701) response to anoxia(GO:0034059) positive regulation of penile erection(GO:0060406) negative regulation of gastric acid secretion(GO:0060455) |
| 0.0 |
0.1 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.0 |
0.0 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.0 |
0.0 |
GO:0002545 |
chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
| 0.0 |
0.0 |
GO:2001038 |
regulation of cellular response to drug(GO:2001038) |
| 0.0 |
0.2 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 |
0.1 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 |
0.0 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.0 |
0.2 |
GO:0034356 |
NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 |
0.2 |
GO:0007172 |
signal complex assembly(GO:0007172) |
| 0.0 |
0.4 |
GO:0061003 |
positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 |
0.0 |
GO:0015729 |
thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.0 |
0.1 |
GO:1902775 |
mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 |
0.0 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 0.0 |
0.2 |
GO:0033160 |
positive regulation of protein import into nucleus, translocation(GO:0033160) |
| 0.0 |
0.1 |
GO:0010807 |
regulation of synaptic vesicle priming(GO:0010807) |
